Molecule FYI-1001205

A

Molecule Summary:

ID: FYI-1001205
SMILES: CC(=CCNC1=NC=NC2=C1NC=N2)CO

Received at FYIcenter.com on: 2022-03-11

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001205
FYIcenter.com

 16 17  0  0  0  0  0  0  0  0999 V2000
    2.4249    2.2158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    3.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    3.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    4.3158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    3.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.3158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    3.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.2158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    1.5158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.2158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2342    1.2790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8036    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1960    0.1464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.6158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 11  6  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 14 10  1  0  0  0  0
 15  2  1  0  0  0  0
 16 15  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="166.02627815867" x2="166.02627815867" y1="364.53710088149" y2="328.74865817826" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="166.02627815867" x2="166.02627815867" y1="328.74865817826" y2="292.96021547502" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="230" x2="199" y1="398" y2="380" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="199" x2="168" y1="380" y2="362" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="227" x2="196" y1="404" y2="386" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="196" x2="165" y1="386" y2="368" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="289.99744368266" x2="259.00465230167" y1="364.53710088149" y2="382.4313222331" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="259.00465230167" x2="228.01186092067" y1="382.4313222331" y2="400.32554358472" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="351.98302644466" x2="320.99023506366" y1="400.32554358472" y2="382.4313222331" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #0000ff" />
<line x1="320.99023506366" x2="289.99744368266" y1="382.4313222331" y2="364.53710088149" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="413.978834476" x2="382.98093046033" y1="364.53710088149" y2="382.4313222331" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="382.98093046033" x2="351.98302644466" y1="382.4313222331" y2="400.32554358472" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #0000ff" />
<line x1="478" x2="447" y1="398" y2="380" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #0000ff" />
<line x1="447" x2="416" y1="380" y2="362" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="475" x2="444" y1="404" y2="386" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #0000ff" />
<line x1="444" x2="413" y1="386" y2="368" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="537.95" x2="506.957208619" y1="364.53710088149" y2="382.4313222331" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="506.957208619" x2="475.964417238" y1="382.4313222331" y2="400.32554358472" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #0000ff" />
<line x1="535" x2="535" y1="293" y2="329" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #0000ff" />
<line x1="535" x2="535" y1="329" y2="365" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="542" x2="542" y1="293" y2="329" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #0000ff" />
<line x1="542" x2="542" y1="329" y2="365" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="475.964417238" x2="506.957208619" y1="257.17177277179" y2="275.06599412341" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="506.957208619" x2="537.95" y1="275.06599412341" y2="292.96021547502" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #0000ff" />
<line x1="416" x2="447" y1="297" y2="279" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="447" x2="478" y1="279" y2="261" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="413" x2="444" y1="290" y2="272" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="444" x2="475" y1="272" y2="254" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="413.978834476" x2="413.978834476" y1="292.96021547502" y2="328.74865817826" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="413.978834476" x2="413.978834476" y1="328.74865817826" y2="364.53710088149" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="360.78187071499" x2="387.38035259549" y1="245.06505386876" y2="269.01263467189" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #0000ff" />
<line x1="387.38035259549" x2="413.978834476" y1="269.01263467189" y2="292.96021547502" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="389.89321253673" x2="375.33754162586" y1="179.67445641528" y2="212.36975514202" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="375.33754162586" x2="360.78187071499" y1="212.36975514202" y2="245.06505386876" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #0000ff" />
<line x1="462" x2="426.5" y1="184" y2="180" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #0000ff" />
<line x1="426.5" x2="391" y1="180" y2="176" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="461" x2="425.5" y1="191" y2="187.5" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #0000ff" />
<line x1="425.5" x2="390" y1="187.5" y2="184" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="461.08153770813" x2="468.52297747307" y1="187.15935357493" y2="222.16556317336" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #0000ff" />
<line x1="468.52297747307" x2="475.964417238" y1="222.16556317336" y2="257.17177277179" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="104.035582762" x2="135.03093046033" y1="400.32554358472" y2="382.4313222331" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="135.03093046033" x2="166.02627815867" y1="382.4313222331" y2="364.53710088149" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<line x1="42.05" x2="73.042791380999" y1="364.53710088149" y2="382.4313222331" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #ff0000" />
<line x1="73.042791380999" x2="104.035582762" y1="382.4313222331" y2="400.32554358472" style="stroke-opacity:1; stroke-width: 3.0137504651808; stroke: #000000" />
<ellipse cx="351.98302644466" cy="400.32554358472" rx="19.589378023675" ry="19.589378023675" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="351.98302644466" y="416.90117114322"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:37.67188081476px">N</text>
<ellipse cx="475.964417238" cy="400.32554358472" rx="19.589378023675" ry="19.589378023675" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="475.964417238" y="416.90117114322"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:37.67188081476px">N</text>
<ellipse cx="537.95" cy="292.96021547502" rx="19.589378023675" ry="19.589378023675" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="309.53584303352"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:37.67188081476px">N</text>
<ellipse cx="360.78187071499" cy="245.06505386876" rx="19.589378023675" ry="19.589378023675" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="360.78187071499" y="261.64068142725"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:37.67188081476px">N</text>
<ellipse cx="461.08153770813" cy="187.15935357493" rx="19.589378023675" ry="19.589378023675" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="461.08153770813" y="203.73498113342"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:37.67188081476px">N</text>
<ellipse cx="42.05" cy="364.53710088149" rx="19.589378023675" ry="19.589378023675" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="381.11272843998"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:37.67188081476px">O</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 114👍, 0💬