Collections:
Molecule FYI-1001204
Molecule Summary:
ID: FYI-1001204
SMILES: CC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(CSSCC(C(=O)N1)NC(=O)C(CCCN=C(N)N)NC(=O)C)C(=O)N)CC2=CNC3=CC=CC=C32)CCCN=C(N)N)CC4=CC=CC=C4)CC5=CN=CN5
Received at FYIcenter.com on: 2022-03-10
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1001204 FYIcenter.com 78 82 0 0 0 0 0 0 0 0999 V2000 13.8877 2.5563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2037 3.9201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.5980 3.7927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.6617 2.3943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.9747 4.0463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 18.2322 4.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.2769 5.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.3424 4.6859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 20.0312 6.7733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 20.4396 8.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.4715 9.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.8624 9.6711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 20.1246 10.8685 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 19.4246 12.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.4233 13.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.2566 14.1845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.1954 13.7318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 15.8315 14.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4329 13.9839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1793 15.3608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.1034 13.5453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 11.9416 12.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0335 11.6985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4467 10.4275 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 10.2245 9.0453 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 10.3835 7.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9119 6.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7705 5.2520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7919 4.2508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8955 4.4188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 5.6578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 6.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 7.7578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2747 5.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0621 6.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8497 5.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 6.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 5.6578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 6.3578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 7.7578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 5.6578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.2747 4.2578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.0621 3.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8497 4.2578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0621 2.1578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0095 13.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4482 15.1383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6387 13.5240 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 15.9587 15.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.2298 16.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.4517 15.3454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.4792 16.2963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 18.8923 17.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.4443 18.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.6060 19.9752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.2158 19.8099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.6639 18.5233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.5021 17.4020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.5303 12.9395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.8268 12.4110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.9326 13.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.2291 12.7413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 25.3350 13.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.1443 14.9867 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 26.6314 13.0714 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 21.8218 7.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.3206 6.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.7028 6.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.2015 5.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.3180 3.9658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.9358 4.1880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.4371 5.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.0133 3.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.3977 2.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.0530 1.0056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.0789 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 16.8216 0.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.0185 2.0017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 1 0 0 0 0 4 3 2 0 0 0 0 5 3 1 0 0 0 0 6 5 1 0 0 0 0 7 6 1 0 0 0 0 8 7 2 0 0 0 0 9 7 1 0 0 0 0 10 9 1 0 0 0 0 11 10 1 0 0 0 0 12 11 2 0 0 0 0 13 11 1 0 0 0 0 14 13 1 0 0 0 0 15 14 1 0 0 0 0 16 15 2 0 0 0 0 17 15 1 0 0 0 0 18 17 1 0 0 0 0 19 18 1 0 0 0 0 20 19 2 0 0 0 0 21 19 1 0 0 0 0 22 21 1 0 0 0 0 23 22 1 0 0 0 0 24 23 1 0 0 0 0 25 24 1 0 0 0 0 26 25 1 0 0 0 0 27 26 1 0 0 0 0 28 27 1 0 0 0 0 29 28 2 0 0 0 0 30 28 1 0 0 0 0 30 2 1 0 0 0 0 31 27 1 0 0 0 0 32 31 1 0 0 0 0 33 32 2 0 0 0 0 34 32 1 0 0 0 0 35 34 1 0 0 0 0 36 35 1 0 0 0 0 37 36 1 0 0 0 0 38 37 1 0 0 0 0 39 38 2 0 0 0 0 40 39 1 0 0 0 0 41 39 1 0 0 0 0 42 34 1 0 0 0 0 43 42 1 0 0 0 0 44 43 2 0 0 0 0 45 43 1 0 0 0 0 46 22 1 0 0 0 0 47 46 2 0 0 0 0 48 46 1 0 0 0 0 49 18 1 0 0 0 0 50 49 1 0 0 0 0 51 50 2 0 0 0 0 52 51 1 0 0 0 0 53 52 1 0 0 0 0 54 53 2 0 0 0 0 55 54 1 0 0 0 0 56 55 2 0 0 0 0 57 56 1 0 0 0 0 58 57 2 0 0 0 0 58 53 1 0 0 0 0 58 50 1 0 0 0 0 59 14 1 0 0 0 0 60 59 1 0 0 0 0 61 60 1 0 0 0 0 62 61 1 0 0 0 0 63 62 2 0 0 0 0 64 63 1 0 0 0 0 65 63 1 0 0 0 0 66 10 1 0 0 0 0 67 66 1 0 0 0 0 68 67 2 0 0 0 0 69 68 1 0 0 0 0 70 69 2 0 0 0 0 71 70 1 0 0 0 0 72 71 2 0 0 0 0 72 67 1 0 0 0 0 73 6 1 0 0 0 0 74 73 1 0 0 0 0 75 74 2 0 0 0 0 76 75 1 0 0 0 0 77 76 2 0 0 0 0 78 77 1 0 0 0 0 78 74 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="306.53533798448" x2="303.59323955932" y1="177.01783421074" y2="164.32025879225" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="303.59323955932" x2="300.65114113415" y1="164.32025879225" y2="151.62268337376" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="332.49842554278" x2="319.51688176363" y1="174.6455345945" y2="175.83168440262" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="319.51688176363" x2="306.53533798448" y1="175.83168440262" y2="177.01783421074" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="333" x2="332.5" y1="149" y2="162" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="332.5" x2="332" y1="162" y2="175" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="336" x2="335" y1="149" y2="162" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="335" x2="334" y1="162" y2="175" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="358.13378568156" x2="345.31610561217" y1="179.36778877566" y2="177.00666168508" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="345.31610561217" x2="332.49842554278" y1="177.00666168508" y2="174.6455345945" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="381.5495373882" x2="369.84166153488" y1="190.83266219575" y2="185.1002254857" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="369.84166153488" x2="358.13378568156" y1="185.1002254857" y2="179.36778877566" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="401.00276665891" x2="391.27615202355" y1="208.18731872902" y2="199.50999046239" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="391.27615202355" x2="381.5495373882" y1="199.50999046239" y2="190.83266219575" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="420" x2="410.5" y1="191" y2="199.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="410.5" x2="401" y1="199.5" y2="208" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="422" x2="412" y1="193" y2="201.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="412" x2="402" y1="201.5" y2="210" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="415.04849350766" x2="408.02563008329" y1="230.14691792395" y2="219.16711832649" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="408.02563008329" x2="401.00276665891" y1="219.16711832649" y2="208.18731872902" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="422.65325931044" x2="418.85087640905" y1="255.08213312105" y2="242.6145255225" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="418.85087640905" x2="415.04849350766" y1="242.6145255225" y2="230.14691792395" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="423.2472652583" x2="422.95026228437" y1="281.14391132272" y2="268.11302222189" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="422.95026228437" x2="422.65325931044" y1="268.11302222189" y2="255.08213312105" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="450" x2="437" y1="283" y2="281.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="437" x2="424" y1="281.5" y2="280" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="449" x2="436.5" y1="286" y2="284.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="436.5" x2="424" y1="284.5" y2="283" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="416.78768333621" x2="420.01747429726" y1="306.40312976411" y2="293.77352054342" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="420.01747429726" x2="423.2472652583" y1="293.77352054342" y2="281.14391132272" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="403.75307006015" x2="410.27037669818" y1="328.97907995824" y2="317.69110486118" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="410.27037669818" x2="416.78768333621" y1="317.69110486118" y2="306.40312976411" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="385.10798681256" x2="394.43052843636" y1="347.20146931817" y2="338.09027463821" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="394.43052843636" x2="403.75307006015" y1="338.09027463821" y2="328.97907995824" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="402" x2="394.5" y1="368" y2="357.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="394.5" x2="387" y1="357.5" y2="347" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="400" x2="392.5" y1="369" y2="359" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="392.5" x2="385" y1="359" y2="349" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="362.24341303874" x2="373.67569992565" y1="359.72028432602" y2="353.4608768221" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="373.67569992565" x2="385.10798681256" y1="353.4608768221" y2="347.20146931817" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="336.84640011415" x2="349.54490657645" y1="365.60075700113" y2="362.66052066358" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="349.54490657645" x2="362.24341303874" y1="362.66052066358" y2="359.72028432602" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="310.80324278859" x2="323.82482145137" y1="364.41460719301" y2="365.00768209707" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="323.82482145137" x2="336.84640011415" y1="365.00768209707" y2="365.60075700113" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="308" x2="310.5" y1="391" y2="378" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="310.5" x2="313" y1="378" y2="365" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="305" x2="307.5" y1="390" y2="377.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="307.5" x2="310" y1="377.5" y2="365" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="286.04678800213" x2="298.42501539536" y1="356.24749093176" y2="360.33104906238" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="298.42501539536" x2="310.80324278859" y1="360.33104906238" y2="364.41460719301" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="264.4130541391" x2="275.22992107062" y1="341.70272460329" y2="348.97510776752" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="275.22992107062" x2="286.04678800213" y1="348.97510776752" y2="356.24749093176" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="247.50343654483" x2="255.95824534196" y1="321.8584569343" y2="331.78059076879" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="255.95824534196" x2="264.4130541391" y1="331.78059076879" y2="341.70272460329" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="236.57670644427" x2="242.04007149455" y1="298.1913234002" y2="310.02489016725" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #c8aa1a" /> <line x1="242.04007149455" x2="247.50343654483" y1="310.02489016725" y2="321.8584569343" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="232.43914777293" x2="234.5079271086" y1="272.45354844282" y2="285.32243592151" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #c8aa1a" /> <line x1="234.5079271086" x2="236.57670644427" y1="285.32243592151" y2="298.1913234002" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #c8aa1a" /> <line x1="235.39986707421" x2="233.91950742357" y1="246.55004768807" y2="259.50179806544" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="233.91950742357" x2="232.43914777293" y1="259.50179806544" y2="272.45354844282" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #c8aa1a" /> <line x1="245.23913801002" x2="240.31950254211" y1="222.40994390081" y2="234.47999579444" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="240.31950254211" x2="235.39986707421" y1="234.47999579444" y2="246.55004768807" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="261.22702223691" x2="253.23308012346" y1="201.81897909986" y2="212.11446150033" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="253.23308012346" x2="245.23913801002" y1="212.11446150033" y2="222.40994390081" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="243" x2="252" y1="185" y2="194" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="252" x2="261" y1="194" y2="203" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="244" x2="253.5" y1="183" y2="192" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="253.5" x2="263" y1="192" y2="201" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="282.17550785914" x2="271.70126504803" y1="186.30406512613" y2="194.06152211299" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="271.70126504803" x2="261.22702223691" y1="194.06152211299" y2="201.81897909986" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="282.17550785914" x2="294.35542292181" y1="186.30406512613" y2="181.66094966844" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="294.35542292181" x2="306.53533798448" y1="181.66094966844" y2="177.01783421074" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="222.66318781589" x2="233.95116291295" y1="209.37533062475" y2="215.89263726278" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="233.95116291295" x2="245.23913801002" y1="215.89263726278" y2="222.40994390081" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="200.08723762175" x2="211.37521271882" y1="222.40994390081" y2="215.89263726278" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="211.37521271882" x2="222.66318781589" y1="215.89263726278" y2="209.37533062475" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="202" x2="202" y1="249" y2="236" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="202" x2="202" y1="236" y2="223" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="199" x2="199" y1="249" y2="236" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="199" x2="199" y1="236" y2="223" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="177.51128742762" x2="188.79926252469" y1="209.37533062475" y2="215.89263726278" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="188.79926252469" x2="200.08723762175" y1="215.89263726278" y2="222.40994390081" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="154.93161305827" x2="166.22145024295" y1="222.40994390081" y2="215.89263726278" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="166.22145024295" x2="177.51128742762" y1="215.89263726278" y2="209.37533062475" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="132.35566286414" x2="143.6436379612" y1="209.37533062475" y2="215.89263726278" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="143.6436379612" x2="154.93161305827" y1="215.89263726278" y2="222.40994390081" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="109.77971267001" x2="121.06768776707" y1="222.40994390081" y2="215.89263726278" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="121.06768776707" x2="132.35566286414" y1="215.89263726278" y2="209.37533062475" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="87.203762475874" x2="98.49173757294" y1="209.37533062475" y2="215.89263726278" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="98.49173757294" x2="109.77971267001" y1="215.89263726278" y2="222.40994390081" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="66" x2="77" y1="224" y2="217.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="77" x2="88" y1="217.5" y2="211" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="64" x2="75.5" y1="222" y2="215.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="75.5" x2="87" y1="215.5" y2="209" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="64.625950194132" x2="64.625950194132" y1="248.47917045292" y2="235.44455717687" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="64.625950194132" x2="64.625950194132" y1="235.44455717687" y2="222.40994390081" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="42.05" x2="53.337975097066" y1="209.37533062475" y2="215.89263726278" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="53.337975097066" x2="64.625950194132" y1="215.89263726278" y2="222.40994390081" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="177.51128742762" x2="177.51128742762" y1="183.30610407264" y2="196.34071734869" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="177.51128742762" x2="177.51128742762" y1="196.34071734869" y2="209.37533062475" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="154.93161305827" x2="166.22145024295" y1="170.27149079658" y2="176.78879743461" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="166.22145024295" x2="177.51128742762" y1="176.78879743461" y2="183.30610407264" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="134" x2="145" y1="185" y2="178.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="145" x2="156" y1="178.5" y2="172" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="132" x2="143.5" y1="183" y2="176.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="143.5" x2="155" y1="176.5" y2="170" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="154.93161305827" x2="154.93161305827" y1="144.20226424446" y2="157.23687752052" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="154.93161305827" x2="154.93161305827" y1="157.23687752052" y2="170.27149079658" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="247.05653551822" x2="255.73479482866" y1="361.15409178639" y2="351.42840819484" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="255.73479482866" x2="264.4130541391" y1="351.42840819484" y2="341.70272460329" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="257" x2="253" y1="386" y2="373.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="253" x2="249" y1="373.5" y2="361" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="254" x2="250" y1="387" y2="374.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #ff0000" /> <line x1="250" x2="246" y1="374.5" y2="362" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="221.53103854848" x2="234.29378703335" y1="355.85086627064" y2="358.50247902852" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="234.29378703335" x2="247.05653551822" y1="358.50247902852" y2="361.15409178639" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="339.21497555517" x2="338.03068783466" y1="391.56384455943" y2="378.58230078028" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="338.03068783466" x2="336.84640011415" y1="378.58230078028" y2="365.60075700113" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="362.88397117688" x2="351.04947336603" y1="402.49057465999" y2="397.02720960971" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="351.04947336603" x2="339.21497555517" y1="397.02720960971" y2="391.56384455943" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="385" x2="374" y1="389" y2="395.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="374" x2="363" y1="395.5" y2="402" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="387" x2="375.5" y1="391" y2="397.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="375.5" x2="364" y1="397.5" y2="404" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="404.76976989569" x2="395.20329479487" y1="407.47352110666" y2="398.6202255608" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="395.20329479487" x2="385.63681969405" y1="398.6202255608" y2="389.76693001494" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="393.84117770752" x2="399.3054738016" y1="431.14065464076" y2="419.30708787371" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="399.3054738016" x2="404.76976989569" y1="419.30708787371" y2="407.47352110666" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="406" x2="401" y1="455" y2="443" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="401" x2="396" y1="443" y2="431" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="403" x2="398" y1="456" y2="444" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="398" x2="393" y1="444" y2="432" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="388.51002087761" x2="396.31496109855" y1="475.97786222279" y2="465.53806803247" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="396.31496109855" x2="404.11990131949" y1="465.53806803247" y2="455.09827384216" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="363" x2="376" y1="475" y2="476.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="376" x2="389" y1="476.5" y2="478" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="363" x2="376" y1="472" y2="473.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="376" x2="389" y1="473.5" y2="475" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="352.34641738699" x2="357.48484814918" y1="448.94221220064" y2="460.92102180133" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="357.48484814918" x2="362.62327891136" y1="460.92102180133" y2="472.89983140203" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="367" x2="359.5" y1="428" y2="438.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="359.5" x2="352" y1="438.5" y2="449" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="370" x2="362" y1="429" y2="439.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="362" x2="354" y1="439.5" y2="450" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="367.95443574127" x2="380.89780672439" y1="428.06262382" y2="429.60163923038" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="380.89780672439" x2="393.84117770752" y1="429.60163923038" y2="431.14065464076" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="367.95443574127" x2="365.41920345907" y1="428.06262382" y2="415.27659923999" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="365.41920345907" x2="362.88397117688" y1="415.27659923999" y2="402.49057465999" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="424.34217277349" x2="414.04762141682" y1="344.96696418513" y2="336.97302207169" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="414.04762141682" x2="403.75307006015" y1="336.97302207169" y2="328.97907995824" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="448.48413864836" x2="436.41315571093" y1="335.12583116171" y2="340.04639767342" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="436.41315571093" x2="424.34217277349" y1="340.04639767342" y2="344.96696418513" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="469.07510344931" x2="458.77962104884" y1="351.1137153886" y2="343.11977327516" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="458.77962104884" x2="448.48413864836" y1="343.11977327516" y2="335.12583116171" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="493.21706932418" x2="481.14608638675" y1="341.2763065404" y2="346.1950109645" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="481.14608638675" x2="469.07510344931" y1="346.1950109645" y2="351.1137153886" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="515" x2="505" y1="357" y2="349" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="505" x2="495" y1="349" y2="341" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="513" x2="503" y1="359" y2="351" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="503" x2="493" y1="351" y2="343" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="510.25889513882" x2="512.03439567578" y1="383.08762175477" y2="370.17404417342" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="512.03439567578" x2="513.80989621274" y1="370.17404417342" y2="357.26046659207" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="537.95" x2="525.87994810637" y1="347.42305774387" y2="352.34176216797" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="525.87994810637" x2="513.80989621274" y1="352.34176216797" y2="357.26046659207" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="448.39103426782" x2="435.52214678913" y1="250.94643653732" y2="253.01428482919" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="435.52214678913" x2="422.65325931044" y1="253.01428482919" y2="255.08213312105" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="457.67912727082" x2="453.03508076932" y1="226.58660641198" y2="238.76652147465" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="453.03508076932" x2="448.39103426782" y1="238.76652147465" y2="250.94643653732" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="484" x2="471" y1="222" y2="224" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="471" x2="458" y1="224" y2="226" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="484" x2="471" y1="224" y2="226" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="471" x2="458" y1="226" y2="228" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="492.70313314358" x2="488.06001768589" y1="198.09294179052" y2="210.27099476558" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="488.06001768589" x2="483.4169022282" y1="210.27099476558" y2="222.44904774064" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="476" x2="484" y1="179" y2="189" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="484" x2="492" y1="189" y2="199" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="478" x2="486" y1="178" y2="188" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="486" x2="494" y1="188" y2="198" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="450.51381414421" x2="463.3827016229" y1="182.00636692025" y2="179.93758758458" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="463.3827016229" x2="476.25158910159" y1="179.93758758458" y2="177.86880824891" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="443" x2="447.5" y1="207" y2="195" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="447.5" x2="452" y1="195" y2="183" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="440" x2="445" y1="206" y2="194" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="445" x2="450" y1="194" y2="182" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="441.22758322882" x2="449.45335524982" y1="206.36433495798" y2="216.47547068498" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="449.45335524982" x2="457.67912727082" y1="216.47547068498" y2="226.58660641198" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="396.09430371667" x2="388.82192055243" y1="169.19706624511" y2="180.01486422043" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="388.82192055243" x2="381.5495373882" y1="180.01486422043" y2="190.83266219575" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="384.63129238418" x2="390.36279805042" y1="145.7850387137" y2="157.4910524794" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="390.36279805042" x2="396.09430371667" y1="157.4910524794" y2="169.19706624511" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="396" x2="390" y1="123" y2="134.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="390" x2="384" y1="134.5" y2="146" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="399" x2="392.5" y1="124" y2="135.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="392.5" x2="386" y1="135.5" y2="147" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="378.69495708074" x2="387.76425478946" y1="104.02213777721" y2="113.38471428464" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="387.76425478946" x2="396.83355249818" y1="113.38471428464" y2="122.74729079207" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="356" x2="368" y1="117" y2="111.5" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="368" x2="380" y1="111.5" y2="106" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="355" x2="367" y1="115" y2="109" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="367" x2="379" y1="109" y2="103" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="358.94938005512" x2="357.11615480223" y1="141.2955454839" y2="128.3903472968" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="357.11615480223" x2="355.28292954933" y1="128.3903472968" y2="115.4851491097" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <line x1="358.94938005512" x2="371.79033621965" y1="141.2955454839" y2="143.5402920988" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #0000ff" /> <line x1="371.79033621965" x2="384.63129238418" y1="143.5402920988" y2="145.7850387137" style="stroke-opacity:1; stroke-width: 1.0976529684384; stroke: #000000" /> <ellipse cx="333.6845753509" cy="148.60610144416" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="333.6845753509" y="154.64319277057" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">O</text> <ellipse cx="358.13378568156" cy="179.36778877566" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="358.13378568156" y="185.40488010207" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="420.84331015268" cy="191.27770113475" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="420.84331015268" y="197.31479246116" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">O</text> <ellipse cx="415.04849350766" cy="230.14691792395" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="415.04849350766" y="236.18400925037" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="449.14704183783" cy="284.10649271161" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="449.14704183783" y="290.14358403802" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">O</text> <ellipse cx="416.78768333621" cy="306.40312976411" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="416.78768333621" y="312.44022109052" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="400.6247628739" cy="368.14995494041" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="400.6247628739" y="374.18704626682" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">O</text> <ellipse cx="362.24341303874" cy="359.72028432602" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="362.24341303874" y="365.75737565243" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="306.08098860743" cy="390.05369150702" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="306.08098860743" y="396.09078283343" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">O</text> <ellipse cx="286.04678800213" cy="356.24749093176" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="286.04678800213" y="362.28458225817" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="236.57670644427" cy="298.1913234002" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="236.57670644427" y="304.22841472661" fill="#c8aa1a" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">S</text> <ellipse cx="232.43914777293" cy="272.45354844282" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="232.43914777293" y="278.49063976923" fill="#c8aa1a" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">S</text> <ellipse cx="243.00463287698" cy="183.17575793988" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="243.00463287698" y="189.21284926629" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">O</text> <ellipse cx="282.17550785914" cy="186.30406512613" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="282.17550785914" y="192.34115645254" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="222.66318781589" cy="209.37533062475" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="222.66318781589" y="215.41242195116" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="200.08723762175" cy="248.47917045292" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="200.08723762175" y="254.51626177934" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">O</text> <ellipse cx="87.203762475874" cy="209.37533062475" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="87.203762475874" y="215.41242195116" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="64.625950194132" cy="248.47917045292" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="64.625950194132" y="254.51626177934" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="42.05" cy="209.37533062475" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="215.41242195116" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="177.51128742762" cy="183.30610407264" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.51128742762" y="189.34319539905" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="132.35566286414" cy="183.30610407264" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="132.35566286414" y="189.34319539905" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">O</text> <ellipse cx="255.22551386709" cy="385.91054657284" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="255.22551386709" y="391.94763789925" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">O</text> <ellipse cx="221.53103854848" cy="355.85086627064" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="221.53103854848" y="361.88795759705" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="404.76976989569" cy="407.47352110666" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="404.76976989569" y="413.51061243307" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="493.21706932418" cy="341.2763065404" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="493.21706932418" y="347.31339786681" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="510.25889513882" cy="383.08762175477" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="510.25889513882" y="389.12471308118" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="537.95" cy="347.42305774387" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="353.46014907028" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="378.69495708074" cy="104.02213777721" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="378.69495708074" y="110.05922910362" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> <ellipse cx="358.94938005512" cy="141.2955454839" rx="7.1347442948495" ry="7.1347442948495" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="358.94938005512" y="147.33263681031" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:13.72066210548px">N</text> </g></svg>
✍: FYIcenter.com
2022-04-21, 117👍, 0💬
Popular Posts:
What are examples of Constitutional Isomers? The picture below gives an example of Constitutional Is...
Where to find FAQ (Frequently Asked Questions) on running Open Babel on macOS? Here is a list of tut...
How to display the InChi string and InChi Key of the molecule in JSME editor? JSME does not offer an...
How to convert SMILES to SDF/Mol file and view the molecule structure? To help you to SMILES to SDF/...
How to install JSME on an Appache Web server? If you want to install JSME on a Web server for others...