Collections:
Molecule FYI-1001208
Molecule Summary:
ID: FYI-1001208
SMILES: CC[C@H](C)[C@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)CNC(=O)CNC(=O)CNC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](N)CC1=CC=CC=C1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC1=CC=C(O)C=C1)C(=O)N[C@@H](CC(C)C)C(O)=O
Received at FYIcenter.com on: 2022-03-13
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1001208 FYIcenter.com 155160 0 0 1 0 0 0 0 0999 V2000 40.4609 26.1318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 40.4609 24.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 41.6733 24.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 42.8857 24.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 41.6733 22.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 40.4609 21.9318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 40.4609 20.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 41.6733 19.8318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 39.2484 19.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 38.0360 20.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 38.0360 21.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 36.8236 22.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 35.6111 21.9318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 36.8236 24.0318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 39.2484 18.4318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 38.0360 17.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 36.8236 18.4318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 38.0360 16.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 39.2484 15.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 39.2484 14.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 40.4609 13.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 41.6733 14.2318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 40.4609 12.1318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 36.8236 15.6318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 36.8236 14.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 38.0360 13.5318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 35.6111 13.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 35.6111 12.1318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 36.8236 11.4318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 36.8236 10.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 38.0360 9.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 39.2484 10.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 39.2484 11.4318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 38.0360 12.1318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.3987 14.2318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 33.1862 13.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 33.1862 12.1318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 31.9738 14.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 31.9738 15.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 33.1862 16.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 34.3987 15.6318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 33.1862 17.7318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 30.7614 13.5318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 29.5489 14.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 29.5489 15.6318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 28.3365 13.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.1240 14.2318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 25.9116 13.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.9116 12.1318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 24.6992 14.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.6992 15.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.9116 16.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.1240 15.6318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 25.9116 17.7318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 23.4867 13.5318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 22.2743 14.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.2743 15.6318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 21.0619 13.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.8494 14.2318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 18.6370 13.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.6370 12.1318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.4245 14.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.2121 13.5318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.9997 14.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9997 15.6318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.7872 13.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5748 14.2318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 11.3624 13.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3624 12.1318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1499 14.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9375 13.5318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.7250 14.2318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7250 15.6318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.5126 13.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2337 14.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2969 13.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9969 11.8483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3663 12.1394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.4067 11.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7382 11.6352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1156 9.8332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7842 9.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7438 10.3374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4123 9.9047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3719 10.8415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.0404 10.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 11.3457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.7493 9.0395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.1560 8.8964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.4875 9.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7785 10.6985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5279 8.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8973 8.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5973 7.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.6605 6.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3816 7.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.1691 6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9567 7.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.1691 4.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3816 4.2000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.9567 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9567 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7443 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7443 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9567 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1691 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1691 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 42.8857 21.9318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 42.8857 20.5318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 44.0982 22.6318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 44.2445 24.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 45.6139 24.3152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 46.3139 23.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 45.3771 22.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 45.6682 20.6930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 44.6278 19.7562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 46.9997 20.2603 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 47.2907 18.8909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 46.2504 17.9541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 44.9189 18.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 43.8785 17.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 42.5470 17.8826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 44.1696 16.0805 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 48.6222 18.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 49.6626 19.3951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 48.9133 17.0889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 50.2448 16.6563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 50.5359 15.2868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 51.8674 14.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 52.1585 13.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 51.1181 12.5480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 53.4900 13.0522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 51.2852 17.5931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 52.6167 17.1604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 50.9941 18.9625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 52.0345 19.8992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 51.7435 21.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 52.7839 22.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 52.4928 23.5748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 53.5332 24.5116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 54.8647 24.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 55.9050 25.0158 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 55.1558 22.7096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 54.1154 21.7728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 53.3660 19.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 53.6571 18.0972 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 54.4064 20.4033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 55.7379 19.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 56.7783 20.9075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 58.1098 20.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 58.4009 19.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 59.1502 21.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 56.0290 18.6014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 54.9886 17.6646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 57.3605 18.1688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 1 0 0 0 0 3 4 1 6 0 0 0 5 3 1 0 0 0 0 5 6 1 1 0 0 0 7 6 1 0 0 0 0 8 7 2 0 0 0 0 9 7 1 0 0 0 0 10 9 1 0 0 0 0 11 10 1 0 0 0 0 12 11 1 0 0 0 0 13 12 1 0 0 0 0 14 12 2 0 0 0 0 9 15 1 1 0 0 0 16 15 1 0 0 0 0 17 16 2 0 0 0 0 18 16 1 0 0 0 0 19 18 1 0 0 0 0 20 19 1 0 0 0 0 21 20 1 0 0 0 0 22 21 1 0 0 0 0 23 21 2 0 0 0 0 18 24 1 6 0 0 0 25 24 1 0 0 0 0 26 25 2 0 0 0 0 27 25 1 0 0 0 0 28 27 1 0 0 0 0 29 28 1 0 0 0 0 30 29 2 0 0 0 0 31 30 1 0 0 0 0 32 31 2 0 0 0 0 33 32 1 0 0 0 0 34 33 2 0 0 0 0 34 29 1 0 0 0 0 27 35 1 6 0 0 0 36 35 1 0 0 0 0 37 36 2 0 0 0 0 38 36 1 0 0 0 0 39 38 1 0 0 0 0 40 39 1 0 0 0 0 41 40 1 0 0 0 0 42 40 2 0 0 0 0 38 43 1 1 0 0 0 44 43 1 0 0 0 0 45 44 2 0 0 0 0 46 44 1 0 0 0 0 47 46 1 0 0 0 0 48 47 1 0 0 0 0 49 48 2 0 0 0 0 50 48 1 0 0 0 0 51 50 1 0 0 0 0 52 51 1 0 0 0 0 53 52 1 0 0 0 0 54 52 2 0 0 0 0 50 55 1 1 0 0 0 56 55 1 0 0 0 0 57 56 2 0 0 0 0 58 56 1 0 0 0 0 59 58 1 0 0 0 0 60 59 1 0 0 0 0 61 60 2 0 0 0 0 62 60 1 0 0 0 0 63 62 1 0 0 0 0 64 63 1 0 0 0 0 65 64 2 0 0 0 0 66 64 1 0 0 0 0 67 66 1 0 0 0 0 68 67 1 0 0 0 0 69 68 2 0 0 0 0 70 68 1 0 0 0 0 71 70 1 0 0 0 0 72 71 1 0 0 0 0 73 72 2 0 0 0 0 74 72 1 1 0 0 0 75 74 1 0 0 0 0 76 75 1 0 0 0 0 77 76 1 0 0 0 0 78 77 1 0 0 0 0 78 74 1 0 0 0 0 79 78 1 0 0 0 0 80 79 2 0 0 0 0 81 79 1 0 0 0 0 82 81 1 0 0 0 0 83 82 1 0 0 0 0 84 83 1 0 0 0 0 85 84 1 0 0 0 0 86 85 1 0 0 0 0 87 86 1 0 0 0 0 88 86 2 0 0 0 0 81 89 1 1 0 0 0 90 89 1 0 0 0 0 91 90 2 0 0 0 0 92 90 1 6 0 0 0 93 92 1 0 0 0 0 94 93 1 0 0 0 0 95 94 1 0 0 0 0 96 95 1 0 0 0 0 96 92 1 0 0 0 0 97 96 1 0 0 0 0 98 97 2 0 0 0 0 99 97 1 0 0 0 0 99100 1 6 0 0 0 101 99 1 0 0 0 0 102101 1 0 0 0 0 103102 2 0 0 0 0 104103 1 0 0 0 0 105104 2 0 0 0 0 106105 1 0 0 0 0 107106 2 0 0 0 0 107102 1 0 0 0 0 108 5 1 0 0 0 0 109108 2 0 0 0 0 110108 1 0 0 0 0 111110 1 0 0 0 0 112111 1 0 0 0 0 113112 1 0 0 0 0 114113 1 0 0 0 0 114110 1 0 0 0 0 114115 1 1 0 0 0 116115 2 0 0 0 0 117115 1 0 0 0 0 118117 1 6 0 0 0 119118 1 0 0 0 0 120119 1 0 0 0 0 121120 1 0 0 0 0 122121 1 0 0 0 0 123121 2 0 0 0 0 124118 1 0 0 0 0 125124 2 0 0 0 0 126124 1 0 0 0 0 127126 1 6 0 0 0 128127 1 0 0 0 0 129128 1 0 0 0 0 130129 1 0 0 0 0 131130 1 0 0 0 0 132130 2 0 0 0 0 133127 1 0 0 0 0 134133 2 0 0 0 0 135133 1 0 0 0 0 136135 1 1 0 0 0 137136 1 0 0 0 0 138137 1 0 0 0 0 139138 2 0 0 0 0 140139 1 0 0 0 0 141140 2 0 0 0 0 142141 1 0 0 0 0 143141 1 0 0 0 0 144143 2 0 0 0 0 144138 1 0 0 0 0 145136 1 0 0 0 0 146145 2 0 0 0 0 147145 1 0 0 0 0 148147 1 1 0 0 0 149148 1 0 0 0 0 150149 1 0 0 0 0 151150 1 0 0 0 0 152150 1 0 0 0 0 153148 1 0 0 0 0 154153 1 0 0 0 0 155153 2 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="381.26373571011" x2="381.26373571011" y1="387.80389263265" y2="393.67251184273" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="381.26373571011" x2="381.26373571011" y1="393.67251184273" y2="399.54113105281" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="391.42818418196" x2="386.34595994604" y1="381.93527342258" y2="384.86958302761" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="386.34595994604" x2="381.26373571011" y1="384.86958302761" y2="387.80389263265" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 392,382 401,390 403,387" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="391.42818418196" x2="391.42818418196" y1="370.19803500242" y2="376.0666542125" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="391.42818418196" x2="391.42818418196" y1="376.0666542125" y2="381.93527342258" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 392,371 383,363 381,366" fill-opacity="1" style="fill:#000000" /> <line x1="381.26373571011" x2="381.26373571011" y1="352.59217737218" y2="358.46079658226" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="381.26373571011" x2="381.26373571011" y1="358.46079658226" y2="364.32941579234" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="392" x2="386.5" y1="347" y2="350" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="386.5" x2="381" y1="350" y2="353" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="392" x2="387" y1="348" y2="351" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="387" x2="382" y1="351" y2="354" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="371.09844886408" x2="376.18109228709" y1="346.7235581621" y2="349.65786776714" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="376.18109228709" x2="381.26373571011" y1="349.65786776714" y2="352.59217737218" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="360.93400039222" x2="366.01622462815" y1="352.59217737218" y2="349.65786776714" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="366.01622462815" x2="371.09844886408" y1="349.65786776714" y2="346.7235581621" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="360.93400039222" x2="360.93400039222" y1="364.32941579234" y2="358.46079658226" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="360.93400039222" x2="360.93400039222" y1="358.46079658226" y2="352.59217737218" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="350.76955192037" x2="355.85177615629" y1="370.19803500242" y2="367.26372539738" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="355.85177615629" x2="360.93400039222" y1="367.26372539738" y2="364.32941579234" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="340.60426507434" x2="345.68690849735" y1="364.32941579234" y2="367.26372539738" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="345.68690849735" x2="350.76955192037" y1="367.26372539738" y2="370.19803500242" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="352" x2="352" y1="382" y2="376.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="352" x2="352" y1="376.5" y2="371" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="351" x2="351" y1="382" y2="376.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="351" x2="351" y1="376.5" y2="371" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 372,347 373,335 370,335" fill-opacity="1" style="fill:#000000" /> <line x1="360.93400039222" x2="366.01622462815" y1="329.11770053187" y2="332.05201013691" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="366.01622462815" x2="371.09844886408" y1="332.05201013691" y2="334.98631974195" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="352" x2="357" y1="336" y2="333" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="357" x2="362" y1="333" y2="330" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="351" x2="356" y1="335" y2="332" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="356" x2="361" y1="332" y2="329" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="360.93400039222" x2="360.93400039222" y1="317.38046211171" y2="323.24908132179" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="360.93400039222" x2="360.93400039222" y1="323.24908132179" y2="329.11770053187" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="371.09844886408" x2="366.01622462815" y1="311.51184290163" y2="314.44615250667" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="366.01622462815" x2="360.93400039222" y1="314.44615250667" y2="317.38046211171" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="371.09844886408" x2="371.09844886408" y1="299.77460448147" y2="305.64322369155" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="371.09844886408" x2="371.09844886408" y1="305.64322369155" y2="311.51184290163" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="381.26373571011" x2="376.18109228709" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="376.18109228709" x2="371.09844886408" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="391.42818418196" x2="386.34595994604" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="386.34595994604" x2="381.26373571011" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="381" x2="381" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="381" x2="381" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="382" x2="382" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="382" x2="382" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 361,318 352,310 350,314" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="350.76955192037" x2="350.76955192037" y1="299.77460448147" y2="305.64322369155" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="350.76955192037" x2="350.76955192037" y1="305.64322369155" y2="311.51184290163" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="361" x2="356" y1="294" y2="297" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="356" x2="351" y1="297" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="362" x2="357" y1="295" y2="298" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="357" x2="352" y1="298" y2="301" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="340.60426507434" x2="345.68690849735" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="345.68690849735" x2="350.76955192037" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="340.60426507434" x2="340.60426507434" y1="282.16874685124" y2="288.03736606132" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="340.60426507434" x2="340.60426507434" y1="288.03736606132" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="350.76955192037" x2="345.68690849735" y1="276.30012764116" y2="279.2344372462" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="345.68690849735" x2="340.60426507434" y1="279.2344372462" y2="282.16874685124" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="351" x2="351" y1="265" y2="271" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="351" x2="351" y1="271" y2="277" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="352" x2="352" y1="265" y2="271" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="352" x2="352" y1="271" y2="277" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="360.93400039222" x2="355.85177615629" y1="258.69427001092" y2="261.62857961596" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="355.85177615629" x2="350.76955192037" y1="261.62857961596" y2="264.562889221" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="372" x2="367" y1="265" y2="262" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="367" x2="362" y1="262" y2="259" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="371" x2="366" y1="266" y2="263" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="366" x2="361" y1="263" y2="260" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="371.09844886408" x2="371.09844886408" y1="276.30012764116" y2="270.43150843108" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="371.09844886408" x2="371.09844886408" y1="270.43150843108" y2="264.562889221" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="362" x2="367" y1="283" y2="280" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="367" x2="372" y1="280" y2="277" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="361" x2="366" y1="282" y2="279" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="366" x2="371" y1="279" y2="276" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="360.93400039222" x2="355.85177615629" y1="282.16874685124" y2="279.2344372462" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="355.85177615629" x2="350.76955192037" y1="279.2344372462" y2="276.30012764116" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 341,294 330,299 332,302" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="320.27452975645" x2="325.35717317947" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="325.35717317947" x2="330.43981660248" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="320" x2="320" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="320" x2="320" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="321" x2="321" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="321" x2="321" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="310.11008128459" x2="315.19230552052" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="315.19230552052" x2="320.27452975645" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="310.11008128459" x2="310.11008128459" y1="311.51184290163" y2="305.64322369155" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="310.11008128459" x2="310.11008128459" y1="305.64322369155" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="320.27452975645" x2="315.19230552052" y1="317.38046211171" y2="314.44615250667" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="315.19230552052" x2="310.11008128459" y1="314.44615250667" y2="311.51184290163" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="330.43981660248" x2="325.35717317947" y1="311.51184290163" y2="314.44615250667" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="325.35717317947" x2="320.27452975645" y1="314.44615250667" y2="317.38046211171" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="321" x2="321" y1="330" y2="324" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="321" x2="321" y1="324" y2="318" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="320" x2="320" y1="330" y2="324" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="320" x2="320" y1="324" y2="318" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 311,300 301,293 300,296" fill-opacity="1" style="fill:#000000" /> <line x1="289.78034596671" x2="294.86298938972" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="294.86298938972" x2="299.94563281274" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="291" x2="291" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="291" x2="291" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="290" x2="290" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="290" x2="290" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="279.61589749485" x2="284.69812173078" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="284.69812173078" x2="289.78034596671" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="269.45061064882" x2="274.53325407184" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="274.53325407184" x2="279.61589749485" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="259.28616217697" x2="264.36838641289" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="264.36838641289" x2="269.45061064882" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="259" x2="259" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="259" x2="259" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="260" x2="260" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="260" x2="260" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="249.12171370511" x2="254.20393794104" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="254.20393794104" x2="259.28616217697" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="249.12171370511" x2="249.12171370511" y1="311.51184290163" y2="305.64322369155" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="249.12171370511" x2="249.12171370511" y1="305.64322369155" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="259.28616217697" x2="254.20393794104" y1="317.38046211171" y2="314.44615250667" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="254.20393794104" x2="249.12171370511" y1="314.44615250667" y2="311.51184290163" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="269.45061064882" x2="264.36838641289" y1="311.51184290163" y2="314.44615250667" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="264.36838641289" x2="259.28616217697" y1="314.44615250667" y2="317.38046211171" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="260" x2="260" y1="330" y2="324" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="260" x2="260" y1="324" y2="318" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="259" x2="259" y1="330" y2="324" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="259" x2="259" y1="324" y2="318" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 250,300 240,293 239,296" fill-opacity="1" style="fill:#000000" /> <line x1="228.79197838722" x2="233.87420262315" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="233.87420262315" x2="238.95642685908" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="230" x2="230" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="230" x2="230" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="229" x2="229" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="229" x2="229" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="218.62752991537" x2="223.7097541513" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="223.7097541513" x2="228.79197838722" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="208.46224306934" x2="213.54488649235" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="213.54488649235" x2="218.62752991537" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="198.29779459748" x2="203.38001883341" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="203.38001883341" x2="208.46224306934" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="198" x2="198" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="198" x2="198" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="199" x2="199" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="199" x2="199" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="188.13250775145" x2="193.21515117447" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="193.21515117447" x2="198.29779459748" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="177.9680592796" x2="183.05028351552" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="183.05028351552" x2="188.13250775145" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="167.80361080774" x2="172.88583504367" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="172.88583504367" x2="177.9680592796" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="169" x2="169" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="169" x2="169" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="168" x2="168" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="168" x2="168" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="157.63832396171" x2="162.72096738473" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="162.72096738473" x2="167.80361080774" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="147.47387548985" x2="152.55609972578" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="152.55609972578" x2="157.63832396171" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="137.309427018" x2="142.39165125393" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="142.39165125393" x2="147.47387548985" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="137" x2="137" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="137" x2="137" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="138" x2="138" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="138" x2="138" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="127.14414017197" x2="132.22678359498" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="132.22678359498" x2="137.309427018" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="116.97969170011" x2="122.06191593604" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="122.06191593604" x2="127.14414017197" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="106.81440485408" x2="111.8970482771" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="111.8970482771" x2="116.97969170011" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="108" x2="108" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="108" x2="108" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="107" x2="107" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="107" x2="107" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 97,294 106,302 108,299" fill-opacity="1" style="fill:#000000" /> <line x1="85.927989085413" x2="91.28897273382" y1="298.67968781171" y2="296.29283654155" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="91.28897273382" x2="96.649956382227" y1="296.29283654155" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="78.074099833982" x2="82.001044459698" y1="289.95724291718" y2="294.31846536445" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="82.001044459698" x2="85.927989085413" y1="294.31846536445" y2="298.67968781171" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="83.942719044061" x2="81.008409439021" y1="279.79195607115" y2="284.87459949417" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="81.008409439021" x2="78.074099833982" y1="284.87459949417" y2="289.95724291718" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="95.42341496732" x2="89.683067005691" y1="282.23246328837" y2="281.01220967976" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="89.683067005691" x2="83.942719044061" y1="281.01220967976" y2="279.79195607115" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="95.42341496732" x2="96.036685674774" y1="282.23246328837" y2="288.06922427988" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="96.036685674774" x2="96.649956382227" y1="288.06922427988" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="104.14585986184" x2="99.784637414582" y1="274.37857403694" y2="278.30551866266" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="99.784637414582" x2="95.42341496732" y1="278.30551866266" y2="282.23246328837" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="116" x2="110.5" y1="278" y2="276" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="110.5" x2="105" y1="276" y2="274" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="116" x2="110" y1="279" y2="277" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="110" x2="104" y1="277" y2="275" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="101.70535264462" x2="102.92560625323" y1="262.89787811368" y2="268.63822607531" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="102.92560625323" x2="104.14585986184" y1="268.63822607531" y2="274.37857403694" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="90.543238907054" x2="96.124295775838" y1="259.27107144185" y2="261.08447477777" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="96.124295775838" x2="101.70535264462" y1="261.08447477777" y2="262.89787811368" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="81.820794012531" x2="86.182016459792" y1="267.12496069329" y2="263.19801606757" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="86.182016459792" x2="90.543238907054" y1="263.19801606757" y2="259.27107144185" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="70.657841900788" x2="76.23931795666" y1="263.49731564728" y2="265.31113817029" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="76.23931795666" x2="81.820794012531" y1="265.31113817029" y2="267.12496069329" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="61.935397006265" x2="66.296619453527" y1="271.35120489872" y2="267.424260273" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="66.296619453527" x2="70.657841900788" y1="267.424260273" y2="263.49731564728" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="50.772444894523" x2="56.353920950394" y1="267.72439822689" y2="269.5378015628" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="56.353920950394" x2="61.935397006265" y1="269.5378015628" y2="271.35120489872" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="42.05" x2="46.411222447261" y1="275.57828747832" y2="271.6513428526" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="46.411222447261" x2="50.772444894523" y1="271.6513428526" y2="267.72439822689" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="48" x2="49.5" y1="257" y2="262.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="49.5" x2="51" y1="262.5" y2="268" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="49" x2="50.5" y1="257" y2="262.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="50.5" x2="52" y1="262.5" y2="268" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 102,263 112,257 110,254" fill-opacity="1" style="fill:#000000" /> <line x1="121.59074965089" x2="116.00927359502" y1="258.67163390825" y2="256.85781138525" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="116.00927359502" x2="110.42779753915" y1="256.85781138525" y2="255.04398886225" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="125" x2="124" y1="271" y2="265" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="124" x2="123" y1="265" y2="259" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="124" x2="122.5" y1="271" y2="265" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="122.5" x2="121" y1="265" y2="259" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 131,251 121,258 123,260" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="141.79389046867" x2="136.05354250704" y1="253.25825187404" y2="252.03799826543" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="136.05354250704" x2="130.31319454541" y1="252.03799826543" y2="250.81774465682" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="147.66250967875" x2="144.72820007371" y1="243.09380340219" y2="248.17602763811" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="144.72820007371" x2="141.79389046867" y1="248.17602763811" y2="253.25825187404" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="139.80862042732" x2="143.73556505303" y1="234.37052013349" y2="238.73216176784" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="143.73556505303" x2="147.66250967875" y1="238.73216176784" y2="243.09380340219" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="129.08665313051" x2="134.44763677891" y1="239.14506104798" y2="236.75779059073" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="134.44763677891" x2="139.80862042732" y1="236.75779059073" y2="234.37052013349" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="129.08665313051" x2="129.69992383796" y1="239.14506104798" y2="244.9814028524" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="129.69992383796" x2="130.31319454541" y1="244.9814028524" y2="250.81774465682" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="118.92136628448" x2="124.00400970749" y1="233.2764418379" y2="236.21075144294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="124.00400970749" x2="129.08665313051" y1="236.21075144294" y2="239.14506104798" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="110" x2="115" y1="240" y2="237" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="115" x2="120" y1="237" y2="234" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="109" x2="114" y1="239" y2="236" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="114" x2="119" y1="236" y2="233" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="118.92136628448" x2="118.92136628448" y1="221.53920341774" y2="227.40782262782" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="118.92136628448" x2="118.92136628448" y1="227.40782262782" y2="233.2764418379" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 119,222 130,218 129,215" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="108.75691781262" x2="113.83914204855" y1="215.67058420766" y2="218.6048938127" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="113.83914204855" x2="118.92136628448" y1="218.6048938127" y2="221.53920341774" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="108.75691781262" x2="108.75691781262" y1="203.9333457875" y2="209.80196499758" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="108.75691781262" x2="108.75691781262" y1="209.80196499758" y2="215.67058420766" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="99" x2="104" y1="199" y2="202" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="104" x2="109" y1="202" y2="205" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="99" x2="104.5" y1="198" y2="201" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="104.5" x2="110" y1="201" y2="204" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="98.592469340763" x2="98.592469340763" y1="186.32748815727" y2="192.19610736735" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="98.592469340763" x2="98.592469340763" y1="192.19610736735" y2="198.06472657742" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="109" x2="104" y1="180" y2="183" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="104" x2="99" y1="183" y2="186" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="110" x2="104.5" y1="181" y2="184" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="104.5" x2="99" y1="184" y2="187" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="118.92136628448" x2="113.83914204855" y1="186.32748815727" y2="183.39317855223" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="113.83914204855" x2="108.75691781262" y1="183.39317855223" y2="180.45886894719" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="120" x2="120" y1="199" y2="193" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="120" x2="120" y1="193" y2="187" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="119" x2="119" y1="199" y2="193" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="119" x2="119" y1="193" y2="187" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="118.92136628448" x2="113.83914204855" y1="198.06472657742" y2="200.99903618246" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="113.83914204855" x2="108.75691781262" y1="200.99903618246" y2="203.9333457875" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="401.59263265382" x2="396.51040841789" y1="364.32941579234" y2="367.26372539738" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="396.51040841789" x2="391.42818418196" y1="367.26372539738" y2="370.19803500242" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="401" x2="401" y1="353" y2="359" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="401" x2="401" y1="359" y2="365" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="403" x2="403" y1="353" y2="359" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="403" x2="403" y1="359" y2="365" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="411.75791949985" x2="406.67527607683" y1="370.19803500242" y2="367.26372539738" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="406.67527607683" x2="401.59263265382" y1="367.26372539738" y2="364.32941579234" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="412.98446091476" x2="412.3711902073" y1="381.87071861126" y2="376.03437680684" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="412.3711902073" x2="411.75791949985" y1="376.03437680684" y2="370.19803500242" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="424.46515683802" x2="418.72480887639" y1="384.31122582848" y2="383.09097221987" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="418.72480887639" x2="412.98446091476" y1="383.09097221987" y2="381.87071861126" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="430.33377604809" x2="427.39946644306" y1="374.14593898245" y2="379.22858240547" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="427.39946644306" x2="424.46515683802" y1="379.22858240547" y2="384.31122582848" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="422.47988679666" x2="426.40683142238" y1="365.42349408793" y2="369.78471653519" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="426.40683142238" x2="430.33377604809" y1="369.78471653519" y2="374.14593898245" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="422.47988679666" x2="417.11890314826" y1="365.42349408793" y2="367.81076454517" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="417.11890314826" x2="411.75791949985" y1="367.81076454517" y2="370.19803500242" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <polygon points=" 423,366 427,355 424,354" fill-opacity="1" style="fill:#000000" /> <line x1="416" x2="420.5" y1="347" y2="351" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="420.5" x2="425" y1="351" y2="355" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="417" x2="421.5" y1="346" y2="350" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="421.5" x2="426" y1="350" y2="354" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="436.08334612563" x2="430.50187006975" y1="350.31599149284" y2="352.12981401584" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="430.50187006975" x2="424.92039401388" y1="352.12981401584" y2="353.94363653885" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 439,339 435,350 438,351" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="429.80140844832" x2="434.1622117085" y1="330.98140631815" y2="334.90835094387" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="434.1622117085" x2="438.52301496867" y1="334.90835094387" y2="338.83529556958" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="418.63845633658" x2="424.21993239245" y1="334.60905136415" y2="332.79522884115" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="424.21993239245" x2="429.80140844832" y1="332.79522884115" y2="330.98140631815" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="409.91601144206" x2="414.27723388932" y1="326.75516211272" y2="330.68210673844" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="414.27723388932" x2="418.63845633658" y1="330.68210673844" y2="334.60905136415" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="398.75305933032" x2="404.33453538619" y1="330.38196878455" y2="328.56856544864" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="404.33453538619" x2="409.91601144206" y1="328.56856544864" y2="326.75516211272" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="412" x2="411" y1="316" y2="321.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="411" x2="410" y1="321.5" y2="327" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="413" x2="412" y1="316" y2="321.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="412" x2="411" y1="321.5" y2="327" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="449.68596708042" x2="444.10449102454" y1="335.20848889776" y2="337.02189223367" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="444.10449102454" x2="438.52301496867" y1="337.02189223367" y2="338.83529556958" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="459" x2="455" y1="343" y2="339" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="455" x2="451" y1="339" y2="335" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="458" x2="454" y1="344" y2="340" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="454" x2="450" y1="340" y2="336" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="452.12647429764" x2="450.90622068903" y1="323.7277929745" y2="329.46814093613" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="450.90622068903" x2="449.68596708042" y1="329.46814093613" y2="335.20848889776" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 464,321 452,323 453,326" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="465.7299336266" x2="464.50968001799" y1="308.61945200523" y2="314.36021915395" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="464.50968001799" x2="463.28942640938" y1="314.36021915395" y2="320.10098630267" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="476.89288573834" x2="471.31140968247" y1="304.99264533341" y2="306.80604866932" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="471.31140968247" x2="465.7299336266" y1="306.80604866932" y2="308.61945200523" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="479.33339295556" x2="478.11313934695" y1="293.51194941015" y2="299.25229737178" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="478.11313934695" x2="476.89288573834" y1="299.25229737178" y2="304.99264533341" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="470.61094806104" x2="474.9721705083" y1="285.65806015871" y2="289.58500478443" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="474.9721705083" x2="479.33339295556" y1="289.58500478443" y2="293.51194941015" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="491" x2="485.5" y1="290" y2="291.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="485.5" x2="480" y1="291.5" y2="293" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="491" x2="485.5" y1="291" y2="293" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="485.5" x2="480" y1="293" y2="295" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="472.0118713039" x2="467.65064885664" y1="327.9548755541" y2="324.02793092838" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="467.65064885664" x2="463.28942640938" y1="324.02793092838" y2="320.10098630267" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="483" x2="477.5" y1="324" y2="326" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="477.5" x2="472" y1="326" y2="328" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="484" x2="478.5" y1="325" y2="327" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="478.5" x2="473" y1="327" y2="329" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="469.57136408668" x2="470.79161769529" y1="339.43557147736" y2="333.69522351573" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="470.79161769529" x2="472.0118713039" y1="333.69522351573" y2="327.9548755541" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 479,348 471,339 469,341" fill-opacity="1" style="fill:#000000" /> <line x1="475.85414013816" x2="477.07397455968" y1="358.76931827788" y2="353.02897031625" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="477.07397455968" x2="478.2938089812" y1="353.02897031625" y2="347.28862235462" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="484.57658503268" x2="480.21536258542" y1="366.62320752931" y2="362.69626290359" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="480.21536258542" x2="475.85414013816" y1="362.69626290359" y2="358.76931827788" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="483" x2="484.5" y1="379" y2="373" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="484.5" x2="486" y1="373" y2="367" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="482" x2="483" y1="378" y2="372.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="483" x2="484" y1="372.5" y2="367" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="490.85852270998" x2="486.49730026272" y1="385.957792704" y2="382.03084807828" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="486.49730026272" x2="482.13607781546" y1="382.03084807828" y2="378.10390345257" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="502" x2="496.5" y1="382" y2="384" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="496.5" x2="491" y1="384" y2="386" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="503" x2="497.5" y1="383" y2="385" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="497.5" x2="492" y1="385" y2="387" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="510.74308134207" x2="506.3822780819" y1="390.1848752836" y2="386.25793065788" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="506.3822780819" x2="502.02147482173" y1="386.25793065788" y2="382.33098603217" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="504.46198203894" x2="503.24172843033" y1="370.85029010891" y2="376.59063807054" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="503.24172843033" x2="502.02147482173" y1="376.59063807054" y2="382.33098603217" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="496" x2="500.5" y1="364" y2="368" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="500.5" x2="505" y1="368" y2="372" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="497" x2="501" y1="363" y2="367" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="501" x2="505" y1="367" y2="371" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="495.73953714442" x2="490.15806108855" y1="362.99640085748" y2="364.80980419339" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="490.15806108855" x2="484.57658503268" y1="364.80980419339" y2="366.62320752931" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="489.45676109295" x2="483.87528503708" y1="343.66181568279" y2="345.4752190187" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="483.87528503708" x2="478.2938089812" y1="345.4752190187" y2="347.28862235462" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="492" x2="490.5" y1="333" y2="338.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="490.5" x2="489" y1="338.5" y2="344" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="493" x2="492" y1="333" y2="338.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="492" x2="491" y1="338.5" y2="344" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="498.17920598747" x2="493.81798354021" y1="351.51486656005" y2="347.58834112142" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" /> <line x1="493.81798354021" x2="489.45676109295" y1="347.58834112142" y2="343.66181568279" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <polygon points=" 510,348 498,350 499,354" fill-opacity="1" style="fill:#000000" /> <line x1="518.06460299373" x2="513.70338054647" y1="355.74194913965" y2="351.81500451393" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="513.70338054647" x2="509.34215809921" y1="351.81500451393" y2="347.88805988822" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="529.22755510548" x2="523.64607904961" y1="352.11514246782" y2="353.92854580373" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="523.64607904961" x2="518.06460299373" y1="353.92854580373" y2="355.74194913965" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="531.6680623227" x2="530.44780871409" y1="340.63444654456" y2="346.37479450619" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="530.44780871409" x2="529.22755510548" y1="346.37479450619" y2="352.11514246782" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="537.95" x2="533.58877755274" y1="359.96903171925" y2="356.04208709353" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="533.58877755274" x2="529.22755510548" y1="356.04208709353" y2="352.11514246782" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="511.78266531643" x2="510.56241170782" y1="336.40820233913" y2="342.14813111367" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="510.56241170782" x2="509.34215809921" y1="342.14813111367" y2="347.88805988822" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="503.06022042191" x2="507.42144286917" y1="328.5543130877" y2="332.48125771341" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="507.42144286917" x2="511.78266531643" y1="332.48125771341" y2="336.40820233913" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="523" x2="517.5" y1="333" y2="334.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="517.5" x2="512" y1="334.5" y2="336" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <line x1="524" x2="518" y1="334" y2="335.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" /> <line x1="518" x2="512" y1="335.5" y2="337" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" /> <ellipse cx="381.26373571011" cy="364.32941579234" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="381.26373571011" y="367.04750798377" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="391.42818418196" cy="346.7235581621" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="391.42818418196" y="349.44165035353" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="340.60426507434" cy="364.32941579234" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="340.60426507434" y="367.04750798377" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="350.76955192037" cy="381.93527342258" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="350.76955192037" y="384.653365614" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="371.09844886408" cy="334.98631974195" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="371.09844886408" y="337.70441193337" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="350.76955192037" cy="334.98631974195" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="350.76955192037" y="337.70441193337" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="391.42818418196" cy="299.77460448147" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="391.42818418196" y="302.4926966729" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="381.26373571011" cy="282.16874685124" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="381.26373571011" y="284.88683904266" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="350.76955192037" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="350.76955192037" y="314.22993509306" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="360.93400039222" cy="293.90598527139" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="360.93400039222" y="296.62407746282" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="330.43981660248" cy="299.77460448147" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="330.43981660248" y="302.4926966729" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="320.27452975645" cy="282.16874685124" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.27452975645" y="284.88683904266" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="330.43981660248" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="330.43981660248" y="314.22993509306" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="320.27452975645" cy="329.11770053187" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.27452975645" y="331.83579272329" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="299.94563281274" cy="293.90598527139" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="299.94563281274" y="296.62407746282" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="289.78034596671" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="289.78034596671" y="314.22993509306" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="269.45061064882" cy="299.77460448147" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="269.45061064882" y="302.4926966729" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="259.28616217697" cy="282.16874685124" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="259.28616217697" y="284.88683904266" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="269.45061064882" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="269.45061064882" y="314.22993509306" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="259.28616217697" cy="329.11770053187" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="259.28616217697" y="331.83579272329" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="238.95642685908" cy="293.90598527139" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="238.95642685908" y="296.62407746282" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="228.79197838722" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="228.79197838722" y="314.22993509306" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="208.46224306934" cy="299.77460448147" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="208.46224306934" y="302.4926966729" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="198.29779459748" cy="282.16874685124" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="198.29779459748" y="284.88683904266" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="177.9680592796" cy="293.90598527139" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.9680592796" y="296.62407746282" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="167.80361080774" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="167.80361080774" y="314.22993509306" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="147.47387548985" cy="299.77460448147" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="147.47387548985" y="302.4926966729" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="137.309427018" cy="282.16874685124" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="137.309427018" y="284.88683904266" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="116.97969170011" cy="293.90598527139" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="116.97969170011" y="296.62407746282" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="106.81440485408" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="106.81440485408" y="314.22993509306" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="95.42341496732" cy="282.23246328837" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="95.42341496732" y="284.9505554798" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="115.30881197359" cy="278.00538070877" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="115.30881197359" y="280.7234729002" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="61.935397006265" cy="271.35120489872" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="61.935397006265" y="274.06929709014" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="42.05" cy="275.57828747832" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="278.29637966974" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="48.331937677303" cy="256.24370230363" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="48.331937677303" y="258.96179449505" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="110.42779753915" cy="255.04398886225" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="110.42779753915" y="257.76208105368" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="124.03041849394" cy="270.15232983151" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="124.03041849394" y="272.87042202294" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="129.08665313051" cy="239.14506104798" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="129.08665313051" y="241.8631532394" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="108.75691781262" cy="239.14506104798" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="108.75691781262" y="241.8631532394" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="129.08665313051" cy="215.67058420766" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="129.08665313051" y="218.38867639909" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="401.59263265382" cy="352.59217737218" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="401.59263265382" y="355.31026956361" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="411.75791949985" cy="370.19803500242" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="411.75791949985" y="372.91612719384" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="416.19794911936" cy="346.08974728741" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="416.19794911936" y="348.80783947884" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="436.08334612563" cy="350.31599149284" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="436.08334612563" y="353.03408368427" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="398.75305933032" cy="330.38196878455" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="398.75305933032" y="333.10006097598" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="412.35651865928" cy="315.27362781529" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="412.35651865928" y="317.99172000672" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="458.40841197494" cy="343.06237814919" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="458.40841197494" y="345.78047034061" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="452.12647429764" cy="323.7277929745" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="452.12647429764" y="326.44588516592" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="470.61094806104" cy="285.65806015871" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="470.61094806104" y="288.37615235014" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="490.4963450673" cy="289.88514273832" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="490.4963450673" y="292.60323492974" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="483.17482341564" cy="324.3272305081" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="483.17482341564" y="327.04532269952" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="469.57136408668" cy="339.43557147736" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="469.57136408668" y="342.15366366878" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="510.74308134207" cy="390.1848752836" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="510.74308134207" y="392.90296747503" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="491.89726831017" cy="332.18111975953" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="491.89726831017" y="334.89921195095" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="498.17920598747" cy="351.51486656005" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="498.17920598747" y="354.23295875147" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">N</text> <ellipse cx="503.06022042191" cy="328.5543130877" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="503.06022042191" y="331.27240527913" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> <ellipse cx="522.94561742817" cy="332.7813956673" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="522.94561742817" y="335.49948785873" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:6.1774822532425px">O</text> </g></svg>
✍: FYIcenter.com
2022-04-21, 113👍, 0💬
Popular Posts:
What are the options for installing Open Babel on macOS computers? There are a number of options for...
How to hide those H symbols (Hydrogen symbols) implicitly added to non-carbon terminal atoms in SVG ...
What Is SDF/Mol file format? SDF (Structural Data File), also call Mol file, or Molfile, is a text f...
What are examples of Enantiomers Isomers? The picture below gives an example of Enantiomers Isomers:...
How to download and instal Open Babel from source code on CentOS computers? I want to build the bina...