Molecule FYI-1001208

A

Molecule Summary:

ID: FYI-1001208
SMILES: CC[C@H](C)[C@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)CNC(=O)CNC(=O)CNC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](N)CC1=CC=CC=C1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC1=CC=C(O)C=C1)C(=O)N[C@@H](CC(C)C)C(O)=O

Received at FYIcenter.com on: 2022-03-13

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001208
FYIcenter.com

155160  0  0  1  0  0  0  0  0999 V2000
   40.4609   26.1318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4609   24.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6733   24.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8857   24.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6733   22.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4609   21.9318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4609   20.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6733   19.8318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.2484   19.8318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0360   20.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0360   21.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8236   22.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6111   21.9318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.8236   24.0318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.2484   18.4318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0360   17.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8236   18.4318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.0360   16.3318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2484   15.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2484   14.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4609   13.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6733   14.2318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.4609   12.1318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.8236   15.6318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.8236   14.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0360   13.5318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6111   13.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6111   12.1318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8236   11.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8236   10.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0360    9.3318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2484   10.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2484   11.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0360   12.1318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3987   14.2318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.1862   13.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1862   12.1318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9738   14.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9738   15.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1862   16.3318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3987   15.6318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1862   17.7318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.7614   13.5318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5489   14.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5489   15.6318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3365   13.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1240   14.2318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9116   13.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9116   12.1318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6992   14.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6992   15.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9116   16.3318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1240   15.6318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9116   17.7318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4867   13.5318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2743   14.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2743   15.6318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0619   13.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8494   14.2318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6370   13.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6370   12.1318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4245   14.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2121   13.5318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9997   14.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9997   15.6318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7872   13.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5748   14.2318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3624   13.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3624   12.1318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1499   14.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9375   13.5318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7250   14.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7250   15.6318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5126   13.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2337   14.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2969   13.0608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9969   11.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3663   12.1394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4067   11.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7382   11.6352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1156    9.8332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7842    9.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7438   10.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4123    9.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3719   10.8415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0404   10.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   11.3457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7493    9.0395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1560    8.8964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4875    9.3291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7785   10.6985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5279    8.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8973    8.6834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5973    7.4710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6605    6.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3816    7.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1691    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9567    7.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1691    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3816    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9567    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9567    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7443    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7443    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9567    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1691    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1691    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8857   21.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8857   20.5318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.0982   22.6318    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.2445   24.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6139   24.3152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3139   23.1027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3771   22.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6682   20.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6278   19.7562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.9997   20.2603    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   47.2907   18.8909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.2504   17.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9189   18.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8785   17.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5470   17.8826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.1696   16.0805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   48.6222   18.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   49.6626   19.3951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   48.9133   17.0889    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   50.2448   16.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   50.5359   15.2868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   51.8674   14.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.1585   13.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   51.1181   12.5480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   53.4900   13.0522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   51.2852   17.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.6167   17.1604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   50.9941   18.9625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   52.0345   19.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   51.7435   21.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.7839   22.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.4928   23.5748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   53.5332   24.5116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.8647   24.0790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   55.9050   25.0158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   55.1558   22.7096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.1154   21.7728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   53.3660   19.4666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   53.6571   18.0972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   54.4064   20.4033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   55.7379   19.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   56.7783   20.9075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   58.1098   20.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   58.4009   19.1055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   59.1502   21.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   56.0290   18.6014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.9886   17.6646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   57.3605   18.1688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  3  4  1  6  0  0  0
  5  3  1  0  0  0  0
  5  6  1  1  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  7  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 12  2  0  0  0  0
  9 15  1  1  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 16  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 21  2  0  0  0  0
 18 24  1  6  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 27 25  1  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  2  0  0  0  0
 31 30  1  0  0  0  0
 32 31  2  0  0  0  0
 33 32  1  0  0  0  0
 34 33  2  0  0  0  0
 34 29  1  0  0  0  0
 27 35  1  6  0  0  0
 36 35  1  0  0  0  0
 37 36  2  0  0  0  0
 38 36  1  0  0  0  0
 39 38  1  0  0  0  0
 40 39  1  0  0  0  0
 41 40  1  0  0  0  0
 42 40  2  0  0  0  0
 38 43  1  1  0  0  0
 44 43  1  0  0  0  0
 45 44  2  0  0  0  0
 46 44  1  0  0  0  0
 47 46  1  0  0  0  0
 48 47  1  0  0  0  0
 49 48  2  0  0  0  0
 50 48  1  0  0  0  0
 51 50  1  0  0  0  0
 52 51  1  0  0  0  0
 53 52  1  0  0  0  0
 54 52  2  0  0  0  0
 50 55  1  1  0  0  0
 56 55  1  0  0  0  0
 57 56  2  0  0  0  0
 58 56  1  0  0  0  0
 59 58  1  0  0  0  0
 60 59  1  0  0  0  0
 61 60  2  0  0  0  0
 62 60  1  0  0  0  0
 63 62  1  0  0  0  0
 64 63  1  0  0  0  0
 65 64  2  0  0  0  0
 66 64  1  0  0  0  0
 67 66  1  0  0  0  0
 68 67  1  0  0  0  0
 69 68  2  0  0  0  0
 70 68  1  0  0  0  0
 71 70  1  0  0  0  0
 72 71  1  0  0  0  0
 73 72  2  0  0  0  0
 74 72  1  1  0  0  0
 75 74  1  0  0  0  0
 76 75  1  0  0  0  0
 77 76  1  0  0  0  0
 78 77  1  0  0  0  0
 78 74  1  0  0  0  0
 79 78  1  0  0  0  0
 80 79  2  0  0  0  0
 81 79  1  0  0  0  0
 82 81  1  0  0  0  0
 83 82  1  0  0  0  0
 84 83  1  0  0  0  0
 85 84  1  0  0  0  0
 86 85  1  0  0  0  0
 87 86  1  0  0  0  0
 88 86  2  0  0  0  0
 81 89  1  1  0  0  0
 90 89  1  0  0  0  0
 91 90  2  0  0  0  0
 92 90  1  6  0  0  0
 93 92  1  0  0  0  0
 94 93  1  0  0  0  0
 95 94  1  0  0  0  0
 96 95  1  0  0  0  0
 96 92  1  0  0  0  0
 97 96  1  0  0  0  0
 98 97  2  0  0  0  0
 99 97  1  0  0  0  0
 99100  1  6  0  0  0
101 99  1  0  0  0  0
102101  1  0  0  0  0
103102  2  0  0  0  0
104103  1  0  0  0  0
105104  2  0  0  0  0
106105  1  0  0  0  0
107106  2  0  0  0  0
107102  1  0  0  0  0
108  5  1  0  0  0  0
109108  2  0  0  0  0
110108  1  0  0  0  0
111110  1  0  0  0  0
112111  1  0  0  0  0
113112  1  0  0  0  0
114113  1  0  0  0  0
114110  1  0  0  0  0
114115  1  1  0  0  0
116115  2  0  0  0  0
117115  1  0  0  0  0
118117  1  6  0  0  0
119118  1  0  0  0  0
120119  1  0  0  0  0
121120  1  0  0  0  0
122121  1  0  0  0  0
123121  2  0  0  0  0
124118  1  0  0  0  0
125124  2  0  0  0  0
126124  1  0  0  0  0
127126  1  6  0  0  0
128127  1  0  0  0  0
129128  1  0  0  0  0
130129  1  0  0  0  0
131130  1  0  0  0  0
132130  2  0  0  0  0
133127  1  0  0  0  0
134133  2  0  0  0  0
135133  1  0  0  0  0
136135  1  1  0  0  0
137136  1  0  0  0  0
138137  1  0  0  0  0
139138  2  0  0  0  0
140139  1  0  0  0  0
141140  2  0  0  0  0
142141  1  0  0  0  0
143141  1  0  0  0  0
144143  2  0  0  0  0
144138  1  0  0  0  0
145136  1  0  0  0  0
146145  2  0  0  0  0
147145  1  0  0  0  0
148147  1  1  0  0  0
149148  1  0  0  0  0
150149  1  0  0  0  0
151150  1  0  0  0  0
152150  1  0  0  0  0
153148  1  0  0  0  0
154153  1  0  0  0  0
155153  2  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="381.26373571011" x2="381.26373571011" y1="387.80389263265" y2="393.67251184273" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="381.26373571011" x2="381.26373571011" y1="393.67251184273" y2="399.54113105281" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="391.42818418196" x2="386.34595994604" y1="381.93527342258" y2="384.86958302761" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="386.34595994604" x2="381.26373571011" y1="384.86958302761" y2="387.80389263265" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 392,382 401,390 403,387" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="391.42818418196" x2="391.42818418196" y1="370.19803500242" y2="376.0666542125" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="391.42818418196" x2="391.42818418196" y1="376.0666542125" y2="381.93527342258" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 392,371 383,363 381,366" fill-opacity="1"  style="fill:#000000" />
<line x1="381.26373571011" x2="381.26373571011" y1="352.59217737218" y2="358.46079658226" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="381.26373571011" x2="381.26373571011" y1="358.46079658226" y2="364.32941579234" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="392" x2="386.5" y1="347" y2="350" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="386.5" x2="381" y1="350" y2="353" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="392" x2="387" y1="348" y2="351" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="387" x2="382" y1="351" y2="354" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="371.09844886408" x2="376.18109228709" y1="346.7235581621" y2="349.65786776714" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="376.18109228709" x2="381.26373571011" y1="349.65786776714" y2="352.59217737218" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="360.93400039222" x2="366.01622462815" y1="352.59217737218" y2="349.65786776714" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="366.01622462815" x2="371.09844886408" y1="349.65786776714" y2="346.7235581621" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="360.93400039222" x2="360.93400039222" y1="364.32941579234" y2="358.46079658226" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="360.93400039222" x2="360.93400039222" y1="358.46079658226" y2="352.59217737218" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="350.76955192037" x2="355.85177615629" y1="370.19803500242" y2="367.26372539738" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="355.85177615629" x2="360.93400039222" y1="367.26372539738" y2="364.32941579234" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="340.60426507434" x2="345.68690849735" y1="364.32941579234" y2="367.26372539738" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="345.68690849735" x2="350.76955192037" y1="367.26372539738" y2="370.19803500242" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="352" x2="352" y1="382" y2="376.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="352" x2="352" y1="376.5" y2="371" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="351" x2="351" y1="382" y2="376.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="351" x2="351" y1="376.5" y2="371" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 372,347 373,335 370,335" fill-opacity="1"  style="fill:#000000" />
<line x1="360.93400039222" x2="366.01622462815" y1="329.11770053187" y2="332.05201013691" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="366.01622462815" x2="371.09844886408" y1="332.05201013691" y2="334.98631974195" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="352" x2="357" y1="336" y2="333" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="357" x2="362" y1="333" y2="330" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="351" x2="356" y1="335" y2="332" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="356" x2="361" y1="332" y2="329" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="360.93400039222" x2="360.93400039222" y1="317.38046211171" y2="323.24908132179" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="360.93400039222" x2="360.93400039222" y1="323.24908132179" y2="329.11770053187" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="371.09844886408" x2="366.01622462815" y1="311.51184290163" y2="314.44615250667" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="366.01622462815" x2="360.93400039222" y1="314.44615250667" y2="317.38046211171" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="371.09844886408" x2="371.09844886408" y1="299.77460448147" y2="305.64322369155" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="371.09844886408" x2="371.09844886408" y1="305.64322369155" y2="311.51184290163" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="381.26373571011" x2="376.18109228709" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="376.18109228709" x2="371.09844886408" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="391.42818418196" x2="386.34595994604" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="386.34595994604" x2="381.26373571011" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="381" x2="381" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="381" x2="381" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="382" x2="382" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="382" x2="382" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 361,318 352,310 350,314" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="350.76955192037" x2="350.76955192037" y1="299.77460448147" y2="305.64322369155" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="350.76955192037" x2="350.76955192037" y1="305.64322369155" y2="311.51184290163" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="361" x2="356" y1="294" y2="297" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="356" x2="351" y1="297" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="362" x2="357" y1="295" y2="298" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="357" x2="352" y1="298" y2="301" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="340.60426507434" x2="345.68690849735" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="345.68690849735" x2="350.76955192037" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="340.60426507434" x2="340.60426507434" y1="282.16874685124" y2="288.03736606132" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="340.60426507434" x2="340.60426507434" y1="288.03736606132" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="350.76955192037" x2="345.68690849735" y1="276.30012764116" y2="279.2344372462" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="345.68690849735" x2="340.60426507434" y1="279.2344372462" y2="282.16874685124" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="351" x2="351" y1="265" y2="271" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="351" x2="351" y1="271" y2="277" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="352" x2="352" y1="265" y2="271" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="352" x2="352" y1="271" y2="277" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="360.93400039222" x2="355.85177615629" y1="258.69427001092" y2="261.62857961596" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="355.85177615629" x2="350.76955192037" y1="261.62857961596" y2="264.562889221" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="372" x2="367" y1="265" y2="262" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="367" x2="362" y1="262" y2="259" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="371" x2="366" y1="266" y2="263" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="366" x2="361" y1="263" y2="260" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="371.09844886408" x2="371.09844886408" y1="276.30012764116" y2="270.43150843108" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="371.09844886408" x2="371.09844886408" y1="270.43150843108" y2="264.562889221" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="362" x2="367" y1="283" y2="280" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="367" x2="372" y1="280" y2="277" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="361" x2="366" y1="282" y2="279" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="366" x2="371" y1="279" y2="276" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="360.93400039222" x2="355.85177615629" y1="282.16874685124" y2="279.2344372462" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="355.85177615629" x2="350.76955192037" y1="279.2344372462" y2="276.30012764116" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 341,294 330,299 332,302" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="320.27452975645" x2="325.35717317947" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="325.35717317947" x2="330.43981660248" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="320" x2="320" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="320" x2="320" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="321" x2="321" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="321" x2="321" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="310.11008128459" x2="315.19230552052" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="315.19230552052" x2="320.27452975645" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="310.11008128459" x2="310.11008128459" y1="311.51184290163" y2="305.64322369155" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="310.11008128459" x2="310.11008128459" y1="305.64322369155" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="320.27452975645" x2="315.19230552052" y1="317.38046211171" y2="314.44615250667" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="315.19230552052" x2="310.11008128459" y1="314.44615250667" y2="311.51184290163" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="330.43981660248" x2="325.35717317947" y1="311.51184290163" y2="314.44615250667" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="325.35717317947" x2="320.27452975645" y1="314.44615250667" y2="317.38046211171" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="321" x2="321" y1="330" y2="324" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="321" x2="321" y1="324" y2="318" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="320" x2="320" y1="330" y2="324" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="320" x2="320" y1="324" y2="318" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 311,300 301,293 300,296" fill-opacity="1"  style="fill:#000000" />
<line x1="289.78034596671" x2="294.86298938972" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="294.86298938972" x2="299.94563281274" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="291" x2="291" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="291" x2="291" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="290" x2="290" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="290" x2="290" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="279.61589749485" x2="284.69812173078" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="284.69812173078" x2="289.78034596671" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="269.45061064882" x2="274.53325407184" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="274.53325407184" x2="279.61589749485" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="259.28616217697" x2="264.36838641289" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="264.36838641289" x2="269.45061064882" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="259" x2="259" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="259" x2="259" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="260" x2="260" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="260" x2="260" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="249.12171370511" x2="254.20393794104" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="254.20393794104" x2="259.28616217697" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="249.12171370511" x2="249.12171370511" y1="311.51184290163" y2="305.64322369155" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="249.12171370511" x2="249.12171370511" y1="305.64322369155" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="259.28616217697" x2="254.20393794104" y1="317.38046211171" y2="314.44615250667" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="254.20393794104" x2="249.12171370511" y1="314.44615250667" y2="311.51184290163" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="269.45061064882" x2="264.36838641289" y1="311.51184290163" y2="314.44615250667" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="264.36838641289" x2="259.28616217697" y1="314.44615250667" y2="317.38046211171" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="260" x2="260" y1="330" y2="324" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="260" x2="260" y1="324" y2="318" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="259" x2="259" y1="330" y2="324" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="259" x2="259" y1="324" y2="318" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 250,300 240,293 239,296" fill-opacity="1"  style="fill:#000000" />
<line x1="228.79197838722" x2="233.87420262315" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="233.87420262315" x2="238.95642685908" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="230" x2="230" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="230" x2="230" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="229" x2="229" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="229" x2="229" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="218.62752991537" x2="223.7097541513" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="223.7097541513" x2="228.79197838722" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="208.46224306934" x2="213.54488649235" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="213.54488649235" x2="218.62752991537" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="198.29779459748" x2="203.38001883341" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="203.38001883341" x2="208.46224306934" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="198" x2="198" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="198" x2="198" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="199" x2="199" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="199" x2="199" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="188.13250775145" x2="193.21515117447" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="193.21515117447" x2="198.29779459748" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="177.9680592796" x2="183.05028351552" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="183.05028351552" x2="188.13250775145" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="167.80361080774" x2="172.88583504367" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="172.88583504367" x2="177.9680592796" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="169" x2="169" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="169" x2="169" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="168" x2="168" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="168" x2="168" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="157.63832396171" x2="162.72096738473" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="162.72096738473" x2="167.80361080774" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="147.47387548985" x2="152.55609972578" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="152.55609972578" x2="157.63832396171" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="137.309427018" x2="142.39165125393" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="142.39165125393" x2="147.47387548985" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="137" x2="137" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="137" x2="137" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="138" x2="138" y1="283" y2="288.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="138" x2="138" y1="288.5" y2="294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="127.14414017197" x2="132.22678359498" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="132.22678359498" x2="137.309427018" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="116.97969170011" x2="122.06191593604" y1="293.90598527139" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="122.06191593604" x2="127.14414017197" y1="296.84029487643" y2="299.77460448147" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="106.81440485408" x2="111.8970482771" y1="299.77460448147" y2="296.84029487643" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="111.8970482771" x2="116.97969170011" y1="296.84029487643" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="108" x2="108" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="108" x2="108" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="107" x2="107" y1="312" y2="306" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="107" x2="107" y1="306" y2="300" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 97,294 106,302 108,299" fill-opacity="1"  style="fill:#000000" />
<line x1="85.927989085413" x2="91.28897273382" y1="298.67968781171" y2="296.29283654155" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="91.28897273382" x2="96.649956382227" y1="296.29283654155" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="78.074099833982" x2="82.001044459698" y1="289.95724291718" y2="294.31846536445" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="82.001044459698" x2="85.927989085413" y1="294.31846536445" y2="298.67968781171" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="83.942719044061" x2="81.008409439021" y1="279.79195607115" y2="284.87459949417" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="81.008409439021" x2="78.074099833982" y1="284.87459949417" y2="289.95724291718" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="95.42341496732" x2="89.683067005691" y1="282.23246328837" y2="281.01220967976" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="89.683067005691" x2="83.942719044061" y1="281.01220967976" y2="279.79195607115" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="95.42341496732" x2="96.036685674774" y1="282.23246328837" y2="288.06922427988" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="96.036685674774" x2="96.649956382227" y1="288.06922427988" y2="293.90598527139" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="104.14585986184" x2="99.784637414582" y1="274.37857403694" y2="278.30551866266" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="99.784637414582" x2="95.42341496732" y1="278.30551866266" y2="282.23246328837" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="116" x2="110.5" y1="278" y2="276" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="110.5" x2="105" y1="276" y2="274" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="116" x2="110" y1="279" y2="277" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="110" x2="104" y1="277" y2="275" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="101.70535264462" x2="102.92560625323" y1="262.89787811368" y2="268.63822607531" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="102.92560625323" x2="104.14585986184" y1="268.63822607531" y2="274.37857403694" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="90.543238907054" x2="96.124295775838" y1="259.27107144185" y2="261.08447477777" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="96.124295775838" x2="101.70535264462" y1="261.08447477777" y2="262.89787811368" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="81.820794012531" x2="86.182016459792" y1="267.12496069329" y2="263.19801606757" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="86.182016459792" x2="90.543238907054" y1="263.19801606757" y2="259.27107144185" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="70.657841900788" x2="76.23931795666" y1="263.49731564728" y2="265.31113817029" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="76.23931795666" x2="81.820794012531" y1="265.31113817029" y2="267.12496069329" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="61.935397006265" x2="66.296619453527" y1="271.35120489872" y2="267.424260273" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="66.296619453527" x2="70.657841900788" y1="267.424260273" y2="263.49731564728" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="50.772444894523" x2="56.353920950394" y1="267.72439822689" y2="269.5378015628" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="56.353920950394" x2="61.935397006265" y1="269.5378015628" y2="271.35120489872" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="42.05" x2="46.411222447261" y1="275.57828747832" y2="271.6513428526" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="46.411222447261" x2="50.772444894523" y1="271.6513428526" y2="267.72439822689" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="48" x2="49.5" y1="257" y2="262.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="49.5" x2="51" y1="262.5" y2="268" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="49" x2="50.5" y1="257" y2="262.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="50.5" x2="52" y1="262.5" y2="268" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 102,263 112,257 110,254" fill-opacity="1"  style="fill:#000000" />
<line x1="121.59074965089" x2="116.00927359502" y1="258.67163390825" y2="256.85781138525" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="116.00927359502" x2="110.42779753915" y1="256.85781138525" y2="255.04398886225" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="125" x2="124" y1="271" y2="265" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="124" x2="123" y1="265" y2="259" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="124" x2="122.5" y1="271" y2="265" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="122.5" x2="121" y1="265" y2="259" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 131,251 121,258 123,260" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="141.79389046867" x2="136.05354250704" y1="253.25825187404" y2="252.03799826543" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="136.05354250704" x2="130.31319454541" y1="252.03799826543" y2="250.81774465682" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="147.66250967875" x2="144.72820007371" y1="243.09380340219" y2="248.17602763811" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="144.72820007371" x2="141.79389046867" y1="248.17602763811" y2="253.25825187404" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="139.80862042732" x2="143.73556505303" y1="234.37052013349" y2="238.73216176784" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="143.73556505303" x2="147.66250967875" y1="238.73216176784" y2="243.09380340219" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="129.08665313051" x2="134.44763677891" y1="239.14506104798" y2="236.75779059073" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="134.44763677891" x2="139.80862042732" y1="236.75779059073" y2="234.37052013349" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="129.08665313051" x2="129.69992383796" y1="239.14506104798" y2="244.9814028524" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="129.69992383796" x2="130.31319454541" y1="244.9814028524" y2="250.81774465682" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="118.92136628448" x2="124.00400970749" y1="233.2764418379" y2="236.21075144294" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="124.00400970749" x2="129.08665313051" y1="236.21075144294" y2="239.14506104798" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="110" x2="115" y1="240" y2="237" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="115" x2="120" y1="237" y2="234" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="109" x2="114" y1="239" y2="236" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="114" x2="119" y1="236" y2="233" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="118.92136628448" x2="118.92136628448" y1="221.53920341774" y2="227.40782262782" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="118.92136628448" x2="118.92136628448" y1="227.40782262782" y2="233.2764418379" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 119,222 130,218 129,215" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="108.75691781262" x2="113.83914204855" y1="215.67058420766" y2="218.6048938127" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="113.83914204855" x2="118.92136628448" y1="218.6048938127" y2="221.53920341774" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="108.75691781262" x2="108.75691781262" y1="203.9333457875" y2="209.80196499758" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="108.75691781262" x2="108.75691781262" y1="209.80196499758" y2="215.67058420766" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="99" x2="104" y1="199" y2="202" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="104" x2="109" y1="202" y2="205" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="99" x2="104.5" y1="198" y2="201" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="104.5" x2="110" y1="201" y2="204" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="98.592469340763" x2="98.592469340763" y1="186.32748815727" y2="192.19610736735" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="98.592469340763" x2="98.592469340763" y1="192.19610736735" y2="198.06472657742" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="109" x2="104" y1="180" y2="183" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="104" x2="99" y1="183" y2="186" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="110" x2="104.5" y1="181" y2="184" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="104.5" x2="99" y1="184" y2="187" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="118.92136628448" x2="113.83914204855" y1="186.32748815727" y2="183.39317855223" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="113.83914204855" x2="108.75691781262" y1="183.39317855223" y2="180.45886894719" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="120" x2="120" y1="199" y2="193" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="120" x2="120" y1="193" y2="187" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="119" x2="119" y1="199" y2="193" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="119" x2="119" y1="193" y2="187" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="118.92136628448" x2="113.83914204855" y1="198.06472657742" y2="200.99903618246" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="113.83914204855" x2="108.75691781262" y1="200.99903618246" y2="203.9333457875" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="401.59263265382" x2="396.51040841789" y1="364.32941579234" y2="367.26372539738" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="396.51040841789" x2="391.42818418196" y1="367.26372539738" y2="370.19803500242" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="401" x2="401" y1="353" y2="359" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="401" x2="401" y1="359" y2="365" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="403" x2="403" y1="353" y2="359" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="403" x2="403" y1="359" y2="365" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="411.75791949985" x2="406.67527607683" y1="370.19803500242" y2="367.26372539738" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="406.67527607683" x2="401.59263265382" y1="367.26372539738" y2="364.32941579234" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="412.98446091476" x2="412.3711902073" y1="381.87071861126" y2="376.03437680684" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="412.3711902073" x2="411.75791949985" y1="376.03437680684" y2="370.19803500242" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="424.46515683802" x2="418.72480887639" y1="384.31122582848" y2="383.09097221987" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="418.72480887639" x2="412.98446091476" y1="383.09097221987" y2="381.87071861126" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="430.33377604809" x2="427.39946644306" y1="374.14593898245" y2="379.22858240547" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="427.39946644306" x2="424.46515683802" y1="379.22858240547" y2="384.31122582848" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="422.47988679666" x2="426.40683142238" y1="365.42349408793" y2="369.78471653519" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="426.40683142238" x2="430.33377604809" y1="369.78471653519" y2="374.14593898245" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="422.47988679666" x2="417.11890314826" y1="365.42349408793" y2="367.81076454517" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="417.11890314826" x2="411.75791949985" y1="367.81076454517" y2="370.19803500242" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<polygon points=" 423,366 427,355 424,354" fill-opacity="1"  style="fill:#000000" />
<line x1="416" x2="420.5" y1="347" y2="351" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="420.5" x2="425" y1="351" y2="355" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="417" x2="421.5" y1="346" y2="350" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="421.5" x2="426" y1="350" y2="354" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="436.08334612563" x2="430.50187006975" y1="350.31599149284" y2="352.12981401584" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="430.50187006975" x2="424.92039401388" y1="352.12981401584" y2="353.94363653885" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 439,339 435,350 438,351" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="429.80140844832" x2="434.1622117085" y1="330.98140631815" y2="334.90835094387" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="434.1622117085" x2="438.52301496867" y1="334.90835094387" y2="338.83529556958" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="418.63845633658" x2="424.21993239245" y1="334.60905136415" y2="332.79522884115" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="424.21993239245" x2="429.80140844832" y1="332.79522884115" y2="330.98140631815" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="409.91601144206" x2="414.27723388932" y1="326.75516211272" y2="330.68210673844" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="414.27723388932" x2="418.63845633658" y1="330.68210673844" y2="334.60905136415" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="398.75305933032" x2="404.33453538619" y1="330.38196878455" y2="328.56856544864" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="404.33453538619" x2="409.91601144206" y1="328.56856544864" y2="326.75516211272" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="412" x2="411" y1="316" y2="321.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="411" x2="410" y1="321.5" y2="327" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="413" x2="412" y1="316" y2="321.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="412" x2="411" y1="321.5" y2="327" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="449.68596708042" x2="444.10449102454" y1="335.20848889776" y2="337.02189223367" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="444.10449102454" x2="438.52301496867" y1="337.02189223367" y2="338.83529556958" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="459" x2="455" y1="343" y2="339" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="455" x2="451" y1="339" y2="335" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="458" x2="454" y1="344" y2="340" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="454" x2="450" y1="340" y2="336" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="452.12647429764" x2="450.90622068903" y1="323.7277929745" y2="329.46814093613" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="450.90622068903" x2="449.68596708042" y1="329.46814093613" y2="335.20848889776" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 464,321 452,323 453,326" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="465.7299336266" x2="464.50968001799" y1="308.61945200523" y2="314.36021915395" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="464.50968001799" x2="463.28942640938" y1="314.36021915395" y2="320.10098630267" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="476.89288573834" x2="471.31140968247" y1="304.99264533341" y2="306.80604866932" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="471.31140968247" x2="465.7299336266" y1="306.80604866932" y2="308.61945200523" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="479.33339295556" x2="478.11313934695" y1="293.51194941015" y2="299.25229737178" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="478.11313934695" x2="476.89288573834" y1="299.25229737178" y2="304.99264533341" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="470.61094806104" x2="474.9721705083" y1="285.65806015871" y2="289.58500478443" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="474.9721705083" x2="479.33339295556" y1="289.58500478443" y2="293.51194941015" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="491" x2="485.5" y1="290" y2="291.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="485.5" x2="480" y1="291.5" y2="293" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="491" x2="485.5" y1="291" y2="293" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="485.5" x2="480" y1="293" y2="295" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="472.0118713039" x2="467.65064885664" y1="327.9548755541" y2="324.02793092838" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="467.65064885664" x2="463.28942640938" y1="324.02793092838" y2="320.10098630267" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="483" x2="477.5" y1="324" y2="326" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="477.5" x2="472" y1="326" y2="328" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="484" x2="478.5" y1="325" y2="327" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="478.5" x2="473" y1="327" y2="329" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="469.57136408668" x2="470.79161769529" y1="339.43557147736" y2="333.69522351573" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="470.79161769529" x2="472.0118713039" y1="333.69522351573" y2="327.9548755541" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 479,348 471,339 469,341" fill-opacity="1"  style="fill:#000000" />
<line x1="475.85414013816" x2="477.07397455968" y1="358.76931827788" y2="353.02897031625" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="477.07397455968" x2="478.2938089812" y1="353.02897031625" y2="347.28862235462" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="484.57658503268" x2="480.21536258542" y1="366.62320752931" y2="362.69626290359" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="480.21536258542" x2="475.85414013816" y1="362.69626290359" y2="358.76931827788" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="483" x2="484.5" y1="379" y2="373" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="484.5" x2="486" y1="373" y2="367" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="482" x2="483" y1="378" y2="372.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="483" x2="484" y1="372.5" y2="367" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="490.85852270998" x2="486.49730026272" y1="385.957792704" y2="382.03084807828" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="486.49730026272" x2="482.13607781546" y1="382.03084807828" y2="378.10390345257" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="502" x2="496.5" y1="382" y2="384" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="496.5" x2="491" y1="384" y2="386" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="503" x2="497.5" y1="383" y2="385" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="497.5" x2="492" y1="385" y2="387" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="510.74308134207" x2="506.3822780819" y1="390.1848752836" y2="386.25793065788" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="506.3822780819" x2="502.02147482173" y1="386.25793065788" y2="382.33098603217" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="504.46198203894" x2="503.24172843033" y1="370.85029010891" y2="376.59063807054" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="503.24172843033" x2="502.02147482173" y1="376.59063807054" y2="382.33098603217" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="496" x2="500.5" y1="364" y2="368" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="500.5" x2="505" y1="368" y2="372" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="497" x2="501" y1="363" y2="367" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="501" x2="505" y1="367" y2="371" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="495.73953714442" x2="490.15806108855" y1="362.99640085748" y2="364.80980419339" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="490.15806108855" x2="484.57658503268" y1="364.80980419339" y2="366.62320752931" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="489.45676109295" x2="483.87528503708" y1="343.66181568279" y2="345.4752190187" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="483.87528503708" x2="478.2938089812" y1="345.4752190187" y2="347.28862235462" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="492" x2="490.5" y1="333" y2="338.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="490.5" x2="489" y1="338.5" y2="344" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="493" x2="492" y1="333" y2="338.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="492" x2="491" y1="338.5" y2="344" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="498.17920598747" x2="493.81798354021" y1="351.51486656005" y2="347.58834112142" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #0000ff" />
<line x1="493.81798354021" x2="489.45676109295" y1="347.58834112142" y2="343.66181568279" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<polygon points=" 510,348 498,350 499,354" fill-opacity="1"  style="fill:#000000" />
<line x1="518.06460299373" x2="513.70338054647" y1="355.74194913965" y2="351.81500451393" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="513.70338054647" x2="509.34215809921" y1="351.81500451393" y2="347.88805988822" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="529.22755510548" x2="523.64607904961" y1="352.11514246782" y2="353.92854580373" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="523.64607904961" x2="518.06460299373" y1="353.92854580373" y2="355.74194913965" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="531.6680623227" x2="530.44780871409" y1="340.63444654456" y2="346.37479450619" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="530.44780871409" x2="529.22755510548" y1="346.37479450619" y2="352.11514246782" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="537.95" x2="533.58877755274" y1="359.96903171925" y2="356.04208709353" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="533.58877755274" x2="529.22755510548" y1="356.04208709353" y2="352.11514246782" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="511.78266531643" x2="510.56241170782" y1="336.40820233913" y2="342.14813111367" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="510.56241170782" x2="509.34215809921" y1="342.14813111367" y2="347.88805988822" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="503.06022042191" x2="507.42144286917" y1="328.5543130877" y2="332.48125771341" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="507.42144286917" x2="511.78266531643" y1="332.48125771341" y2="336.40820233913" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="523" x2="517.5" y1="333" y2="334.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="517.5" x2="512" y1="334.5" y2="336" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<line x1="524" x2="518" y1="334" y2="335.5" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #ff0000" />
<line x1="518" x2="512" y1="335.5" y2="337" style="stroke-opacity:1; stroke-width: 0.4941985802594; stroke: #000000" />
<ellipse cx="381.26373571011" cy="364.32941579234" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="381.26373571011" y="367.04750798377"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="391.42818418196" cy="346.7235581621" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="391.42818418196" y="349.44165035353"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="340.60426507434" cy="364.32941579234" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="340.60426507434" y="367.04750798377"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="350.76955192037" cy="381.93527342258" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="350.76955192037" y="384.653365614"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="371.09844886408" cy="334.98631974195" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="371.09844886408" y="337.70441193337"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="350.76955192037" cy="334.98631974195" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="350.76955192037" y="337.70441193337"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="391.42818418196" cy="299.77460448147" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="391.42818418196" y="302.4926966729"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="381.26373571011" cy="282.16874685124" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="381.26373571011" y="284.88683904266"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="350.76955192037" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="350.76955192037" y="314.22993509306"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="360.93400039222" cy="293.90598527139" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="360.93400039222" y="296.62407746282"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="330.43981660248" cy="299.77460448147" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="330.43981660248" y="302.4926966729"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="320.27452975645" cy="282.16874685124" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.27452975645" y="284.88683904266"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="330.43981660248" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="330.43981660248" y="314.22993509306"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="320.27452975645" cy="329.11770053187" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.27452975645" y="331.83579272329"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="299.94563281274" cy="293.90598527139" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="299.94563281274" y="296.62407746282"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="289.78034596671" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="289.78034596671" y="314.22993509306"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="269.45061064882" cy="299.77460448147" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="269.45061064882" y="302.4926966729"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="259.28616217697" cy="282.16874685124" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="259.28616217697" y="284.88683904266"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="269.45061064882" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="269.45061064882" y="314.22993509306"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="259.28616217697" cy="329.11770053187" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="259.28616217697" y="331.83579272329"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="238.95642685908" cy="293.90598527139" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="238.95642685908" y="296.62407746282"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="228.79197838722" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="228.79197838722" y="314.22993509306"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="208.46224306934" cy="299.77460448147" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="208.46224306934" y="302.4926966729"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="198.29779459748" cy="282.16874685124" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="198.29779459748" y="284.88683904266"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="177.9680592796" cy="293.90598527139" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.9680592796" y="296.62407746282"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="167.80361080774" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="167.80361080774" y="314.22993509306"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="147.47387548985" cy="299.77460448147" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="147.47387548985" y="302.4926966729"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="137.309427018" cy="282.16874685124" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="137.309427018" y="284.88683904266"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="116.97969170011" cy="293.90598527139" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="116.97969170011" y="296.62407746282"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="106.81440485408" cy="311.51184290163" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="106.81440485408" y="314.22993509306"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="95.42341496732" cy="282.23246328837" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="95.42341496732" y="284.9505554798"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="115.30881197359" cy="278.00538070877" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="115.30881197359" y="280.7234729002"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="61.935397006265" cy="271.35120489872" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="61.935397006265" y="274.06929709014"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="42.05" cy="275.57828747832" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="278.29637966974"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="48.331937677303" cy="256.24370230363" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="48.331937677303" y="258.96179449505"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="110.42779753915" cy="255.04398886225" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="110.42779753915" y="257.76208105368"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="124.03041849394" cy="270.15232983151" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="124.03041849394" y="272.87042202294"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="129.08665313051" cy="239.14506104798" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="129.08665313051" y="241.8631532394"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="108.75691781262" cy="239.14506104798" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="108.75691781262" y="241.8631532394"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="129.08665313051" cy="215.67058420766" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="129.08665313051" y="218.38867639909"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="401.59263265382" cy="352.59217737218" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="401.59263265382" y="355.31026956361"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="411.75791949985" cy="370.19803500242" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="411.75791949985" y="372.91612719384"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="416.19794911936" cy="346.08974728741" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="416.19794911936" y="348.80783947884"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="436.08334612563" cy="350.31599149284" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="436.08334612563" y="353.03408368427"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="398.75305933032" cy="330.38196878455" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="398.75305933032" y="333.10006097598"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="412.35651865928" cy="315.27362781529" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="412.35651865928" y="317.99172000672"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="458.40841197494" cy="343.06237814919" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="458.40841197494" y="345.78047034061"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="452.12647429764" cy="323.7277929745" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="452.12647429764" y="326.44588516592"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="470.61094806104" cy="285.65806015871" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="470.61094806104" y="288.37615235014"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="490.4963450673" cy="289.88514273832" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="490.4963450673" y="292.60323492974"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="483.17482341564" cy="324.3272305081" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="483.17482341564" y="327.04532269952"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="469.57136408668" cy="339.43557147736" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="469.57136408668" y="342.15366366878"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="510.74308134207" cy="390.1848752836" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="510.74308134207" y="392.90296747503"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="491.89726831017" cy="332.18111975953" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="491.89726831017" y="334.89921195095"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="498.17920598747" cy="351.51486656005" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="498.17920598747" y="354.23295875147"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">N</text>
<ellipse cx="503.06022042191" cy="328.5543130877" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="503.06022042191" y="331.27240527913"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
<ellipse cx="522.94561742817" cy="332.7813956673" rx="3.2122907716861" ry="3.2122907716861" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="522.94561742817" y="335.49948785873"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:6.1774822532425px">O</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 113👍, 0💬