Collections:
Molecule FYI-1001213
Molecule Summary:
ID: FYI-1001213
SMILES: C1CN=C(N1)NC2=C(C=CC=C2Cl)Cl
Received at FYIcenter.com on: 2022-03-18
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1001213 FYIcenter.com 23 24 0 0 0 0 0 0 0 0999 V2000 5.6808 2.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1808 1.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5116 0.6386 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.5981 1.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7026 2.0398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 0.5453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 -0.4547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 -0.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8660 -1.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 -2.4547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5981 -1.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5981 -0.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4641 -0.4547 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 -0.4547 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 6.2472 2.4999 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4892 2.8374 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5956 0.9210 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6823 1.7461 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2419 2.4547 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1951 0.8553 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3291 -2.2647 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 -3.0747 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1350 -2.2647 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 2 0 0 0 0 4 5 1 0 0 0 0 1 5 1 0 0 0 0 4 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 2 0 0 0 0 8 9 1 0 0 0 0 9 10 2 0 0 0 0 10 11 1 0 0 0 0 11 12 2 0 0 0 0 7 12 1 0 0 0 0 12 13 1 0 0 0 0 8 14 1 0 0 0 0 1 15 1 0 0 0 0 1 16 1 0 0 0 0 2 17 1 0 0 0 0 2 18 1 0 0 0 0 5 19 1 0 0 0 0 6 20 1 0 0 0 0 9 21 1 0 0 0 0 10 22 1 0 0 0 0 11 23 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="402.36826762064" x2="423.33797381641" y1="488.48665702542" y2="452.16712589435" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="423.33797381641" x2="444.30768001218" y1="452.16712589435" y2="415.84759476328" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="444.30768001218" x2="416.24182523976" y1="415.84759476328" y2="384.68241741513" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="416.24182523976" x2="388.17597046735" y1="384.68241741513" y2="353.51724006698" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" /> <line x1="387" x2="348.5" y1="350" y2="367" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" /> <line x1="348.5" x2="310" y1="367" y2="384" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="390" x2="352" y1="358" y2="375" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" /> <line x1="352" x2="314" y1="375" y2="392" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="311.55266402801" x2="315.93533262293" y1="387.63075810626" y2="429.33950372964" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="315.93533262293" x2="320.31800121784" y1="429.33950372964" y2="471.04824935302" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" /> <line x1="402.36826762064" x2="361.34313441924" y1="488.48665702542" y2="479.76745318922" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="361.34313441924" x2="320.31800121784" y1="479.76745318922" y2="471.04824935302" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" /> <line x1="311.55266402801" x2="275.23313289694" y1="387.63075810626" y2="366.66105191049" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="275.23313289694" x2="238.91360176587" y1="366.66105191049" y2="345.69134571472" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" /> <line x1="238.91360176587" x2="238.91360176587" y1="345.69134571472" y2="303.75193332318" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" /> <line x1="238.91360176587" x2="238.91360176587" y1="303.75193332318" y2="261.81252093165" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="242" x2="205.5" y1="258" y2="237.5" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="205.5" x2="169" y1="237.5" y2="217" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="237" x2="201" y1="266" y2="245" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="201" x2="165" y1="245" y2="224" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="166.26615162125" x2="166.26615162125" y1="219.87310854011" y2="177.93369614858" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="166.26615162125" x2="166.26615162125" y1="177.93369614858" y2="135.99428375704" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="169" x2="205.5" y1="140" y2="119" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="205.5" x2="242" y1="119" y2="98" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="165" x2="201" y1="133" y2="112" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="201" x2="237" y1="112" y2="91" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="238.91360176587" x2="275.23313289694" y1="94.054871365505" y2="115.02457756127" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="275.23313289694" x2="311.55266402801" y1="115.02457756127" y2="135.99428375704" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="308" x2="308" y1="136" y2="178" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="308" x2="308" y1="178" y2="220" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="316" x2="316" y1="136" y2="178" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="316" x2="316" y1="178" y2="220" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="238.91360176587" x2="275.23313289694" y1="261.81252093165" y2="240.84281473588" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="275.23313289694" x2="311.55266402801" y1="240.84281473588" y2="219.87310854011" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="311.55266402801" x2="347.87219515908" y1="219.87310854011" y2="240.84281473588" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="347.87219515908" x2="384.19172629015" y1="240.84281473588" y2="261.81252093165" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #00bc00" /> <line x1="166.26615162125" x2="129.94662049018" y1="219.87310854011" y2="240.84281473588" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" /> <line x1="129.94662049018" x2="93.627089359111" y1="240.84281473588" y2="261.81252093165" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #00bc00" /> <line x1="320.31800121784" x2="300.99651392906" y1="471.04824935302" y2="488.44891155427" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" /> <line x1="300.99651392906" x2="281.67502664028" y1="488.44891155427" y2="505.84957375552" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #a4a4a4" /> <line x1="238.91360176587" x2="216.39213731162" y1="345.69134571472" y2="358.6925635561" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" /> <line x1="216.39213731162" x2="193.87067285736" y1="358.6925635561" y2="371.69378139747" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #a4a4a4" /> <ellipse cx="388.17597046735" cy="353.51724006698" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="388.17597046735" y="372.94198540702" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:44.147148500079px">N</text> <ellipse cx="320.31800121784" cy="471.04824935302" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.31800121784" y="490.47299469306" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:44.147148500079px">N</text> <ellipse cx="238.91360176587" cy="345.69134571472" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="238.91360176587" y="365.11609105476" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:44.147148500079px">N</text> <ellipse cx="384.19172629015" cy="261.81252093165" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="384.19172629015" y="281.23726627168" fill="#00bc00" style="text-anchor:middle; font-family:sans-serif;font-size:44.147148500079px">Cl</text> <ellipse cx="93.627089359111" cy="261.81252093165" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="93.627089359111" y="281.23726627168" fill="#00bc00" style="text-anchor:middle; font-family:sans-serif;font-size:44.147148500079px">Cl</text> <ellipse cx="281.67502664028" cy="505.84957375552" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="281.67502664028" y="525.27431909555" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:44.147148500079px">H</text> <ellipse cx="193.87067285736" cy="371.69378139747" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="193.87067285736" y="391.11852673751" fill="#a4a4a4" style="text-anchor:middle; font-family:sans-serif;font-size:44.147148500079px">H</text> </g></svg>
✍: FYIcenter.com
2022-04-21, 117👍, 0💬
Popular Posts:
Where to find FAQ (Frequently Asked Questions) in understanding what is SDF/Mol (V2000 and V3000) fi...
How to hide those H symbols (Hydrogen symbols) implicitly added to non-carbon terminal atoms in SVG ...
How to download and install Open Babel library RPM package for CentOS computers? Open Babel library ...
What Are CTfile (Chemical Table File) and CTAB (Connection Table)? CTfile (Chemical Table File) refe...
Where to find tutorials on molecule visualization software PyMol? I want to know how to use PyMol. H...