Molecule FYI-1001213

A

Molecule Summary:

ID: FYI-1001213
SMILES: C1CN=C(N1)NC2=C(C=CC=C2Cl)Cl

Received at FYIcenter.com on: 2022-03-18

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001213
FYIcenter.com

 23 24  0  0  0  0  0  0  0  0999 V2000
    5.6808    2.2477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1808    1.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5116    0.6386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981    1.0453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7026    2.0398    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321    0.5453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -0.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -0.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -1.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -2.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981   -1.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981   -0.9547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4641   -0.4547    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -0.4547    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.2472    2.4999    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4892    2.8374    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5956    0.9210    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6823    1.7461    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2419    2.4547    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1951    0.8553    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3291   -2.2647    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -3.0747    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1350   -2.2647    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  2  0  0  0  0
  4  5  1  0  0  0  0
  1  5  1  0  0  0  0
  4  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  2  0  0  0  0
  8  9  1  0  0  0  0
  9 10  2  0  0  0  0
 10 11  1  0  0  0  0
 11 12  2  0  0  0  0
  7 12  1  0  0  0  0
 12 13  1  0  0  0  0
  8 14  1  0  0  0  0
  1 15  1  0  0  0  0
  1 16  1  0  0  0  0
  2 17  1  0  0  0  0
  2 18  1  0  0  0  0
  5 19  1  0  0  0  0
  6 20  1  0  0  0  0
  9 21  1  0  0  0  0
 10 22  1  0  0  0  0
 11 23  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="402.36826762064" x2="423.33797381641" y1="488.48665702542" y2="452.16712589435" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="423.33797381641" x2="444.30768001218" y1="452.16712589435" y2="415.84759476328" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="444.30768001218" x2="416.24182523976" y1="415.84759476328" y2="384.68241741513" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="416.24182523976" x2="388.17597046735" y1="384.68241741513" y2="353.51724006698" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" />
<line x1="387" x2="348.5" y1="350" y2="367" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" />
<line x1="348.5" x2="310" y1="367" y2="384" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="390" x2="352" y1="358" y2="375" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" />
<line x1="352" x2="314" y1="375" y2="392" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="311.55266402801" x2="315.93533262293" y1="387.63075810626" y2="429.33950372964" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="315.93533262293" x2="320.31800121784" y1="429.33950372964" y2="471.04824935302" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" />
<line x1="402.36826762064" x2="361.34313441924" y1="488.48665702542" y2="479.76745318922" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="361.34313441924" x2="320.31800121784" y1="479.76745318922" y2="471.04824935302" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" />
<line x1="311.55266402801" x2="275.23313289694" y1="387.63075810626" y2="366.66105191049" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="275.23313289694" x2="238.91360176587" y1="366.66105191049" y2="345.69134571472" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" />
<line x1="238.91360176587" x2="238.91360176587" y1="345.69134571472" y2="303.75193332318" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" />
<line x1="238.91360176587" x2="238.91360176587" y1="303.75193332318" y2="261.81252093165" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="242" x2="205.5" y1="258" y2="237.5" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="205.5" x2="169" y1="237.5" y2="217" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="237" x2="201" y1="266" y2="245" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="201" x2="165" y1="245" y2="224" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="166.26615162125" x2="166.26615162125" y1="219.87310854011" y2="177.93369614858" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="166.26615162125" x2="166.26615162125" y1="177.93369614858" y2="135.99428375704" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="169" x2="205.5" y1="140" y2="119" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="205.5" x2="242" y1="119" y2="98" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="165" x2="201" y1="133" y2="112" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="201" x2="237" y1="112" y2="91" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="238.91360176587" x2="275.23313289694" y1="94.054871365505" y2="115.02457756127" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="275.23313289694" x2="311.55266402801" y1="115.02457756127" y2="135.99428375704" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="308" x2="308" y1="136" y2="178" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="308" x2="308" y1="178" y2="220" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="316" x2="316" y1="136" y2="178" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="316" x2="316" y1="178" y2="220" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="238.91360176587" x2="275.23313289694" y1="261.81252093165" y2="240.84281473588" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="275.23313289694" x2="311.55266402801" y1="240.84281473588" y2="219.87310854011" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="311.55266402801" x2="347.87219515908" y1="219.87310854011" y2="240.84281473588" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="347.87219515908" x2="384.19172629015" y1="240.84281473588" y2="261.81252093165" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #00bc00" />
<line x1="166.26615162125" x2="129.94662049018" y1="219.87310854011" y2="240.84281473588" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #000000" />
<line x1="129.94662049018" x2="93.627089359111" y1="240.84281473588" y2="261.81252093165" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #00bc00" />
<line x1="320.31800121784" x2="300.99651392906" y1="471.04824935302" y2="488.44891155427" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" />
<line x1="300.99651392906" x2="281.67502664028" y1="488.44891155427" y2="505.84957375552" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #a4a4a4" />
<line x1="238.91360176587" x2="216.39213731162" y1="345.69134571472" y2="358.6925635561" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #0000ff" />
<line x1="216.39213731162" x2="193.87067285736" y1="358.6925635561" y2="371.69378139747" style="stroke-opacity:1; stroke-width: 3.5317718800063; stroke: #a4a4a4" />
<ellipse cx="388.17597046735" cy="353.51724006698" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="388.17597046735" y="372.94198540702"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:44.147148500079px">N</text>
<ellipse cx="320.31800121784" cy="471.04824935302" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.31800121784" y="490.47299469306"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:44.147148500079px">N</text>
<ellipse cx="238.91360176587" cy="345.69134571472" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="238.91360176587" y="365.11609105476"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:44.147148500079px">N</text>
<ellipse cx="384.19172629015" cy="261.81252093165" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="384.19172629015" y="281.23726627168"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:44.147148500079px">Cl</text>
<ellipse cx="93.627089359111" cy="261.81252093165" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="93.627089359111" y="281.23726627168"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:44.147148500079px">Cl</text>
<ellipse cx="281.67502664028" cy="505.84957375552" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="281.67502664028" y="525.27431909555"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:44.147148500079px">H</text>
<ellipse cx="193.87067285736" cy="371.69378139747" rx="22.956517220041" ry="22.956517220041" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="193.87067285736" y="391.11852673751"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:44.147148500079px">H</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 117👍, 0💬