Molecule FYI-1001214

A

Molecule Summary:

ID: FYI-1001214
SMILES: [Ir]12(O[Ir](=O)(=O)(=O)(O1)O2)(=O)(=O)=O

Received at FYIcenter.com on: 2022-03-19

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001214
FYIcenter.com

 11 12  0  0  0  0  0  0  0  0999 V2000
    3.8660   -0.4913    0.0000 Ir  0  0  0  0  0  0  0  0  0  0  0  0
    3.3882    1.4572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1248    0.4746    0.0000 Ir  0  0  0  0  0  0  0  0  0  0  0  0
    5.1125    0.6311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5475    1.3809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9340    1.4562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -0.9913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6980   -0.7325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6072   -1.4572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2244   -1.4249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0889   -1.1206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  2  0  0  0  0
  3  5  2  0  0  0  0
  3  6  2  0  0  0  0
  3  7  1  0  0  0  0
  1  7  1  0  0  0  0
  3  8  1  0  0  0  0
  1  8  1  0  0  0  0
  1  9  2  0  0  0  0
  1 10  2  0  0  0  0
  1 11  2  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="292.27969172526" x2="260.24331800973" y1="224.11690914008" y2="354.76335992428" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="260.24331800973" x2="228.20694429421" y1="354.76335992428" y2="485.40981070849" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="228.20694429421" x2="277.59579502434" y1="485.40981070849" y2="419.52671984857" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="277.59579502434" x2="326.98464575446" y1="419.52671984857" y2="353.64362898864" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="326" x2="392.5" y1="361" y2="371.5" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="392.5" x2="459" y1="371.5" y2="382" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="329" x2="395" y1="347" y2="357.5" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="395" x2="461" y1="357.5" y2="368" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="321" x2="349.5" y1="357" y2="418" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="349.5" x2="378" y1="418" y2="479" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="334" x2="362.5" y1="351" y2="412" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="362.5" x2="391" y1="412" y2="473" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="321" x2="308" y1="353" y2="418.5" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="308" x2="295" y1="418.5" y2="484" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="334" x2="321.5" y1="355" y2="421" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="321.5" x2="309" y1="421" y2="487" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="326.98464575446" x2="184.51732287723" y1="353.64362898864" y2="255.35539075176" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="184.51732287723" x2="42.05" y1="255.35539075176" y2="157.06715251487" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="292.27969172526" x2="167.16484586263" y1="224.11690914008" y2="190.59203082747" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="167.16484586263" x2="42.05" y1="190.59203082747" y2="157.06715251487" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="326.98464575446" x2="432.46732287723" y1="353.64362898864" y2="272.70786776636" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="432.46732287723" x2="537.95" y1="272.70786776636" y2="191.77210654408" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="292.27969172526" x2="415.11484586263" y1="224.11690914008" y2="207.94450784208" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="415.11484586263" x2="537.95" y1="207.94450784208" y2="191.77210654408" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="300" x2="282.5" y1="223" y2="158" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="282.5" x2="265" y1="158" y2="93" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="286" x2="268.5" y1="226" y2="161.5" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="268.5" x2="251" y1="161.5" y2="97" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="299" x2="323" y1="227" y2="164.5" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="323" x2="347" y1="164.5" y2="102" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="286" x2="310" y1="222" y2="159.5" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="310" x2="334" y1="159.5" y2="97" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="297" x2="245" y1="219" y2="177" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="245" x2="193" y1="177" y2="135" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<line x1="288" x2="236" y1="230" y2="188" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #000000" />
<line x1="236" x2="184" y1="188" y2="146" style="stroke-opacity:1; stroke-width: 5.6462952947539; stroke: #ff0000" />
<ellipse cx="292.27969172526" cy="224.11690914008" rx="36.7009194159" ry="36.7009194159" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="292.27969172526" y="255.17153326122"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:70.578691184424px">Ir</text>
<ellipse cx="228.20694429421" cy="485.40981070849" rx="36.7009194159" ry="36.7009194159" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="228.20694429421" y="516.46443482964"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:70.578691184424px">O</text>
<ellipse cx="326.98464575446" cy="353.64362898864" rx="36.7009194159" ry="36.7009194159" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="326.98464575446" y="384.69825310979"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:70.578691184424px">Ir</text>
<ellipse cx="459.43473499189" cy="374.63020281233" rx="36.7009194159" ry="36.7009194159" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="459.43473499189" y="405.68482693348"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:70.578691184424px">O</text>
<ellipse cx="383.66851000541" cy="475.17801784749" rx="36.7009194159" ry="36.7009194159" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="383.66851000541" y="506.23264196863"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:70.578691184424px">O</text>
<ellipse cx="301.39845862628" cy="485.27571119524" rx="36.7009194159" ry="36.7009194159" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="301.39845862628" y="516.33033531639"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:70.578691184424px">O</text>
<ellipse cx="42.05" cy="157.06715251487" rx="36.7009194159" ry="36.7009194159" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="188.12177663602"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:70.578691184424px">O</text>
<ellipse cx="537.95" cy="191.77210654408" rx="36.7009194159" ry="36.7009194159" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="222.82673066522"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:70.578691184424px">O</text>
<ellipse cx="257.57473769605" cy="94.590189291509" rx="36.7009194159" ry="36.7009194159" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="257.57473769605" y="125.64481341266"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:70.578691184424px">O</text>
<ellipse cx="340.3409572742" cy="98.921603569497" rx="36.7009194159" ry="36.7009194159" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="340.3409572742" y="129.97622769064"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:70.578691184424px">O</text>
<ellipse cx="188.07095997837" cy="139.7280854516" rx="36.7009194159" ry="36.7009194159" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="188.07095997837" y="170.78270957274"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:70.578691184424px">O</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 118👍, 0💬