Molecule FYI-1001219

A

Molecule Summary:

ID: FYI-1001219
SMILES: c1cccc(c1C(=O)N(CCc1ccc(c(c1)OC)OC)C)OC

Received at FYIcenter.com on: 2022-03-20

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001219
FYIcenter.com

 24 25  0  0  0  0  0  0  0  0999 V2000
    9.6994    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    2.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    4.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    2.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  6  1  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  7  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 17 12  1  0  0  0  0
 18 16  1  0  0  0  0
 19 18  1  0  0  0  0
 20 15  1  0  0  0  0
 21 20  1  0  0  0  0
 22  9  1  0  0  0  0
 23  5  1  0  0  0  0
 24 23  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="490" x2="465.5" y1="431" y2="416.5" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="465.5" x2="441" y1="416.5" y2="402" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="487" x2="462.5" y1="436" y2="422" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="462.5" x2="438" y1="422" y2="408" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="537.95" x2="513.15561351996" y1="404.52372508104" y2="418.83919071617" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="513.15561351996" x2="488.36122703991" y1="418.83919071617" y2="433.15465635129" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="535" x2="535" y1="348" y2="376.5" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="535" x2="535" y1="376.5" y2="405" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="541" x2="541" y1="348" y2="376.5" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="541" x2="541" y1="376.5" y2="405" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="488.36122703991" x2="513.15561351996" y1="318.63093127026" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="513.15561351996" x2="537.95" y1="332.94639690539" y2="347.26186254052" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="441" x2="465.5" y1="350" y2="336" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="465.5" x2="490" y1="336" y2="322" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="438" x2="462.5" y1="345" y2="331" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="462.5" x2="487" y1="331" y2="317" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="438.76836394678" x2="438.76836394678" y1="347.26186254052" y2="375.89279381078" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="438.76836394678" x2="438.76836394678" y1="375.89279381078" y2="404.52372508104" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="389.1795909867" x2="413.97397746674" y1="318.63093127026" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="413.97397746674" x2="438.76836394678" y1="332.94639690539" y2="347.26186254052" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="387" x2="387" y1="262" y2="290.5" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #ff0000" />
<line x1="387" x2="387" y1="290.5" y2="319" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="393" x2="393" y1="262" y2="290.5" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #ff0000" />
<line x1="393" x2="393" y1="290.5" y2="319" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="339.59081802661" x2="364.38520450665" y1="347.26186254052" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #0000ff" />
<line x1="364.38520450665" x2="389.1795909867" y1="332.94639690539" y2="318.63093127026" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="290.00204506652" x2="314.79643154656" y1="318.63093127026" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="314.79643154656" x2="339.59081802661" y1="332.94639690539" y2="347.26186254052" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #0000ff" />
<line x1="240.40918197339" x2="265.20561351996" y1="347.26186254052" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="265.20561351996" x2="290.00204506652" y1="332.94639690539" y2="318.63093127026" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="190.8204090133" x2="215.61479549335" y1="318.63093127026" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="215.61479549335" x2="240.40918197339" y1="332.94639690539" y2="347.26186254052" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="143" x2="168" y1="350" y2="336" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="168" x2="193" y1="336" y2="322" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="140" x2="165" y1="345" y2="331" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="165" x2="190" y1="331" y2="317" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="91.638772960088" x2="116.43520450665" y1="318.63093127026" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="116.43520450665" x2="141.23163605322" y1="332.94639690539" y2="347.26186254052" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="89" x2="89" y1="262" y2="290.5" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="89" x2="89" y1="290.5" y2="319" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="95" x2="95" y1="262" y2="290.5" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="95" x2="95" y1="290.5" y2="319" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="141.23163605322" x2="116.43520450665" y1="232.73813745948" y2="247.05360309461" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="116.43520450665" x2="91.638772960088" y1="247.05360309461" y2="261.36906872974" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="193" x2="168" y1="259" y2="245" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="168" x2="143" y1="245" y2="231" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="190" x2="165" y1="264" y2="250" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="165" x2="140" y1="250" y2="236" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="190.8204090133" x2="190.8204090133" y1="261.36906872974" y2="290" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="190.8204090133" x2="190.8204090133" y1="290" y2="318.63093127026" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="141.23163605322" x2="141.23163605322" y1="175.47627491896" y2="204.10720618922" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #ff0000" />
<line x1="141.23163605322" x2="141.23163605322" y1="204.10720618922" y2="232.73813745948" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="190.8204090133" x2="166.02602253326" y1="146.84534364871" y2="161.16080928383" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="166.02602253326" x2="141.23163605322" y1="161.16080928383" y2="175.47627491896" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #ff0000" />
<line x1="42.05" x2="66.844386480044" y1="232.73813745948" y2="247.05360309461" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #ff0000" />
<line x1="66.844386480044" x2="91.638772960088" y1="247.05360309461" y2="261.36906872974" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="175.47627491896" y2="204.10720618922" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="204.10720618922" y2="232.73813745948" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #ff0000" />
<line x1="339.59081802661" x2="339.59081802661" y1="404.52372508104" y2="375.89279381078" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="339.59081802661" x2="339.59081802661" y1="375.89279381078" y2="347.26186254052" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #0000ff" />
<line x1="488.36122703991" x2="488.36122703991" y1="261.36906872974" y2="290" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #ff0000" />
<line x1="488.36122703991" x2="488.36122703991" y1="290" y2="318.63093127026" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="438.76836394678" x2="463.56479549335" y1="232.73813745948" y2="247.05360309461" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #000000" />
<line x1="463.56479549335" x2="488.36122703991" y1="247.05360309461" y2="261.36906872974" style="stroke-opacity:1; stroke-width: 2.4110366075309; stroke: #ff0000" />
<ellipse cx="389.1795909867" cy="261.36906872974" rx="15.671737948951" ry="15.671737948951" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="389.1795909867" y="274.62977007116"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137957594136px">O</text>
<ellipse cx="339.59081802661" cy="347.26186254052" rx="15.671737948951" ry="15.671737948951" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.59081802661" y="360.52256388194"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137957594136px">N</text>
<ellipse cx="141.23163605322" cy="175.47627491896" rx="15.671737948951" ry="15.671737948951" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="141.23163605322" y="188.73697626038"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137957594136px">O</text>
<ellipse cx="42.05" cy="232.73813745948" rx="15.671737948951" ry="15.671737948951" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="245.9988388009"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137957594136px">O</text>
<ellipse cx="488.36122703991" cy="261.36906872974" rx="15.671737948951" ry="15.671737948951" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="488.36122703991" y="274.62977007116"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137957594136px">O</text>
</g></svg>

✍: FYIcenter.com

2022-07-01, 108👍, 0💬