Molecule FYI-1001207

A

Molecule Summary:

ID: FYI-1001207
SMILES: CC[C@H](C)[C@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)CNC(=O)CNC(=O)CNC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](N)CC1=CC=CC=C1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC1=CC=C(O)C=C1)C(=O)N[C@@H](CC(C)C)C(O)=O

Received at FYIcenter.com on: 2022-03-13

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001207
FYIcenter.com

155160  0  0  1  0  0  0  0  0999 V2000
   39.1145    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9020    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9020    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1145    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6896    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4772    6.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4772    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6896    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2648    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2648    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4772    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4772    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2648    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6896    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.0523    4.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8399    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8399    2.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6275    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6275    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8399    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8399    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6275    9.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.0523    9.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4151    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.2025    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2025    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9901    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9901    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2025    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2025    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4151    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6275    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6275    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4151    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7777    4.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7777    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9901    7.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.5653    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3528    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3528    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5653    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1404    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.5653    8.4000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3528    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1404    8.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3528   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1404   11.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.1404   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3528   13.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9280   13.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7156   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7156   11.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9280   10.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5031   10.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9280   14.7000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7156   15.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5031   14.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7156   16.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5031   17.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5031   18.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7156   19.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2907   19.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2907   21.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0783   21.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8659   21.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0783   23.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8659   23.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8659   25.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0783   25.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6533   25.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6533   27.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4409   28.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2285   27.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4409   29.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5735   30.2229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1409   31.5543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7409   31.5543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3083   30.2229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9768   29.7903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6857   28.4208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9365   30.7270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2275   32.0964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5591   32.5291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8501   33.8984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1815   34.3310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4726   35.7005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8041   36.1331    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4322   36.6372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6049   30.2944    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3139   28.9249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3543   27.9882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9825   28.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5497   27.1609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1497   27.1609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7171   28.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497   29.3153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497   30.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623   31.4153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   31.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249   30.7153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   32.8153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249   33.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249   34.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125   35.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   34.9153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   33.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125   32.8153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6896    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4772    9.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.9020    9.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.1810    8.5306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1178    9.5709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4178   10.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0484   10.4923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0080   11.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2990   12.7985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6766   10.9964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.6361   11.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3047   11.5006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2642   12.4374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9328   12.0048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8923   12.9416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6418   10.6354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9272   13.3026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2587   13.7352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.8868   14.2394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.1779   15.6089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5094   16.0415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8005   17.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1319   17.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1723   16.9067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.4229   19.2129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1375   16.5456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8060   16.1130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.4286   17.9151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3881   18.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0567   18.4192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0162   19.3560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6848   18.9234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6444   19.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9354   21.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8951   22.1663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2670   21.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3073   20.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6792   20.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6388   21.1580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.0107   20.6539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3018   22.0232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6333   22.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9244   23.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8839   24.7620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2558   24.2579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2614   22.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9299   22.5274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.5525   24.3294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  3  4  1  1  0  0  0
  5  3  1  0  0  0  0
  5  6  1  6  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  7  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 12  2  0  0  0  0
  9 15  1  6  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 16  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 21  2  0  0  0  0
 18 24  1  1  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 27 25  1  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  2  0  0  0  0
 31 30  1  0  0  0  0
 32 31  2  0  0  0  0
 33 32  1  0  0  0  0
 34 33  2  0  0  0  0
 34 29  1  0  0  0  0
 27 35  1  6  0  0  0
 36 35  1  0  0  0  0
 37 36  2  0  0  0  0
 38 36  1  0  0  0  0
 39 38  1  0  0  0  0
 40 39  1  0  0  0  0
 41 40  1  0  0  0  0
 42 40  2  0  0  0  0
 38 43  1  6  0  0  0
 44 43  1  0  0  0  0
 45 44  2  0  0  0  0
 46 44  1  0  0  0  0
 47 46  1  0  0  0  0
 48 47  1  0  0  0  0
 49 48  2  0  0  0  0
 50 48  1  0  0  0  0
 51 50  1  0  0  0  0
 52 51  1  0  0  0  0
 53 52  1  0  0  0  0
 54 52  2  0  0  0  0
 50 55  1  6  0  0  0
 56 55  1  0  0  0  0
 57 56  2  0  0  0  0
 58 56  1  0  0  0  0
 59 58  1  0  0  0  0
 60 59  1  0  0  0  0
 61 60  2  0  0  0  0
 62 60  1  0  0  0  0
 63 62  1  0  0  0  0
 64 63  1  0  0  0  0
 65 64  2  0  0  0  0
 66 64  1  0  0  0  0
 67 66  1  0  0  0  0
 68 67  1  0  0  0  0
 69 68  2  0  0  0  0
 70 68  1  0  0  0  0
 71 70  1  0  0  0  0
 72 71  1  0  0  0  0
 73 72  2  0  0  0  0
 74 72  1  1  0  0  0
 75 74  1  0  0  0  0
 76 75  1  0  0  0  0
 77 76  1  0  0  0  0
 78 77  1  0  0  0  0
 78 74  1  0  0  0  0
 79 78  1  0  0  0  0
 80 79  2  0  0  0  0
 81 79  1  0  0  0  0
 82 81  1  0  0  0  0
 83 82  1  0  0  0  0
 84 83  1  0  0  0  0
 85 84  1  0  0  0  0
 86 85  1  0  0  0  0
 87 86  1  0  0  0  0
 88 86  2  0  0  0  0
 81 89  1  1  0  0  0
 90 89  1  0  0  0  0
 91 90  2  0  0  0  0
 92 90  1  6  0  0  0
 93 92  1  0  0  0  0
 94 93  1  0  0  0  0
 95 94  1  0  0  0  0
 96 95  1  0  0  0  0
 96 92  1  0  0  0  0
 97 96  1  0  0  0  0
 98 97  2  0  0  0  0
 99 97  1  0  0  0  0
 99100  1  6  0  0  0
101 99  1  0  0  0  0
102101  1  0  0  0  0
103102  2  0  0  0  0
104103  1  0  0  0  0
105104  2  0  0  0  0
106105  1  0  0  0  0
107106  2  0  0  0  0
107102  1  0  0  0  0
108  5  1  0  0  0  0
109108  2  0  0  0  0
110108  1  0  0  0  0
111110  1  0  0  0  0
112111  1  0  0  0  0
113112  1  0  0  0  0
114113  1  0  0  0  0
114110  1  0  0  0  0
114115  1  6  0  0  0
116115  2  0  0  0  0
117115  1  0  0  0  0
118117  1  1  0  0  0
119118  1  0  0  0  0
120119  1  0  0  0  0
121120  1  0  0  0  0
122121  1  0  0  0  0
123121  2  0  0  0  0
124118  1  0  0  0  0
125124  2  0  0  0  0
126124  1  0  0  0  0
127126  1  6  0  0  0
128127  1  0  0  0  0
129128  1  0  0  0  0
130129  1  0  0  0  0
131130  1  0  0  0  0
132130  2  0  0  0  0
133127  1  0  0  0  0
134133  2  0  0  0  0
135133  1  0  0  0  0
136135  1  1  0  0  0
137136  1  0  0  0  0
138137  1  0  0  0  0
139138  2  0  0  0  0
140139  1  0  0  0  0
141140  2  0  0  0  0
142141  1  0  0  0  0
143141  1  0  0  0  0
144143  2  0  0  0  0
144138  1  0  0  0  0
145136  1  0  0  0  0
146145  2  0  0  0  0
147145  1  0  0  0  0
148147  1  6  0  0  0
149148  1  0  0  0  0
150149  1  0  0  0  0
151150  1  0  0  0  0
152150  1  0  0  0  0
153148  1  0  0  0  0
154153  1  0  0  0  0
155153  2  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="510.56028221887" x2="518.05419701479" y1="124.13138955775" y2="119.80500575804" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="518.05419701479" x2="525.54811181072" y1="119.80500575804" y2="115.47862195833" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="510.56028221887" x2="510.56028221887" y1="141.43692475659" y2="132.78415715717" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="510.56028221887" x2="510.56028221887" y1="132.78415715717" y2="124.13138955775" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 511,142 525,153 527,148" fill-opacity="1"  style="fill:#000000" />
<line x1="495.57368873667" x2="503.06698547777" y1="150.08969235601" y2="145.7633085563" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="503.06698547777" x2="510.56028221887" y1="145.7633085563" y2="141.43692475659" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 496,151 482,140 480,144" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="480.58709525448" x2="480.58709525448" y1="124.13138955775" y2="132.78415715717" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="480.58709525448" x2="480.58709525448" y1="132.78415715717" y2="141.43692475659" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="496" x2="488.5" y1="115" y2="119.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="488.5" x2="481" y1="119.5" y2="124" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="497" x2="489.5" y1="117" y2="121" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="489.5" x2="482" y1="121" y2="125" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="465.60050177228" x2="473.09379851338" y1="115.47862195833" y2="119.80500575804" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="473.09379851338" x2="480.58709525448" y1="119.80500575804" y2="124.13138955775" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="465.60050177228" x2="465.60050177228" y1="98.173086759493" y2="106.82585435891" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="465.60050177228" x2="465.60050177228" y1="106.82585435891" y2="115.47862195833" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="480.58709525448" x2="473.09379851338" y1="89.520319160074" y2="93.846702959783" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="473.09379851338" x2="465.60050177228" y1="93.846702959783" y2="98.173086759493" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="480.58709525448" x2="480.58709525448" y1="72.214783961234" y2="80.867551560654" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="480.58709525448" x2="480.58709525448" y1="80.867551560654" y2="89.520319160074" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="465.60050177228" x2="473.09379851338" y1="63.562016361814" y2="67.888400161524" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="473.09379851338" x2="480.58709525448" y1="67.888400161524" y2="72.214783961234" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="496" x2="488.5" y1="63" y2="67.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="488.5" x2="481" y1="67.5" y2="72" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="497" x2="489.5" y1="65" y2="69.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="489.5" x2="482" y1="69.5" y2="74" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 466,116 450,122 452,127" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="435.62607869823" x2="443.11937543933" y1="115.47862195833" y2="119.80500575804" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="443.11937543933" x2="450.61267218043" y1="119.80500575804" y2="124.13138955775" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="435" x2="435" y1="99" y2="107.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="435" x2="435" y1="107.5" y2="116" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="437" x2="437" y1="99" y2="107.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="437" x2="437" y1="107.5" y2="116" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="420.63948521604" x2="428.13278195714" y1="124.13138955775" y2="119.80500575804" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="428.13278195714" x2="435.62607869823" y1="119.80500575804" y2="115.47862195833" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="420.63948521604" x2="420.63948521604" y1="141.43692475659" y2="132.78415715717" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="420.63948521604" x2="420.63948521604" y1="132.78415715717" y2="124.13138955775" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="435.62607869823" x2="428.13278195714" y1="150.08969235601" y2="145.7633085563" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="428.13278195714" x2="420.63948521604" y1="145.7633085563" y2="141.43692475659" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="435.62607869823" x2="435.62607869823" y1="167.39522755485" y2="158.74245995543" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="435.62607869823" x2="435.62607869823" y1="158.74245995543" y2="150.08969235601" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="420.63948521604" x2="428.13278195714" y1="176.04799515427" y2="171.72161135456" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="428.13278195714" x2="435.62607869823" y1="171.72161135456" y2="167.39522755485" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="452" x2="444.5" y1="176" y2="171.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="444.5" x2="437" y1="171.5" y2="167" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="451" x2="443.5" y1="177" y2="173" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="443.5" x2="436" y1="173" y2="169" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 421,125 407,114 405,118" fill-opacity="1"  style="fill:#000000" />
<line x1="390.66382603233" x2="398.15835888309" y1="124.13138955775" y2="119.80500575804" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="398.15835888309" x2="405.65289173384" y1="119.80500575804" y2="115.47862195833" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="392" x2="392" y1="142" y2="133.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="392" x2="392" y1="133.5" y2="125" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="390" x2="390" y1="142" y2="133.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="390" x2="390" y1="133.5" y2="125" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="375.67723255014" x2="383.17052929124" y1="115.47862195833" y2="119.80500575804" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="383.17052929124" x2="390.66382603233" y1="119.80500575804" y2="124.13138955775" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="375.67723255014" x2="375.67723255014" y1="98.173086759493" y2="106.82585435891" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="375.67723255014" x2="375.67723255014" y1="106.82585435891" y2="115.47862195833" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="390.66382603233" x2="383.17052929124" y1="89.520319160074" y2="93.846702959783" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="383.17052929124" x2="375.67723255014" y1="93.846702959783" y2="98.173086759493" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="390" x2="390" y1="73" y2="81.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="390" x2="390" y1="81.5" y2="90" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="392" x2="392" y1="73" y2="81.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="392" x2="392" y1="81.5" y2="90" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="405.65289173384" x2="398.15835888309" y1="63.562016361814" y2="67.888400161524" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="398.15835888309" x2="390.66382603233" y1="67.888400161524" y2="72.214783961234" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="422" x2="414.5" y1="72" y2="67.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="414.5" x2="407" y1="67.5" y2="63" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="421" x2="413.5" y1="74" y2="69.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="413.5" x2="406" y1="69.5" y2="65" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="420.63948521604" x2="420.63948521604" y1="89.520319160074" y2="80.867551560654" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="420.63948521604" x2="420.63948521604" y1="80.867551560654" y2="72.214783961234" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="407" x2="414.5" y1="99" y2="95" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="414.5" x2="422" y1="95" y2="91" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="406" x2="413.5" y1="98" y2="93.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="413.5" x2="421" y1="93.5" y2="89" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="405.65289173384" x2="398.15835888309" y1="98.173086759493" y2="93.846702959783" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="398.15835888309" x2="390.66382603233" y1="93.846702959783" y2="89.520319160074" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 376,116 360,122 362,127" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="360.69063906794" x2="360.69063906794" y1="141.43692475659" y2="132.78415715717" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="360.69063906794" x2="360.69063906794" y1="132.78415715717" y2="124.13138955775" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="377" x2="369.5" y1="150" y2="145.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="369.5" x2="362" y1="145.5" y2="141" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="376" x2="368.5" y1="151" y2="147" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="368.5" x2="361" y1="147" y2="143" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="345.70404558575" x2="353.19734232685" y1="150.08969235601" y2="145.7633085563" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="353.19734232685" x2="360.69063906794" y1="145.7633085563" y2="141.43692475659" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="330.7162159939" x2="338.21013078982" y1="141.43692475659" y2="145.7633085563" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="338.21013078982" x2="345.70404558575" y1="145.7633085563" y2="150.08969235601" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="330.7162159939" x2="330.7162159939" y1="124.13138955775" y2="132.78415715717" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="330.7162159939" x2="330.7162159939" y1="132.78415715717" y2="141.43692475659" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="345.70404558575" x2="338.21013078982" y1="115.47862195833" y2="119.80500575804" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="338.21013078982" x2="330.7162159939" y1="119.80500575804" y2="124.13138955775" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="316" x2="323.5" y1="117" y2="121" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="323.5" x2="331" y1="121" y2="125" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="317" x2="324.5" y1="115" y2="119.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="324.5" x2="332" y1="119.5" y2="124" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 346,151 344,168 349,168" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="330.7162159939" x2="338.21013078982" y1="176.04799515427" y2="171.72161135456" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="338.21013078982" x2="345.70404558575" y1="171.72161135456" y2="167.39522755485" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="316" x2="323.5" y1="169" y2="173" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="323.5" x2="331" y1="173" y2="177" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="317" x2="324.5" y1="167" y2="171.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="324.5" x2="332" y1="171.5" y2="176" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="330.7162159939" x2="330.7162159939" y1="193.35353035311" y2="184.70076275369" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="330.7162159939" x2="330.7162159939" y1="184.70076275369" y2="176.04799515427" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="315.7296225117" x2="323.2229192528" y1="202.00629795253" y2="197.67991415282" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="323.2229192528" x2="330.7162159939" y1="197.67991415282" y2="193.35353035311" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="315.7296225117" x2="315.7296225117" y1="219.31183315137" y2="210.65906555195" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="315.7296225117" x2="315.7296225117" y1="210.65906555195" y2="202.00629795253" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="332" x2="324.5" y1="228" y2="223.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="324.5" x2="317" y1="223.5" y2="219" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="331" x2="323.5" y1="229" y2="225" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="323.5" x2="316" y1="225" y2="221" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="300.74302902951" x2="308.23632577061" y1="227.96460075079" y2="223.63821695108" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="308.23632577061" x2="315.7296225117" y1="223.63821695108" y2="219.31183315137" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="285.75643554731" x2="293.24973228841" y1="219.31183315137" y2="223.63821695108" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="293.24973228841" x2="300.74302902951" y1="223.63821695108" y2="227.96460075079" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="285.75643554731" x2="285.75643554731" y1="202.00629795253" y2="210.65906555195" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="285.75643554731" x2="285.75643554731" y1="210.65906555195" y2="219.31183315137" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="300.74302902951" x2="293.24973228841" y1="193.35353035311" y2="197.67991415282" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="293.24973228841" x2="285.75643554731" y1="197.67991415282" y2="202.00629795253" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="271" x2="278.5" y1="195" y2="199" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="278.5" x2="286" y1="199" y2="203" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="272" x2="279.5" y1="193" y2="197.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="279.5" x2="287" y1="197.5" y2="202" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 301,228 299,246 304,246" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="285.75643554731" x2="293.24973228841" y1="253.92290354905" y2="249.59651974934" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="293.24973228841" x2="300.74302902951" y1="249.59651974934" y2="245.27013594963" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="271" x2="278.5" y1="247" y2="251" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="278.5" x2="286" y1="251" y2="255" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="272" x2="279.5" y1="245" y2="249.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="279.5" x2="287" y1="249.5" y2="254" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="285.75643554731" x2="285.75643554731" y1="271.22843874789" y2="262.57567114847" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="285.75643554731" x2="285.75643554731" y1="262.57567114847" y2="253.92290354905" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="270.76860595546" x2="278.26252075139" y1="279.88120634731" y2="275.5548225476" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="278.26252075139" x2="285.75643554731" y1="275.5548225476" y2="271.22843874789" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="270.76860595546" x2="270.76860595546" y1="297.18674154615" y2="288.53397394673" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="270.76860595546" x2="270.76860595546" y1="288.53397394673" y2="279.88120634731" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="287" x2="279.5" y1="306" y2="301.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="279.5" x2="272" y1="301.5" y2="297" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="286" x2="278.5" y1="307" y2="302.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="278.5" x2="271" y1="302.5" y2="298" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="255.78201247327" x2="263.27530921436" y1="305.83950914557" y2="301.51312534586" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="263.27530921436" x2="270.76860595546" y1="301.51312534586" y2="297.18674154615" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="255.78201247327" x2="255.78201247327" y1="323.14504434441" y2="314.49227674499" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="255.78201247327" x2="255.78201247327" y1="314.49227674499" y2="305.83950914557" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="240.79541899107" x2="248.28871573217" y1="331.79781194383" y2="327.47142814412" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="248.28871573217" x2="255.78201247327" y1="327.47142814412" y2="323.14504434441" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="226" x2="233.5" y1="324" y2="328.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="233.5" x2="241" y1="328.5" y2="333" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="227" x2="234.5" y1="323" y2="327.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="234.5" x2="242" y1="327.5" y2="332" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="240.79541899107" x2="240.79541899107" y1="349.10334714266" y2="340.45057954325" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="240.79541899107" x2="240.79541899107" y1="340.45057954325" y2="331.79781194383" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="225.80882550888" x2="233.30212224997" y1="357.75611474208" y2="353.42973094237" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="233.30212224997" x2="240.79541899107" y1="353.42973094237" y2="349.10334714266" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="225.80882550888" x2="225.80882550888" y1="375.06164994092" y2="366.4088823415" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="225.80882550888" x2="225.80882550888" y1="366.4088823415" y2="357.75611474208" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="242" x2="234.5" y1="383" y2="379" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="234.5" x2="227" y1="379" y2="375" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="241" x2="233.5" y1="385" y2="380.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="233.5" x2="226" y1="380.5" y2="376" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="210.81975980737" x2="218.31429265812" y1="383.71441754034" y2="379.38803374063" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="218.31429265812" x2="225.80882550888" y1="379.38803374063" y2="375.06164994092" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="210.81975980737" x2="210.81975980737" y1="401.01995273918" y2="392.36718513976" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="210.81975980737" x2="210.81975980737" y1="392.36718513976" y2="383.71441754034" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="195.83316632517" x2="203.32646306627" y1="409.6727203386" y2="405.34633653889" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="203.32646306627" x2="210.81975980737" y1="405.34633653889" y2="401.01995273918" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="181" x2="188.5" y1="402" y2="406.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="188.5" x2="196" y1="406.5" y2="411" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="182" x2="189.5" y1="401" y2="405" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="189.5" x2="197" y1="405" y2="409" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 196,427 199,410 194,410" fill-opacity="1"  style="fill:#000000" />
<line x1="209.83334430103" x2="202.8332553131" y1="437.15020190539" y2="432.06422872142" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="202.8332553131" x2="195.83316632517" y1="432.06422872142" y2="426.97825553744" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="204.48593392459" x2="207.15963911281" y1="453.60776587948" y2="445.37898389244" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="207.15963911281" x2="209.83334430103" y1="445.37898389244" y2="437.15020190539" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="187.18039872575" x2="195.83316632517" y1="453.60776587948" y2="453.60776587948" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="195.83316632517" x2="204.48593392459" y1="453.60776587948" y2="453.60776587948" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="181.83298834931" x2="184.50669353753" y1="437.15020190539" y2="445.37898389244" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="184.50669353753" x2="187.18039872575" y1="445.37898389244" y2="453.60776587948" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="181.83298834931" x2="188.83307733724" y1="437.15020190539" y2="432.06422872142" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="188.83307733724" x2="195.83316632517" y1="432.06422872142" y2="426.97825553744" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="165.37418826556" x2="173.60358830743" y1="431.80279152895" y2="434.47649671717" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="173.60358830743" x2="181.83298834931" y1="434.47649671717" y2="437.15020190539" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="161" x2="163" y1="416" y2="424" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="163" x2="165" y1="424" y2="432" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="163" x2="165" y1="415" y2="423.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="165" x2="167" y1="423.5" y2="432" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="152.51493950316" x2="158.94456388436" y1="443.38143068663" y2="437.59211110779" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="158.94456388436" x2="165.37418826556" y1="437.59211110779" y2="431.80279152895" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="156.11201860521" x2="154.31347905419" y1="460.30871633041" y2="451.84507350852" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="154.31347905419" x2="152.51493950316" y1="451.84507350852" y2="443.38143068663" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="172.57205479862" x2="164.34203670191" y1="465.65736281651" y2="462.98303957346" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="164.34203670191" x2="156.11201860521" y1="462.98303957346" y2="460.30871633041" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="176.16913390066" x2="174.37059434964" y1="482.58341235063" y2="474.12038758357" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="174.37059434964" x2="172.57205479862" y1="474.12038758357" y2="465.65736281651" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="192.62669787476" x2="184.39791588771" y1="487.93082272707" y2="485.25711753885" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="184.39791588771" x2="176.16913390066" y1="485.25711753885" y2="482.58341235063" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="196.22501308646" x2="194.42585548061" y1="504.8593444805" y2="496.39508360379" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="194.42585548061" x2="192.62669787476" y1="496.39508360379" y2="487.93082272707" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="212.68381317021" x2="204.45441312834" y1="510.20675485695" y2="507.53304966873" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="204.45441312834" x2="196.22501308646" y1="507.53304966873" y2="504.8593444805" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="184" x2="190.5" y1="518" y2="512" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="190.5" x2="197" y1="512" y2="506" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="183" x2="189.5" y1="516" y2="510.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="189.5" x2="196" y1="510.5" y2="505" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 153,444 137,436 136,441" fill-opacity="1"  style="fill:#000000" />
<line x1="132.45782420771" x2="134.25636375873" y1="421.10549855675" y2="429.56975943347" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="134.25636375873" x2="136.05490330975" y1="429.56975943347" y2="438.03402031019" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="145" x2="138.5" y1="409" y2="415" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="138.5" x2="132" y1="415" y2="421" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="146" x2="140" y1="411" y2="416.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="140" x2="134" y1="416.5" y2="422" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 117,416 132,424 134,419" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="110.65037763786" x2="113.32531893573" y1="399.30052420621" y2="407.52930619326" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="113.32531893573" x2="116.00026023361" y1="407.52930619326" y2="415.75808818031" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="93.344842439017" x2="101.99761003844" y1="399.30052420621" y2="399.30052420621" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="101.99761003844" x2="110.65037763786" y1="399.30052420621" y2="399.30052420621" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="87.997432062576" x2="90.671137250796" y1="415.75808818031" y2="407.52930619326" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="90.671137250796" x2="93.344842439017" y1="407.52930619326" y2="399.30052420621" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="101.99761003844" x2="94.997521050506" y1="425.93127065791" y2="420.84467941911" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="94.997521050506" x2="87.997432062576" y1="420.84467941911" y2="415.75808818031" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="101.99761003844" x2="108.99893513602" y1="425.93127065791" y2="420.84467941911" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="108.99893513602" x2="116.00026023361" y1="420.84467941911" y2="415.75808818031" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="101.99761003844" x2="101.99761003844" y1="443.23680585675" y2="434.58403825733" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="101.99761003844" x2="101.99761003844" y1="434.58403825733" y2="425.93127065791" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="118" x2="110.5" y1="452" y2="447.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="110.5" x2="103" y1="447.5" y2="443" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="117" x2="109.5" y1="453" y2="449" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="109.5" x2="102" y1="449" y2="445" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="87.011016556242" x2="94.504313297339" y1="451.88957345617" y2="447.56318965646" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="94.504313297339" x2="101.99761003844" y1="447.56318965646" y2="443.23680585675" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 88,452 74,441 71,446" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="87.011016556242" x2="87.011016556242" y1="469.19510865501" y2="460.54234105559" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="87.011016556242" x2="87.011016556242" y1="460.54234105559" y2="451.88957345617" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="72.024423074047" x2="79.517719815144" y1="477.84787625443" y2="473.52149245472" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="79.517719815144" x2="87.011016556242" y1="473.52149245472" y2="469.19510865501" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="73" x2="73" y1="496" y2="487" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="73" x2="73" y1="487" y2="478" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="72" x2="72" y1="496" y2="487" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="72" x2="72" y1="487" y2="478" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="57.037829591852" x2="64.531126332949" y1="503.80617905269" y2="499.47979525298" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="64.531126332949" x2="72.024423074047" y1="499.47979525298" y2="495.15341145327" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="42" x2="49.5" y1="496" y2="500.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="49.5" x2="57" y1="500.5" y2="505" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="43" x2="50.5" y1="495" y2="499.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="50.5" x2="58" y1="499.5" y2="504" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="477.84787625443" y2="486.50064385385" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="486.50064385385" y2="495.15341145327" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="57" x2="49.5" y1="469" y2="473.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="49.5" x2="42" y1="473.5" y2="478" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="58" x2="50.5" y1="470" y2="474.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="50.5" x2="43" y1="474.5" y2="479" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="57.037829591852" x2="64.531126332949" y1="469.19510865501" y2="473.52149245472" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="64.531126332949" x2="72.024423074047" y1="473.52149245472" y2="477.84787625443" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="495.57368873667" x2="495.57368873667" y1="167.39522755485" y2="158.74245995543" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="495.57368873667" x2="495.57368873667" y1="158.74245995543" y2="150.08969235601" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="482" x2="489.5" y1="177" y2="173" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="489.5" x2="497" y1="173" y2="169" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="481" x2="488.5" y1="176" y2="171.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="488.5" x2="496" y1="171.5" y2="167" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="510.56028221887" x2="503.06698547777" y1="176.04799515427" y2="171.72161135456" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="503.06698547777" x2="495.57368873667" y1="171.72161135456" y2="167.39522755485" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="526.37012473266" x2="518.46520347576" y1="169.00958676697" y2="172.52879096062" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="518.46520347576" x2="510.56028221887" y1="172.52879096062" y2="176.04799515427" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="537.95" x2="532.16006236633" y1="181.86883552937" y2="175.43921114817" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="532.16006236633" x2="526.37012473266" y1="175.43921114817" y2="169.00958676697" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="529.29723240058" x2="533.62361620029" y1="196.85542901156" y2="189.36213227046" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="533.62361620029" x2="537.95" y1="189.36213227046" y2="181.86883552937" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="512.3699467568" x2="520.83358957869" y1="193.25834990952" y2="195.05688946054" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="520.83358957869" x2="529.29723240058" y1="195.05688946054" y2="196.85542901156" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="512.3699467568" x2="511.46511448783" y1="193.25834990952" y2="184.65317253189" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="511.46511448783" x2="510.56028221887" y1="184.65317253189" y2="176.04799515427" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<polygon points=" 513,194 498,203 502,207" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="504" x2="502.5" y1="222" y2="213.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="502.5" x2="501" y1="213.5" y2="205" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="503" x2="501" y1="222" y2="214" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="501" x2="499" y1="214" y2="206" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="483.05189791065" x2="491.2806798977" y1="199.48957869076" y2="202.16451998863" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="491.2806798977" x2="499.50946188475" y1="202.16451998863" y2="204.83946128651" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 471,212 485,202 482,198" fill-opacity="1"  style="fill:#000000" />
<line x1="453.73261295485" x2="461.9613949419" y1="205.72204358165" y2="208.3963668247" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="461.9613949419" x2="470.19017692894" y1="208.3963668247" y2="211.07069006775" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="440.87089197314" x2="447.30175246399" y1="217.30191884899" y2="211.51198121532" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="447.30175246399" x2="453.73261295485" y1="211.51198121532" y2="205.72204358165" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="424.41332799904" x2="432.64210998609" y1="211.95450847255" y2="214.62821366077" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="432.64210998609" x2="440.87089197314" y1="214.62821366077" y2="217.30191884899" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="411.55160701733" x2="417.98246750819" y1="223.53438373989" y2="217.74444610622" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="417.98246750819" x2="424.41332799904" y1="217.74444610622" y2="211.95450847255" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="420" x2="422" y1="196" y2="204.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="422" x2="424" y1="204.5" y2="213" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="422" x2="424" y1="195" y2="203.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="424" x2="426" y1="203.5" y2="212" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="473.78849214065" x2="471.98933453479" y1="227.99673960187" y2="219.53371483481" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="471.98933453479" x2="470.19017692894" y1="219.53371483481" y2="211.07069006775" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="491" x2="483" y1="233" y2="230.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="483" x2="475" y1="230.5" y2="228" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="490" x2="482" y1="235" y2="232" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="482" x2="474" y1="232" y2="229" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="460.92800726859" x2="467.35824970462" y1="239.57661486921" y2="233.78667723554" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="467.35824970462" x2="473.78849214065" y1="233.78667723554" y2="227.99673960187" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 465,257 464,240 459,241" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="480.98512256405" x2="472.75572252217" y1="261.85254699909" y2="259.17884181087" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="472.75572252217" x2="464.5263224803" y1="259.17884181087" y2="256.50513662265" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="484.58343777575" x2="482.7842801699" y1="278.77983264287" y2="270.31618982098" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="482.7842801699" x2="480.98512256405" y1="270.31618982098" y2="261.85254699909" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="501.04100174985" x2="492.8122197628" y1="284.12724301931" y2="281.45353783109" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="492.8122197628" x2="484.58343777575" y1="281.45353783109" y2="278.77983264287" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="513.9014866219" x2="507.47124418587" y1="272.54736775197" y2="278.33730538564" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="507.47124418587" x2="501.04100174985" y1="278.33730538564" y2="284.12724301931" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="506" x2="504" y1="301" y2="292.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="504" x2="502" y1="292.5" y2="284" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="504" x2="502.5" y1="302" y2="293.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="502.5" x2="501" y1="293.5" y2="285" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="451.66583760824" x2="458.09608004427" y1="268.08377578033" y2="262.29445620149" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="458.09608004427" x2="464.5263224803" y1="262.29445620149" y2="256.50513662265" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="435" x2="443.5" y1="264" y2="266.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="443.5" x2="452" y1="266.5" y2="269" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="436" x2="444" y1="262" y2="265" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="444" x2="452" y1="265" y2="268" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="455.26415281995" x2="453.46499521409" y1="285.01229753376" y2="276.54803665705" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="453.46499521409" x2="451.66583760824" y1="276.54803665705" y2="268.08377578033" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 443,297 458,287 454,284" fill-opacity="1"  style="fill:#000000" />
<line x1="425.94486786414" x2="434.17364985119" y1="291.243526315" y2="293.91723150322" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="434.17364985119" x2="442.40243183824" y1="293.91723150322" y2="296.59093669144" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="413.08314688243" x2="419.51400737329" y1="302.82340158234" y2="297.03346394867" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="419.51400737329" x2="425.94486786414" y1="297.03346394867" y2="291.243526315" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="397" x2="405" y1="299" y2="301.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="405" x2="413" y1="301.5" y2="304" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="397" x2="405.5" y1="297" y2="299.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="405.5" x2="414" y1="299.5" y2="302" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="383.76509803628" x2="390.19534047231" y1="309.05463036358" y2="303.26531078474" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="390.19534047231" x2="396.62558290833" y1="303.26531078474" y2="297.4759912059" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="389" x2="387" y1="326" y2="317.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="387" x2="385" y1="317.5" y2="309" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="387" x2="385" y1="327" y2="318.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="385" x2="383" y1="318.5" y2="310" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="374.50292837593" x2="380.93255275713" y1="337.5617912747" y2="331.77247169586" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="380.93255275713" x2="387.36217713833" y1="331.77247169586" y2="325.98315211702" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="403.82221333174" x2="395.59219523503" y1="331.33056249346" y2="328.65685730524" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="395.59219523503" x2="387.36217713833" y1="328.65685730524" y2="325.98315211702" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="417" x2="410.5" y1="320" y2="325.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="410.5" x2="404" y1="325.5" y2="331" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="418" x2="411.5" y1="321" y2="327" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="411.5" x2="405" y1="327" y2="333" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="416.68146209413" x2="414.88230448828" y1="319.75068722612" y2="311.28704440423" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="414.88230448828" x2="413.08314688243" y1="311.28704440423" y2="302.82340158234" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="446.00074704994" x2="444.20158944409" y1="313.51822233522" y2="305.05457951333" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="444.20158944409" x2="442.40243183824" y1="305.05457951333" y2="296.59093669144" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="434" x2="440.5" y1="326" y2="320.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="440.5" x2="447" y1="320.5" y2="315" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="433" x2="439.5" y1="325" y2="319" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="439.5" x2="446" y1="319" y2="313" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="462.45954713369" x2="454.23014709181" y1="318.86686882132" y2="316.19254557827" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #0000ff" />
<line x1="454.23014709181" x2="446.00074704994" y1="316.19254557827" y2="313.51822233522" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<polygon points=" 467,336 466,319 460,320" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="482.51666242915" x2="474.28726238727" y1="341.14032873188" y2="338.46662354366" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="474.28726238727" x2="466.05786234539" y1="338.46662354366" y2="335.79291835544" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="486.11497764085" x2="484.315820035" y1="358.06885048532" y2="349.6045896086" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="484.315820035" x2="482.51666242915" y1="349.6045896086" y2="341.14032873188" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="473.25325665914" x2="479.68411714999" y1="369.647489643" y2="363.85817006416" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="479.68411714999" x2="486.11497764085" y1="363.85817006416" y2="358.06885048532" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="502.57254161494" x2="494.3437596279" y1="363.41626086176" y2="360.74255567354" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="494.3437596279" x2="486.11497764085" y1="360.74255567354" y2="358.06885048532" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="453.19737747334" x2="459.62761990937" y1="347.37279362278" y2="341.58285598911" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="459.62761990937" x2="466.05786234539" y1="341.58285598911" y2="335.79291835544" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="436.73857738959" x2="444.96797743146" y1="342.02538324634" y2="344.69908843456" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="444.96797743146" x2="453.19737747334" y1="344.69908843456" y2="347.37279362278" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="458" x2="456.5" y1="365" y2="356.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="456.5" x2="455" y1="356.5" y2="348" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<line x1="456" x2="454.5" y1="365" y2="356.5" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #ff0000" />
<line x1="454.5" x2="453" y1="356.5" y2="348" style="stroke-opacity:1; stroke-width: 0.72865064570758; stroke: #000000" />
<ellipse cx="480.58709525448" cy="141.43692475659" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="480.58709525448" y="145.44450330798"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="495.57368873667" cy="115.47862195833" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="495.57368873667" y="119.48620050972"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="465.60050177228" cy="63.562016361814" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="465.60050177228" y="67.569594913206"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="495.57368873667" cy="63.562016361814" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="495.57368873667" y="67.569594913206"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="450.61267218043" cy="124.13138955775" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="450.61267218043" y="128.13896810914"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="435.62607869823" cy="98.173086759493" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="435.62607869823" y="102.18066531089"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="420.63948521604" cy="176.04799515427" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="420.63948521604" y="180.05557370566"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="450.61267218043" cy="176.04799515427" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="450.61267218043" y="180.05557370566"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="405.65289173384" cy="115.47862195833" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="405.65289173384" y="119.48620050972"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="390.66382603233" cy="141.43692475659" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="390.66382603233" y="145.44450330798"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="360.69063906794" cy="124.13138955775" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="360.69063906794" y="128.13896810914"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="375.67723255014" cy="150.08969235601" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="375.67723255014" y="154.0972709074"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="345.70404558575" cy="115.47862195833" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="345.70404558575" y="119.48620050972"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="315.7296225117" cy="115.47862195833" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="315.7296225117" y="119.48620050972"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="345.70404558575" cy="167.39522755485" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="345.70404558575" y="171.40280610624"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="315.7296225117" cy="167.39522755485" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="315.7296225117" y="171.40280610624"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="315.7296225117" cy="202.00629795253" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="315.7296225117" y="206.01387650392"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="330.7162159939" cy="227.96460075079" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="330.7162159939" y="231.97217930218"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="300.74302902951" cy="193.35353035311" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="300.74302902951" y="197.3611089045"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="270.76860595546" cy="193.35353035311" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="270.76860595546" y="197.3611089045"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="300.74302902951" cy="245.27013594963" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="300.74302902951" y="249.27771450102"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="270.76860595546" cy="245.27013594963" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="270.76860595546" y="249.27771450102"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="270.76860595546" cy="279.88120634731" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="270.76860595546" y="283.8887848987"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="285.75643554731" cy="305.83950914557" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="285.75643554731" y="309.84708769696"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="255.78201247327" cy="323.14504434441" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="255.78201247327" y="327.1526228958"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="225.80882550888" cy="323.14504434441" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="225.80882550888" y="327.1526228958"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="225.80882550888" cy="357.75611474208" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="225.80882550888" y="361.76369329348"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="240.79541899107" cy="383.71441754034" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.79541899107" y="387.72199609174"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="210.81975980737" cy="401.01995273918" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="210.81975980737" y="405.02753129057"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="180.84657284298" cy="401.01995273918" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="180.84657284298" y="405.02753129057"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="181.83298834931" cy="437.15020190539" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="181.83298834931" y="441.15778045678"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="161.77587305386" cy="414.87426977551" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="161.77587305386" y="418.8818483269"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="192.62669787476" cy="487.93082272707" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="192.62669787476" y="491.93840127846"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="212.68381317021" cy="510.20675485695" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="212.68381317021" y="514.21433340834"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="183.36452821441" cy="516.43798363819" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="183.36452821441" y="520.44556218958"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="136.05490330975" cy="438.03402031019" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="136.05490330975" y="442.04159886158"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="145.31830907976" cy="409.52685939907" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="145.31830907976" y="413.53443795046"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="101.99761003844" cy="425.93127065791" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="101.99761003844" y="429.9388492093"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="116.98667573995" cy="451.88957345617" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="116.98667573995" y="455.89715200756"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="72.024423074047" cy="443.23680585675" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="72.024423074047" y="447.24438440814"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="480.58709525448" cy="176.04799515427" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="480.58709525448" y="180.05557370566"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="510.56028221887" cy="176.04799515427" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="510.56028221887" y="180.05557370566"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="503.10654098679" cy="221.76551082063" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="503.10654098679" y="225.77308937202"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="483.05189791065" cy="199.48957869076" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="483.05189791065" y="203.49715724215"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="411.55160701733" cy="223.53438373989" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="411.55160701733" y="227.54196229128"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="420.816248897" cy="195.02722282877" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="420.816248897" y="199.03480138016"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="490.2472922244" cy="233.34414997831" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="490.2472922244" y="237.35172852971"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="460.92800726859" cy="239.57661486921" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="460.92800726859" y="243.5841934206"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="513.9014866219" cy="272.54736775197" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="513.9014866219" y="276.55494630336"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="504.63808085189" cy="301.05452866309" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="504.63808085189" y="305.06210721448"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="435.20703752449" cy="262.73636540389" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="435.20703752449" y="266.74394395528"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="455.26415281995" cy="285.01229753376" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="455.26415281995" y="289.01987608515"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="374.50292837593" cy="337.5617912747" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="374.50292837593" y="341.56936982609"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="433.14026217789" cy="325.09809760256" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="433.14026217789" y="329.10567615395"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="462.45954713369" cy="318.86686882132" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="462.45954713369" y="322.87444737271"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">N</text>
<ellipse cx="436.73857738959" cy="342.02538324634" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="436.73857738959" y="346.03296179773"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
<ellipse cx="456.79569268504" cy="364.30007926656" rx="4.7362291970993" ry="4.7362291970993" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="456.79569268504" y="368.30765781795"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:9.1081330713447px">O</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 117👍, 0💬