Molecule FYI-1001245

A

Molecule Summary:

ID: FYI-1001245
SMILES: Cc1cc(OCc2cn(Cc3ccc([N+](=O)[O-])cc3)nn2)ccc1Cl

Received at FYIcenter.com on: 2022-04-11

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001245
FYIcenter.com

 25 27  0  0  0  0  0  0  0  0999 V2000
   13.1418   10.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1418    8.9341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9294    8.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9294    6.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7170    6.1341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5044    6.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2921    6.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0132    6.7035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0763    5.6631    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6840    5.8094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8611    4.6768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4688    4.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6458    3.6905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2152    2.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3924    1.2790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.4253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9618    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6077    2.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4306    3.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7763    4.4507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1458    4.7418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1418    6.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3542    6.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3542    8.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5667    8.9341    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 15  2  0  0  0  0
 18 14  1  0  0  0  0
 19 18  2  0  0  0  0
 19 11  1  0  0  0  0
 20  9  1  0  0  0  0
 21 20  2  0  0  0  0
 21  7  1  0  0  0  0
 22  4  2  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 24  2  1  0  0  0  0
 25 24  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="460.70126327353" x2="460.70126327353" y1="410.0048883193" y2="432.30441230319" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="460.70126327353" x2="460.70126327353" y1="432.30441230319" y2="454.60393628707" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="421" x2="440.5" y1="390" y2="401.5" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="440.5" x2="460" y1="401.5" y2="413" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="424" x2="443" y1="386" y2="397" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="443" x2="462" y1="397" y2="408" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="422.07848773343" x2="422.07848773343" y1="343.10631636763" y2="365.40584035152" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="422.07848773343" x2="422.07848773343" y1="365.40584035152" y2="387.70536433541" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="383.45571219334" x2="402.76709996338" y1="320.80679238374" y2="331.95655437569" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #ff0000" />
<line x1="402.76709996338" x2="422.07848773343" y1="331.95655437569" y2="343.10631636763" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="344.82656536067" x2="364.141138777" y1="343.10631636763" y2="331.95655437569" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="364.141138777" x2="383.45571219334" y1="331.95655437569" y2="320.80679238374" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #ff0000" />
<line x1="306.20697546686" x2="325.51677041377" y1="320.80679238374" y2="331.95655437569" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="325.51677041377" x2="344.82656536067" y1="331.95655437569" y2="343.10631636763" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="267" x2="287.5" y1="342" y2="332.5" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="287.5" x2="308" y1="332.5" y2="323" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="265" x2="285.5" y1="337" y2="328" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="285.5" x2="306" y1="328" y2="319" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="235.619425119" x2="250.54258513365" y1="305.80239838887" y2="322.37413035518" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="250.54258513365" x2="265.4657451483" y1="322.37413035518" y2="338.94586232149" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="191.26567191505" x2="213.44254851703" y1="310.4629989015" y2="308.13269864518" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="213.44254851703" x2="235.619425119" y1="308.13269864518" y2="305.80239838887" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="165.05098864885" x2="178.15833028195" y1="274.38236909557" y2="292.42268399854" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="178.15833028195" x2="191.26567191505" y1="292.42268399854" y2="310.4629989015" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="121" x2="143.5" y1="282" y2="279.5" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="143.5" x2="166" y1="279.5" y2="277" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="121" x2="143" y1="277" y2="275" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="143" x2="165" y1="275" y2="273" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="94.479366532406" x2="107.58830098865" y1="242.96233980227" y2="261.00265470524" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="107.58830098865" x2="120.69723544489" y1="261.00265470524" y2="279.0429696082" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="111" x2="102" y1="202" y2="222.5" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="102" x2="93" y1="222.5" y2="243" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="115" x2="106" y1="204" y2="224" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="106" x2="97" y1="224" y2="244" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="86.406938850238" x2="99.512687660198" y1="166.14047967777" y2="184.18079458074" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="99.512687660198" x2="112.61843647016" y1="184.18079458074" y2="202.22110948371" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="43" x2="65" y1="174" y2="171.5" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #ff0000" />
<line x1="65" x2="87" y1="171.5" y2="169" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="42" x2="64.5" y1="169" y2="166.5" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #ff0000" />
<line x1="64.5" x2="87" y1="166.5" y2="164" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="103" x2="94" y1="125" y2="145.5" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #ff0000" />
<line x1="94" x2="85" y1="145.5" y2="166" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="107" x2="98" y1="127" y2="147.5" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #ff0000" />
<line x1="98" x2="89" y1="147.5" y2="168" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="156.97856096668" x2="134.79849871842" y1="197.55732332479" y2="199.88921640425" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="134.79849871842" x2="112.61843647016" y1="199.88921640425" y2="202.22110948371" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="186" x2="172.5" y1="233" y2="215" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="172.5" x2="159" y1="215" y2="197" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="182" x2="169" y1="236" y2="217.5" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="169" x2="156" y1="217.5" y2="199" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="183.19324423288" x2="174.12211644086" y1="233.641138777" y2="254.01175393629" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="174.12211644086" x2="165.05098864885" y1="254.01175393629" y2="274.38236909557" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="257.91894910289" x2="246.76918711095" y1="267.17962284877" y2="286.49101061882" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="246.76918711095" x2="235.619425119" y1="286.49101061882" y2="305.80239838887" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="303" x2="281" y1="275" y2="270" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="281" x2="259" y1="270" y2="265" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="302" x2="280" y1="279" y2="274.5" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="280" x2="258" y1="274.5" y2="270" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="301.54637495423" x2="303.87667521055" y1="276.45303917979" y2="298.62991578176" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #0000ff" />
<line x1="303.87667521055" x2="306.20697546686" y1="298.62991578176" y2="320.80679238374" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="460" x2="440.5" y1="319" y2="330.5" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="440.5" x2="421" y1="330.5" y2="342" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="462" x2="443" y1="323" y2="334.5" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="443" x2="424" y1="334.5" y2="346" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="499.32403881362" x2="480.01265104357" y1="343.10631636763" y2="331.95655437569" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="480.01265104357" x2="460.70126327353" y1="331.95655437569" y2="320.80679238374" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="502" x2="502" y1="388" y2="366" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="502" x2="502" y1="366" y2="344" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="497" x2="497" y1="388" y2="366" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="497" x2="497" y1="366" y2="344" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="499.32403881362" x2="480.01265104357" y1="387.70536433541" y2="398.85512632735" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="480.01265104357" x2="460.70126327353" y1="398.85512632735" y2="410.0048883193" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<line x1="537.95" x2="518.63701940681" y1="410.0048883193" y2="398.85512632735" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #00bc00" />
<line x1="518.63701940681" x2="499.32403881362" y1="398.85512632735" y2="387.70536433541" style="stroke-opacity:1; stroke-width: 1.8778387734612; stroke: #000000" />
<ellipse cx="383.45571219334" cy="320.80679238374" rx="12.205952027498" ry="12.205952027498" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="383.45571219334" y="331.13490563778"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.472984668265px">O</text>
<ellipse cx="235.619425119" cy="305.80239838887" rx="12.205952027498" ry="12.205952027498" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="235.619425119" y="316.13051164291"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.472984668265px">N</text>
<ellipse cx="86.406938850238" cy="166.14047967777" rx="12.205952027498" ry="12.205952027498" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="86.406938850238" y="176.46859293181"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.472984668265px">N</text>
<ellipse cx="42.05" cy="170.80108019041" rx="12.205952027498" ry="12.205952027498" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="181.12919344444"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.472984668265px">O</text>
<ellipse cx="104.54600878799" cy="125.39606371293" rx="12.205952027498" ry="12.205952027498" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="104.54600878799" y="135.72417696696"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.472984668265px">O</text>
<ellipse cx="257.91894910289" cy="267.17962284877" rx="12.205952027498" ry="12.205952027498" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="257.91894910289" y="277.50773610281"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.472984668265px">N</text>
<ellipse cx="301.54637495423" cy="276.45303917979" rx="12.205952027498" ry="12.205952027498" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="301.54637495423" y="286.78115243382"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.472984668265px">N</text>
<ellipse cx="537.95" cy="410.0048883193" rx="12.205952027498" ry="12.205952027498" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="420.33300157333"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:23.472984668265px">Cl</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 123👍, 0💬