Molecule FYI-1001250

A

Molecule Summary:

ID: FYI-1001250
SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC1=CN=C-N1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)O

Received at FYIcenter.com on: 2022-04-12

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001250
FYIcenter.com

 41 41  0  0  1  0  0  0  0  0999 V2000
    0.0000    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6114    4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3990    2.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2785    8.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9090    8.6834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2090    7.4710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1459    6.4306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    2.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    4.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3990    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3990    7.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    2.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3367    4.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5493    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1865    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5493    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7617    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7617    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7617    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9741    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1865    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6  0  0  0
  3 21  1  0  0  0  0
  4  2  1  0  0  0  0
  5  4  1  0  0  0  0
  6  2  1  0  0  0  0
  7  6  2  0  0  0  0
  8  6  1  0  0  0  0
  9  8  1  1  0  0  0
 10 21  2  0  0  0  0
 11  9  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 16 12  1  0  0  0  0
 17  9  1  0  0  0  0
 18 17  2  0  0  0  0
 19 17  1  0  0  0  0
 20 19  1  6  0  0  0
 21 41  1  0  0  0  0
 22 20  1  0  0  0  0
 23 20  1  0  0  0  0
 24 23  2  0  0  0  0
 25 23  1  0  0  0  0
 26 25  1  1  0  0  0
 27 35  1  0  0  0  0
 28 26  1  0  0  0  0
 29 28  1  0  0  0  0
 30 28  1  0  0  0  0
 31 26  1  0  0  0  0
 32 31  2  0  0  0  0
 33 31  1  0  0  0  0
 34 33  1  6  0  0  0
 35 41  1  0  0  0  0
 36 34  1  0  0  0  0
 37 36  1  0  0  0  0
 38 34  1  0  0  0  0
 39 38  2  0  0  0  0
 40 38  1  0  0  0  0
 41 40  1  1  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><polygon points=" 72,237 40,249 45,258" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="537.95" x2="523.36513046178" y1="303.43241943779" y2="295.0115940693" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="523.36513046178" x2="508.78026092357" y1="295.0115940693" y2="286.59076870082" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="71.219739076433" x2="71.219739076433" y1="202.38251501596" y2="219.22416575293" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="71.219739076433" x2="71.219739076433" y1="219.22416575293" y2="236.0658164899" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="42.05" x2="56.634869538217" y1="185.54086427899" y2="193.96168964748" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="56.634869538217" x2="71.219739076433" y1="193.96168964748" y2="202.38251501596" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="100.38947815287" x2="85.80460861465" y1="252.90746722687" y2="244.48664185839" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="85.80460861465" x2="71.219739076433" y1="244.48664185839" y2="236.0658164899" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="129" x2="114.5" y1="235" y2="243.5" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="114.5" x2="100" y1="243.5" y2="252" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="131" x2="116.5" y1="238" y2="246.5" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="116.5" x2="102" y1="246.5" y2="255" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="100.38947815287" x2="100.38947815287" y1="286.59076870082" y2="269.74911796385" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #0000ff" />
<line x1="100.38947815287" x2="100.38947815287" y1="269.74911796385" y2="252.90746722687" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<polygon points=" 130,304 103,283 98,291" fill-opacity="1"  style="fill:#000000" />
<line x1="508" x2="508" y1="253" y2="270" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="508" x2="508" y1="270" y2="287" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="511" x2="511" y1="253" y2="270" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="511" x2="511" y1="270" y2="287" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="129.5592172293" x2="129.5592172293" y1="337.11572091173" y2="320.27407017476" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="129.5592172293" x2="129.5592172293" y1="320.27407017476" y2="303.43241943779" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="100.38947815287" x2="114.97434769108" y1="353.9573716487" y2="345.53654628021" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="114.97434769108" x2="129.5592172293" y1="345.53654628021" y2="337.11572091173" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="99" x2="101" y1="388" y2="371.5" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="101" x2="103" y1="371.5" y2="355" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="96" x2="97.5" y1="388" y2="371" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="97.5" x2="99" y1="371" y2="354" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="63.920086457009" x2="80.394829802925" y1="394.45913572101" y2="390.95727534277" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #0000ff" />
<line x1="80.394829802925" x2="96.86957314884" y1="390.95727534277" y2="387.45541496453" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="46" x2="54.5" y1="367" y2="381.5" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="54.5" x2="63" y1="381.5" y2="396" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #0000ff" />
<line x1="49" x2="57.5" y1="365" y2="379.5" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="57.5" x2="66" y1="379.5" y2="394" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #0000ff" />
<line x1="69.619782256421" x2="58.34910898823" y1="340.25789174923" y2="352.7736441969" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #0000ff" />
<line x1="58.34910898823" x2="47.078435720038" y1="352.7736441969" y2="365.28939664458" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="69.619782256421" x2="85.004630204644" y1="340.25789174923" y2="347.10763169896" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #0000ff" />
<line x1="85.004630204644" x2="100.38947815287" y1="347.10763169896" y2="353.9573716487" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="158.73376820594" x2="144.14649271762" y1="286.59076870082" y2="295.0115940693" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="144.14649271762" x2="129.5592172293" y1="295.0115940693" y2="303.43241943779" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="157" x2="157" y1="253" y2="270" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="157" x2="157" y1="270" y2="287" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="161" x2="161" y1="253" y2="270" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="161" x2="161" y1="270" y2="287" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="187.90350728238" x2="173.31863774416" y1="303.43241943779" y2="295.0115940693" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #0000ff" />
<line x1="173.31863774416" x2="158.73376820594" y1="295.0115940693" y2="286.59076870082" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<polygon points=" 218,287 186,300 191,308" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="508.78026092357" x2="494.1941884103" y1="286.59076870082" y2="295.0115940693" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="494.1941884103" x2="479.60811589703" y1="295.0115940693" y2="303.43241943779" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="217.07324635881" x2="217.07324635881" y1="252.90746722687" y2="269.74911796385" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="217.07324635881" x2="217.07324635881" y1="269.74911796385" y2="286.59076870082" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="246.24298543524" x2="231.65811589703" y1="303.43241943779" y2="295.0115940693" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="231.65811589703" x2="217.07324635881" y1="295.0115940693" y2="286.59076870082" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="249" x2="249" y1="338" y2="321" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="249" x2="249" y1="321" y2="304" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="245" x2="245" y1="338" y2="321" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="245" x2="245" y1="321" y2="304" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="275.41513046178" x2="260.82905794851" y1="286.59076870082" y2="295.0115940693" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #0000ff" />
<line x1="260.82905794851" x2="246.24298543524" y1="295.0115940693" y2="303.43241943779" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<polygon points=" 305,304 278,283 273,291" fill-opacity="1"  style="fill:#000000" />
<line x1="508.78026092357" x2="494.1941884103" y1="353.9573716487" y2="345.53654628021" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="494.1941884103" x2="479.60811589703" y1="345.53654628021" y2="337.11572091173" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="304.58486953822" x2="304.58486953822" y1="337.11572091173" y2="320.27407017476" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="304.58486953822" x2="304.58486953822" y1="320.27407017476" y2="303.43241943779" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="333.75460861465" x2="319.16973907643" y1="353.9573716487" y2="345.53654628021" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="319.16973907643" x2="304.58486953822" y1="345.53654628021" y2="337.11572091173" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="275.41513046178" x2="290" y1="353.9573716487" y2="345.53654628021" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="290" x2="304.58486953822" y1="345.53654628021" y2="337.11572091173" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="333.75460861465" x2="319.16973907643" y1="286.59076870082" y2="295.0115940693" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="319.16973907643" x2="304.58486953822" y1="295.0115940693" y2="303.43241943779" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="332" x2="332" y1="253" y2="270" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="332" x2="332" y1="270" y2="287" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="336" x2="336" y1="253" y2="270" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="336" x2="336" y1="270" y2="287" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="362.92434769108" x2="348.33947815287" y1="303.43241943779" y2="295.0115940693" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #0000ff" />
<line x1="348.33947815287" x2="333.75460861465" y1="295.0115940693" y2="286.59076870082" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<polygon points=" 393,287 361,300 366,308" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="479.60811589703" x2="479.60811589703" y1="337.11572091173" y2="320.27407017476" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="479.60811589703" x2="479.60811589703" y1="320.27407017476" y2="303.43241943779" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="392.09889866773" x2="392.09889866773" y1="252.90746722687" y2="269.74911796385" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="392.09889866773" x2="392.09889866773" y1="269.74911796385" y2="286.59076870082" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="421.26863774416" x2="406.68376820594" y1="236.0658164899" y2="244.48664185839" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="406.68376820594" x2="392.09889866773" y1="244.48664185839" y2="252.90746722687" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="421.26863774416" x2="406.68376820594" y1="303.43241943779" y2="295.0115940693" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="406.68376820594" x2="392.09889866773" y1="295.0115940693" y2="286.59076870082" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="424" x2="424" y1="338" y2="321" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="424" x2="424" y1="321" y2="304" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="420" x2="420" y1="338" y2="321" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #ff0000" />
<line x1="420" x2="420" y1="321" y2="304" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<line x1="450.43837682059" x2="435.85350728238" y1="286.59076870082" y2="295.0115940693" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #0000ff" />
<line x1="435.85350728238" x2="421.26863774416" y1="295.0115940693" y2="303.43241943779" style="stroke-opacity:1; stroke-width: 1.4182409774928; stroke: #000000" />
<polygon points=" 480,304 453,283 448,291" fill-opacity="1"  style="fill:#000000" />
<ellipse cx="42.05" cy="252.90746722687" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="260.70779260309"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">N</text>
<ellipse cx="537.95" cy="303.43241943779" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="311.232744814"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">O</text>
<ellipse cx="42.05" cy="185.54086427899" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="193.3411896552"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">O</text>
<ellipse cx="129.5592172293" cy="236.0658164899" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="129.5592172293" y="243.86614186611"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">O</text>
<ellipse cx="100.38947815287" cy="286.59076870082" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="100.38947815287" y="294.39109407703"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">N</text>
<ellipse cx="508.78026092357" cy="252.90746722687" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="508.78026092357" y="260.70779260309"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">O</text>
<ellipse cx="63.920086457009" cy="394.45913572101" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="63.920086457009" y="402.25946109722"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">N</text>
<ellipse cx="69.619782256421" cy="340.25789174923" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="69.619782256421" y="348.05821712544"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">N</text>
<ellipse cx="158.73376820594" cy="252.90746722687" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="158.73376820594" y="260.70779260309"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">O</text>
<ellipse cx="187.90350728238" cy="303.43241943779" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="187.90350728238" y="311.232744814"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">N</text>
<ellipse cx="246.24298543524" cy="337.11572091173" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="246.24298543524" y="344.91604628794"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">O</text>
<ellipse cx="275.41513046178" cy="286.59076870082" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="275.41513046178" y="294.39109407703"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">N</text>
<ellipse cx="508.78026092357" cy="353.9573716487" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="508.78026092357" y="361.75769702491"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">O</text>
<ellipse cx="333.75460861465" cy="252.90746722687" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="333.75460861465" y="260.70779260309"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">O</text>
<ellipse cx="362.92434769108" cy="303.43241943779" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="362.92434769108" y="311.232744814"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">N</text>
<ellipse cx="421.26863774416" cy="236.0658164899" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="421.26863774416" y="243.86614186611"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">O</text>
<ellipse cx="421.26863774416" cy="337.11572091173" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="421.26863774416" y="344.91604628794"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">O</text>
<ellipse cx="450.43837682059" cy="286.59076870082" rx="9.2185663537034" ry="9.2185663537034" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="450.43837682059" y="294.39109407703"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:17.72801221866px">N</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 124👍, 0💬