Molecule FYI-1001241

A

Molecule Summary:

ID: FYI-1001241
SMILES: CC1(C)CCC(CC1)Cc1cc(O)c(c(=O)[nH]1)c1ccccc1

Received at FYIcenter.com on: 2022-04-07

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001241
FYIcenter.com

 23 25  0  0  0  0  0  0  0  0999 V2000
   11.6119    1.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3119    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  2  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  8  2  1  0  0  0  0
  9  6  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 12  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 15  1  0  0  0  0
 17 10  1  0  0  0  0
 18 14  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 21  1  0  0  0  0
 23 22  2  0  0  0  0
 23 18  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="481.56468091846" x2="495.66000373622" y1="304.09733672301" y2="279.68074951876" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="495.66000373622" x2="509.75532655398" y1="279.68074951876" y2="255.26416231451" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="537.95" x2="509.75734045923" y1="304.09733672301" y2="304.09733672301" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="509.75734045923" x2="481.56468091846" y1="304.09733672301" y2="304.09733672301" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="481.56468091846" x2="481.56468091846" y1="360.48668361504" y2="332.29201016902" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="481.56468091846" x2="481.56468091846" y1="332.29201016902" y2="304.09733672301" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="432.72747869947" x2="457.14607980897" y1="388.68135706105" y2="374.58402033805" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="457.14607980897" x2="481.56468091846" y1="374.58402033805" y2="360.48668361504" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="383.89430429097" x2="408.31089149522" y1="360.48668361504" y2="374.58402033805" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="408.31089149522" x2="432.72747869947" y1="374.58402033805" y2="388.68135706105" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="383.89430429097" x2="383.89430429097" y1="304.09733672301" y2="332.29201016902" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="383.89430429097" x2="383.89430429097" y1="332.29201016902" y2="360.48668361504" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="432.72747869947" x2="408.31089149522" y1="275.90266327699" y2="290" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="408.31089149522" x2="383.89430429097" y1="290" y2="304.09733672301" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="432.72747869947" x2="457.14607980897" y1="275.90266327699" y2="290" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="457.14607980897" x2="481.56468091846" y1="290" y2="304.09733672301" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="335.05710207198" x2="359.47570318147" y1="388.68135706105" y2="374.58402033805" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="359.47570318147" x2="383.89430429097" y1="374.58402033805" y2="360.48668361504" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="286.22392766348" x2="310.64051486773" y1="360.48668361504" y2="374.58402033805" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="310.64051486773" x2="335.05710207198" y1="374.58402033805" y2="388.68135706105" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="239" x2="263.5" y1="392" y2="378" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="263.5" x2="288" y1="378" y2="364" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="236" x2="260.5" y1="387" y2="372.5" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="260.5" x2="285" y1="372.5" y2="358" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="188.55355103599" x2="212.97215214549" y1="360.48668361504" y2="374.58402033805" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="212.97215214549" x2="237.39075325498" y1="374.58402033805" y2="388.68135706105" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="139.72037662749" x2="164.13696383174" y1="388.68135706105" y2="374.58402033805" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #ff0000" />
<line x1="164.13696383174" x2="188.55355103599" y1="374.58402033805" y2="360.48668361504" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="186" x2="186" y1="305" y2="333" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="186" x2="186" y1="333" y2="361" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="192" x2="192" y1="305" y2="333" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="192" x2="192" y1="333" y2="361" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="237.39075325498" x2="212.97215214549" y1="275.90266327699" y2="290" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="212.97215214549" x2="188.55355103599" y1="290" y2="304.09733672301" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="235" x2="235" y1="220" y2="248" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #ff0000" />
<line x1="235" x2="235" y1="248" y2="276" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="241" x2="241" y1="220" y2="248" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #ff0000" />
<line x1="241" x2="241" y1="248" y2="276" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="286.22392766348" x2="261.80734045923" y1="304.09733672301" y2="290" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #0000ff" />
<line x1="261.80734045923" x2="237.39075325498" y1="290" y2="275.90266327699" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="286.22392766348" x2="286.22392766348" y1="304.09733672301" y2="332.29201016902" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #0000ff" />
<line x1="286.22392766348" x2="286.22392766348" y1="332.29201016902" y2="360.48668361504" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="139.72037662749" x2="164.13696383174" y1="275.90266327699" y2="290" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="164.13696383174" x2="188.55355103599" y1="290" y2="304.09733672301" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="93" x2="117.5" y1="307" y2="293" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="117.5" x2="142" y1="293" y2="279" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="90" x2="114.5" y1="302" y2="288" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="114.5" x2="139" y1="288" y2="274" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="42.05" x2="66.46658720425" y1="275.90266327699" y2="290" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="66.46658720425" x2="90.883174408499" y1="290" y2="304.09733672301" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="40" x2="40" y1="220" y2="248" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="40" x2="40" y1="248" y2="276" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="46" x2="46" y1="220" y2="248" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="46" x2="46" y1="248" y2="276" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="90.883174408499" x2="66.46658720425" y1="191.31864293895" y2="205.41597966195" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="66.46658720425" x2="42.05" y1="205.41597966195" y2="219.51331638496" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="142" x2="117.5" y1="217" y2="203" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="117.5" x2="93" y1="203" y2="189" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="139" x2="114.5" y1="223" y2="208.5" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="114.5" x2="90" y1="208.5" y2="194" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="139.72037662749" x2="139.72037662749" y1="219.51331638496" y2="247.70798983098" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<line x1="139.72037662749" x2="139.72037662749" y1="247.70798983098" y2="275.90266327699" style="stroke-opacity:1; stroke-width: 2.3742878230926; stroke: #000000" />
<ellipse cx="139.72037662749" cy="388.68135706105" rx="15.432870850102" ry="15.432870850102" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="139.72037662749" y="401.73994008806"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:29.678597788658px">O</text>
<ellipse cx="237.39075325498" cy="219.51331638496" rx="15.432870850102" ry="15.432870850102" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="237.39075325498" y="232.57189941197"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:29.678597788658px">O</text>
<ellipse cx="286.22392766348" cy="304.09733672301" rx="15.432870850102" ry="15.432870850102" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="286.22392766348" y="317.15591975002"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:29.678597788658px">N</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 122👍, 0💬