Molecule FYI-1001237

A

Molecule Summary:

ID: FYI-1001237
SMILES: CCC(O)[C@@](C)(O)[C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@](C)(O)[C@H](O[C@@H]1O[C@H](C)C[C@@H]([C@H]1O)N(C)C)[C@@H](C)[C@H](O[C@H]1C[C@@](C)(OC)C(=O)[C@H](C)O1)[C@@H](C)C([O-])=O

Received at FYIcenter.com on: 2022-04-04

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001237
FYIcenter.com

 52 53  0  0  1  0  0  0  0  0999 V2000
   12.1244    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0368    4.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7368    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7870    6.4876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1870    6.4876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    9.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    9.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    9.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119   11.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870   11.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746   12.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995   14.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119   14.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870   14.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    9.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   11.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   13.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248   14.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124   14.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124   11.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   12.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    9.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    9.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    5.6000    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0
    2.4248    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  3  1  0  0  0  0
  6  5  1  0  0  0  0
  5  7  1  6  0  0  0
  8  5  1  0  0  0  0
  8  9  1  6  0  0  0
 10  8  1  0  0  0  0
 10 11  1  6  0  0  0
 12 10  1  0  0  0  0
 13 12  2  0  0  0  0
 14 12  1  0  0  0  0
 14 15  1  1  0  0  0
 16 14  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 17 19  1  1  0  0  0
 20 17  1  0  0  0  0
 20 21  1  1  0  0  0
 22 21  1  1  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 24 25  1  1  0  0  0
 26 24  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 28 22  1  0  0  0  0
 28 29  1  6  0  0  0
 27 30  1  1  0  0  0
 31 30  1  0  0  0  0
 32 30  1  0  0  0  0
 33 20  1  0  0  0  0
 33 34  1  1  0  0  0
 35 33  1  0  0  0  0
 35 36  1  1  0  0  0
 37 36  1  6  0  0  0
 38 37  1  0  0  0  0
 39 38  1  0  0  0  0
 39 40  1  1  0  0  0
 41 39  1  0  0  0  0
 42 41  1  0  0  0  0
 43 39  1  0  0  0  0
 44 43  2  0  0  0  0
 45 43  1  0  0  0  0
 45 46  1  1  0  0  0
 47 45  1  0  0  0  0
 47 37  1  0  0  0  0
 48 35  1  0  0  0  0
 48 49  1  6  0  0  0
 50 48  1  0  0  0  0
 51 50  1  0  0  0  0
 52 50  2  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="450.04155583302" x2="450.04155583302" y1="89.779802942294" y2="66.224485641388" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="450.04155583302" x2="450.04155583302" y1="66.224485641388" y2="42.669168340481" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="490.83936539819" x2="470.4404606156" y1="113.3351202432" y2="101.55746159275" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="470.4404606156" x2="450.04155583302" y1="101.55746159275" y2="89.779802942294" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="531.63717496336" x2="511.23827018077" y1="89.779802942294" y2="101.55746159275" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<line x1="511.23827018077" x2="490.83936539819" y1="101.55746159275" y2="113.3351202432" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="490.83936539819" x2="490.83936539819" y1="160.44575484501" y2="136.89043754411" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="490.83936539819" x2="490.83936539819" y1="136.89043754411" y2="113.3351202432" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="514.39468269909" x2="502.61702404864" y1="201.24356441018" y2="180.8446596276" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="502.61702404864" x2="490.83936539819" y1="180.8446596276" y2="160.44575484501" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<polygon points=" 491,161 538,168 538,154" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="450.04155583302" x2="470.4404606156" y1="184.00107214592" y2="172.22341349547" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="470.4404606156" x2="490.83936539819" y1="172.22341349547" y2="160.44575484501" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<polygon points=" 451,185 413,155 406,167" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="450.04155583302" x2="450.04155583302" y1="231.11170674773" y2="207.55638944683" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="450.04155583302" x2="450.04155583302" y1="207.55638944683" y2="184.00107214592" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<polygon points=" 451,232 488,261 495,249" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="409.24038122252" x2="429.64096852777" y1="254.66702404864" y2="242.88936539819" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="429.64096852777" x2="450.04155583302" y1="242.88936539819" y2="231.11170674773" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="368" x2="388.5" y1="234" y2="245.5" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<line x1="388.5" x2="409" y1="245.5" y2="257" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="370" x2="390.5" y1="229" y2="241" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<line x1="390.5" x2="411" y1="241" y2="253" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="409.24038122252" x2="409.24038122252" y1="301.77765865045" y2="278.22234134955" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="409.24038122252" x2="409.24038122252" y1="278.22234134955" y2="254.66702404864" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<polygon points=" 410,302 447,332 454,320" fill-opacity="1"  style="fill:#000000" />
<line x1="368.44257165735" x2="388.84147643993" y1="325.33297595136" y2="313.55531730091" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="388.84147643993" x2="409.24038122252" y1="313.55531730091" y2="301.77765865045" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="327.64139704685" x2="348.0419843521" y1="301.77765865045" y2="313.55531730091" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="348.0419843521" x2="368.44257165735" y1="313.55531730091" y2="325.33297595136" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="304.08607974594" x2="315.8637383964" y1="260.97984908528" y2="281.37875386787" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="315.8637383964" x2="327.64139704685" y1="281.37875386787" y2="301.77765865045" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<polygon points=" 328,302 358,265 346,258" fill-opacity="1"  style="fill:#000000" />
<line x1="286.84358748168" x2="307.24249226426" y1="325.33297595136" y2="313.55531730091" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="307.24249226426" x2="327.64139704685" y1="313.55531730091" y2="301.77765865045" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<polygon points=" 287,326 280,373 294,373" fill-opacity="1"  style="fill:#000000" />
<polygon points=" 328,396 291,367 284,379" fill-opacity="1"  style="fill:#000000" />
<line x1="368.44257165735" x2="348.0419843521" y1="372.44361055317" y2="384.22126920363" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<line x1="348.0419843521" x2="327.64139704685" y1="384.22126920363" y2="395.99892785408" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="409.24038122252" x2="388.84147643993" y1="395.99892785408" y2="384.22126920363" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="388.84147643993" x2="368.44257165735" y1="384.22126920363" y2="372.44361055317" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<polygon points=" 410,396 454,379 447,367" fill-opacity="1"  style="fill:#000000" />
<line x1="409.24038122252" x2="409.24038122252" y1="443.10956245589" y2="419.55424515499" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="409.24038122252" x2="409.24038122252" y1="419.55424515499" y2="395.99892785408" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="368.44257165735" x2="388.84147643993" y1="466.6648797568" y2="454.88722110635" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="388.84147643993" x2="409.24038122252" y1="454.88722110635" y2="443.10956245589" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="327.64139704685" x2="348.0419843521" y1="443.10956245589" y2="454.88722110635" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="348.0419843521" x2="368.44257165735" y1="454.88722110635" y2="466.6648797568" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="327.64139704685" x2="327.64139704685" y1="443.10956245589" y2="419.55424515499" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="327.64139704685" x2="327.64139704685" y1="419.55424515499" y2="395.99892785408" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<polygon points=" 328,444 284,461 291,473" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<polygon points=" 369,467 362,514 376,514" fill-opacity="1"  style="fill:#000000" />
<line x1="409.24038122252" x2="388.84147643993" y1="537.33083165952" y2="525.55317300907" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="388.84147643993" x2="368.44257165735" y1="525.55317300907" y2="513.77551435861" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #0000ff" />
<line x1="327.64139704685" x2="348.0419843521" y1="537.33083165952" y2="525.55317300907" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="348.0419843521" x2="368.44257165735" y1="525.55317300907" y2="513.77551435861" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #0000ff" />
<line x1="246.04577791651" x2="266.44468269909" y1="301.77765865045" y2="313.55531730091" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="266.44468269909" x2="286.84358748168" y1="313.55531730091" y2="325.33297595136" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<polygon points=" 247,302 254,255 239,255" fill-opacity="1"  style="fill:#000000" />
<line x1="205.24460330601" x2="225.64519061126" y1="325.33297595136" y2="313.55531730091" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="225.64519061126" x2="246.04577791651" y1="313.55531730091" y2="301.77765865045" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<polygon points=" 206,326 199,373 213,373" fill-opacity="1"  style="fill:#000000" />
<polygon points=" 165,396 209,379 202,367" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="164.44679374084" x2="164.44679374084" y1="443.10956245589" y2="419.55424515499" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="164.44679374084" x2="164.44679374084" y1="419.55424515499" y2="395.99892785408" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="123.64561913034" x2="144.04620643559" y1="466.6648797568" y2="454.88722110635" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="144.04620643559" x2="164.44679374084" y1="454.88722110635" y2="443.10956245589" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<polygon points=" 124,467 161,497 168,485" fill-opacity="1"  style="fill:#000000" />
<line x1="123.64561913034" x2="123.64561913034" y1="513.77551435861" y2="490.22019705771" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<line x1="123.64561913034" x2="123.64561913034" y1="490.22019705771" y2="466.6648797568" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="82.84780956517" x2="103.24671434776" y1="537.33083165952" y2="525.55317300907" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="103.24671434776" x2="123.64561913034" y1="525.55317300907" y2="513.77551435861" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<line x1="82.84780956517" x2="103.24671434776" y1="443.10956245589" y2="454.88722110635" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="103.24671434776" x2="123.64561913034" y1="454.88722110635" y2="466.6648797568" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="44" x2="64.5" y1="469" y2="457.5" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<line x1="64.5" x2="85" y1="457.5" y2="446" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="41" x2="61.5" y1="465" y2="453" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<line x1="61.5" x2="82" y1="453" y2="441" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="82.84780956517" x2="82.84780956517" y1="395.99892785408" y2="419.55424515499" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="82.84780956517" x2="82.84780956517" y1="419.55424515499" y2="443.10956245589" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<polygon points=" 83,396 46,367 39,379" fill-opacity="1"  style="fill:#000000" />
<line x1="123.64561913034" x2="103.24671434776" y1="372.44361055317" y2="384.22126920363" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<line x1="103.24671434776" x2="82.84780956517" y1="384.22126920363" y2="395.99892785408" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="123.64561913034" x2="144.04620643559" y1="372.44361055317" y2="384.22126920363" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<line x1="144.04620643559" x2="164.44679374084" y1="384.22126920363" y2="395.99892785408" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="164.44679374084" x2="184.84569852342" y1="301.77765865045" y2="313.55531730091" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="184.84569852342" x2="205.24460330601" y1="313.55531730091" y2="325.33297595136" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<polygon points=" 165,302 121,320 128,332" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="164.44679374084" x2="164.44679374084" y1="254.66702404864" y2="278.22234134955" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="164.44679374084" x2="164.44679374084" y1="278.22234134955" y2="301.77765865045" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="205.24460330601" x2="184.84569852342" y1="231.11170674773" y2="242.88936539819" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<line x1="184.84569852342" x2="164.44679374084" y1="242.88936539819" y2="254.66702404864" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="123" x2="143.5" y1="234" y2="245.5" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<line x1="143.5" x2="164" y1="245.5" y2="257" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<line x1="125" x2="145.5" y1="229" y2="241" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #ff0000" />
<line x1="145.5" x2="166" y1="241" y2="253" style="stroke-opacity:1; stroke-width: 1.9836117287801; stroke: #000000" />
<ellipse cx="531.63717496336" cy="89.779802942294" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="531.63717496336" y="100.68966745058"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O</text>
<ellipse cx="537.95" cy="160.44575484501" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="171.3556193533"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O</text>
<ellipse cx="409.24038122252" cy="160.44575484501" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="409.24038122252" y="171.3556193533"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O</text>
<ellipse cx="368.44257165735" cy="231.11170674773" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="368.44257165735" y="242.02157125602"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O</text>
<ellipse cx="351.19671434776" cy="260.97984908528" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="351.19671434776" y="271.88971359357"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O</text>
<ellipse cx="286.84358748168" cy="372.44361055317" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="286.84358748168" y="383.35347506146"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O</text>
<ellipse cx="368.44257165735" cy="372.44361055317" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="368.44257165735" y="383.35347506146"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O</text>
<ellipse cx="286.84358748168" cy="466.6648797568" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="286.84358748168" y="477.57474426509"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O</text>
<ellipse cx="368.44257165735" cy="513.77551435861" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="368.44257165735" y="524.6853788669"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">N</text>
<ellipse cx="205.24460330601" cy="372.44361055317" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="205.24460330601" y="383.35347506146"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O</text>
<ellipse cx="123.64561913034" cy="513.77551435861" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="123.64561913034" y="524.6853788669"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O</text>
<ellipse cx="42.05" cy="466.6648797568" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="477.57474426509"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O</text>
<ellipse cx="123.64561913034" cy="372.44361055317" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="123.64561913034" y="383.35347506146"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O</text>
<ellipse cx="205.24460330601" cy="231.11170674773" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="205.24460330601" y="242.02157125602"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O<tspan baseline-shift='super' font-size='12.397573304875'>-</tspan></text>
<ellipse cx="123.64561913034" cy="231.11170674773" rx="12.89347623707" ry="12.89347623707" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="123.64561913034" y="242.02157125602"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:24.795146609751px">O</text>
</g></svg>

✍: FYIcenter.com

2022-05-15, 148👍, 0💬