Molecule FYI-1000236

A

Molecule Summary:

ID: FYI-1000236
SMILES: NCc5ccc4OC3(CCN(C(=O)c2cc(C#Cc1ccccc1)co2)CC3)Cc4c5

Received at FYIcenter.com on: 2021-01-30

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000236
FYIcenter.com

 31 35  0  0  0  0  0  0  0  0999 V2000
   17.6428    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3428    1.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6428    2.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3428    3.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6428    4.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2428    4.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3060    5.8901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0271    5.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0271    6.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8146    7.4207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6022    6.7207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3897    7.4207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3897    8.8207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1773    6.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8984    7.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9616    6.2498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5693    6.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1769    6.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7846    6.6888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2152    7.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8228    8.1141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    6.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5694    5.7024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9618    5.5561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6616    5.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0310    5.3284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6022    5.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8146    4.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1733    3.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5428    3.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2428    2.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 12  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  3  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 21 20  1  0  0  0  0
 22 21  2  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 24 19  1  0  0  0  0
 25 16  2  0  0  0  0
 26 25  1  0  0  0  0
 26 14  1  0  0  0  0
 27 11  1  0  0  0  0
 28 27  1  0  0  0  0
 28  8  1  0  0  0  0
 29  8  1  0  0  0  0
 30 29  1  0  0  0  0
 30  6  1  0  0  0  0
 31 30  2  0  0  0  0
 31  3  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="537.95" x2="528.4877041673" y1="203.54570648974" y2="187.15565835096" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="528.4877041673" x2="519.02540833461" y1="187.15565835096" y2="170.76561021218" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #0000ff" />
<line x1="519.02540833461" x2="528.4877041673" y1="236.3230992542" y2="219.93440287197" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="528.4877041673" x2="537.95" y1="219.93440287197" y2="203.54570648974" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="540" x2="530.5" y1="269" y2="252.5" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="530.5" x2="521" y1="252.5" y2="236" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="537" x2="527.5" y1="271" y2="254.5" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="527.5" x2="518" y1="254.5" y2="238" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="519.02540833461" x2="528.4877041673" y1="301.88058829623" y2="285.49054015745" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="528.4877041673" x2="537.95" y1="285.49054015745" y2="269.10049201867" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="482" x2="501" y1="304" y2="304" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="501" x2="520" y1="304" y2="304" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="482" x2="501" y1="300" y2="300" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="501" x2="520" y1="300" y2="300" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="455.84971432933" x2="468.51296966657" y1="330.0052350241" y2="315.94291166016" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #ff0000" />
<line x1="468.51296966657" x2="481.17622500382" y1="315.94291166016" y2="301.88058829623" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="421.27448535665" x2="438.56209984299" y1="314.61143146085" y2="322.30833324247" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="438.56209984299" x2="455.84971432933" y1="322.30833324247" y2="330.0052350241" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #ff0000" />
<line x1="421.27448535665" x2="421.27448535665" y1="352.46061479163" y2="333.53602312624" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="421.27448535665" x2="421.27448535665" y1="333.53602312624" y2="314.61143146085" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="388.49438907909" x2="404.88443721787" y1="371.38520645703" y2="361.92291062433" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="404.88443721787" x2="421.27448535665" y1="361.92291062433" y2="352.46061479163" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="355.71699631463" x2="372.10569269686" y1="352.46061479163" y2="361.92291062433" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #0000ff" />
<line x1="372.10569269686" x2="388.49438907909" y1="361.92291062433" y2="371.38520645703" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="322.93690003707" x2="339.32694817585" y1="371.38520645703" y2="361.92291062433" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="339.32694817585" x2="355.71699631463" y1="361.92291062433" y2="352.46061479163" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #0000ff" />
<line x1="325" x2="325" y1="410" y2="391" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #ff0000" />
<line x1="325" x2="325" y1="391" y2="372" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="321" x2="321" y1="410" y2="391" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #ff0000" />
<line x1="321" x2="321" y1="391" y2="372" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="290.15950727261" x2="306.54820365484" y1="352.46061479163" y2="361.92291062433" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="306.54820365484" x2="322.93690003707" y1="361.92291062433" y2="371.38520645703" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="257" x2="274" y1="370" y2="362.5" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="274" x2="291" y1="362.5" y2="355" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="255" x2="272.5" y1="367" y2="359" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="272.5" x2="290" y1="359" y2="351" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="230.25776762544" x2="242.92102296269" y1="339.72977162701" y2="353.79209499095" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="242.92102296269" x2="255.58427829993" y1="353.79209499095" y2="367.85441835489" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="192.61675480297" x2="211.43726121421" y1="343.68501128508" y2="341.70739145605" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="211.43726121421" x2="230.25776762544" y1="341.70739145605" y2="339.72977162701" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="156" x2="175" y1="352" y2="350" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="175" x2="194" y1="350" y2="348" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="155" x2="174" y1="344" y2="342" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="174" x2="193" y1="342" y2="340" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="154.97303846741" x2="173.79489663519" y1="347.64025094315" y2="345.66263111412" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="173.79489663519" x2="192.61675480297" y1="345.66263111412" y2="343.68501128508" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="117.33202564494" x2="136.15253205617" y1="351.59819411431" y2="349.61922252873" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="136.15253205617" x2="154.97303846741" y1="349.61922252873" y2="347.64025094315" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="104" x2="112" y1="387" y2="370" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="112" x2="120" y1="370" y2="353" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="101" x2="108.5" y1="386" y2="368.5" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="108.5" x2="116" y1="368.5" y2="351" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="64.294505746124" x2="83.116363913906" y1="390.13136625815" y2="388.15239467257" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="83.116363913906" x2="101.93822208169" y1="388.15239467257" y2="386.17342308699" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="41" x2="52" y1="361" y2="376.5" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="52" x2="63" y1="376.5" y2="392" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="44" x2="55" y1="359" y2="374" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="55" x2="66" y1="374" y2="389" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="57.443803563251" x2="49.746901781625" y1="324.93074094468" y2="342.22105894411" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="49.746901781625" x2="42.05" y1="342.22105894411" y2="359.51137694354" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="95" x2="76.5" y1="319" y2="321" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="76.5" x2="58" y1="321" y2="323" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="96" x2="77" y1="323" y2="325" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="77" x2="58" y1="325" y2="327" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="95.087519898816" x2="106.20977277188" y1="320.97550128661" y2="336.28684770046" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="106.20977277188" x2="117.33202564494" y1="336.28684770046" y2="351.59819411431" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="248" x2="238.5" y1="306" y2="322.5" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="238.5" x2="229" y1="322.5" y2="339" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="251" x2="241.5" y1="308" y2="324.5" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="241.5" x2="232" y1="324.5" y2="341" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="286.20426761454" x2="267.69331345269" y1="314.81960196916" y2="310.88463865931" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #ff0000" />
<line x1="267.69331345269" x2="249.18235929084" y1="310.88463865931" y2="306.94967534946" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="286.20426761454" x2="288.18188744357" y1="314.81960196916" y2="333.6401083804" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #ff0000" />
<line x1="288.18188744357" x2="290.15950727261" y1="333.6401083804" y2="352.46061479163" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="355.71699631463" x2="355.71699631463" y1="314.61143146085" y2="333.53602312624" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="355.71699631463" x2="355.71699631463" y1="333.53602312624" y2="352.46061479163" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #0000ff" />
<line x1="388.49438907909" x2="372.10569269686" y1="295.68683979545" y2="305.14913562815" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="372.10569269686" x2="355.71699631463" y1="305.14913562815" y2="314.61143146085" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="388.49438907909" x2="404.88443721787" y1="295.68683979545" y2="305.14913562815" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="404.88443721787" x2="421.27448535665" y1="305.14913562815" y2="314.61143146085" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="425.22702150162" x2="423.25075342914" y1="276.97041863838" y2="295.79092504961" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="423.25075342914" x2="421.27448535665" y1="295.79092504961" y2="314.61143146085" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="462.25163333842" x2="443.73932742002" y1="269.10049201867" y2="273.03545532852" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="443.73932742002" x2="425.22702150162" y1="273.03545532852" y2="276.97041863838" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="462.25163333842" x2="471.71392917112" y1="269.10049201867" y2="285.49054015745" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="471.71392917112" x2="481.17622500382" y1="285.49054015745" y2="301.88058829623" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="480" x2="470.5" y1="236" y2="252.5" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="470.5" x2="461" y1="252.5" y2="269" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="483" x2="473.5" y1="238" y2="254.5" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="473.5" x2="464" y1="254.5" y2="271" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="481.17622500382" x2="500.10081666921" y1="236.3230992542" y2="236.3230992542" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<line x1="500.10081666921" x2="519.02540833461" y1="236.3230992542" y2="236.3230992542" style="stroke-opacity:1; stroke-width: 1.5936565227206; stroke: #000000" />
<ellipse cx="519.02540833461" cy="170.76561021218" rx="10.358767397684" ry="10.358767397684" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="519.02540833461" y="179.53072108714"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:19.920706534007px">N</text>
<ellipse cx="455.84971432933" cy="330.0052350241" rx="10.358767397684" ry="10.358767397684" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="455.84971432933" y="338.77034589906"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:19.920706534007px">O</text>
<ellipse cx="355.71699631463" cy="352.46061479163" rx="10.358767397684" ry="10.358767397684" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="355.71699631463" y="361.2257256666"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:19.920706534007px">N</text>
<ellipse cx="322.93690003707" cy="409.23438978782" rx="10.358767397684" ry="10.358767397684" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="322.93690003707" y="417.99950066278"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:19.920706534007px">O</text>
<ellipse cx="286.20426761454" cy="314.81960196916" rx="10.358767397684" ry="10.358767397684" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="286.20426761454" y="323.58471284413"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:19.920706534007px">O</text>
</g></svg>

✍: FYIcenter.com

2021-02-17, 106👍, 0💬