Molecule FYI-1000292

A

Molecule Summary:

ID: FYI-1000292
SMILES: CCCCC(CC)C(=O)O[Ca]OC(=O)C(CC)CCCC

Received at FYIcenter.com on: 2021-03-15

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000292
FYIcenter.com

 21 20  0  0  0  0  0  0  0  0999 V2000
   16.9742    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.8000    0.0000 Ca  0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  5  1  0  0  0  0
  9  8  2  0  0  0  0
 10  8  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 13  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 15  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="502.5239805116" x2="520.2369902558" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="520.2369902558" x2="537.95" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="467.10380400844" x2="484.81389226002" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="484.81389226002" x2="502.5239805116" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="431.68362750527" x2="449.39371575685" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="449.39371575685" x2="467.10380400844" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="396.26345100211" x2="413.97353925369" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="413.97353925369" x2="431.68362750527" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="396.26345100211" x2="396.26345100211" y1="249.09910334508" y2="269.54955167254" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="396.26345100211" x2="396.26345100211" y1="269.54955167254" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="431.68362750527" x2="413.97353925369" y1="228.64865501761" y2="238.87387918135" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="413.97353925369" x2="396.26345100211" y1="238.87387918135" y2="249.09910334508" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="360.84035300633" x2="378.55190200422" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="378.55190200422" x2="396.26345100211" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="363" x2="363" y1="352" y2="331.5" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" />
<line x1="363" x2="363" y1="331.5" y2="311" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="359" x2="359" y1="352" y2="331.5" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" />
<line x1="359" x2="359" y1="331.5" y2="311" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="325.42017650316" x2="343.13026475475" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" />
<line x1="343.13026475475" x2="360.84035300633" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="290" x2="307.71008825158" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="307.71008825158" x2="325.42017650316" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" />
<line x1="254.57982349684" x2="272.28991174842" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" />
<line x1="272.28991174842" x2="290" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="219.15380400844" x2="236.86681375264" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="236.86681375264" x2="254.57982349684" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" />
<line x1="222" x2="222" y1="352" y2="331.5" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" />
<line x1="222" x2="222" y1="331.5" y2="311" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="218" x2="218" y1="352" y2="331.5" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" />
<line x1="218" x2="218" y1="331.5" y2="311" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="183.73362750527" x2="201.44371575685" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="201.44371575685" x2="219.15380400844" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="183.73362750527" x2="183.73362750527" y1="249.09910334508" y2="269.54955167254" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="183.73362750527" x2="183.73362750527" y1="269.54955167254" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="219.15380400844" x2="201.44371575685" y1="228.64865501761" y2="238.87387918135" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="201.44371575685" x2="183.73362750527" y1="238.87387918135" y2="249.09910334508" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="148.31345100211" x2="166.02353925369" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="166.02353925369" x2="183.73362750527" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="112.89327449895" x2="130.60336275053" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="130.60336275053" x2="148.31345100211" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="77.470176503164" x2="95.181725501055" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="95.181725501055" x2="112.89327449895" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="42.05" x2="59.760088251582" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<line x1="59.760088251582" x2="77.470176503164" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" />
<ellipse cx="360.84035300633" cy="351.35134498239" rx="11.193916365954" ry="11.193916365954" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="360.84035300633" y="360.82312036896"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.526762242218px">O</text>
<ellipse cx="325.42017650316" cy="290" rx="11.193916365954" ry="11.193916365954" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="325.42017650316" y="299.47177538658"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.526762242218px">O</text>
<ellipse cx="290" cy="310.45044832746" rx="11.193916365954" ry="11.193916365954" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290" y="319.92222371404"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:21.526762242218px">Ca</text>
<ellipse cx="254.57982349684" cy="290" rx="11.193916365954" ry="11.193916365954" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="254.57982349684" y="299.47177538658"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.526762242218px">O</text>
<ellipse cx="219.15380400844" cy="351.35134498239" rx="11.193916365954" ry="11.193916365954" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="219.15380400844" y="360.82312036896"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.526762242218px">O</text>
</g></svg>

✍: FYIcenter.com

2022-05-31, 123👍, 0💬