Collections:
Molecule FYI-1000292
Molecule Summary:
ID: FYI-1000292
SMILES: CCCCC(CC)C(=O)O[Ca]OC(=O)C(CC)CCCC
Received at FYIcenter.com on: 2021-03-15
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000292 FYIcenter.com 21 20 0 0 0 0 0 0 0 0999 V2000 16.9742 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7616 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5492 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3368 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3368 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9119 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9119 4.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 2.1000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 2.8000 0.0000 Ca 0 0 0 0 0 0 0 0 0 0 0 0 7.2747 2.1000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0621 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0621 4.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8497 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8497 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0621 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 1 0 0 0 0 4 3 1 0 0 0 0 5 4 1 0 0 0 0 6 5 1 0 0 0 0 7 6 1 0 0 0 0 8 5 1 0 0 0 0 9 8 2 0 0 0 0 10 8 1 0 0 0 0 11 10 1 0 0 0 0 12 11 1 0 0 0 0 13 12 1 0 0 0 0 14 13 2 0 0 0 0 15 13 1 0 0 0 0 16 15 1 0 0 0 0 17 16 1 0 0 0 0 18 15 1 0 0 0 0 19 18 1 0 0 0 0 20 19 1 0 0 0 0 21 20 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="502.5239805116" x2="520.2369902558" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="520.2369902558" x2="537.95" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="467.10380400844" x2="484.81389226002" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="484.81389226002" x2="502.5239805116" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="431.68362750527" x2="449.39371575685" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="449.39371575685" x2="467.10380400844" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="396.26345100211" x2="413.97353925369" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="413.97353925369" x2="431.68362750527" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="396.26345100211" x2="396.26345100211" y1="249.09910334508" y2="269.54955167254" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="396.26345100211" x2="396.26345100211" y1="269.54955167254" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="431.68362750527" x2="413.97353925369" y1="228.64865501761" y2="238.87387918135" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="413.97353925369" x2="396.26345100211" y1="238.87387918135" y2="249.09910334508" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="360.84035300633" x2="378.55190200422" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="378.55190200422" x2="396.26345100211" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="363" x2="363" y1="352" y2="331.5" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" /> <line x1="363" x2="363" y1="331.5" y2="311" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="359" x2="359" y1="352" y2="331.5" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" /> <line x1="359" x2="359" y1="331.5" y2="311" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="325.42017650316" x2="343.13026475475" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" /> <line x1="343.13026475475" x2="360.84035300633" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="290" x2="307.71008825158" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="307.71008825158" x2="325.42017650316" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" /> <line x1="254.57982349684" x2="272.28991174842" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" /> <line x1="272.28991174842" x2="290" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="219.15380400844" x2="236.86681375264" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="236.86681375264" x2="254.57982349684" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" /> <line x1="222" x2="222" y1="352" y2="331.5" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" /> <line x1="222" x2="222" y1="331.5" y2="311" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="218" x2="218" y1="352" y2="331.5" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #ff0000" /> <line x1="218" x2="218" y1="331.5" y2="311" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="183.73362750527" x2="201.44371575685" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="201.44371575685" x2="219.15380400844" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="183.73362750527" x2="183.73362750527" y1="249.09910334508" y2="269.54955167254" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="183.73362750527" x2="183.73362750527" y1="269.54955167254" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="219.15380400844" x2="201.44371575685" y1="228.64865501761" y2="238.87387918135" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="201.44371575685" x2="183.73362750527" y1="238.87387918135" y2="249.09910334508" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="148.31345100211" x2="166.02353925369" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="166.02353925369" x2="183.73362750527" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="112.89327449895" x2="130.60336275053" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="130.60336275053" x2="148.31345100211" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="77.470176503164" x2="95.181725501055" y1="310.45044832746" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="95.181725501055" x2="112.89327449895" y1="300.22522416373" y2="290" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="42.05" x2="59.760088251582" y1="290" y2="300.22522416373" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <line x1="59.760088251582" x2="77.470176503164" y1="300.22522416373" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 1.7221409793775; stroke: #000000" /> <ellipse cx="360.84035300633" cy="351.35134498239" rx="11.193916365954" ry="11.193916365954" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="360.84035300633" y="360.82312036896" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:21.526762242218px">O</text> <ellipse cx="325.42017650316" cy="290" rx="11.193916365954" ry="11.193916365954" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="325.42017650316" y="299.47177538658" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:21.526762242218px">O</text> <ellipse cx="290" cy="310.45044832746" rx="11.193916365954" ry="11.193916365954" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290" y="319.92222371404" fill="#c8aa1a" style="text-anchor:middle; font-family:sans-serif;font-size:21.526762242218px">Ca</text> <ellipse cx="254.57982349684" cy="290" rx="11.193916365954" ry="11.193916365954" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="254.57982349684" y="299.47177538658" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:21.526762242218px">O</text> <ellipse cx="219.15380400844" cy="351.35134498239" rx="11.193916365954" ry="11.193916365954" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="219.15380400844" y="360.82312036896" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:21.526762242218px">O</text> </g></svg>
✍: FYIcenter.com
2022-05-31, 123👍, 0💬
Popular Posts:
What is pubchem.ncbi.nlm.nih.gov Molecule Database? pubchem.ncbi.nlm.nih.gov Molecule Database is th...
Molecule Summary: ID: FYI-1000043 SMILES: CC1=CC=C(C=C1)C(=O)O Received at FYIcenter.com on: 2020-04...
What IS JSME, Molecule Editor in JavaScript? JSME, Molecule Editor in JavaScript is a free molecule ...
What is dtp.cancer.gov Basic Chemical Database? chedtp.cancer.gov Basic Chemical Database offers 4 w...
How to create a molecule structure with custom wedge/hash bonds? I don't like the default presentati...