Molecule FYI-1001170

A

Molecule Summary:

ID: FYI-1001170
SMILES: CCOc1ccc(CC2=NNC(=S)N2N)cc1

Received at FYIcenter.com on: 2022-02-11

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001170
FYIcenter.com

 17 18  0  0  0  0  0  0  0  0999 V2000
    8.4072    7.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1949    6.7870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9823    7.4870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7699    6.7870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5575    7.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3450    6.7870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3450    5.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1326    4.6870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1326    3.2870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4326    1.1327    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8326    1.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6555    0.0000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.2652    2.4641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5967    2.8967    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5575    4.6870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7699    5.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 12  1  0  0  0  0
 14  9  1  0  0  0  0
 15 14  1  0  0  0  0
 16  7  1  0  0  0  0
 17 16  2  0  0  0  0
 17  4  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="466.44229588924" x2="502.19614794462" y1="469.52132101056" y2="490.16612546389" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="502.19614794462" x2="537.95" y1="490.16612546389" y2="510.81092991721" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="394.9168962318" x2="430.67959606052" y1="510.81092991721" y2="490.16612546389" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #ff0000" />
<line x1="430.67959606052" x2="466.44229588924" y1="490.16612546389" y2="469.52132101056" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="323.40329360548" x2="359.16009491864" y1="469.52132101056" y2="490.16612546389" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="359.16009491864" x2="394.9168962318" y1="490.16612546389" y2="510.81092991721" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #ff0000" />
<line x1="255" x2="290.5" y1="515" y2="494.5" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="290.5" x2="326" y1="494.5" y2="474" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="250" x2="286" y1="508" y2="487" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="286" x2="322" y1="487" y2="466" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="180.37018983728" x2="216.12994040822" y1="469.52132101056" y2="490.16612546389" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="216.12994040822" x2="251.88969097916" y1="490.16612546389" y2="510.81092991721" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="177" x2="177" y1="387" y2="428.5" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="177" x2="177" y1="428.5" y2="470" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="185" x2="185" y1="387" y2="428.5" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="185" x2="185" y1="428.5" y2="470" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="108.85658721096" x2="144.61338852412" y1="345.65249429061" y2="366.29729874393" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="144.61338852412" x2="180.37018983728" y1="366.29729874393" y2="386.94210319726" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="108.85658721096" x2="108.85658721096" y1="263.07327647731" y2="304.36288538396" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="108.85658721096" x2="108.85658721096" y1="304.36288538396" y2="345.65249429061" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="40" x2="73.5" y1="219" y2="243" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #0000ff" />
<line x1="73.5" x2="107" y1="243" y2="267" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="45" x2="78.5" y1="212" y2="236" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #0000ff" />
<line x1="78.5" x2="112" y1="236" y2="260" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="67.566978304311" x2="54.808489152155" y1="136.00155580931" y2="175.26797387953" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #0000ff" />
<line x1="54.808489152155" x2="42.05" y1="175.26797387953" y2="214.53439194976" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #0000ff" />
<line x1="150.14619611761" x2="108.85658721096" y1="136.00155580931" y2="136.00155580931" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="108.85658721096" x2="67.566978304311" y1="136.00155580931" y2="136.00155580931" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #0000ff" />
<line x1="196" x2="171.5" y1="67" y2="100.5" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #c8aa1a" />
<line x1="171.5" x2="147" y1="100.5" y2="134" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="203" x2="178.5" y1="72" y2="105.5" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #c8aa1a" />
<line x1="178.5" x2="154" y1="105.5" y2="139" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="175.66317442192" x2="162.90468526977" y1="214.53439194976" y2="175.26797387953" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #0000ff" />
<line x1="162.90468526977" x2="150.14619611761" y1="175.26797387953" y2="136.00155580931" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="175.66317442192" x2="142.25988081644" y1="214.53439194976" y2="238.80383421353" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #0000ff" />
<line x1="142.25988081644" x2="108.85658721096" y1="238.80383421353" y2="263.07327647731" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="254.20190907793" x2="214.93254174993" y1="240.05137025407" y2="227.29288110191" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #0000ff" />
<line x1="214.93254174993" x2="175.66317442192" y1="227.29288110191" y2="214.53439194976" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #0000ff" />
<line x1="251.88969097916" x2="216.12994040822" y1="345.65249429061" y2="366.29729874393" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="216.12994040822" x2="180.37018983728" y1="366.29729874393" y2="386.94210319726" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="326" x2="290.5" y1="384" y2="363" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="290.5" x2="255" y1="363" y2="342" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="322" x2="286" y1="391" y2="370.5" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="286" x2="250" y1="370.5" y2="350" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="323.40329360548" x2="323.40329360548" y1="386.94210319726" y2="428.23171210391" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<line x1="323.40329360548" x2="323.40329360548" y1="428.23171210391" y2="469.52132101056" style="stroke-opacity:1; stroke-width: 3.4769925994289; stroke: #000000" />
<ellipse cx="394.9168962318" cy="510.81092991721" rx="22.600451896288" ry="22.600451896288" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="394.9168962318" y="529.93438921407"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:43.462407492861px">O</text>
<ellipse cx="42.05" cy="214.53439194976" rx="22.600451896288" ry="22.600451896288" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="233.65785124662"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:43.462407492861px">N</text>
<ellipse cx="67.566978304311" cy="136.00155580931" rx="22.600451896288" ry="22.600451896288" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="67.566978304311" y="155.12501510617"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:43.462407492861px">N</text>
<ellipse cx="198.68508064516" cy="69.189070082786" rx="22.600451896288" ry="22.600451896288" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="198.68508064516" y="88.312529379645"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:43.462407492861px">S</text>
<ellipse cx="175.66317442192" cy="214.53439194976" rx="22.600451896288" ry="22.600451896288" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="175.66317442192" y="233.65785124662"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:43.462407492861px">N</text>
<ellipse cx="254.20190907793" cy="240.05137025407" rx="22.600451896288" ry="22.600451896288" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="254.20190907793" y="259.17482955093"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:43.462407492861px">N</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 113👍, 0💬