Molecule FYI-1001258

A

Molecule Summary:

ID: FYI-1001258
SMILES: CC(=O)OC(C(=O)NC1CCN(CC1)CC2=CC=CC=C2)C3=CC=CC=C3

Received at FYIcenter.com on: 2022-04-17

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001258
FYIcenter.com

 27 29  0  0  0  0  0  0  0  0999 V2000
   12.1244    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    8.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6996    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    7.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6374    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6374    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6996    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6996   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   11.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  2  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  6  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 14  9  1  0  0  0  0
 15 12  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 21 16  1  0  0  0  0
 22  5  1  0  0  0  0
 23 22  2  0  0  0  0
 24 23  1  0  0  0  0
 25 24  2  0  0  0  0
 26 25  1  0  0  0  0
 27 26  2  0  0  0  0
 27 22  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="488.36163603972" x2="513.15581801986" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="513.15581801986" x2="537.95" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="492" x2="492" y1="405" y2="376.5" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #ff0000" />
<line x1="492" x2="492" y1="376.5" y2="348" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="486" x2="486" y1="405" y2="376.5" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #ff0000" />
<line x1="486" x2="486" y1="376.5" y2="348" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="438.77327207944" x2="463.56745405958" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #ff0000" />
<line x1="463.56745405958" x2="488.36163603972" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="389.18081801986" x2="413.97704504965" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="413.97704504965" x2="438.77327207944" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #ff0000" />
<line x1="339.59245405958" x2="364.38663603972" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="364.38663603972" x2="389.18081801986" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="337" x2="337" y1="262" y2="290.5" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #ff0000" />
<line x1="337" x2="337" y1="290.5" y2="319" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="343" x2="343" y1="262" y2="290.5" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #ff0000" />
<line x1="343" x2="343" y1="290.5" y2="319" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="290" x2="314.79622702979" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #0000ff" />
<line x1="314.79622702979" x2="339.59245405958" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="240.41163603972" x2="265.20581801986" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="265.20581801986" x2="290" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #0000ff" />
<line x1="190.82327207944" x2="215.61745405958" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="215.61745405958" x2="240.41163603972" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="141.23081801986" x2="166.02704504965" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="166.02704504965" x2="190.82327207944" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="141.23081801986" x2="141.23081801986" y1="261.36930487282" y2="290" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #0000ff" />
<line x1="141.23081801986" x2="141.23081801986" y1="290" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="190.82327207944" x2="166.02704504965" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="166.02704504965" x2="141.23081801986" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #0000ff" />
<line x1="240.41163603972" x2="215.61745405958" y1="261.36930487282" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="215.61745405958" x2="190.82327207944" y1="247.05395730923" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="240.41163603972" x2="240.41163603972" y1="261.36930487282" y2="290" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="240.41163603972" x2="240.41163603972" y1="290" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="91.642454059582" x2="116.43663603972" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="116.43663603972" x2="141.23081801986" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #0000ff" />
<line x1="91.642454059582" x2="91.642454059582" y1="175.47721949127" y2="204.10791461846" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="91.642454059582" x2="91.642454059582" y1="204.10791461846" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="41" x2="66" y1="150" y2="164.5" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="66" x2="91" y1="164.5" y2="179" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="44" x2="69" y1="145" y2="159" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="69" x2="94" y1="159" y2="173" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="89.585134109729" y2="118.21582923691" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="118.21582923691" y2="146.84652436409" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="91" x2="66" y1="59" y2="73" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="66" x2="41" y1="73" y2="87" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="94" x2="69" y1="64" y2="78.5" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="69" x2="44" y1="78.5" y2="93" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="141.23081801986" x2="116.43663603972" y1="89.585134109729" y2="75.269786546138" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="116.43663603972" x2="91.642454059582" y1="75.269786546138" y2="60.954438982548" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="145" x2="145" y1="147" y2="118.5" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="145" x2="145" y1="118.5" y2="90" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="139" x2="139" y1="147" y2="118.5" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="139" x2="139" y1="118.5" y2="90" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="141.23081801986" x2="116.43663603972" y1="146.84652436409" y2="161.16187192768" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="116.43663603972" x2="91.642454059582" y1="161.16187192768" y2="175.47721949127" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="389.18081801986" x2="389.18081801986" y1="404.52278050873" y2="375.89208538154" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="389.18081801986" x2="389.18081801986" y1="375.89208538154" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="441" x2="416" y1="431" y2="416.5" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="416" x2="391" y1="416.5" y2="402" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="438" x2="413" y1="436" y2="422" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="413" x2="388" y1="422" y2="408" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="438.77327207944" x2="438.77327207944" y1="490.41486589027" y2="461.78417076309" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="438.77327207944" x2="438.77327207944" y1="461.78417076309" y2="433.15347563591" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="391" x2="416" y1="522" y2="508" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="416" x2="441" y1="508" y2="494" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="388" x2="413" y1="517" y2="502.5" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="413" x2="438" y1="502.5" y2="488" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="339.59245405958" x2="364.38663603972" y1="490.41486589027" y2="504.73021345386" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="364.38663603972" x2="389.18081801986" y1="504.73021345386" y2="519.04556101745" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="337" x2="337" y1="434" y2="462.5" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="337" x2="337" y1="462.5" y2="491" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="343" x2="343" y1="434" y2="462.5" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="343" x2="343" y1="462.5" y2="491" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="339.59245405958" x2="364.38663603972" y1="433.15347563591" y2="418.83812807232" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<line x1="364.38663603972" x2="389.18081801986" y1="418.83812807232" y2="404.52278050873" style="stroke-opacity:1; stroke-width: 2.411008713372; stroke: #000000" />
<ellipse cx="488.36163603972" cy="404.52278050873" rx="15.671556636918" ry="15.671556636918" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="488.36163603972" y="417.78332843227"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.13760891715px">O</text>
<ellipse cx="438.77327207944" cy="318.63069512718" rx="15.671556636918" ry="15.671556636918" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="438.77327207944" y="331.89124305073"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.13760891715px">O</text>
<ellipse cx="339.59245405958" cy="261.36930487282" rx="15.671556636918" ry="15.671556636918" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.59245405958" y="274.62985279636"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.13760891715px">O</text>
<ellipse cx="290" cy="347.26139025436" rx="15.671556636918" ry="15.671556636918" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290" y="360.52193817791"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.13760891715px">N</text>
<ellipse cx="141.23081801986" cy="261.36930487282" rx="15.671556636918" ry="15.671556636918" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="141.23081801986" y="274.62985279636"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.13760891715px">N</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 124👍, 0💬