Molecule FYI-1001261

A

Molecule Summary:

ID: FYI-1001261
SMILES: COC1=CC=CC=C1N1CCN(CC1)C(=O)C1=CSC(=N1)N1N=C(C=C1C(F)(F)F)C1=CC=CC=C1O

Received at FYIcenter.com on: 2022-04-17

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001261
FYIcenter.com

 59 63  0  0  0  0  0  0  0  0999 V2000
    5.4641   -3.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981   -2.5341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -3.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -4.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -4.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -4.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -3.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -2.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -1.5341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -1.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -0.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660    0.4659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -0.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -1.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660    1.4659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000    1.9659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321    1.9659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8366    2.9604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8147    3.1683    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.3147    2.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6456    1.5591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3092    2.1977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9784    2.9409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8919    2.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7874    1.5396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8092    1.3317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4025    0.4182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9958   -0.4954    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.3161    0.0114    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.4890    0.8249    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.7579    3.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7579    4.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6240    4.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4900    4.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4900    3.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6240    2.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6240    1.5341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1541   -3.5711    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0010   -3.3441    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7741   -2.4972    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2690   -4.3441    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -5.1541    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4631   -4.3441    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4631   -2.7241    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3894   -0.9265    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7879   -1.6168    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7879    0.5485    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3894   -0.1418    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3426   -0.1418    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9441    0.5485    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9441   -1.6168    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3426   -0.9265    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3758    3.3752    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2481    1.1248    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2210    4.3441    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6240    5.1541    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.0269    4.3441    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.0269    2.7241    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1609    1.2241    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  2  0  0  0  0
  4  5  1  0  0  0  0
  5  6  2  0  0  0  0
  6  7  1  0  0  0  0
  7  8  2  0  0  0  0
  3  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
  9 14  1  0  0  0  0
 12 15  1  0  0  0  0
 15 16  2  0  0  0  0
 15 17  1  0  0  0  0
 17 18  2  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  2  0  0  0  0
 17 21  1  0  0  0  0
 20 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  2  0  0  0  0
 24 25  1  0  0  0  0
 25 26  2  0  0  0  0
 22 26  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 27 29  1  0  0  0  0
 27 30  1  0  0  0  0
 24 31  1  0  0  0  0
 31 32  2  0  0  0  0
 32 33  1  0  0  0  0
 33 34  2  0  0  0  0
 34 35  1  0  0  0  0
 35 36  2  0  0  0  0
 31 36  1  0  0  0  0
 36 37  1  0  0  0  0
  1 38  1  0  0  0  0
  1 39  1  0  0  0  0
  1 40  1  0  0  0  0
  4 41  1  0  0  0  0
  5 42  1  0  0  0  0
  6 43  1  0  0  0  0
  7 44  1  0  0  0  0
 10 45  1  0  0  0  0
 10 46  1  0  0  0  0
 11 47  1  0  0  0  0
 11 48  1  0  0  0  0
 13 49  1  0  0  0  0
 13 50  1  0  0  0  0
 14 51  1  0  0  0  0
 14 52  1  0  0  0  0
 18 53  1  0  0  0  0
 25 54  1  0  0  0  0
 32 55  1  0  0  0  0
 33 56  1  0  0  0  0
 34 57  1  0  0  0  0
 35 58  1  0  0  0  0
 37 59  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="254.20573960536" x2="233.3752648377" y1="144.03754389709" y2="156.06437690382" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="233.3752648377" x2="212.54479007004" y1="156.06437690382" y2="168.09120991056" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #ff0000" />
<line x1="212.54479007004" x2="191.71431530238" y1="168.09120991056" y2="156.06437690382" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #ff0000" />
<line x1="191.71431530238" x2="170.88384053472" y1="156.06437690382" y2="144.03754389709" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="174" x2="174" y1="145" y2="120.5" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="174" x2="174" y1="120.5" y2="96" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="169" x2="169" y1="145" y2="120.5" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="169" x2="169" y1="120.5" y2="96" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="170.88384053472" x2="150.05096040046" y1="95.930211870162" y2="83.903378863429" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="150.05096040046" x2="129.2180802662" y1="83.903378863429" y2="71.876545856697" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="128" x2="107.5" y1="70" y2="82" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="107.5" x2="87" y1="82" y2="94" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="131" x2="110" y1="75" y2="87" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="110" x2="89" y1="87" y2="99" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="87.557130730874" x2="87.557130730874" y1="95.930211870162" y2="119.98387788363" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="87.557130730874" x2="87.557130730874" y1="119.98387788363" y2="144.03754389709" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="87" x2="107.5" y1="147" y2="159" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="107.5" x2="128" y1="159" y2="171" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="89" x2="110" y1="142" y2="154" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="110" x2="131" y1="154" y2="166" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="170.88384053472" x2="150.05096040046" y1="144.03754389709" y2="156.06437690382" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="150.05096040046" x2="129.2180802662" y1="156.06437690382" y2="168.09120991056" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="129.2180802662" x2="129.2180802662" y1="168.09120991056" y2="192.14487592402" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="129.2180802662" x2="129.2180802662" y1="192.14487592402" y2="216.19854193749" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="129.2180802662" x2="108.38760549854" y1="216.19854193749" y2="228.22537494422" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="108.38760549854" x2="87.557130730874" y1="228.22537494422" y2="240.25220795095" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="87.557130730874" x2="87.557130730874" y1="240.25220795095" y2="264.30587396442" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="87.557130730874" x2="87.557130730874" y1="264.30587396442" y2="288.35953997788" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="87.557130730874" x2="108.38760549854" y1="288.35953997788" y2="300.38637298461" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="108.38760549854" x2="129.2180802662" y1="300.38637298461" y2="312.41320599135" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="129.2180802662" x2="150.05096040046" y1="312.41320599135" y2="300.38637298461" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="150.05096040046" x2="170.88384053472" y1="300.38637298461" y2="288.35953997788" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="170.88384053472" x2="170.88384053472" y1="288.35953997788" y2="264.30587396442" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="170.88384053472" x2="170.88384053472" y1="264.30587396442" y2="240.25220795095" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="129.2180802662" x2="150.05096040046" y1="216.19854193749" y2="228.22537494422" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="150.05096040046" x2="170.88384053472" y1="228.22537494422" y2="240.25220795095" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="129.2180802662" x2="129.2180802662" y1="312.41320599135" y2="336.46687200481" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="129.2180802662" x2="129.2180802662" y1="336.46687200481" y2="360.52053801828" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="128" x2="107.5" y1="359" y2="371" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="107.5" x2="87" y1="371" y2="383" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #ff0000" />
<line x1="131" x2="110" y1="363" y2="375" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="110" x2="89" y1="375" y2="387" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #ff0000" />
<line x1="129.2180802662" x2="150.05096040046" y1="360.52053801828" y2="372.54737102501" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="150.05096040046" x2="170.88384053472" y1="372.54737102501" y2="384.57420403174" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="169" x2="171.5" y1="385" y2="409" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="171.5" x2="174" y1="409" y2="433" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="174" x2="176.5" y1="385" y2="409" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="176.5" x2="179" y1="409" y2="433" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="175.91105673153" x2="199.4379474593" y1="432.41694573252" y2="437.41770289672" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="199.4379474593" x2="222.96483818707" y1="437.41770289672" y2="442.41846006092" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #c8aa1a" />
<line x1="222.96483818707" x2="234.99167119381" y1="442.41846006092" y2="421.58798529326" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #c8aa1a" />
<line x1="234.99167119381" x2="247.01850420054" y1="421.58798529326" y2="400.7575105256" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="249" x2="233" y1="400" y2="382" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="233" x2="217" y1="382" y2="364" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="246" x2="229.5" y1="403" y2="385" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="229.5" x2="213" y1="385" y2="367" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="170.88384053472" x2="192.85686443802" y1="384.57420403174" y2="374.78917269746" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="192.85686443802" x2="214.82988834132" y1="374.78917269746" y2="365.00414136319" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="247.01850420054" x2="270.93987505093" y1="400.7575105256" y2="398.24149706059" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="270.93987505093" x2="294.86124590132" y1="398.24149706059" y2="395.72548359558" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="294.86124590132" x2="310.95795919753" y1="395.72548359558" y2="413.60216817679" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="310.95795919753" x2="327.05467249374" y1="413.60216817679" y2="431.478852758" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="329" x2="351" y1="434" y2="424.5" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="351" x2="373" y1="424.5" y2="415" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="327" x2="348.5" y1="430" y2="420" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="348.5" x2="370" y1="420" y2="410" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="371.00072030034" x2="368.48711220194" y1="411.90879008944" y2="387.98741923905" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="368.48711220194" x2="365.97350410353" y1="387.98741923905" y2="364.06604838866" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="367" x2="343.5" y1="362" y2="357" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="343.5" x2="320" y1="357" y2="352" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="366" x2="342.5" y1="367" y2="362" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="342.5" x2="319" y1="362" y2="357" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="294.86124590132" x2="306.88807890805" y1="395.72548359558" y2="374.89500882792" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #0000ff" />
<line x1="306.88807890805" x2="318.91491191479" y1="374.89500882792" y2="354.06453406026" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="318.91491191479" x2="309.13228594711" y1="354.06453406026" y2="332.09151015696" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="309.13228594711" x2="299.34965997943" y1="332.09151015696" y2="310.11848625366" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="299.34965997943" x2="289.56703401176" y1="310.11848625366" y2="288.14305698376" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="289.56703401176" x2="279.78440804408" y1="288.14305698376" y2="266.16762771386" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #00bc00" />
<line x1="299.34965997943" x2="321.32508924934" y1="310.11848625366" y2="300.33345491938" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="321.32508924934" x2="343.30051851924" y1="300.33345491938" y2="290.54842358511" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #00bc00" />
<line x1="299.34965997943" x2="277.37663607613" y1="310.11848625366" y2="319.90111222134" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="277.37663607613" x2="255.40361217283" y1="319.90111222134" y2="329.68373818901" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #00bc00" />
<line x1="371.00072030034" x2="391.831195068" y1="411.90879008944" y2="423.93562309618" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="391.831195068" x2="412.66166983566" y1="423.93562309618" y2="435.96245610291" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="411" x2="411" y1="436" y2="460.5" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="411" x2="411" y1="460.5" y2="485" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="416" x2="416" y1="436" y2="460.5" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="416" x2="416" y1="460.5" y2="485" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="412.66166983566" x2="433.49454996993" y1="484.06978812984" y2="496.09662113657" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="433.49454996993" x2="454.32743010419" y1="496.09662113657" y2="508.1234541433" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="456" x2="477" y1="511" y2="499" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="477" x2="498" y1="499" y2="487" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="454" x2="474.5" y1="506" y2="494" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="474.5" x2="495" y1="494" y2="482" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="495.98837963951" x2="495.98837963951" y1="484.06978812984" y2="460.01612211637" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="495.98837963951" x2="495.98837963951" y1="460.01612211637" y2="435.96245610291" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="498" x2="477" y1="434" y2="422" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="477" x2="456" y1="422" y2="410" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="495" x2="474.5" y1="439" y2="427" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="474.5" x2="454" y1="427" y2="415" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="412.66166983566" x2="433.49454996993" y1="435.96245610291" y2="423.93562309618" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="433.49454996993" x2="454.32743010419" y1="423.93562309618" y2="411.90879008944" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="454.32743010419" x2="454.32743010419" y1="411.90879008944" y2="387.85512407598" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #000000" />
<line x1="454.32743010419" x2="454.32743010419" y1="387.85512407598" y2="363.80145806251" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #ff0000" />
<line x1="454.32743010419" x2="467.24184338682" y1="363.80145806251" y2="356.34482159834" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #ff0000" />
<line x1="467.24184338682" x2="480.15625666945" y1="356.34482159834" y2="348.88818513417" style="stroke-opacity:1; stroke-width: 2.0255876646532; stroke: #a4a4a4" />
<ellipse cx="212.54479007004" cy="168.09120991056" rx="13.166319820245" ry="13.166319820245" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="212.54479007004" y="179.23194206615"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.319845808164px">O</text>
<ellipse cx="129.2180802662" cy="216.19854193749" rx="13.166319820245" ry="13.166319820245" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="129.2180802662" y="227.33927409308"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.319845808164px">N</text>
<ellipse cx="129.2180802662" cy="312.41320599135" rx="13.166319820245" ry="13.166319820245" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="129.2180802662" y="323.55393814694"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.319845808164px">N</text>
<ellipse cx="87.557130730874" cy="384.57420403174" rx="13.166319820245" ry="13.166319820245" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="87.557130730874" y="395.71493618733"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.319845808164px">O</text>
<ellipse cx="222.96483818707" cy="442.41846006092" rx="13.166319820245" ry="13.166319820245" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="222.96483818707" y="453.55919221651"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:25.319845808164px">S</text>
<ellipse cx="214.82988834132" cy="365.00414136319" rx="13.166319820245" ry="13.166319820245" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="214.82988834132" y="376.14487351878"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.319845808164px">N</text>
<ellipse cx="294.86124590132" cy="395.72548359558" rx="13.166319820245" ry="13.166319820245" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="294.86124590132" y="406.86621575118"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.319845808164px">N</text>
<ellipse cx="327.05467249374" cy="431.478852758" rx="13.166319820245" ry="13.166319820245" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="327.05467249374" y="442.61958491359"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.319845808164px">N</text>
<ellipse cx="279.78440804408" cy="266.16762771386" rx="13.166319820245" ry="13.166319820245" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="279.78440804408" y="277.30835986945"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:25.319845808164px">F</text>
<ellipse cx="343.30051851924" cy="290.54842358511" rx="13.166319820245" ry="13.166319820245" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="343.30051851924" y="301.6891557407"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:25.319845808164px">F</text>
<ellipse cx="255.40361217283" cy="329.68373818901" rx="13.166319820245" ry="13.166319820245" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="255.40361217283" y="340.82447034461"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:25.319845808164px">F</text>
<ellipse cx="454.32743010419" cy="363.80145806251" rx="13.166319820245" ry="13.166319820245" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="454.32743010419" y="374.94219021811"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.319845808164px">O</text>
<ellipse cx="480.15625666945" cy="348.88818513417" rx="13.166319820245" ry="13.166319820245" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="480.15625666945" y="360.02891728976"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:25.319845808164px">H</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 120👍, 0💬