Molecule FYI-1001265

A

Molecule Summary:

ID: FYI-1001265
SMILES: O=C(NC1=CC=CC(C2)=C1)OCCCCOCCCCOCCCCOCCCCOCCCCOCCCCOCCCCOCCCCOC(NC3=CC2=CC=C3)=O

Received at FYIcenter.com on: 2022-04-20

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001265
FYIcenter.com

 60 62  0  0  0  0  0  0  0  0999 V2000
   22.5684   17.8683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3702   17.1766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6073   18.3308    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7328   19.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6077   20.7721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1171   22.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7516   22.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8765   21.2161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3596   21.7990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3671   19.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9884   15.9388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.4528   14.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7568   13.2858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8958   11.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8680   10.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6736    9.1562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3156    7.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7990    6.5363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1315    5.3244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3227    4.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3847    3.1849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3308    2.2885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1766    1.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9388    0.9075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6355    0.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2858    0.1390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9093    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5260    0.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1562    0.2222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8198    0.5803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5363    1.0969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3244    1.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2018    2.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1849    3.5112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2885    4.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5256    5.7193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9075    6.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4430    8.2603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1390    9.6101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   10.9866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0278   12.3698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2222   13.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5803   15.0761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0969   16.3596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7644   17.5714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5731   18.6940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5112   19.7109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5651   20.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7193   21.3702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9571   21.9884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2603   22.4528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6101   22.7568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9866   22.8958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.3698   22.8680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7397   22.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0761   22.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2253   23.9609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1898   24.8783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8775   24.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3882   24.1225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  8  2  0  0  0  0
 10  4  1  0  0  0  0
 11  2  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  1  0  0  0  0
 31 30  1  0  0  0  0
 32 31  1  0  0  0  0
 33 32  1  0  0  0  0
 34 33  1  0  0  0  0
 35 34  1  0  0  0  0
 36 35  1  0  0  0  0
 37 36  1  0  0  0  0
 38 37  1  0  0  0  0
 39 38  1  0  0  0  0
 40 39  1  0  0  0  0
 41 40  1  0  0  0  0
 42 41  1  0  0  0  0
 43 42  1  0  0  0  0
 44 43  1  0  0  0  0
 45 44  1  0  0  0  0
 46 45  1  0  0  0  0
 47 46  1  0  0  0  0
 48 47  1  0  0  0  0
 49 48  1  0  0  0  0
 50 49  1  0  0  0  0
 51 50  1  0  0  0  0
 52 51  1  0  0  0  0
 53 52  1  0  0  0  0
 54 53  1  0  0  0  0
 55 54  2  0  0  0  0
 56 55  1  0  0  0  0
 56  9  1  0  0  0  0
 57 56  2  0  0  0  0
 58 57  1  0  0  0  0
 59 58  2  0  0  0  0
 59 54  1  0  0  0  0
 60 52  2  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="488" x2="499.5" y1="386" y2="393" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="499.5" x2="511" y1="393" y2="400" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="489" x2="501" y1="384" y2="390.5" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="501" x2="513" y1="390.5" y2="397" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="472.57463170715" x2="480.1780875301" y1="407.43845982242" y2="395.9351058955" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #0000ff" />
<line x1="480.1780875301" x2="487.78154335304" y1="395.9351058955" y2="384.43175196858" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="455.14319346579" x2="463.85891258647" y1="434.73874320191" y2="421.08860151216" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="463.85891258647" x2="472.57463170715" y1="421.08860151216" y2="407.43845982242" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #0000ff" />
<line x1="474" x2="465.5" y1="456" y2="445" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="465.5" x2="457" y1="445" y2="434" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="472" x2="463.5" y1="458" y2="447" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="463.5" x2="455" y1="447" y2="436" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="462.80345843566" x2="467.69303167821" y1="481.89033515152" y2="468.99565545073" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="467.69303167821" x2="472.58260492075" y1="468.99565545073" y2="456.10097574995" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="436" x2="450" y1="488" y2="486" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="450" x2="464" y1="486" y2="484" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="436" x2="449.5" y1="485" y2="483" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="449.5" x2="463" y1="483" y2="481" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="418.14150243385" x2="426.86320146473" y1="464.95124285019" y2="475.63235912422" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="426.86320146473" x2="435.58490049561" y1="475.63235912422" y2="486.31347539824" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="387.90508314475" x2="403.0232927893" y1="476.57020837437" y2="470.76072561228" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="403.0232927893" x2="418.14150243385" y1="470.76072561228" y2="464.95124285019" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="427" x2="422" y1="439" y2="452" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="422" x2="417" y1="452" y2="465" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="430" x2="425" y1="440" y2="453" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="425" x2="420" y1="453" y2="466" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="427.92064891894" x2="441.53192119236" y1="439.16188344863" y2="436.95031332527" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="441.53192119236" x2="455.14319346579" y1="436.95031332527" y2="434.73874320191" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="500.10414497775" x2="493.9428441654" y1="359.75864247155" y2="372.09519722007" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="493.9428441654" x2="487.78154335304" y1="372.09519722007" y2="384.43175196858" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="509.36104597179" x2="504.73259547477" y1="333.77991924689" y2="346.76928085922" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="504.73259547477" x2="500.10414497775" y1="346.76928085922" y2="359.75864247155" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="515.4206883107" x2="512.39086714124" y1="306.87630324419" y2="320.32811124554" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="512.39086714124" x2="509.36104597179" y1="320.32811124554" y2="333.77991924689" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="518.19138003803" x2="516.80603417436" y1="279.43848193004" y2="293.15739258711" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="516.80603417436" x2="515.4206883107" y1="293.15739258711" y2="306.87630324419" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="517.63724169256" x2="517.91431086529" y1="251.86511598461" y2="265.65179895732" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="517.91431086529" x2="518.19138003803" y1="265.65179895732" y2="279.43848193004" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="513.7622598811" x2="515.69975078683" y1="224.56084599832" y2="238.21298099147" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="515.69975078683" x2="517.63724169256" y1="238.21298099147" y2="251.86511598461" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="506.62623370568" x2="510.19424679339" y1="197.92233934795" y2="211.24159267313" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="510.19424679339" x2="513.7622598811" y1="211.24159267313" y2="224.56084599832" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="496.32882833634" x2="501.47753102101" y1="172.33829019668" y2="185.13031477231" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="501.47753102101" x2="506.62623370568" y1="185.13031477231" y2="197.92233934795" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="483.02352813496" x2="489.67617823565" y1="148.18144628049" y2="160.25986823859" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="489.67617823565" x2="496.32882833634" y1="160.25986823859" y2="172.33829019668" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="466.90169022803" x2="474.9626091815" y1="125.80462230136" y2="136.99303429093" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="474.9626091815" x2="483.02352813496" y1="136.99303429093" y2="148.18144628049" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="448.20450432706" x2="457.55309727755" y1="105.53472001704" y2="115.6696711592" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="457.55309727755" x2="466.90169022803" y1="115.6696711592" y2="125.80462230136" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="427.19707978439" x2="437.70079205573" y1="87.666748330875" y2="96.600734173959" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="437.70079205573" x2="448.20450432706" y1="96.600734173959" y2="105.53472001704" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="404.19037193056" x2="415.69372585747" y1="72.459836684983" y2="80.063292507929" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="415.69372585747" x2="427.19707978439" y1="80.063292507929" y2="87.666748330875" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="379.51726243353" x2="391.85381718204" y1="60.139228363674" y2="66.299532524328" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="391.85381718204" x2="404.19037193056" y1="66.299532524328" y2="72.459836684983" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="353.53853920887" x2="366.5279008212" y1="50.880334066234" y2="55.509781214954" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="366.5279008212" x2="379.51726243353" y1="55.509781214954" y2="60.139228363674" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="326.63492320617" x2="340.08673120752" y1="44.820691727329" y2="47.850512896782" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="340.08673120752" x2="353.53853920887" y1="47.850512896782" y2="50.880334066234" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="299.19710189201" x2="312.91601254909" y1="42.05" y2="43.435345863664" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="312.91601254909" x2="326.63492320617" y1="43.435345863664" y2="44.820691727329" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="271.62373594659" x2="285.4104189193" y1="42.604138345466" y2="42.327069172733" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="285.4104189193" x2="299.19710189201" y1="42.327069172733" y2="42.05" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="244.31946596029" x2="257.97160095344" y1="46.479120156924" y2="44.541629251195" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="257.97160095344" x2="271.62373594659" y1="44.541629251195" y2="42.604138345466" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="217.68095930992" x2="231.00021263511" y1="53.617139635747" y2="50.048129896335" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="231.00021263511" x2="244.31946596029" y1="50.048129896335" y2="46.479120156924" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="192.09691015865" x2="204.88893473429" y1="63.914545005085" y2="58.765842320416" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="204.88893473429" x2="217.68095930992" y1="58.765842320416" y2="53.617139635747" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="167.94006624247" x2="180.01848820056" y1="77.219845206465" y2="70.567195105775" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="180.01848820056" x2="192.09691015865" y1="70.567195105775" y2="63.914545005085" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="145.56324226334" x2="156.7516542529" y1="93.339689809995" y2="85.27976750823" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="156.7516542529" x2="167.94006624247" y1="85.27976750823" y2="77.219845206465" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="125.29333997902" x2="135.42829112118" y1="112.03886901436" y2="102.68927941218" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="135.42829112118" x2="145.56324226334" y1="102.68927941218" y2="93.339689809995" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="107.42536829285" x2="116.35935413593" y1="133.04629355704" y2="122.5425812857" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="116.35935413593" x2="125.29333997902" y1="122.5425812857" y2="112.03886901436" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="92.218456646957" x2="99.821912469903" y1="156.05300141087" y2="144.54964748395" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="99.821912469903" x2="107.42536829285" y1="144.54964748395" y2="133.04629355704" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="79.897848325649" x2="86.058152486303" y1="180.7241176045" y2="168.38855950768" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="86.058152486303" x2="92.218456646957" y1="168.38855950768" y2="156.05300141087" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="70.638954028209" x2="75.268401176929" y1="206.70284082916" y2="193.71347921683" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="75.268401176929" x2="79.897848325649" y1="193.71347921683" y2="180.7241176045" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="64.579311689304" x2="67.609132858756" y1="233.60845013526" y2="220.15564548221" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="67.609132858756" x2="70.638954028209" y1="220.15564548221" y2="206.70284082916" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="61.808619961975" x2="63.193965825639" y1="261.04627144942" y2="247.32736079234" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="63.193965825639" x2="64.579311689304" y1="247.32736079234" y2="233.60845013526" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="62.362758307441" x2="62.085689134708" y1="288.61764409144" y2="274.83195777043" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="62.085689134708" x2="61.808619961975" y1="274.83195777043" y2="261.04627144942" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="66.237740118899" x2="64.30024921317" y1="315.92390738113" y2="302.27077573628" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="64.30024921317" x2="62.362758307441" y1="302.27077573628" y2="288.61764409144" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="73.375759597722" x2="69.80674985831" y1="342.56241403151" y2="329.24316070632" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="69.80674985831" x2="66.237740118899" y1="329.24316070632" y2="315.92390738113" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="83.67316496706" x2="78.524462282391" y1="368.14646318277" y2="355.35443860714" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="78.524462282391" x2="73.375759597722" y1="355.35443860714" y2="342.56241403151" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="96.97846516844" x2="90.32581506775" y1="392.30131379556" y2="380.22388848917" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="90.32581506775" x2="83.67316496706" y1="380.22388848917" y2="368.14646318277" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="113.09830977197" x2="105.0383874702" y1="414.67813777469" y2="403.48972578512" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="105.0383874702" x2="96.97846516844" y1="403.48972578512" y2="392.30131379556" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="131.79748897634" x2="122.44789937415" y1="434.94804005901" y2="424.81308891685" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="122.44789937415" x2="113.09830977197" y1="424.81308891685" y2="414.67813777469" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="152.80491351901" x2="142.30120124767" y1="452.81601174518" y2="443.88202590209" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="142.30120124767" x2="131.79748897634" y1="443.88202590209" y2="434.94804005901" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="175.81162137284" x2="164.30826744593" y1="468.02292339107" y2="460.41946756812" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="164.30826744593" x2="152.80491351901" y1="460.41946756812" y2="452.81601174518" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="200.48473086987" x2="188.14817612136" y1="480.34552501578" y2="474.18422420342" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="188.14817612136" x2="175.81162137284" y1="474.18422420342" y2="468.02292339107" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="226.46146079113" x2="213.4730958305" y1="489.60242600982" y2="484.9739755128" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="213.4730958305" x2="200.48473086987" y1="484.9739755128" y2="480.34552501578" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="253.36707009723" x2="239.91426544418" y1="495.66206834872" y2="492.63224717927" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="239.91426544418" x2="226.46146079113" y1="492.63224717927" y2="489.60242600982" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="280.80489141139" x2="267.08598075431" y1="498.43276007605" y2="497.04741421239" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #0000ff" />
<line x1="267.08598075431" x2="253.36707009723" y1="497.04741421239" y2="495.66206834872" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="308.37626405341" x2="294.5905777324" y1="497.87862173058" y2="498.15569090332" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="294.5905777324" x2="280.80489141139" y1="498.15569090332" y2="498.43276007605" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #0000ff" />
<line x1="336" x2="322.5" y1="493" y2="495" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="322.5" x2="309" y1="495" y2="497" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="336" x2="322.5" y1="496" y2="498" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="322.5" x2="309" y1="498" y2="500" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="362.32103399348" x2="349.00178066829" y1="486.8676137437" y2="490.43562683142" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="349.00178066829" x2="335.68252734311" y1="490.43562683142" y2="494.00363991913" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="362.32103399348" x2="375.11305856911" y1="486.8676137437" y2="481.71891105904" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="375.11305856911" x2="387.90508314475" y1="481.71891105904" y2="476.57020837437" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="367" x2="365.5" y1="520" y2="503.5" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="365.5" x2="364" y1="503.5" y2="487" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="364" x2="362.5" y1="520" y2="504" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="362.5" x2="361" y1="504" y2="488" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="344.65438595081" x2="354.97471430926" y1="537.95" y2="528.80671729982" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="354.97471430926" x2="365.29504266771" y1="528.80671729982" y2="519.66343459963" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="319" x2="332" y1="531" y2="535.5" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="332" x2="345" y1="535.5" y2="540" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="319" x2="332.5" y1="528" y2="532.5" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="332.5" x2="346" y1="532.5" y2="537" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="318.49626542006" x2="313.43626473674" y1="529.21933110381" y2="513.5489764172" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="313.43626473674" x2="308.37626405341" y1="513.5489764172" y2="497.87862173058" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="251" x2="253" y1="524" y2="510" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="253" x2="255" y1="510" y2="496" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<line x1="248" x2="250" y1="523" y2="509.5" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #ff0000" />
<line x1="250" x2="252" y1="509.5" y2="496" style="stroke-opacity:1; stroke-width: 1.1783948926518; stroke: #000000" />
<ellipse cx="511.6653047033" cy="398.21943159299" rx="7.6595668022368" ry="7.6595668022368" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="511.6653047033" y="404.70060350258"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:14.729936158148px">O</text>
<ellipse cx="472.57463170715" cy="407.43845982242" rx="7.6595668022368" ry="7.6595668022368" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="472.57463170715" y="413.919631732"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:14.729936158148px">N</text>
<ellipse cx="500.10414497775" cy="359.75864247155" rx="7.6595668022368" ry="7.6595668022368" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="500.10414497775" y="366.23981438114"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:14.729936158148px">O</text>
<ellipse cx="513.7622598811" cy="224.56084599832" rx="7.6595668022368" ry="7.6595668022368" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="513.7622598811" y="231.0420179079"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:14.729936158148px">O</text>
<ellipse cx="448.20450432706" cy="105.53472001704" rx="7.6595668022368" ry="7.6595668022368" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="448.20450432706" y="112.01589192663"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:14.729936158148px">O</text>
<ellipse cx="326.63492320617" cy="44.820691727329" rx="7.6595668022368" ry="7.6595668022368" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="326.63492320617" y="51.301863636914"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:14.729936158148px">O</text>
<ellipse cx="192.09691015865" cy="63.914545005085" rx="7.6595668022368" ry="7.6595668022368" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="192.09691015865" y="70.39571691467"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:14.729936158148px">O</text>
<ellipse cx="92.218456646957" cy="156.05300141087" rx="7.6595668022368" ry="7.6595668022368" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="92.218456646957" y="162.53417332045"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:14.729936158148px">O</text>
<ellipse cx="62.362758307441" cy="288.61764409144" rx="7.6595668022368" ry="7.6595668022368" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="62.362758307441" y="295.09881600102"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:14.729936158148px">O</text>
<ellipse cx="113.09830977197" cy="414.67813777469" rx="7.6595668022368" ry="7.6595668022368" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="113.09830977197" y="421.15930968427"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:14.729936158148px">O</text>
<ellipse cx="226.46146079113" cy="489.60242600982" rx="7.6595668022368" ry="7.6595668022368" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="226.46146079113" y="496.0835979194"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:14.729936158148px">O</text>
<ellipse cx="280.80489141139" cy="498.43276007605" rx="7.6595668022368" ry="7.6595668022368" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="280.80489141139" y="504.91393198564"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:14.729936158148px">N</text>
<ellipse cx="248.94392985051" cy="522.88461289558" rx="7.6595668022368" ry="7.6595668022368" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="248.94392985051" y="529.36578480516"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:14.729936158148px">O</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 136👍, 0💬