Molecule FYI-1001267

A

Molecule Summary:

ID: FYI-1001267
SMILES: CCOc1c(OC)c(OC)c(c2c1c(=O)cc(o2)c1ccc(c(c1)OC)OC)OC

Received at FYIcenter.com on: 2022-04-21

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001267
FYIcenter.com

 30 32  0  0  0  0  0  0  0  0999 V2000
    8.4871   11.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622   11.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6374   11.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6374   12.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249   13.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125   11.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6374    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    9.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6374    7.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6374    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6374    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    8.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  5  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11  8  2  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 13  4  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 14  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 18 12  1  0  0  0  0
 19 17  1  0  0  0  0
 20 19  2  0  0  0  0
 21 20  1  0  0  0  0
 22 21  2  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 24 19  1  0  0  0  0
 25 23  1  0  0  0  0
 26 25  1  0  0  0  0
 27 22  1  0  0  0  0
 28 27  1  0  0  0  0
 29 11  1  0  0  0  0
 30 29  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="403.01859285714" x2="425.62119285714" y1="433.55" y2="446.6" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="425.62119285714" x2="448.22379285714" y1="446.6" y2="459.65" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="357.80966428571" x2="380.41412857143" y1="459.65" y2="446.6" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="380.41412857143" x2="403.01859285714" y1="446.6" y2="433.55" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="312.60446428571" x2="335.20706428571" y1="433.55" y2="446.6" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="335.20706428571" x2="357.80966428571" y1="446.6" y2="459.65" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="269" x2="291.5" y1="463" y2="449.5" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="291.5" x2="314" y1="449.5" y2="436" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="267" x2="289.5" y1="458" y2="445" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="289.5" x2="312" y1="445" y2="432" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="267.39926428571" x2="267.39926428571" y1="511.85" y2="485.75" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="267.39926428571" x2="267.39926428571" y1="485.75" y2="459.65" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="222.19033571429" x2="244.7948" y1="537.95" y2="524.9" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="244.7948" x2="267.39926428571" y1="524.9" y2="511.85" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="222.19033571429" x2="244.7948" y1="433.55" y2="446.6" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="244.7948" x2="267.39926428571" y1="446.6" y2="459.65" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="176.98513571429" x2="199.58773571429" y1="459.65" y2="446.6" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="199.58773571429" x2="222.19033571429" y1="446.6" y2="433.55" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="131.77620714286" x2="154.38067142857" y1="433.55" y2="446.6" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="154.38067142857" x2="176.98513571429" y1="446.6" y2="459.65" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="220" x2="220" y1="382" y2="408" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="220" x2="220" y1="408" y2="434" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="225" x2="225" y1="382" y2="408" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="225" x2="225" y1="408" y2="434" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="267.39926428571" x2="244.7948" y1="355.25" y2="368.3" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="244.7948" x2="222.19033571429" y1="368.3" y2="381.35" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="314" x2="291.5" y1="379" y2="366" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="291.5" x2="269" y1="366" y2="353" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="312" x2="289.5" y1="384" y2="371" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="289.5" x2="267" y1="371" y2="358" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="312.60446428571" x2="312.60446428571" y1="381.35" y2="407.45" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="312.60446428571" x2="312.60446428571" y1="407.45" y2="433.55" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="357.80966428571" x2="335.20706428571" y1="355.25" y2="368.3" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="335.20706428571" x2="312.60446428571" y1="368.3" y2="381.35" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="405" x2="382.5" y1="379" y2="366" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="382.5" x2="360" y1="366" y2="353" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="402" x2="379.5" y1="384" y2="371" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="379.5" x2="357" y1="371" y2="358" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="357.80966428571" x2="357.80966428571" y1="303.05" y2="329.15" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="357.80966428571" x2="357.80966428571" y1="329.15" y2="355.25" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="312" x2="334.5" y1="280" y2="293" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="334.5" x2="357" y1="293" y2="306" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="314" x2="337" y1="275" y2="288" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="337" x2="360" y1="288" y2="301" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="267.39926428571" x2="290.00186428571" y1="303.05" y2="290" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="290.00186428571" x2="312.60446428571" y1="290" y2="276.95" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="267.39926428571" x2="267.39926428571" y1="303.05" y2="329.15" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="267.39926428571" x2="267.39926428571" y1="329.15" y2="355.25" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="312.60446428571" x2="312.60446428571" y1="224.75" y2="250.85" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="312.60446428571" x2="312.60446428571" y1="250.85" y2="276.95" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="267" x2="289.5" y1="202" y2="215" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="289.5" x2="312" y1="215" y2="228" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="269" x2="291.5" y1="197" y2="210" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="291.5" x2="314" y1="210" y2="223" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="267.39926428571" x2="267.39926428571" y1="146.45" y2="172.55" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="267.39926428571" x2="267.39926428571" y1="172.55" y2="198.65" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="312" x2="289.5" y1="118" y2="131.5" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="289.5" x2="267" y1="131.5" y2="145" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="314" x2="291.5" y1="123" y2="136" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="291.5" x2="269" y1="136" y2="149" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="357.80966428571" x2="335.20706428571" y1="146.45" y2="133.4" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="335.20706428571" x2="312.60446428571" y1="133.4" y2="120.35" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="361" x2="361" y1="199" y2="173" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="361" x2="361" y1="173" y2="147" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="356" x2="356" y1="199" y2="173" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="356" x2="356" y1="173" y2="147" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="357.80966428571" x2="335.20706428571" y1="198.65" y2="211.7" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="335.20706428571" x2="312.60446428571" y1="211.7" y2="224.75" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="403.01859285714" x2="380.41412857143" y1="120.35" y2="133.4" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="380.41412857143" x2="357.80966428571" y1="133.4" y2="146.45" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="448.22379285714" x2="425.62119285714" y1="146.45" y2="133.4" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="425.62119285714" x2="403.01859285714" y1="133.4" y2="120.35" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="312.60446428571" x2="312.60446428571" y1="68.15" y2="94.25" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="312.60446428571" x2="312.60446428571" y1="94.25" y2="120.35" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="357.80966428571" x2="335.20706428571" y1="42.05" y2="55.1" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="335.20706428571" x2="312.60446428571" y1="55.1" y2="68.15" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="176.98513571429" x2="199.58773571429" y1="355.25" y2="368.3" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<line x1="199.58773571429" x2="222.19033571429" y1="368.3" y2="381.35" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="176.98513571429" x2="176.98513571429" y1="303.05" y2="329.15" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #000000" />
<line x1="176.98513571429" x2="176.98513571429" y1="329.15" y2="355.25" style="stroke-opacity:1; stroke-width: 2.1978794441001; stroke: #ff0000" />
<ellipse cx="357.80966428571" cy="459.65" rx="14.286216386651" ry="14.286216386651" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="357.80966428571" y="471.73833694255"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.473493051251px">O</text>
<ellipse cx="267.39926428571" cy="511.85" rx="14.286216386651" ry="14.286216386651" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="267.39926428571" y="523.93833694255"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.473493051251px">O</text>
<ellipse cx="176.98513571429" cy="459.65" rx="14.286216386651" ry="14.286216386651" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="176.98513571429" y="471.73833694255"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.473493051251px">O</text>
<ellipse cx="403.01859285714" cy="381.35" rx="14.286216386651" ry="14.286216386651" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="403.01859285714" y="393.43833694255"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.473493051251px">O</text>
<ellipse cx="267.39926428571" cy="303.05" rx="14.286216386651" ry="14.286216386651" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="267.39926428571" y="315.13833694255"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.473493051251px">O</text>
<ellipse cx="403.01859285714" cy="120.35" rx="14.286216386651" ry="14.286216386651" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="403.01859285714" y="132.43833694255"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.473493051251px">O</text>
<ellipse cx="312.60446428571" cy="68.15" rx="14.286216386651" ry="14.286216386651" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="312.60446428571" y="80.238336942551"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.473493051251px">O</text>
<ellipse cx="176.98513571429" cy="355.25" rx="14.286216386651" ry="14.286216386651" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="176.98513571429" y="367.33833694255"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.473493051251px">O</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 135👍, 0💬