Molecule FYI-1001271

A

Molecule Summary:

ID: FYI-1001271
SMILES: CC1=C2C=CC=C(C2=C(C3=C1[C@@H](OC3=O)[C@H]4[C@@H](C(=C(C(=O)[C@H]4O)C(=O)N)O)N(C)C)O)O

Received at FYIcenter.com on: 2022-04-22

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001271
FYIcenter.com

 32 35  0  0  1  0  0  0  0  0999 V2000
    2.8104    5.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2430    6.8318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3062    7.8722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9367    7.5811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    8.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4326    9.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8021   10.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7388    9.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1082    9.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0450    8.4543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6124    7.1229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7450    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8776    7.1229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4450    8.4543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2679    9.5870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7450    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9574    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9574    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7450    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5326    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3201    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5326    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3201    4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7450    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9574    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5326    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1698    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1698    4.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1698    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3824    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5409   10.8262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2347   11.5756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  8  3  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 11  2  1  0  0  0  0
 12 11  1  0  0  0  0
 12 13  1  1  0  0  0
 14 13  1  0  0  0  0
 14 10  1  0  0  0  0
 15 14  2  0  0  0  0
 16 12  1  1  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 20  1  0  0  0  0
 22 16  1  0  0  0  0
 22 23  1  1  0  0  0
 24 19  1  0  0  0  0
 25 24  2  0  0  0  0
 26 24  1  0  0  0  0
 27 18  1  0  0  0  0
 17 28  1  6  0  0  0
 29 28  1  0  0  0  0
 30 28  1  0  0  0  0
 31  9  1  0  0  0  0
 32  7  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="227.95894986005" x2="218.69263364318" y1="334.72507688586" y2="306.20427234873" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="218.69263364318" x2="209.42631742631" y1="306.20427234873" y2="277.6834678116" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="191" x2="211" y1="382" y2="359.5" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="211" x2="231" y1="359.5" y2="337" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="186" x2="206" y1="378" y2="355.5" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="206" x2="226" y1="355.5" y2="333" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="129.15679964753" x2="158.4915663119" y1="366.82517277722" y2="373.06055107295" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="158.4915663119" x2="187.82633297626" y1="373.06055107295" y2="379.29592936867" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="92" x2="112" y1="414" y2="391.5" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="112" x2="132" y1="391.5" y2="369" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="87" x2="107" y1="410" y2="387.5" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="107" x2="127" y1="387.5" y2="365" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="107.56109920868" x2="98.29478299181" y1="468.43763433429" y2="439.91897180276" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="98.29478299181" x2="89.02846677494" y1="439.91897180276" y2="411.40030927123" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="167" x2="138" y1="478" y2="472" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="138" x2="109" y1="472" y2="466" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="166" x2="136.5" y1="484" y2="478" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="136.5" x2="107" y1="478" y2="472" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="206.35896541" x2="186.2947989737" y1="436.33753844293" y2="458.62296468434" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="186.2947989737" x2="166.23063253741" y1="458.62296468434" y2="480.90839092574" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="206.35896541" x2="197.09264919313" y1="436.33753844293" y2="407.8167339058" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="197.09264919313" x2="187.82633297626" y1="407.8167339058" y2="379.29592936867" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="266" x2="237" y1="446" y2="440" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="237" x2="208" y1="440" y2="434" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="265" x2="235.5" y1="452" y2="446" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="235.5" x2="206" y1="446" y2="440" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="305.15683161132" x2="285.09052316943" y1="404.23315854038" y2="426.52072678738" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="285.09052316943" x2="265.02421472753" y1="426.52072678738" y2="448.80829503438" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="284" x2="293.5" y1="349" y2="377.5" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="293.5" x2="303" y1="377.5" y2="406" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="290" x2="299.5" y1="347" y2="375.5" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="299.5" x2="309" y1="375.5" y2="404" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="286.62419917758" x2="257.29157451882" y1="347.19583347731" y2="340.96045518159" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="257.29157451882" x2="227.95894986005" y1="340.96045518159" y2="334.72507688586" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="335.14490998307" x2="310.88455458032" y1="311.94270534573" y2="329.56926941152" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="310.88455458032" x2="286.62419917758" y1="329.56926941152" y2="347.19583347731" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<polygon points=" 336,312 379,355 389,340" fill-opacity="1"  style="fill:#000000" />
<line x1="365.13298835482" x2="374.39930457169" y1="404.23315854038" y2="375.71449600885" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="374.39930457169" x2="383.66562078856" y1="375.71449600885" y2="347.19583347731" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #ff0000" />
<line x1="365.13298835482" x2="335.14490998307" y1="404.23315854038" y2="404.23315854038" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="335.14490998307" x2="305.15683161132" y1="404.23315854038" y2="404.23315854038" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="403" x2="385.5" y1="451" y2="427" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #ff0000" />
<line x1="385.5" x2="368" y1="427" y2="403" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="398" x2="380.5" y1="455" y2="431" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #ff0000" />
<line x1="380.5" x2="363" y1="431" y2="407" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<polygon points=" 336,252 327,312 345,312" fill-opacity="1"  style="fill:#000000" />
<line x1="387.08426172293" x2="361.114585853" y1="221.97847023048" y2="236.97250941636" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="361.114585853" x2="335.14490998307" y1="236.97250941636" y2="251.96654860223" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="387.08426172293" x2="387.08426172293" y1="162.00231348699" y2="191.99039185874" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="387.08426172293" x2="387.08426172293" y1="191.99039185874" y2="221.97847023048" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="334" x2="360" y1="135" y2="150" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="360" x2="386" y1="150" y2="165" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="337" x2="363" y1="130" y2="145" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="363" x2="389" y1="145" y2="160" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="283.2055582432" x2="309.17523411313" y1="162.00231348699" y2="147.00827430112" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="309.17523411313" x2="335.14490998307" y1="147.00827430112" y2="132.01423511524" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="230" x2="256" y1="135" y2="150" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #ff0000" />
<line x1="256" x2="282" y1="150" y2="165" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="233" x2="259" y1="130" y2="145" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #ff0000" />
<line x1="259" x2="285" y1="145" y2="160" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="283.2055582432" x2="283.2055582432" y1="221.97847023048" y2="191.99039185874" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="283.2055582432" x2="283.2055582432" y1="191.99039185874" y2="162.00231348699" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="283.2055582432" x2="309.17523411313" y1="221.97847023048" y2="236.97250941636" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="309.17523411313" x2="335.14490998307" y1="236.97250941636" y2="251.96654860223" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<polygon points=" 284,222 227,245 236,260" fill-opacity="1"  style="fill:#000000" />
<line x1="335.14490998307" x2="335.14490998307" y1="72.038078371748" y2="102.02615674349" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="335.14490998307" x2="335.14490998307" y1="102.02615674349" y2="132.01423511524" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="386" x2="360" y1="40" y2="55" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #ff0000" />
<line x1="360" x2="334" y1="55" y2="70" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="389" x2="363" y1="45" y2="60" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #ff0000" />
<line x1="363" x2="337" y1="60" y2="75" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="283.2055582432" x2="309.17523411313" y1="42.05" y2="57.044039185874" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #0000ff" />
<line x1="309.17523411313" x2="335.14490998307" y1="57.044039185874" y2="72.038078371748" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="439.0236134628" x2="413.05393759287" y1="132.01423511524" y2="147.00827430112" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #ff0000" />
<line x1="413.05393759287" x2="387.08426172293" y1="147.00827430112" y2="162.00231348699" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<polygon points=" 388,222 435,260 444,245" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="439.0236134628" x2="439.0236134628" y1="311.94270534573" y2="281.95462697398" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="439.0236134628" x2="439.0236134628" y1="281.95462697398" y2="251.96654860223" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #0000ff" />
<line x1="490.97153322506" x2="464.99757334393" y1="221.97847023048" y2="236.97250941636" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="464.99757334393" x2="439.0236134628" y1="236.97250941636" y2="251.96654860223" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #0000ff" />
<line x1="283.56113117247" x2="274.29267295" y1="505.84562009745" y2="477.32695756591" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #ff0000" />
<line x1="274.29267295" x2="265.02421472753" y1="477.32695756591" y2="448.80829503438" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<line x1="184.76326497115" x2="175.49694875428" y1="537.95" y2="509.42919546287" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #ff0000" />
<line x1="175.49694875428" x2="166.23063253741" y1="509.42919546287" y2="480.90839092574" style="stroke-opacity:1; stroke-width: 2.5253085470264; stroke: #000000" />
<ellipse cx="383.66562078856" cy="347.19583347731" rx="16.414505555671" ry="16.414505555671" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="383.66562078856" y="361.08503048596"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:31.56635683783px">O</text>
<ellipse cx="400.3861164864" cy="452.75815335706" rx="16.414505555671" ry="16.414505555671" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="400.3861164864" y="466.64735036571"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:31.56635683783px">O</text>
<ellipse cx="231.26192249214" cy="132.01423511524" rx="16.414505555671" ry="16.414505555671" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="231.26192249214" y="145.90343212389"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:31.56635683783px">O</text>
<ellipse cx="231.26192249214" cy="251.96654860223" rx="16.414505555671" ry="16.414505555671" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="231.26192249214" y="265.85574561088"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:31.56635683783px">O</text>
<ellipse cx="387.08426172293" cy="42.05" rx="16.414505555671" ry="16.414505555671" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="387.08426172293" y="55.939197008645"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:31.56635683783px">O</text>
<ellipse cx="283.2055582432" cy="42.05" rx="16.414505555671" ry="16.414505555671" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="283.2055582432" y="55.939197008645"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:31.56635683783px">N</text>
<ellipse cx="439.0236134628" cy="132.01423511524" rx="16.414505555671" ry="16.414505555671" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="439.0236134628" y="145.90343212389"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:31.56635683783px">O</text>
<ellipse cx="439.0236134628" cy="251.96654860223" rx="16.414505555671" ry="16.414505555671" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="439.0236134628" y="265.85574561088"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:31.56635683783px">N</text>
<ellipse cx="283.56113117247" cy="505.84562009745" rx="16.414505555671" ry="16.414505555671" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="283.56113117247" y="519.73481710609"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:31.56635683783px">O</text>
<ellipse cx="184.76326497115" cy="537.95" rx="16.414505555671" ry="16.414505555671" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="184.76326497115" y="551.83919700864"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:31.56635683783px">O</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 141👍, 0💬