Molecule FYI-1001275

A

Molecule Summary:

ID: FYI-1001275
SMILES: CO[C@@]1(C(=O)Nc2cncc3ccccc23)CCOc2ccc(Cl)cc21

Received at FYIcenter.com on: 2022-04-23

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001275
FYIcenter.com

 26 29  0  0  1  0  0  0  0  0999 V2000
    2.4216    2.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6324    2.7962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8433    2.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8433    3.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1322    4.5254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6324    4.1943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6324    5.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8433    6.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8433    7.6895    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6324    8.3886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4216    7.6895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2109    8.3886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    7.6895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    6.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2109    5.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4216    6.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8433    0.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0540    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2648    0.6990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2648    2.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4755    2.7962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4755    4.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2648    4.8933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2648    6.2914    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.2067    4.0032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0540    2.7962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  3  4  1  1  0  0  0
  5  4  2  0  0  0  0
  6  4  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 16  7  1  0  0  0  0
 16 11  2  0  0  0  0
 17  3  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 21  1  0  0  0  0
 23 22  2  0  0  0  0
 24 23  1  0  0  0  0
 25 23  1  0  0  0  0
 26 25  2  0  0  0  0
 26 20  1  0  0  0  0
 26  3  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="254.58107899239" x2="219.15923249366" y1="208.19741726152" y2="187.74530883134" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #ff0000" />
<line x1="219.15923249366" x2="183.73738599493" y1="187.74530883134" y2="167.29320040116" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="325.4306229721" x2="290.00585098224" y1="167.29320040116" y2="187.74530883134" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="290.00585098224" x2="254.58107899239" y1="187.74530883134" y2="208.19741726152" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #ff0000" />
<polygon points=" 326,168 314,250 338,250" fill-opacity="1"  style="fill:#000000" />
<line x1="404" x2="366.5" y1="307" y2="276.5" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #ff0000" />
<line x1="366.5" x2="329" y1="276.5" y2="246" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="399" x2="361" y1="313" y2="283" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #ff0000" />
<line x1="361" x2="323" y1="283" y2="253" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="254.58107899239" x2="290.00585098224" y1="290" y2="269.54789156982" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #0000ff" />
<line x1="290.00585098224" x2="325.4306229721" y1="269.54789156982" y2="249.09578313964" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="254.58107899239" x2="254.58107899239" y1="371.80258273848" y2="330.90129136924" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="254.58107899239" x2="254.58107899239" y1="330.90129136924" y2="290" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #0000ff" />
<line x1="328" x2="292.5" y1="409" y2="389" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="292.5" x2="257" y1="389" y2="369" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="324" x2="288.5" y1="417" y2="396.5" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="288.5" x2="253" y1="396.5" y2="376" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="325.4306229721" x2="325.4306229721" y1="494.50353135508" y2="453.60223998584" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #0000ff" />
<line x1="325.4306229721" x2="325.4306229721" y1="453.60223998584" y2="412.7009486166" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="257" x2="292.5" y1="540" y2="519.5" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="292.5" x2="328" y1="519.5" y2="499" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #0000ff" />
<line x1="253" x2="288.5" y1="532" y2="511.5" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="288.5" x2="324" y1="511.5" y2="491" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #0000ff" />
<line x1="183.73738599493" x2="219.15923249366" y1="494.50353135508" y2="514.95563978526" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="219.15923249366" x2="254.58107899239" y1="514.95563978526" y2="535.40774821544" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="112.89954397971" x2="148.31846498732" y1="535.40774821544" y2="514.95563978526" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="148.31846498732" x2="183.73738599493" y1="514.95563978526" y2="494.50353135508" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="40" x2="75.5" y1="499" y2="519.5" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="75.5" x2="111" y1="519.5" y2="540" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="45" x2="80.5" y1="491" y2="511.5" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="80.5" x2="116" y1="511.5" y2="532" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="412.7009486166" y2="453.60223998584" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="453.60223998584" y2="494.50353135508" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="111" x2="75.5" y1="369" y2="389" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="75.5" x2="40" y1="389" y2="409" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="116" x2="80.5" y1="376" y2="396.5" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="80.5" x2="45" y1="396.5" y2="417" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="183.73738599493" x2="148.31846498732" y1="412.7009486166" y2="392.25176567754" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="148.31846498732" x2="112.89954397971" y1="392.25176567754" y2="371.80258273848" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="183.73738599493" x2="219.15923249366" y1="412.7009486166" y2="392.25176567754" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="219.15923249366" x2="254.58107899239" y1="392.25176567754" y2="371.80258273848" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="180" x2="180" y1="413" y2="454" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="180" x2="180" y1="454" y2="495" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="189" x2="189" y1="413" y2="454" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="189" x2="189" y1="454" y2="495" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="325.4306229721" x2="325.4306229721" y1="85.490617662675" y2="126.39190903192" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="325.4306229721" x2="325.4306229721" y1="126.39190903192" y2="167.29320040116" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="396.26846498732" x2="360.84954397971" y1="44.592251784555" y2="65.041434723615" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="360.84954397971" x2="325.4306229721" y1="65.041434723615" y2="85.490617662675" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="467.11215798478" x2="431.69031148605" y1="85.490617662675" y2="65.041434723615" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #ff0000" />
<line x1="431.69031148605" x2="396.26846498732" y1="65.041434723615" y2="44.592251784555" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="467.11215798478" x2="467.11215798478" y1="167.29320040116" y2="126.39190903192" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="467.11215798478" x2="467.11215798478" y1="126.39190903192" y2="85.490617662675" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #ff0000" />
<line x1="541" x2="505.5" y1="205" y2="184.5" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="505.5" x2="470" y1="184.5" y2="164" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="536" x2="500.5" y1="212" y2="191.5" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="500.5" x2="465" y1="191.5" y2="171" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="537.95" x2="537.95" y1="290" y2="249.09870863076" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="537.95" x2="537.95" y1="249.09870863076" y2="208.19741726152" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="470" x2="505.5" y1="335" y2="314.5" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="505.5" x2="541" y1="314.5" y2="294" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="465" x2="500.5" y1="328" y2="307.5" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="500.5" x2="536" y1="307.5" y2="287" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="467.11215798478" x2="467.11215798478" y1="412.7009486166" y2="371.79965724736" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #00bc00" />
<line x1="467.11215798478" x2="467.11215798478" y1="371.79965724736" y2="330.89836587812" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="405.20291487228" x2="436.15753642853" y1="278.81877293375" y2="304.85856940593" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="436.15753642853" x2="467.11215798478" y1="304.85856940593" y2="330.89836587812" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="393" x2="397" y1="209" y2="244.5" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="397" x2="401" y1="244.5" y2="280" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="401" x2="405.5" y1="208" y2="243.5" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="405.5" x2="410" y1="243.5" y2="279" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="396.26846498732" x2="431.69031148605" y1="208.19741726152" y2="187.74530883134" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="431.69031148605" x2="467.11215798478" y1="187.74530883134" y2="167.29320040116" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="396.26846498732" x2="360.84954397971" y1="208.19741726152" y2="187.74530883134" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<line x1="360.84954397971" x2="325.4306229721" y1="187.74530883134" y2="167.29320040116" style="stroke-opacity:1; stroke-width: 3.4187709628002; stroke: #000000" />
<ellipse cx="254.58107899239" cy="208.19741726152" rx="22.222011258201" ry="22.222011258201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="254.58107899239" y="227.00065755692"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:42.734637035003px">O</text>
<ellipse cx="400.84393310129" cy="309.37260220636" rx="22.222011258201" ry="22.222011258201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="400.84393310129" y="328.17584250176"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:42.734637035003px">O</text>
<ellipse cx="254.58107899239" cy="290" rx="22.222011258201" ry="22.222011258201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="254.58107899239" y="308.8032402954"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:42.734637035003px">N</text>
<ellipse cx="325.4306229721" cy="494.50353135508" rx="22.222011258201" ry="22.222011258201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="325.4306229721" y="513.30677165048"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:42.734637035003px">N</text>
<ellipse cx="467.11215798478" cy="85.490617662675" rx="22.222011258201" ry="22.222011258201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="467.11215798478" y="104.29385795808"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:42.734637035003px">O</text>
<ellipse cx="467.11215798478" cy="412.7009486166" rx="22.222011258201" ry="22.222011258201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="467.11215798478" y="431.504188912"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:42.734637035003px">Cl</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 139👍, 0💬