Molecule FYI-1001272

A

Molecule Summary:

ID: FYI-1001272
SMILES: O=C(O)C(NC(=O)C(N)CCCN)CO

Received at FYIcenter.com on: 2022-04-22

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001272
FYIcenter.com

 15 14  0  0  0  0  0  0  0  0999 V2000
   10.9119    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    1.4000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6374    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.4000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  2  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  6  1  0  0  0  0
  9  8  1  0  0  0  0
 10  8  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14  4  1  0  0  0  0
 15 14  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="482" x2="509.5" y1="262" y2="277.5" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="509.5" x2="537" y1="277.5" y2="293" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #ff0000" />
<line x1="485" x2="512.5" y1="256" y2="272" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="512.5" x2="540" y1="272" y2="288" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #ff0000" />
<line x1="482.85151485992" x2="482.85151485992" y1="194.56382481511" y2="226.37588321007" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #ff0000" />
<line x1="482.85151485992" x2="482.85151485992" y1="226.37588321007" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="427.75302971985" x2="455.30227228989" y1="290" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="455.30227228989" x2="482.85151485992" y1="274.09397080252" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="372.65454457977" x2="400.20378714981" y1="258.18794160504" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #0000ff" />
<line x1="400.20378714981" x2="427.75302971985" y1="274.09397080252" y2="290" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="317.55151485992" x2="345.10302971985" y1="290" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="345.10302971985" x2="372.65454457977" y1="274.09397080252" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #0000ff" />
<line x1="321" x2="321" y1="354" y2="322" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #ff0000" />
<line x1="321" x2="321" y1="322" y2="290" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="315" x2="315" y1="354" y2="322" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #ff0000" />
<line x1="315" x2="315" y1="322" y2="290" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="262.45302971985" x2="290.00227228989" y1="258.18794160504" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="290.00227228989" x2="317.55151485992" y1="274.09397080252" y2="290" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="262.45302971985" x2="262.45302971985" y1="194.56382481511" y2="226.37588321007" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #0000ff" />
<line x1="262.45302971985" x2="262.45302971985" y1="226.37588321007" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="207.35454457977" x2="234.90378714981" y1="290" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="234.90378714981" x2="262.45302971985" y1="274.09397080252" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="152.25151485992" x2="179.80302971985" y1="258.18794160504" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="179.80302971985" x2="207.35454457977" y1="274.09397080252" y2="290" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="97.148485140076" x2="124.7" y1="290" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="124.7" x2="152.25151485992" y1="274.09397080252" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="42.05" x2="69.599242570038" y1="258.18794160504" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #0000ff" />
<line x1="69.599242570038" x2="97.148485140076" y1="274.09397080252" y2="290" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="427.75302971985" x2="427.75302971985" y1="353.62411678993" y2="321.81205839496" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="427.75302971985" x2="427.75302971985" y1="321.81205839496" y2="290" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<line x1="372.65454457977" x2="400.20378714981" y1="385.43617518489" y2="369.53014598741" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #ff0000" />
<line x1="400.20378714981" x2="427.75302971985" y1="369.53014598741" y2="353.62411678993" style="stroke-opacity:1; stroke-width: 2.6789163050962; stroke: #000000" />
<ellipse cx="537.95" cy="290" rx="17.412955983126" ry="17.412955983126" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="304.73403967803"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486453813703px">O</text>
<ellipse cx="482.85151485992" cy="194.56382481511" rx="17.412955983126" ry="17.412955983126" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="482.85151485992" y="209.29786449314"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486453813703px">O</text>
<ellipse cx="372.65454457977" cy="258.18794160504" rx="17.412955983126" ry="17.412955983126" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.65454457977" y="272.92198128307"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486453813703px">N</text>
<ellipse cx="317.55151485992" cy="353.62411678993" rx="17.412955983126" ry="17.412955983126" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="317.55151485992" y="368.35815646796"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486453813703px">O</text>
<ellipse cx="262.45302971985" cy="194.56382481511" rx="17.412955983126" ry="17.412955983126" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="262.45302971985" y="209.29786449314"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486453813703px">N</text>
<ellipse cx="42.05" cy="258.18794160504" rx="17.412955983126" ry="17.412955983126" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="272.92198128307"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486453813703px">N</text>
<ellipse cx="372.65454457977" cy="385.43617518489" rx="17.412955983126" ry="17.412955983126" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.65454457977" y="400.17021486292"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486453813703px">O</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 144👍, 0💬