Molecule FYI-1001268

A

Molecule Summary:

ID: FYI-1001268
SMILES: CCOC(=O)Cn3c(C(=O)OCC)cc2cc(OS(=O)(=O)c1ccc(C)cc1)ccc23

Received at FYIcenter.com on: 2022-04-21

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001268
FYIcenter.com

 54 56  0  0  0  0  0  0  0  0999 V2000
    9.4707    3.4385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1601    2.4880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8279    1.7437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5172    0.7931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5387    0.5869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1851    0.0488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8744   -0.9017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4580   -1.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4580   -1.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9580   -0.8404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9580   -2.5724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9580   -2.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4580   -3.4385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8744   -2.5112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9282   -2.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0622   -2.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1962   -2.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3301   -2.7064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4641   -2.2064    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.9641   -3.0724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9641   -1.3404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981   -1.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5981   -0.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -0.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -0.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -0.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -1.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -2.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1962   -1.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0622   -0.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9282   -1.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0600    3.2459    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.6633    4.0278    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8814    3.6311    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6131    2.7800    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7775    2.0000    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.7320   -0.2432    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5676    0.5367    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.5406   -2.3604    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.8504   -1.9619    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.9211   -3.7485    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.7680   -3.9754    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.9950   -3.1285    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.0670   -3.1005    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0622   -3.3264    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1350   -0.3964    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321    0.4136    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3100    0.3305    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4631    0.1036    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6900   -0.7434    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3291   -2.0164    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -2.8264    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6592   -0.8964    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0622   -0.0864    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  2  0  0  0  0
  4  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  2  0  0  0  0
  9 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
  8 14  2  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  2  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  2  0  0  0  0
 19 21  2  0  0  0  0
 19 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  2  0  0  0  0
 24 25  1  0  0  0  0
 25 26  1  0  0  0  0
 25 27  2  0  0  0  0
 27 28  1  0  0  0  0
 22 28  2  0  0  0  0
 17 29  1  0  0  0  0
 29 30  2  0  0  0  0
 30 31  1  0  0  0  0
 15 31  2  0  0  0  0
  7 31  1  0  0  0  0
  1 32  1  0  0  0  0
  1 33  1  0  0  0  0
  1 34  1  0  0  0  0
  2 35  1  0  0  0  0
  2 36  1  0  0  0  0
  6 37  1  0  0  0  0
  6 38  1  0  0  0  0
 12 39  1  0  0  0  0
 12 40  1  0  0  0  0
 13 41  1  0  0  0  0
 13 42  1  0  0  0  0
 13 43  1  0  0  0  0
 14 44  1  0  0  0  0
 16 45  1  0  0  0  0
 23 46  1  0  0  0  0
 24 47  1  0  0  0  0
 26 48  1  0  0  0  0
 26 49  1  0  0  0  0
 26 50  1  0  0  0  0
 27 51  1  0  0  0  0
 28 52  1  0  0  0  0
 29 53  1  0  0  0  0
 30 54  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="358.9188578747" x2="352.77347928088" y1="425.02817370072" y2="406.22204893113" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="352.77347928088" x2="346.62810068705" y1="406.22204893113" y2="387.41592416154" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="346.62810068705" x2="359.84086251885" y1="387.41592416154" y2="372.68957101477" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="359.84086251885" x2="373.05362435066" y1="372.68957101477" y2="357.963217868" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="373.05362435066" x2="366.90626720609" y1="357.963217868" y2="339.15511454767" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="366.90626720609" x2="360.75891006152" y1="339.15511454767" y2="320.34701122735" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="362" x2="342.5" y1="319" y2="315" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="342.5" x2="323" y1="315" y2="311" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="361" x2="341.5" y1="323" y2="319" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="341.5" x2="322" y1="319" y2="315" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="360.75891006152" x2="373.97365044407" y1="320.34701122735" y2="305.62065808058" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="373.97365044407" x2="387.18839082661" y1="305.62065808058" y2="290.89430493381" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="387.18839082661" x2="381.04103368204" y1="290.89430493381" y2="272.08818016422" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="381.04103368204" x2="374.89367653748" y1="272.08818016422" y2="253.28205539463" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #0000ff" />
<line x1="374.89367653748" x2="386.44049864745" y1="253.28205539463" y2="237.3606576018" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #0000ff" />
<line x1="386.44049864745" x2="397.98732075743" y1="237.3606576018" y2="221.43925980897" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="397.98732075743" x2="417.77282814258" y1="221.43925980897" y2="221.43925980897" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="417.77282814258" x2="437.55833552773" y1="221.43925980897" y2="221.43925980897" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="436" x2="446" y1="223" y2="240" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="446" x2="456" y1="240" y2="257" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="440" x2="450" y1="221" y2="238" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="450" x2="460" y1="238" y2="255" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="437.55833552773" x2="447.45108922031" y1="221.43925980897" y2="204.30501041342" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="447.45108922031" x2="457.34384291289" y1="204.30501041342" y2="187.17076101788" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="457.34384291289" x2="477.12935029804" y1="187.17076101788" y2="187.17076101788" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="477.12935029804" x2="496.91485768319" y1="187.17076101788" y2="187.17076101788" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="496.91485768319" x2="506.80761137577" y1="187.17076101788" y2="170.0345330716" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="506.80761137577" x2="516.70036506835" y1="170.0345330716" y2="152.89830512532" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="400" x2="388.5" y1="221" y2="205" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="388.5" x2="377" y1="205" y2="189" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="397" x2="385.5" y1="223" y2="207" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="385.5" x2="374" y1="207" y2="191" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="374.89367653748" x2="356.17262944964" y1="189.59250712183" y2="195.62312977282" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="356.17262944964" x2="337.45158236181" y1="195.62312977282" y2="201.65375242381" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="337.45158236181" x2="320.31733296627" y1="201.65375242381" y2="191.76099873124" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="320.31733296627" x2="303.18308357073" y1="191.76099873124" y2="181.86824503866" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="303" x2="285.5" y1="181" y2="190.5" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="285.5" x2="268" y1="190.5" y2="200" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="305" x2="287.5" y1="184" y2="194" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="287.5" x2="270" y1="194" y2="204" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="268.91458477964" x2="251.77835683336" y1="201.65375242381" y2="191.76099873124" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="251.77835683336" x2="234.64212888708" y1="191.76099873124" y2="181.86824503866" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="234.64212888708" x2="217.50787949154" y1="181.86824503866" y2="191.76099873124" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="217.50787949154" x2="200.373630096" y1="191.76099873124" y2="201.65375242381" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #c8aa1a" />
<line x1="203" x2="193" y1="201" y2="184" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #c8aa1a" />
<line x1="193" x2="183" y1="184" y2="167" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="199" x2="189" y1="203" y2="186" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #c8aa1a" />
<line x1="189" x2="179" y1="186" y2="169" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="199" x2="209" y1="203" y2="220" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #c8aa1a" />
<line x1="209" x2="219" y1="220" y2="237" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="203" x2="212.5" y1="201" y2="218" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #c8aa1a" />
<line x1="212.5" x2="222" y1="218" y2="235" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #ff0000" />
<line x1="200.373630096" x2="183.23938070045" y1="201.65375242381" y2="211.54650611639" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #c8aa1a" />
<line x1="183.23938070045" x2="166.10513130491" y1="211.54650611639" y2="221.43925980897" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="166.10513130491" x2="166.10513130491" y1="221.43925980897" y2="241.22476719412" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="166.10513130491" x2="166.10513130491" y1="241.22476719412" y2="261.01027457927" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="166" x2="148.5" y1="260" y2="269.5" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="148.5" x2="131" y1="269.5" y2="279" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="168" x2="150.5" y1="263" y2="273" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="150.5" x2="133" y1="273" y2="283" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="131.83663251382" x2="114.70040456754" y1="280.79578196443" y2="270.90302827185" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="114.70040456754" x2="97.564176621263" y1="270.90302827185" y2="261.01027457927" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="97.564176621263" x2="80.42992722572" y1="261.01027457927" y2="270.90302827185" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="80.42992722572" x2="63.295677830177" y1="270.90302827185" y2="280.79578196443" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="100" x2="100" y1="262" y2="242" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="100" x2="100" y1="242" y2="222" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="96" x2="96" y1="262" y2="242" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="96" x2="96" y1="242" y2="222" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="97.564176621263" x2="114.70040456754" y1="221.43925980897" y2="211.54650611639" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="114.70040456754" x2="131.83663251382" y1="211.54650611639" y2="201.65375242381" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="168" x2="150.5" y1="220" y2="210" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="150.5" x2="133" y1="210" y2="200" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="166" x2="148.5" y1="224" y2="214" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="148.5" x2="131" y1="214" y2="204" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="268.91458477964" x2="268.91458477964" y1="201.65375242381" y2="221.43925980897" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="268.91458477964" x2="268.91458477964" y1="221.43925980897" y2="241.22476719412" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="268" x2="285.5" y1="244" y2="253.5" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="285.5" x2="303" y1="253.5" y2="263" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="270" x2="287.5" y1="240" y2="250" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="287.5" x2="305" y1="250" y2="260" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="303.18308357073" x2="320.31733296627" y1="261.01027457927" y2="251.1175208867" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="320.31733296627" x2="337.45158236181" y1="251.1175208867" y2="241.22476719412" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="336" x2="336" y1="202" y2="222" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="336" x2="336" y1="222" y2="242" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="340" x2="340" y1="202" y2="222" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="340" x2="340" y1="222" y2="242" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<line x1="374.89367653748" x2="356.17262944964" y1="253.28205539463" y2="247.25341129438" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #0000ff" />
<line x1="356.17262944964" x2="337.45158236181" y1="247.25341129438" y2="241.22476719412" style="stroke-opacity:1; stroke-width: 1.6651173943993; stroke: #000000" />
<ellipse cx="373.05362435066" cy="357.963217868" rx="10.823263063595" ry="10.823263063595" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="373.05362435066" y="367.1213635372"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.813967429991px">O</text>
<ellipse cx="322.03867210878" cy="312.18746798171" rx="10.823263063595" ry="10.823263063595" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="322.03867210878" y="321.34561365091"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.813967429991px">O</text>
<ellipse cx="374.89367653748" cy="253.28205539463" rx="10.823263063595" ry="10.823263063595" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="374.89367653748" y="262.44020106383"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:20.813967429991px">N</text>
<ellipse cx="457.34384291289" cy="255.70775860005" rx="10.823263063595" ry="10.823263063595" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="457.34384291289" y="264.86590426925"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.813967429991px">O</text>
<ellipse cx="457.34384291289" cy="187.17076101788" rx="10.823263063595" ry="10.823263063595" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="457.34384291289" y="196.32890668708"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.813967429991px">O</text>
<ellipse cx="234.64212888708" cy="181.86824503866" rx="10.823263063595" ry="10.823263063595" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="234.64212888708" y="191.02639070786"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.813967429991px">O</text>
<ellipse cx="200.373630096" cy="201.65375242381" rx="10.823263063595" ry="10.823263063595" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="200.373630096" y="210.81189809301"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:20.813967429991px">S</text>
<ellipse cx="180.58812271084" cy="167.38525363273" rx="10.823263063595" ry="10.823263063595" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="180.58812271084" y="176.54339930193"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.813967429991px">O</text>
<ellipse cx="220.15913748115" cy="235.9222512149" rx="10.823263063595" ry="10.823263063595" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="220.15913748115" y="245.0803968841"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.813967429991px">O</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 139👍, 0💬