Molecule FYI-1001266

A

Molecule Summary:

ID: FYI-1001266
SMILES: CO[C@H]1C=C(OC)C(=O)c2c1oc1c2oc2c(c1=O)c(OC)c(c(c2OC)OC)OC

Received at FYIcenter.com on: 2022-04-21

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001266
FYIcenter.com

 31 34  0  0  1  0  0  0  0  0999 V2000
   12.2824    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0699    4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8575    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8575    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6451    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6451    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8575    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4326    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2202    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4326    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6451    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3541    6.2693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9616    6.4158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3922    5.1367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9999    4.9904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1770    6.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7464    7.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1388    7.5484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7082    8.8272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9235    8.5347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4930    9.8135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6701   10.9461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5312    8.3884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9618    7.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7847    5.9767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2152    4.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0381    3.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5695    6.9630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.6840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7083    9.5209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3160    9.3745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  1  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  5  1  0  0  0  0
  9  8  2  0  0  0  0
 10  8  1  0  0  0  0
 11 10  2  0  0  0  0
 11  3  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 14 10  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 18 13  1  0  0  0  0
 19 18  2  0  0  0  0
 20 17  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 20  2  0  0  0  0
 24 23  1  0  0  0  0
 25 24  2  0  0  0  0
 25 16  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 28 24  1  0  0  0  0
 29 28  1  0  0  0  0
 30 23  1  0  0  0  0
 31 30  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="488.99550006513" x2="513.47275003257" y1="266.86319489676" y2="252.73199903928" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="513.47275003257" x2="537.95" y1="252.73199903928" y2="238.60080318179" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<polygon points=" 441,239 485,275 494,260" fill-opacity="1"  style="fill:#000000" />
<line x1="440.0450376148" x2="440.0450376148" y1="182.07601975184" y2="210.33841146681" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="440.0450376148" x2="440.0450376148" y1="210.33841146681" y2="238.60080318179" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="390" x2="414.5" y1="157" y2="171" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="414.5" x2="439" y1="171" y2="185" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="393" x2="417.5" y1="152" y2="166" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="417.5" x2="442" y1="166" y2="180" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="391.09457516446" x2="391.09457516446" y1="97.288844606917" y2="125.55123632189" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="391.09457516446" x2="391.09457516446" y1="125.55123632189" y2="153.81362803687" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="440.0450376148" x2="415.56980638963" y1="69.026452891943" y2="83.15764874943" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="415.56980638963" x2="391.09457516446" y1="83.15764874943" y2="97.288844606917" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="342.1400752296" x2="366.61732519703" y1="182.07601975184" y2="167.94482389435" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="366.61732519703" x2="391.09457516446" y1="167.94482389435" y2="153.81362803687" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="292" x2="316.5" y1="157" y2="171" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="316.5" x2="341" y1="171" y2="185" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="295" x2="319.5" y1="152" y2="166" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="319.5" x2="344" y1="166" y2="180" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="342.1400752296" x2="342.1400752296" y1="238.60080318179" y2="210.33841146681" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="342.1400752296" x2="342.1400752296" y1="210.33841146681" y2="182.07601975184" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="393" x2="368.5" y1="265" y2="251" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="368.5" x2="344" y1="251" y2="237" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="390" x2="365.5" y1="270" y2="256" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="365.5" x2="341" y1="256" y2="242" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="391.09457516446" x2="415.56980638963" y1="266.86319489676" y2="252.73199903928" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="415.56980638963" x2="440.0450376148" y1="252.73199903928" y2="238.60080318179" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="379.3454951801" x2="385.22003517228" y1="322.14847057578" y2="294.50583273627" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="385.22003517228" x2="391.09457516446" y1="294.50583273627" y2="266.86319489676" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="323.12352308995" x2="351.23450913502" y1="328.06338541327" y2="325.10592799453" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="351.23450913502" x2="379.3454951801" y1="325.10592799453" y2="322.14847057578" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="298" x2="309.5" y1="278" y2="304" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="309.5" x2="321" y1="304" y2="330" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="303" x2="314.5" y1="276" y2="301.5" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="314.5" x2="326" y1="301.5" y2="327" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="300.13408617208" x2="321.13708070084" y1="276.41992078095" y2="257.51036198137" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="321.13708070084" x2="342.1400752296" y1="257.51036198137" y2="238.60080318179" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="243.920189051" x2="272.02713761154" y1="270.51308091253" y2="273.46650084674" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="272.02713761154" x2="300.13408617208" y1="273.46650084674" y2="276.41992078095" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="210.69572884778" x2="227.30795894939" y1="316.24163070735" y2="293.37735580994" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="227.30795894939" x2="243.920189051" y1="293.37735580994" y2="270.51308091253" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="237" x2="225.5" y1="367" y2="341.5" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="225.5" x2="214" y1="341.5" y2="316" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="231" x2="219.5" y1="370" y2="344" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="219.5" x2="208" y1="344" y2="318" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="289.90310037126" x2="261.79413306846" y1="373.7919352081" y2="370.83851527389" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="261.79413306846" x2="233.68516576565" y1="370.83851527389" y2="367.88509533967" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="289.90310037126" x2="306.51331173061" y1="373.7919352081" y2="350.92766031069" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="306.51331173061" x2="323.12352308995" y1="350.92766031069" y2="328.06338541327" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="316" x2="304.5" y1="425" y2="399" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="304.5" x2="293" y1="399" y2="373" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="311" x2="299.5" y1="427" y2="401.5" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="299.5" x2="288" y1="401.5" y2="376" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="200.46070556243" x2="217.07293566404" y1="413.6136451345" y2="390.74937023709" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="217.07293566404" x2="233.68516576565" y1="390.74937023709" y2="367.88509533967" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="223.45417996483" x2="211.95744276363" y1="465.24499731323" y2="439.42932122387" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="211.95744276363" x2="200.46070556243" y1="439.42932122387" y2="413.6136451345" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="190.22971976161" x2="206.84194986322" y1="510.97354710806" y2="488.10927221064" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="206.84194986322" x2="223.45417996483" y1="488.10927221064" y2="465.24499731323" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="144" x2="172.5" y1="411" y2="414" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="172.5" x2="201" y1="414" y2="417" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="145" x2="173" y1="405" y2="408" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="173" x2="201" y1="408" y2="411" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="121.25737152348" x2="132.75208998241" y1="356.06334063375" y2="381.88507294991" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="132.75208998241" x2="144.24680844135" y1="381.88507294991" y2="407.70680526607" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="153" x2="136" y1="309" y2="332" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="136" x2="119" y1="332" y2="355" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="157" x2="140.5" y1="313" y2="335.5" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="140.5" x2="124" y1="335.5" y2="358" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="154.4818317267" x2="182.58878028724" y1="310.33479083892" y2="313.28821077314" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="182.58878028724" x2="210.69572884778" y1="313.28821077314" y2="316.24163070735" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="131.4883573243" x2="142.9850945255" y1="258.69536369114" y2="284.51507726503" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="142.9850945255" x2="154.4818317267" y1="284.51507726503" y2="310.33479083892" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="164.71281752752" x2="148.10058742591" y1="212.96681389631" y2="235.83108879372" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="148.10058742591" x2="131.4883573243" y1="235.83108879372" y2="258.69536369114" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="65.043474402397" x2="93.150422962939" y1="350.15650076532" y2="353.10992069954" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="93.150422962939" x2="121.25737152348" y1="353.10992069954" y2="356.06334063375" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="42.05" x2="53.546737201198" y1="298.51707361753" y2="324.33678719143" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="53.546737201198" x2="65.043474402397" y1="324.33678719143" y2="350.15650076532" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="111.02234823813" x2="127.63457833974" y1="453.43131757637" y2="430.56906142122" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<line x1="127.63457833974" x2="144.24680844135" y1="430.56906142122" y2="407.70680526607" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="54.808451117046" x2="82.915399677587" y1="447.52044022341" y2="450.47587889989" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #000000" />
<line x1="82.915399677587" x2="111.02234823813" y1="450.47587889989" y2="453.43131757637" style="stroke-opacity:1; stroke-width: 2.3800129989239; stroke: #ff0000" />
<ellipse cx="488.99550006513" cy="266.86319489676" rx="15.470084493005" ry="15.470084493005" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="488.99550006513" y="279.95326639084"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:29.750162486549px">O</text>
<ellipse cx="391.09457516446" cy="97.288844606917" rx="15.470084493005" ry="15.470084493005" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="391.09457516446" y="110.378916101"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:29.750162486549px">O</text>
<ellipse cx="293.18961277926" cy="153.81362803687" rx="15.470084493005" ry="15.470084493005" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="293.18961277926" y="166.90369953095"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:29.750162486549px">O</text>
<ellipse cx="379.3454951801" cy="322.14847057578" rx="15.470084493005" ry="15.470084493005" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="379.3454951801" y="335.23854206986"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:29.750162486549px">O</text>
<ellipse cx="243.920189051" cy="270.51308091253" rx="15.470084493005" ry="15.470084493005" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="243.920189051" y="283.60315240661"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:29.750162486549px">O</text>
<ellipse cx="312.89253728913" cy="425.42328738683" rx="15.470084493005" ry="15.470084493005" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="312.89253728913" y="438.51335888091"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:29.750162486549px">O</text>
<ellipse cx="223.45417996483" cy="465.24499731323" rx="15.470084493005" ry="15.470084493005" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="223.45417996483" y="478.33506880731"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:29.750162486549px">O</text>
<ellipse cx="131.4883573243" cy="258.69536369114" rx="15.470084493005" ry="15.470084493005" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="131.4883573243" y="271.78543518522"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:29.750162486549px">O</text>
<ellipse cx="65.043474402397" cy="350.15650076532" rx="15.470084493005" ry="15.470084493005" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="65.043474402397" y="363.2465722594"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:29.750162486549px">O</text>
<ellipse cx="111.02234823813" cy="453.43131757637" rx="15.470084493005" ry="15.470084493005" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="111.02234823813" y="466.52138907045"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:29.750162486549px">O</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 132👍, 0💬