Molecule FYI-1001264

A

Molecule Summary:

ID: FYI-1001264
SMILES: C1(=C(C(=C[C@]([C@H]1OC(=O)C)(CC#N)OC(=O)C)Br)OC)Br

Received at FYIcenter.com on: 2022-04-20

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001264
FYIcenter.com

 21 21  0  0  1  0  0  0  0  0999 V2000
    4.8497    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    6.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    4.2000    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    0.0000    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  6  1  1  0  0  0  0
  6  7  1  6  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  8  1  0  0  0  0
  5 11  1  6  0  0  0
 12 11  1  0  0  0  0
 13 12  3  0  0  0  0
 14  5  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 15  1  0  0  0  0
 18  3  1  0  0  0  0
 19  2  1  0  0  0  0
 20 19  1  0  0  0  0
 21  1  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="399" x2="363.5" y1="225" y2="205" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="363.5" x2="328" y1="205" y2="185" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="395" x2="359.5" y1="233" y2="212.5" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="359.5" x2="324" y1="212.5" y2="192" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="396.25760801687" x2="396.25760801687" y1="310.45044832746" y2="269.54955167254" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="396.25760801687" x2="396.25760801687" y1="269.54955167254" y2="228.64865501761" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="328" x2="363.5" y1="356" y2="335.5" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="363.5" x2="399" y1="335.5" y2="315" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="324" x2="359.5" y1="348" y2="327.5" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="359.5" x2="395" y1="327.5" y2="307" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="254.57690200422" x2="289.99707850738" y1="310.45044832746" y2="330.90089665492" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="289.99707850738" x2="325.41725501055" y1="330.90089665492" y2="351.35134498239" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="254.57690200422" x2="254.57690200422" y1="228.64865501761" y2="269.54955167254" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="254.57690200422" x2="254.57690200422" y1="269.54955167254" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="254.57690200422" x2="289.99707850738" y1="228.64865501761" y2="208.19820669015" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="289.99707850738" x2="325.41725501055" y1="208.19820669015" y2="187.74775836269" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<polygon points=" 255,229 190,178 178,199" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="112.89035300633" x2="148.31345100211" y1="228.64865501761" y2="208.19820669015" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="148.31345100211" x2="183.73654899789" y1="208.19820669015" y2="187.74775836269" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #ff0000" />
<line x1="118" x2="118" y1="311" y2="270" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #ff0000" />
<line x1="118" x2="118" y1="270" y2="229" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="109" x2="109" y1="311" y2="270" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #ff0000" />
<line x1="109" x2="109" y1="270" y2="229" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="42.05" x2="77.470176503164" y1="187.74775836269" y2="208.19820669015" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="77.470176503164" x2="112.89035300633" y1="208.19820669015" y2="228.64865501761" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<polygon points=" 255,311 243,393 267,393" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="325.41725501055" x2="289.99707850738" y1="433.15313829223" y2="412.70268996477" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="289.99707850738" x2="254.57690200422" y1="412.70268996477" y2="392.25224163731" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="401" x2="365.5" y1="467" y2="446.5" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #0000ff" />
<line x1="365.5" x2="330" y1="446.5" y2="426" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="392" x2="357" y1="482" y2="461.5" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #0000ff" />
<line x1="357" x2="322" y1="461.5" y2="441" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="396.25760801687" x2="360.83743151371" y1="474.05403494716" y2="453.60358661969" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #0000ff" />
<line x1="360.83743151371" x2="325.41725501055" y1="453.60358661969" y2="433.15313829223" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="183.73654899789" x2="219.15672550105" y1="351.35134498239" y2="330.90089665492" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #ff0000" />
<line x1="219.15672550105" x2="254.57690200422" y1="330.90089665492" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="183.73654899789" x2="183.73654899789" y1="433.15313829223" y2="392.25224163731" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="183.73654899789" x2="183.73654899789" y1="392.25224163731" y2="351.35134498239" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #ff0000" />
<line x1="116" x2="151" y1="478" y2="457.5" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #ff0000" />
<line x1="151" x2="186" y1="457.5" y2="437" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="111" x2="146.5" y1="471" y2="450.5" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #ff0000" />
<line x1="146.5" x2="182" y1="450.5" y2="430" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="254.57690200422" x2="219.15672550105" y1="474.05403494716" y2="453.60358661969" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="219.15672550105" x2="183.73654899789" y1="453.60358661969" y2="433.15313829223" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="467.10964699367" x2="431.68362750527" y1="351.35134498239" y2="330.90089665492" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #db8802" />
<line x1="431.68362750527" x2="396.25760801687" y1="330.90089665492" y2="310.45044832746" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="467.10964699367" x2="431.68362750527" y1="187.74775836269" y2="208.19820669015" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #ff0000" />
<line x1="431.68362750527" x2="396.25760801687" y1="208.19820669015" y2="228.64865501761" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="537.95" x2="502.52982349684" y1="228.64865501761" y2="208.19820669015" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<line x1="502.52982349684" x2="467.10964699367" y1="208.19820669015" y2="187.74775836269" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #ff0000" />
<line x1="325.41725501055" x2="325.41725501055" y1="105.94596505284" y2="146.84686170777" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #db8802" />
<line x1="325.41725501055" x2="325.41725501055" y1="146.84686170777" y2="187.74775836269" style="stroke-opacity:1; stroke-width: 3.4442329915104; stroke: #000000" />
<ellipse cx="183.73654899789" cy="187.74775836269" rx="22.387514444818" ry="22.387514444818" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="183.73654899789" y="206.691039816"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:43.05291239388px">O</text>
<ellipse cx="112.89035300633" cy="310.45044832746" rx="22.387514444818" ry="22.387514444818" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="112.89035300633" y="329.39372978077"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:43.05291239388px">O</text>
<ellipse cx="396.25760801687" cy="474.05403494716" rx="22.387514444818" ry="22.387514444818" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="396.25760801687" y="492.99731640046"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:43.05291239388px">N</text>
<ellipse cx="183.73654899789" cy="351.35134498239" rx="22.387514444818" ry="22.387514444818" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="183.73654899789" y="370.29462643569"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:43.05291239388px">O</text>
<ellipse cx="112.89035300633" cy="474.05403494716" rx="22.387514444818" ry="22.387514444818" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="112.89035300633" y="492.99731640046"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:43.05291239388px">O</text>
<ellipse cx="467.10964699367" cy="351.35134498239" rx="22.387514444818" ry="22.387514444818" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="467.10964699367" y="370.29462643569"  fill="#db8802" style="text-anchor:middle;  font-family:sans-serif;font-size:43.05291239388px">Br</text>
<ellipse cx="467.10964699367" cy="187.74775836269" rx="22.387514444818" ry="22.387514444818" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="467.10964699367" y="206.691039816"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:43.05291239388px">O</text>
<ellipse cx="325.41725501055" cy="105.94596505284" rx="22.387514444818" ry="22.387514444818" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="325.41725501055" y="124.88924650615"  fill="#db8802" style="text-anchor:middle;  font-family:sans-serif;font-size:43.05291239388px">Br</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 133👍, 0💬