Molecule FYI-1001260

A

Molecule Summary:

ID: FYI-1001260
SMILES: CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC

Received at FYIcenter.com on: 2022-04-17

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001260
FYIcenter.com

 28 28  0  0  0  0  0  0  0  0999 V2000
   12.1243    9.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    9.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    9.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    9.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   11.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    9.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    9.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    8.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  5  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 10  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 17 12  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 18  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 22  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="488.36122703991" x2="513.15561351996" y1="476.10105325668" y2="461.78558762155" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="513.15561351996" x2="537.95" y1="461.78558762155" y2="447.47012198642" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="438.77245407982" x2="463.56684055987" y1="447.47012198642" y2="461.78558762155" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="463.56684055987" x2="488.36122703991" y1="461.78558762155" y2="476.10105325668" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="389.18368111973" x2="413.97806759978" y1="476.10105325668" y2="461.78558762155" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="413.97806759978" x2="438.77245407982" y1="461.78558762155" y2="447.47012198642" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="339.59490815965" x2="364.38929463969" y1="447.47012198642" y2="461.78558762155" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="364.38929463969" x2="389.18368111973" y1="461.78558762155" y2="476.10105325668" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="339.59490815965" x2="339.59490815965" y1="390.20825944591" y2="418.83919071617" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="339.59490815965" x2="339.59490815965" y1="418.83919071617" y2="447.47012198642" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="389.18368111973" x2="364.38929463969" y1="361.57732817565" y2="375.89279381078" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="364.38929463969" x2="339.59490815965" y1="375.89279381078" y2="390.20825944591" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="290.00204506652" x2="314.79847661308" y1="476.10105325668" y2="461.78558762155" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="314.79847661308" x2="339.59490815965" y1="461.78558762155" y2="447.47012198642" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="240.41327210643" x2="265.20765858648" y1="447.47012198642" y2="461.78558762155" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #ff0000" />
<line x1="265.20765858648" x2="290.00204506652" y1="461.78558762155" y2="476.10105325668" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="190.8204090133" x2="215.61684055987" y1="476.10105325668" y2="461.78558762155" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="215.61684055987" x2="240.41327210643" y1="461.78558762155" y2="447.47012198642" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #ff0000" />
<line x1="194" x2="194" y1="534" y2="505.5" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #ff0000" />
<line x1="194" x2="194" y1="505.5" y2="477" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="188" x2="188" y1="534" y2="505.5" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #ff0000" />
<line x1="188" x2="188" y1="505.5" y2="477" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="141.23163605322" x2="166.02602253326" y1="447.47012198642" y2="461.78558762155" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="166.02602253326" x2="190.8204090133" y1="461.78558762155" y2="476.10105325668" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="94" x2="118.5" y1="479" y2="465" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="118.5" x2="143" y1="465" y2="451" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="91" x2="115.5" y1="474" y2="459.5" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="115.5" x2="140" y1="459.5" y2="445" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="42.05" x2="66.846431546563" y1="447.47012198642" y2="461.78558762155" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="66.846431546563" x2="91.642863093127" y1="461.78558762155" y2="476.10105325668" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="40" x2="40" y1="391" y2="419.5" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="40" x2="40" y1="419.5" y2="448" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="46" x2="46" y1="391" y2="419.5" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="46" x2="46" y1="419.5" y2="448" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="91.642863093127" x2="66.846431546563" y1="361.57732817565" y2="375.89279381078" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="66.846431546563" x2="42.05" y1="375.89279381078" y2="390.20825944591" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="143" x2="118.5" y1="388" y2="373.5" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="118.5" x2="94" y1="373.5" y2="359" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="140" x2="115.5" y1="393" y2="379" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="115.5" x2="91" y1="379" y2="365" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="141.23163605322" x2="141.23163605322" y1="390.20825944591" y2="418.83919071617" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="141.23163605322" x2="141.23163605322" y1="418.83919071617" y2="447.47012198642" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="190.8204090133" x2="166.02602253326" y1="361.57732817565" y2="375.89279381078" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="166.02602253326" x2="141.23163605322" y1="375.89279381078" y2="390.20825944591" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="242" x2="217.5" y1="388" y2="373.5" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #ff0000" />
<line x1="217.5" x2="193" y1="373.5" y2="359" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="239" x2="214.5" y1="393" y2="379" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #ff0000" />
<line x1="214.5" x2="190" y1="379" y2="365" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="190.8204090133" x2="190.8204090133" y1="304.31546563513" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #ff0000" />
<line x1="190.8204090133" x2="190.8204090133" y1="332.94639690539" y2="361.57732817565" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="240.41327210643" x2="215.61684055987" y1="275.68453436487" y2="290" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="215.61684055987" x2="190.8204090133" y1="290" y2="304.31546563513" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #ff0000" />
<line x1="240.41327210643" x2="240.41327210643" y1="218.42267182435" y2="247.05360309461" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="240.41327210643" x2="240.41327210643" y1="247.05360309461" y2="275.68453436487" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="190.8204090133" x2="215.61684055987" y1="189.79174055409" y2="204.10720618922" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="215.61684055987" x2="240.41327210643" y1="204.10720618922" y2="218.42267182435" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="141.23163605322" x2="166.02602253326" y1="218.42267182435" y2="204.10720618922" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="166.02602253326" x2="190.8204090133" y1="204.10720618922" y2="189.79174055409" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="290.00204506652" x2="265.20765858648" y1="189.79174055409" y2="204.10720618922" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="265.20765858648" x2="240.41327210643" y1="204.10720618922" y2="218.42267182435" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="290.00204506652" x2="290.00204506652" y1="132.52987801358" y2="161.16080928383" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="290.00204506652" x2="290.00204506652" y1="161.16080928383" y2="189.79174055409" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="339.59490815965" x2="314.79847661308" y1="103.89894674332" y2="118.21441237845" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="314.79847661308" x2="290.00204506652" y1="118.21441237845" y2="132.52987801358" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="339.59490815965" x2="339.59490815965" y1="46.637084202799" y2="75.268015473058" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<line x1="339.59490815965" x2="339.59490815965" y1="75.268015473058" y2="103.89894674332" style="stroke-opacity:1; stroke-width: 2.4110211107031; stroke: #000000" />
<ellipse cx="240.41327210643" cy="447.47012198642" rx="15.67163721957" ry="15.67163721957" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.41327210643" y="460.73073809529"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137763883788px">O</text>
<ellipse cx="190.8204090133" cy="533.3629157972" rx="15.67163721957" ry="15.67163721957" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="190.8204090133" y="546.62353190607"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137763883788px">O</text>
<ellipse cx="240.41327210643" cy="390.20825944591" rx="15.67163721957" ry="15.67163721957" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.41327210643" y="403.46887555477"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137763883788px">O</text>
<ellipse cx="190.8204090133" cy="304.31546563513" rx="15.67163721957" ry="15.67163721957" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="190.8204090133" y="317.576081744"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137763883788px">O</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 132👍, 0💬