Molecule FYI-1001621

A

Molecule Summary:

ID: FYI-1001621
SMILES: NC1=NC(=O)c2ncn(COCCO)c2N1

Received at FYIcenter.com on: 2022-10-05

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001621
FYIcenter.com

 16 17  0  0  0  0  0  0  0  0999 V2000
    9.5759    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1431    1.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0800    2.3719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6474    3.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5842    4.7438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2779    3.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5779    5.2069    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2086    4.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    3.5235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    3.5235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    3.5235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.8235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3412    2.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7738    1.6226    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  4  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15  9  1  0  0  0  0
 15  6  2  0  0  0  0
 16 15  1  0  0  0  0
 16  2  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="470.43034901079" x2="480.56930708037" y1="230.40550962756" y2="199.21322064965" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="480.56930708037" x2="490.70826514994" y1="199.21322064965" y2="168.02093167174" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #0000ff" />
<line x1="517" x2="495" y1="277" y2="253" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #0000ff" />
<line x1="495" x2="473" y1="253" y2="229" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="512" x2="490" y1="282" y2="257.5" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #0000ff" />
<line x1="490" x2="468" y1="257.5" y2="233" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="494.05824436424" x2="504.1925171482" y1="341.53579911566" y2="310.34351013775" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="504.1925171482" x2="514.32678993216" y1="310.34351013775" y2="279.15122115984" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #0000ff" />
<line x1="541" x2="519" y1="388" y2="364" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #ff0000" />
<line x1="519" x2="497" y1="364" y2="340" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="536" x2="514" y1="393" y2="368.5" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #ff0000" />
<line x1="514" x2="492" y1="368.5" y2="344" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="429.89325787495" x2="461.97575111959" y1="355.1746655392" y2="348.35523232743" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="461.97575111959" x2="494.05824436424" y1="348.35523232743" y2="341.53579911566" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="397.0962585741" x2="413.49475822452" y1="411.97906832826" y2="383.57686693373" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #0000ff" />
<line x1="413.49475822452" x2="429.89325787495" y1="383.57686693373" y2="355.1746655392" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="333" x2="365" y1="402" y2="409" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="365" x2="397" y1="409" y2="416" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #0000ff" />
<line x1="334" x2="366" y1="395" y2="402" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="366" x2="398" y1="402" y2="409" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #0000ff" />
<line x1="326.08138451654" x2="329.51101358629" y1="333.10697029535" y2="365.72358610004" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #0000ff" />
<line x1="329.51101358629" x2="332.94064265603" y1="365.72358610004" y2="398.34020190473" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="269.27229644187" x2="297.6768404792" y1="300.3099709945" y2="316.70847064492" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="297.6768404792" x2="326.08138451654" y1="316.70847064492" y2="333.10697029535" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #0000ff" />
<line x1="212.4678936528" x2="240.87009504733" y1="333.10697029535" y2="316.70847064492" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #ff0000" />
<line x1="240.87009504733" x2="269.27229644187" y1="316.70847064492" y2="300.3099709945" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="155.66349086374" x2="184.06569225827" y1="300.3099709945" y2="316.70847064492" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="184.06569225827" x2="212.4678936528" y1="316.70847064492" y2="333.10697029535" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #ff0000" />
<line x1="98.854402789063" x2="127.2589468264" y1="333.10697029535" y2="316.70847064492" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="127.2589468264" x2="155.66349086374" y1="316.70847064492" y2="300.3099709945" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="42.05" x2="70.452201394531" y1="300.3099709945" y2="316.70847064492" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #ff0000" />
<line x1="70.452201394531" x2="98.854402789063" y1="316.70847064492" y2="333.10697029535" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="386.0061875248" x2="356.04378602067" y1="306.42895400692" y2="319.76796215113" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="356.04378602067" x2="326.08138451654" y1="319.76796215113" y2="333.10697029535" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #0000ff" />
<line x1="384" x2="406" y1="309" y2="333.5" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="406" x2="428" y1="333.5" y2="358" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="389" x2="411" y1="305" y2="329" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="411" x2="433" y1="329" y2="353" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="406.27473309272" x2="396.14046030876" y1="244.0443760511" y2="275.23666502901" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #0000ff" />
<line x1="396.14046030876" x2="386.0061875248" y1="275.23666502901" y2="306.42895400692" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<line x1="406.27473309272" x2="438.35254105176" y1="244.0443760511" y2="237.22494283933" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #0000ff" />
<line x1="438.35254105176" x2="470.43034901079" y1="237.22494283933" y2="230.40550962756" style="stroke-opacity:1; stroke-width: 2.7619147482796; stroke: #000000" />
<ellipse cx="490.70826514994" cy="168.02093167174" rx="17.952445863817" ry="17.952445863817" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="490.70826514994" y="183.21146278727"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.523934353495px">N</text>
<ellipse cx="514.32678993216" cy="279.15122115984" rx="17.952445863817" ry="17.952445863817" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="514.32678993216" y="294.34175227538"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.523934353495px">N</text>
<ellipse cx="537.95" cy="390.28151064795" rx="17.952445863817" ry="17.952445863817" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="405.47204176348"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:34.523934353495px">O</text>
<ellipse cx="397.0962585741" cy="411.97906832826" rx="17.952445863817" ry="17.952445863817" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="397.0962585741" y="427.1695994438"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.523934353495px">N</text>
<ellipse cx="326.08138451654" cy="333.10697029535" rx="17.952445863817" ry="17.952445863817" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="326.08138451654" y="348.29750141088"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.523934353495px">N</text>
<ellipse cx="212.4678936528" cy="333.10697029535" rx="17.952445863817" ry="17.952445863817" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="212.4678936528" y="348.29750141088"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:34.523934353495px">O</text>
<ellipse cx="42.05" cy="300.3099709945" rx="17.952445863817" ry="17.952445863817" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="315.50050211004"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:34.523934353495px">O</text>
<ellipse cx="406.27473309272" cy="244.0443760511" rx="17.952445863817" ry="17.952445863817" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="406.27473309272" y="259.23490716663"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.523934353495px">N</text>
</g></svg>

✍: FYIcenter.com

2022-10-07, 121👍, 0💬