Molecule FYI-1001618

A

Molecule Summary:

ID: FYI-1001618
SMILES: FC1=CN=C(N=C1)N2C(=NC=N2)[C@H](C)NC3OC4=C(N=3)C=C(C=C4Cl)C(F)(F)F

Received at FYIcenter.com on: 2022-10-04

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001618
FYIcenter.com

 29 32  0  0  1  0  0  0  0  0999 V2000
    5.1502   11.1601    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.1907   10.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8996    8.8540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9400    7.9172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2715    8.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5626    9.7192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5221   10.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3118    7.4130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1655    6.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4444    5.4513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3813    6.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6813    7.7041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9531    5.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9531    3.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7406    6.0207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5282    5.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2493    5.8901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3124    4.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0124    3.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3819    3.9284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3124    2.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9124    2.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    3.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9124    4.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    6.0622    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    1.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    0.5124    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.5124    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.9124    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  7  2  1  0  0  0  0
  8  5  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 12  8  1  0  0  0  0
 13  9  1  0  0  0  0
 14 13  1  0  0  0  0
 13 15  1  6  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 20 16  2  0  0  0  0
 21 19  1  0  0  0  0
 22 21  2  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 24 18  1  0  0  0  0
 25 24  1  0  0  0  0
 26 22  1  0  0  0  0
 27 26  1  0  0  0  0
 28 26  1  0  0  0  0
 29 26  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="311.7879148252" x2="289.11985625544" y1="492.31759684746" y2="512.72429599431" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="289.11985625544" x2="266.45179768568" y1="512.72429599431" y2="533.13099514115" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #00bc00" />
<line x1="296" x2="302.5" y1="434" y2="463.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="302.5" x2="309" y1="463.5" y2="493" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="303" x2="309" y1="432" y2="462" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="309" x2="315" y1="462" y2="492" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="344.4360191718" x2="321.77013917567" y1="391.83306696072" y2="412.24194468119" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="321.77013917567" x2="299.10425917953" y1="412.24194468119" y2="432.65082240166" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="404" x2="375" y1="408" y2="398.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="375" x2="346" y1="398.5" y2="389" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="402" x2="373" y1="414" y2="404.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="373" x2="344" y1="404.5" y2="395" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="415.1350904554" x2="408.79326263256" y1="470.34886041138" y2="440.5176517621" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="408.79326263256" x2="402.45143480973" y1="440.5176517621" y2="410.68644311283" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="372" x2="395" y1="514" y2="493.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="395" x2="418" y1="493.5" y2="473" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="368" x2="390.5" y1="509" y2="488.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="390.5" x2="413" y1="488.5" y2="468" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="369.79897331588" x2="340.79344407054" y1="511.16661585232" y2="501.74210634989" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="340.79344407054" x2="311.7879148252" y1="501.74210634989" y2="492.31759684746" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="447.77883765475" x2="425.11513623224" y1="369.86433052463" y2="390.27538681873" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="425.11513623224" x2="402.45143480973" y1="390.27538681873" y2="410.68644311283" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="441.40433122754" x2="444.59158444114" y1="309.19976935851" y2="339.53204994157" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="444.59158444114" x2="447.77883765475" y1="339.53204994157" y2="369.86433052463" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="496" x2="468.5" y1="282" y2="294.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="468.5" x2="441" y1="294.5" y2="307" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="499" x2="471" y1="288" y2="300.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="471" x2="443" y1="300.5" y2="313" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="537.95" x2="517.5389437059" y1="329.72193290749" y2="307.05605291135" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="517.5389437059" x2="497.12788741181" y1="307.05605291135" y2="284.39017291522" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="511" x2="526" y1="385" y2="358.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="526" x2="541" y1="358.5" y2="332" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="505" x2="520.5" y1="381" y2="355" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="520.5" x2="536" y1="355" y2="329" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="507.4499692478" x2="477.61440345128" y1="382.5479861703" y2="376.20615834746" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="477.61440345128" x2="447.77883765475" y1="376.20615834746" y2="369.86433052463" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="388.57827796473" x2="414.99130459614" y1="278.69973860631" y2="293.94975398241" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="414.99130459614" x2="441.40433122754" y1="293.94975398241" y2="309.19976935851" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="388.57827796473" x2="388.57827796473" y1="217.69967710191" y2="248.19970785411" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="388.57827796473" x2="388.57827796473" y1="248.19970785411" y2="278.69973860631" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<polygon points=" 389,279 332,302 341,318" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="282.92181429186" x2="309.33484092327" y1="278.69973860631" y2="293.94975398241" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="309.33484092327" x2="335.74786755467" y1="293.94975398241" y2="309.19976935851" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="227.1982581076" x2="255.06003619973" y1="303.5093350496" y2="291.10453682795" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #ff0000" />
<line x1="255.06003619973" x2="282.92181429186" y1="291.10453682795" y2="278.69973860631" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="186.3761455194" x2="206.7872018135" y1="258.18193220458" y2="280.84563362709" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="206.7872018135" x2="227.1982581076" y1="280.84563362709" y2="303.5093350496" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #ff0000" />
<line x1="215" x2="199.5" y1="204" y2="230.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="199.5" x2="184" y1="230.5" y2="257" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="220" x2="205" y1="207" y2="233.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="205" x2="190" y1="233.5" y2="260" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="276.54730786466" x2="246.71174206813" y1="218.03517744019" y2="211.69334961735" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="246.71174206813" x2="216.8761762716" y1="211.69334961735" y2="205.35152179452" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="274" x2="277" y1="219" y2="249.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="277" x2="280" y1="249.5" y2="280" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="280" x2="283.5" y1="218" y2="248.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #0000ff" />
<line x1="283.5" x2="287" y1="248.5" y2="279" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="186.3761455194" x2="201.6261608955" y1="152.52111138446" y2="178.93631658949" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="201.6261608955" x2="216.8761762716" y1="178.93631658949" y2="205.35152179452" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="126" x2="156.5" y1="156" y2="156" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="156.5" x2="187" y1="156" y2="156" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="126" x2="156.5" y1="150" y2="150" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="156.5" x2="187" y1="150" y2="150" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="94.876053262808" x2="110.12606863891" y1="205.35152179452" y2="178.93631658949" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="110.12606863891" x2="125.37608401501" y1="178.93631658949" y2="152.52111138446" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="129" x2="113.5" y1="257" y2="230.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="113.5" x2="98" y1="230.5" y2="204" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="123" x2="108" y1="260" y2="233.5" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="108" x2="93" y1="233.5" y2="207" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="125.37608401501" x2="155.87611476721" y1="258.18193220458" y2="258.18193220458" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="155.87611476721" x2="186.3761455194" y1="258.18193220458" y2="258.18193220458" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="94.876053262808" x2="110.12606863891" y1="311.00798546739" y2="284.59495883599" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #00bc00" />
<line x1="110.12606863891" x2="125.37608401501" y1="284.59495883599" y2="258.18193220458" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="94.876053262808" x2="110.12606863891" y1="99.695058121656" y2="126.10808475306" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="110.12606863891" x2="125.37608401501" y1="126.10808475306" y2="152.52111138446" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="147.70210652562" x2="121.28907989421" y1="69.195027369457" y2="84.445042745556" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #00bc00" />
<line x1="121.28907989421" x2="94.876053262808" y1="84.445042745556" y2="99.695058121656" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="64.37602251061" x2="79.626037886709" y1="46.869004858847" y2="73.282031490252" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #00bc00" />
<line x1="79.626037886709" x2="94.876053262808" y1="73.282031490252" y2="99.695058121656" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<line x1="42.05" x2="68.463026631404" y1="130.19508887385" y2="114.94507349776" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #00bc00" />
<line x1="68.463026631404" x2="94.876053262808" y1="114.94507349776" y2="99.695058121656" style="stroke-opacity:1; stroke-width: 2.5684365552203; stroke: #000000" />
<ellipse cx="266.45179768568" cy="533.13099514115" rx="16.694837608932" ry="16.694837608932" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="266.45179768568" y="547.25739619486"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:32.105456940253px">F</text>
<ellipse cx="344.4360191718" cy="391.83306696072" rx="16.694837608932" ry="16.694837608932" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="344.4360191718" y="405.95946801443"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.105456940253px">N</text>
<ellipse cx="415.1350904554" cy="470.34886041138" rx="16.694837608932" ry="16.694837608932" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="415.1350904554" y="484.47526146509"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.105456940253px">N</text>
<ellipse cx="447.77883765475" cy="369.86433052463" rx="16.694837608932" ry="16.694837608932" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="447.77883765475" y="383.99073157834"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.105456940253px">N</text>
<ellipse cx="497.12788741181" cy="284.39017291522" rx="16.694837608932" ry="16.694837608932" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="497.12788741181" y="298.51657396893"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.105456940253px">N</text>
<ellipse cx="507.4499692478" cy="382.5479861703" rx="16.694837608932" ry="16.694837608932" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="507.4499692478" y="396.67438722401"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.105456940253px">N</text>
<ellipse cx="335.74786755467" cy="309.19976935851" rx="16.694837608932" ry="16.694837608932" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="335.74786755467" y="323.32617041222"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.105456940253px">N</text>
<ellipse cx="227.1982581076" cy="303.5093350496" rx="16.694837608932" ry="16.694837608932" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="227.1982581076" y="317.63573610331"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:32.105456940253px">O</text>
<ellipse cx="276.54730786466" cy="218.03517744019" rx="16.694837608932" ry="16.694837608932" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="276.54730786466" y="232.1615784939"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.105456940253px">N</text>
<ellipse cx="94.876053262808" cy="311.00798546739" rx="16.694837608932" ry="16.694837608932" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="94.876053262808" y="325.1343865211"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:32.105456940253px">Cl</text>
<ellipse cx="147.70210652562" cy="69.195027369457" rx="16.694837608932" ry="16.694837608932" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="147.70210652562" y="83.321428423168"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:32.105456940253px">F</text>
<ellipse cx="64.37602251061" cy="46.869004858847" rx="16.694837608932" ry="16.694837608932" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="64.37602251061" y="60.995405912559"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:32.105456940253px">F</text>
<ellipse cx="42.05" cy="130.19508887385" rx="16.694837608932" ry="16.694837608932" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="144.32148992757"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:32.105456940253px">F</text>
</g></svg>

✍: FYIcenter.com

2022-10-07, 120👍, 0💬