Molecule FYI-1001614

A

Molecule Summary:

ID: FYI-1001614
SMILES: CN(C1CC1)C(=O)c2cc(cnc2Cl)c3cnn(c3)c4c(Cl)cc(cc4Cl)C(F)(C(F)(F)F)C(F)(F)F

Received at FYIcenter.com on: 2022-10-04

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001614
FYIcenter.com

 37 40  0  0  0  0  0  0  0  0999 V2000
   15.6121    4.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4060    4.1776    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2001    4.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8075    4.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5038    6.0799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4060    2.7851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6121    2.0888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2001    2.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9941    2.7851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7881    2.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7881    0.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9941    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2001    0.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4060    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.5821    2.7851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4366    4.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0744    4.4595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3781    3.2535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3100    2.2187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9932    3.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1747    4.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7412    5.5067    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.7898    4.0891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2235    2.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0420    1.6903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4269    1.8358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2454    0.7092    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.8386    2.6713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0200    3.7979    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6570    1.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9898    2.5130    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.4755    0.4182    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.5495    0.6602    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2721    1.3991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5340    0.7676    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.7057    0.1270    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.9656    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  5  3  1  0  0  0  0
  6  2  1  0  0  0  0
  7  6  2  0  0  0  0
  8  6  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 13  8  1  0  0  0  0
 14 13  1  0  0  0  0
 15 10  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 19 15  2  0  0  0  0
 20 18  1  0  0  0  0
 21 20  2  0  0  0  0
 22 21  1  0  0  0  0
 23 21  1  0  0  0  0
 24 23  2  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 26 20  1  0  0  0  0
 27 26  1  0  0  0  0
 28 24  1  0  0  0  0
 29 28  1  0  0  0  0
 30 28  1  0  0  0  0
 31 30  1  0  0  0  0
 32 30  1  0  0  0  0
 33 30  1  0  0  0  0
 34 28  1  0  0  0  0
 35 34  1  0  0  0  0
 36 34  1  0  0  0  0
 37 34  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="499.63965161637" x2="518.79482580819" y1="326.13611461623" y2="337.19469001608" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #0000ff" />
<line x1="518.79482580819" x2="537.95" y1="337.19469001608" y2="348.25326541593" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="461.33565599759" x2="480.48765380698" y1="348.25326541593" y2="337.19469001608" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="480.48765380698" x2="499.63965161637" y1="337.19469001608" y2="326.13611461623" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #0000ff" />
<line x1="417.10135439819" x2="439.21850519789" y1="348.25326541593" y2="348.25326541593" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="439.21850519789" x2="461.33565599759" y1="348.25326541593" y2="348.25326541593" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="439.21850519789" x2="428.15992979804" y1="386.56043741713" y2="367.40685141653" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="428.15992979804" x2="417.10135439819" y1="367.40685141653" y2="348.25326541593" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="439.21850519789" x2="450.27708059774" y1="386.56043741713" y2="367.40685141653" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="450.27708059774" x2="461.33565599759" y1="367.40685141653" y2="348.25326541593" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="499.63965161637" x2="499.63965161637" y1="281.90498939925" y2="304.02055200774" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="499.63965161637" x2="499.63965161637" y1="304.02055200774" y2="326.13611461623" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #0000ff" />
<line x1="537" x2="518" y1="258" y2="269" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #ff0000" />
<line x1="518" x2="499" y1="269" y2="280" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="540" x2="520.5" y1="262" y2="273" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #ff0000" />
<line x1="520.5" x2="501" y1="273" y2="284" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="461.33565599759" x2="480.48765380698" y1="259.78783859955" y2="270.8464139994" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="480.48765380698" x2="499.63965161637" y1="270.8464139994" y2="281.90498939925" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="425" x2="444" y1="284" y2="273" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="444" x2="463" y1="273" y2="262" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="422" x2="441.5" y1="280" y2="269" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="441.5" x2="461" y1="269" y2="258" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="384.72131199518" x2="403.87489799579" y1="259.78783859955" y2="270.8464139994" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="403.87489799579" x2="423.02848399639" y1="270.8464139994" y2="281.90498939925" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="383" x2="383" y1="216" y2="238" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="383" x2="383" y1="238" y2="260" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="388" x2="388" y1="216" y2="238" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="388" x2="388" y1="238" y2="260" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="423.02848399639" x2="403.87489799579" y1="193.43956258287" y2="204.49813798272" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #0000ff" />
<line x1="403.87489799579" x2="384.72131199518" y1="204.49813798272" y2="215.55671338257" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="463" x2="444" y1="214" y2="203" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="444" x2="425" y1="203" y2="192" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #0000ff" />
<line x1="461" x2="441.5" y1="218" y2="207" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="441.5" x2="422" y1="207" y2="196" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #0000ff" />
<line x1="461.33565599759" x2="461.33565599759" y1="215.55671338257" y2="237.67227599106" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="461.33565599759" x2="461.33565599759" y1="237.67227599106" y2="259.78783859955" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="499.63965161637" x2="480.48765380698" y1="193.43956258287" y2="204.49813798272" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #00bc00" />
<line x1="480.48765380698" x2="461.33565599759" y1="204.49813798272" y2="215.55671338257" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="346.41413999398" x2="365.56772599458" y1="281.90498939925" y2="270.8464139994" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="365.56772599458" x2="384.72131199518" y1="270.8464139994" y2="259.78783859955" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="341.79250357095" x2="344.10332178246" y1="325.89470955221" y2="303.89984947573" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="344.10332178246" x2="346.41413999398" y1="303.89984947573" y2="281.90498939925" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="300" x2="321.5" y1="338" y2="333.5" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #0000ff" />
<line x1="321.5" x2="343" y1="333.5" y2="329" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="299" x2="320.5" y1="333" y2="328.5" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #0000ff" />
<line x1="320.5" x2="342" y1="328.5" y2="324" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="276.40667142793" x2="287.46524682778" y1="296.78316466074" y2="315.93675066135" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #0000ff" />
<line x1="287.46524682778" x2="298.52382222763" y1="315.93675066135" y2="335.09033666195" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #0000ff" />
<line x1="306.00737921228" x2="291.2070253201" y1="263.91395936485" y2="280.3485620128" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="291.2070253201" x2="276.40667142793" y1="280.3485620128" y2="296.78316466074" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #0000ff" />
<line x1="306" x2="326" y1="267" y2="276" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="326" x2="346" y1="276" y2="285" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="307" x2="327.5" y1="262" y2="271" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="327.5" x2="348" y1="271" y2="280" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="232.41695127497" x2="254.41181135145" y1="292.16152823771" y2="294.47234644923" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="254.41181135145" x2="276.40667142793" y1="294.47234644923" y2="296.78316466074" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #0000ff" />
<line x1="209" x2="222" y1="330" y2="312" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="222" x2="235" y1="312" y2="294" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="205" x2="218" y1="327" y2="309" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="218" x2="231" y1="309" y2="291" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="224.41246757323" x2="215.41536436482" y1="368.35341337808" y2="348.15003298723" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #00bc00" />
<line x1="215.41536436482" x2="206.41826115641" y1="348.15003298723" y2="327.94665259638" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="162.42854100345" x2="184.42340107993" y1="323.32501617335" y2="325.63583438487" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="184.42340107993" x2="206.41826115641" y1="325.63583438487" y2="327.94665259638" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="143" x2="152" y1="284" y2="304.5" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="152" x2="161" y1="304.5" y2="325" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="147" x2="156" y1="282" y2="302.5" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="156" x2="165" y1="302.5" y2="323" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="170.43937747004" x2="157.44003241076" y1="247.12995465056" y2="265.02092863868" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="157.44003241076" x2="144.44068735148" y1="265.02092863868" y2="282.91190262681" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="215" x2="193" y1="250" y2="247.5" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="193" x2="171" y1="247.5" y2="245" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="215" x2="193" y1="255" y2="252.5" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="193" x2="171" y1="252.5" y2="250" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="214.429097623" x2="223.42302444899" y1="251.75159107359" y2="271.95655965565" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="223.42302444899" x2="232.41695127497" y1="271.95655965565" y2="292.16152823771" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="240.42778774156" x2="227.42844268228" y1="215.96646671492" y2="233.85902889426" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #00bc00" />
<line x1="227.42844268228" x2="214.429097623" y1="233.85902889426" y2="251.75159107359" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="100.45096719852" x2="122.445827275" y1="278.29026620378" y2="280.60108441529" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="122.445827275" x2="144.44068735148" y1="280.60108441529" y2="282.91190262681" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="74.449100697536" x2="87.450033948028" y1="314.07539056245" y2="296.18282838311" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #00bc00" />
<line x1="87.450033948028" x2="100.45096719852" y1="296.18282838311" y2="278.29026620378" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="126.44648093466" x2="113.44872406659" y1="242.50831822753" y2="260.39929221565" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="113.44872406659" x2="100.45096719852" y1="260.39929221565" y2="278.29026620378" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="168.78130584611" x2="147.61389339038" y1="273.26205283082" y2="257.88518552917" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #00bc00" />
<line x1="147.61389339038" x2="126.44648093466" y1="257.88518552917" y2="242.50831822753" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="152.44517105322" x2="139.44582599394" y1="206.72319386886" y2="224.61575604819" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #00bc00" />
<line x1="139.44582599394" x2="126.44648093466" y1="224.61575604819" y2="242.50831822753" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="91.268045618463" x2="108.85726327656" y1="214.41003932847" y2="228.459178778" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #00bc00" />
<line x1="108.85726327656" x2="126.44648093466" y1="228.459178778" y2="242.50831822753" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="82.456760781701" x2="91.45386399011" y1="237.88032903966" y2="258.08529762172" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="91.45386399011" x2="100.45096719852" y1="258.08529762172" y2="278.29026620378" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="122.53953055643" x2="102.49814566906" y1="217.82147404897" y2="227.85090154431" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #00bc00" />
<line x1="102.49814566906" x2="82.456760781701" y1="227.85090154431" y2="237.88032903966" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="64.465730747305" x2="73.461245764503" y1="197.47356825795" y2="217.6769486488" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #00bc00" />
<line x1="73.461245764503" x2="82.456760781701" y1="217.6769486488" y2="237.88032903966" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<line x1="42.05" x2="62.253380390851" y1="255.87453545647" y2="246.87743224806" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #00bc00" />
<line x1="62.253380390851" x2="82.456760781701" y1="246.87743224806" y2="237.88032903966" style="stroke-opacity:1; stroke-width: 1.8624150611862; stroke: #000000" />
<ellipse cx="499.63965161637" cy="326.13611461623" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="499.63965161637" y="336.37939745275"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">N</text>
<ellipse cx="537.95" cy="259.78783859955" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="270.03112143607"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">O</text>
<ellipse cx="423.02848399639" cy="193.43956258287" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="423.02848399639" y="203.68284541939"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">N</text>
<ellipse cx="499.63965161637" cy="193.43956258287" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="499.63965161637" y="203.68284541939"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">Cl</text>
<ellipse cx="298.52382222763" cy="335.09033666195" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="298.52382222763" y="345.33361949847"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">N</text>
<ellipse cx="276.40667142793" cy="296.78316466074" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="276.40667142793" y="307.02644749727"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">N</text>
<ellipse cx="224.41246757323" cy="368.35341337808" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="224.41246757323" y="378.59669621461"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">Cl</text>
<ellipse cx="240.42778774156" cy="215.96646671492" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.42778774156" y="226.20974955144"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">Cl</text>
<ellipse cx="74.449100697536" cy="314.07539056245" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="74.449100697536" y="324.31867339897"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">F</text>
<ellipse cx="168.78130584611" cy="273.26205283082" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="168.78130584611" y="283.50533566734"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">F</text>
<ellipse cx="152.44517105322" cy="206.72319386886" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="152.44517105322" y="216.96647670538"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">F</text>
<ellipse cx="91.268045618463" cy="214.41003932847" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="91.268045618463" y="224.65332216499"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">F</text>
<ellipse cx="122.53953055643" cy="217.82147404897" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="122.53953055643" y="228.0647568855"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">F</text>
<ellipse cx="64.465730747305" cy="197.47356825795" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="64.465730747305" y="207.71685109448"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">F</text>
<ellipse cx="42.05" cy="255.87453545647" rx="12.10569789771" ry="12.10569789771" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="266.117818293"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:23.280188264827px">F</text>
</g></svg>

✍: FYIcenter.com

2022-10-07, 119👍, 0💬