Molecule FYI-1001612

A

Molecule Summary:

ID: FYI-1001612
SMILES: C1(NC(=NC2=C1N=C(CN2)C(O)C(COP(OP(OP(O)(=O)O)(=O)O)(=O)O)O)N)=O

Received at FYIcenter.com on: 2022-09-30

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001612
FYIcenter.com

 46 47  0  0  0  0  0  0  0  0999 V2000
    4.2690   -0.6034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4030   -0.1034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4030    0.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2690    1.3966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1350    0.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1350   -0.1034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0290   -0.6380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9350   -0.1242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9350    0.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0290    1.4313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7991   -0.6275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7953   -1.6275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6671   -0.1309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5312   -0.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3991   -0.1375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2632   -0.6409    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   12.1273   -1.1442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9952   -0.6476    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   13.8632   -0.1509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7273   -0.6542    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   15.5914   -1.1576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2239   -1.5183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2306    0.2099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4986    0.2204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4919   -1.5155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7599   -1.5050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7665    0.2232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6709    0.8691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5369    1.3966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2690   -1.6034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -0.4134    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5459    0.8113    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1441    1.5011    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0218    2.0512    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2610   -0.9355    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3310   -1.9396    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1313    0.1812    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.1308   -1.1076    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9278   -1.1107    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.1295   -0.8496    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.9227    0.7480    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.1798   -2.0512    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4586    0.7613    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2090    1.1770    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5369    2.0166    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000    1.0866    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  2  0  0  0  0
  4  5  1  0  0  0  0
  5  6  2  0  0  0  0
  1  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  2  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
  5 10  1  0  0  0  0
  8 11  1  0  0  0  0
 11 12  1  0  0  0  0
 11 13  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 20 22  2  0  0  0  0
 20 23  1  0  0  0  0
 18 24  2  0  0  0  0
 18 25  1  0  0  0  0
 16 26  2  0  0  0  0
 16 27  1  0  0  0  0
 13 28  1  0  0  0  0
  3 29  1  0  0  0  0
  1 30  2  0  0  0  0
  2 31  1  0  0  0  0
  9 32  1  0  0  0  0
  9 33  1  0  0  0  0
 10 34  1  0  0  0  0
 11 35  1  0  0  0  0
 12 36  1  0  0  0  0
 13 37  1  0  0  0  0
 14 38  1  0  0  0  0
 14 39  1  0  0  0  0
 21 40  1  0  0  0  0
 23 41  1  0  0  0  0
 25 42  1  0  0  0  0
 27 43  1  0  0  0  0
 28 44  1  0  0  0  0
 29 45  1  0  0  0  0
 29 46  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="121.68460136594" x2="106.48769418592" y1="268.82260094129" y2="277.59679677271" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="106.48769418592" x2="91.29078700591" y1="277.59679677271" y2="286.37099260413" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="91.29078700591" x2="91.29078700591" y1="286.37099260413" y2="303.91938426696" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="91.29078700591" x2="91.29078700591" y1="303.91938426696" y2="321.46777592979" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="91" x2="106" y1="324" y2="332.5" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="106" x2="121" y1="332.5" y2="341" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="93" x2="108" y1="320" y2="329" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="108" x2="123" y1="329" y2="338" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="121.68460136594" x2="136.88150854595" y1="339.01616759263" y2="330.24197176121" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="136.88150854595" x2="152.07841572596" y1="330.24197176121" y2="321.46777592979" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="154" x2="154" y1="322" y2="304.5" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="154" x2="154" y1="304.5" y2="287" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="151" x2="151" y1="322" y2="304.5" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="151" x2="151" y1="304.5" y2="287" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="121.68460136594" x2="136.88150854595" y1="268.82260094129" y2="277.59679677271" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="136.88150854595" x2="152.07841572596" y1="277.59679677271" y2="286.37099260413" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="152.07841572596" x2="167.76667787254" y1="286.37099260413" y2="276.98962242118" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="167.76667787254" x2="183.45494001911" y1="276.98962242118" y2="267.60825223822" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="183" x2="199" y1="270" y2="279" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="199" x2="215" y1="279" y2="288" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="185" x2="201" y1="266" y2="275.5" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="201" x2="217" y1="275.5" y2="285" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="215.25262571216" x2="215.25262571216" y1="285.64097951095" y2="303.91938426696" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="215.25262571216" x2="215.25262571216" y1="303.91938426696" y2="322.19778902297" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="215.25262571216" x2="199.35378286564" y1="322.19778902297" y2="331.2159074985" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="199.35378286564" x2="183.45494001911" y1="331.2159074985" y2="340.23402597403" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="152.07841572596" x2="167.76667787254" y1="321.46777592979" y2="330.85090095191" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="167.76667787254" x2="183.45494001911" y1="330.85090095191" y2="340.23402597403" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="215.25262571216" x2="230.41619094802" y1="285.64097951095" y2="276.80887398705" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="230.41619094802" x2="245.57975618387" y1="276.80887398705" y2="267.97676846314" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="245.57975618387" x2="245.51307229555" y1="267.97676846314" y2="250.42837680031" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="245.51307229555" x2="245.44638840723" y1="250.42837680031" y2="232.87998513748" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="245.57975618387" x2="260.81176014721" y1="267.97676846314" y2="276.69129976291" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="260.81176014721" x2="276.04376411055" y1="276.69129976291" y2="285.40583106267" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="276.04376411055" x2="291.2073293464" y1="285.40583106267" y2="276.57372553877" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="291.2073293464" x2="306.37089458226" y1="276.57372553877" y2="267.74162001486" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="306.37089458226" x2="321.60114370643" y1="267.74162001486" y2="276.45790615379" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="321.60114370643" x2="336.8313928306" y1="276.45790615379" y2="285.17419229272" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="336.8313928306" x2="351.99495806646" y1="285.17419229272" y2="276.34033192965" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="351.99495806646" x2="367.15852330231" y1="276.34033192965" y2="267.50647156658" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="367.15852330231" x2="382.32208853816" y1="267.50647156658" y2="258.67436604268" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="382.32208853816" x2="397.48565377402" y1="258.67436604268" y2="249.84226051877" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="397.48565377402" x2="412.71590289819" y1="249.84226051877" y2="258.55679181854" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="412.71590289819" x2="427.94615202236" y1="258.55679181854" y2="267.2713231183" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="427.94615202236" x2="443.1781559857" y1="267.2713231183" y2="275.98760925723" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="443.1781559857" x2="458.41015994904" y1="275.98760925723" y2="284.70389539616" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="458.41015994904" x2="473.5737251849" y1="284.70389539616" y2="275.87178987225" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="473.5737251849" x2="488.73729042075" y1="275.87178987225" y2="267.03968434835" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="488.73729042075" x2="503.9008556566" y1="267.03968434835" y2="258.20582398528" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="503.9008556566" x2="519.06442089246" y1="258.20582398528" y2="249.37196362221" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="491" x2="482" y1="267" y2="251.5" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="482" x2="473" y1="251.5" y2="236" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="488" x2="479" y1="268" y2="253" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="479" x2="470" y1="253" y2="238" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="488.73729042075" x2="497.56939594465" y1="267.03968434835" y2="282.2032495842" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="497.56939594465" x2="506.40150146856" y1="282.2032495842" y2="297.36681482006" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="427" x2="418" y1="267" y2="282" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="418" x2="409" y1="282" y2="297" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="430" x2="421.5" y1="269" y2="284" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="421.5" x2="413" y1="284" y2="299" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="427.94615202236" x2="436.66243816129" y1="267.2713231183" y2="252.04107399413" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="436.66243816129" x2="445.37872430022" y1="252.04107399413" y2="236.81082486995" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="369" x2="360.5" y1="267" y2="252" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="360.5" x2="352" y1="252" y2="237" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="366" x2="357" y1="269" y2="254" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="357" x2="348" y1="254" y2="239" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="367.15852330231" x2="375.99062882621" y1="267.50647156658" y2="282.67003680243" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #c8aa1a" />
<line x1="375.99062882621" x2="384.82273435012" y1="282.67003680243" y2="297.83360203829" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="276.04376411055" x2="276.11044799887" y1="285.40583106267" y2="302.9542227255" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="276.11044799887" x2="276.17713188719" y1="302.9542227255" y2="320.50261438834" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="91.29078700591" x2="76.09212498673" y1="321.46777592979" y2="330.24197176121" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="76.09212498673" x2="60.89346296755" y1="330.24197176121" y2="339.01616759263" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="124" x2="124" y1="269" y2="251.5" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="124" x2="124" y1="251.5" y2="234" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="120" x2="120" y1="269" y2="251.5" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #000000" />
<line x1="120" x2="120" y1="251.5" y2="234" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="91.29078700591" x2="81.867300682968" y1="286.37099260413" y2="280.93099118865" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="81.867300682968" x2="72.443814360027" y1="280.93099118865" y2="275.49098977317" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #a4a4a4" />
<line x1="183.45494001911" x2="183.32859159914" y1="340.23402597403" y2="351.11227396582" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="183.32859159914" x2="183.20224317916" y1="351.11227396582" y2="361.99052195761" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #a4a4a4" />
<line x1="245.44638840723" x2="254.84706182101" y1="232.87998513748" y2="227.40313209951" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="254.84706182101" x2="264.24773523479" y1="227.40313209951" y2="221.92627906154" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #a4a4a4" />
<line x1="519.06442089246" x2="528.50721044623" y1="249.37196362221" y2="254.77686825436" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="528.50721044623" x2="537.95" y1="254.77686825436" y2="260.18177288651" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #a4a4a4" />
<line x1="506.40150146856" x2="500.99835167557" y1="297.36681482006" y2="306.80960437383" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="500.99835167557" x2="495.59520188259" y1="306.80960437383" y2="316.2523939276" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #a4a4a4" />
<line x1="445.37872430022" x2="439.90187126225" y1="236.81082486995" y2="227.41015145617" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="439.90187126225" x2="434.42501822428" y1="227.41015145617" y2="218.00947804239" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #a4a4a4" />
<line x1="384.82273435012" x2="379.41958455713" y1="297.83360203829" y2="307.27639159206" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="379.41958455713" x2="374.01643476415" y1="307.27639159206" y2="316.71918114583" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #a4a4a4" />
<line x1="276.17713188719" x2="285.61992144096" y1="320.50261438834" y2="325.90576418132" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #ff0000" />
<line x1="285.61992144096" x2="295.06271099473" y1="325.90576418132" y2="331.30891397431" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #a4a4a4" />
<line x1="60.89346296755" x2="60.89346296755" y1="339.01616759263" y2="349.89617042358" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="60.89346296755" x2="60.89346296755" y1="349.89617042358" y2="360.77617325454" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #a4a4a4" />
<line x1="60.89346296755" x2="51.471731483775" y1="339.01616759263" y2="333.57616617715" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #0000ff" />
<line x1="51.471731483775" x2="42.05" y1="333.57616617715" y2="328.13616476167" style="stroke-opacity:1; stroke-width: 1.4879990564881; stroke: #a4a4a4" />
<ellipse cx="91.29078700591" cy="286.37099260413" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="91.29078700591" y="294.55498741481"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">N</text>
<ellipse cx="121.68460136594" cy="339.01616759263" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="121.68460136594" y="347.20016240331"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">N</text>
<ellipse cx="183.45494001911" cy="267.60825223822" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="183.45494001911" y="275.79224704891"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">N</text>
<ellipse cx="183.45494001911" cy="340.23402597403" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="183.45494001911" y="348.41802078471"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">N</text>
<ellipse cx="245.44638840723" cy="232.87998513748" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="245.44638840723" y="241.06397994816"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">O</text>
<ellipse cx="336.8313928306" cy="285.17419229272" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="336.8313928306" y="293.35818710341"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">O</text>
<ellipse cx="367.15852330231" cy="267.50647156658" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="367.15852330231" y="275.69046637727"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">P</text>
<ellipse cx="397.48565377402" cy="249.84226051877" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="397.48565377402" y="258.02625532946"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">O</text>
<ellipse cx="427.94615202236" cy="267.2713231183" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="427.94615202236" y="275.45531792898"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">P</text>
<ellipse cx="458.41015994904" cy="284.70389539616" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="458.41015994904" y="292.88789020684"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">O</text>
<ellipse cx="488.73729042075" cy="267.03968434835" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="488.73729042075" y="275.22367915903"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">P</text>
<ellipse cx="519.06442089246" cy="249.37196362221" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="519.06442089246" y="257.55595843289"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">O</text>
<ellipse cx="471.06956969461" cy="236.71255387664" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="471.06956969461" y="244.89654868733"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">O</text>
<ellipse cx="506.40150146856" cy="297.36681482006" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="506.40150146856" y="305.55080963074"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">O</text>
<ellipse cx="410.51708942284" cy="297.73533104498" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="410.51708942284" y="305.91932585566"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">O</text>
<ellipse cx="445.37872430022" cy="236.81082486995" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="445.37872430022" y="244.99481968064"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">O</text>
<ellipse cx="349.4943122545" cy="237.17934109487" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="349.4943122545" y="245.36333590556"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">O</text>
<ellipse cx="384.82273435012" cy="297.83360203829" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="384.82273435012" y="306.01759684897"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">O</text>
<ellipse cx="276.17713188719" cy="320.50261438834" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="276.17713188719" y="328.68660919902"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">O</text>
<ellipse cx="60.89346296755" cy="339.01616759263" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="60.89346296755" y="347.20016240331"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">N</text>
<ellipse cx="121.68460136594" cy="233.72581761563" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="121.68460136594" y="241.90981242631"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">O</text>
<ellipse cx="72.443814360027" cy="275.49098977317" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="72.443814360027" y="283.67498458385"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">H</text>
<ellipse cx="183.20224317916" cy="361.99052195761" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="183.20224317916" y="370.17451676829"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">H</text>
<ellipse cx="264.24773523479" cy="221.92627906154" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="264.24773523479" y="230.11027387222"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">H</text>
<ellipse cx="537.95" cy="260.18177288651" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="268.3657676972"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">H</text>
<ellipse cx="495.59520188259" cy="316.2523939276" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="495.59520188259" y="324.43638873828"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">H</text>
<ellipse cx="434.42501822428" cy="218.00947804239" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="434.42501822428" y="226.19347285308"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">H</text>
<ellipse cx="374.01643476415" cy="316.71918114583" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="374.01643476415" y="324.90317595651"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">H</text>
<ellipse cx="295.06271099473" cy="331.30891397431" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="295.06271099473" y="339.49290878499"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">H</text>
<ellipse cx="60.89346296755" cy="360.77617325454" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="60.89346296755" y="368.96016806522"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">H</text>
<ellipse cx="42.05" cy="328.13616476167" rx="9.6719938671729" ry="9.6719938671729" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="336.32015957235"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.599988206102px">H</text>
</g></svg>

✍: FYIcenter.com

2022-10-07, 120👍, 0💬