Molecule FYI-1001611

A

Molecule Summary:

ID: FYI-1001611
SMILES: C1(NC(=NC2=C1N=C(CN2)C(O)C(COP(OP(OP(O)(=O)O)(=O)O)(=O)O)O)N)=O.P

Received at FYIcenter.com on: 2022-09-30

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001611
FYIcenter.com

 50 50  0  0  0  0  0  0  0  0999 V2000
   -6.4605    0.0262    1.7129 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7205   -0.1479    2.1686 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7791    0.3623    1.4824 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6203    1.0338    0.3585 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4073    1.2386   -0.1494 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2760    0.7464    0.5155 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0321    0.9757    0.0083 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8308    1.8300   -0.9338 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9561    2.6550   -1.5030 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2224    1.9233   -1.3360 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4376    2.0093   -1.4795 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0203    3.3621   -1.2850 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4781    1.0692   -0.7471 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0457    1.3387   -1.2124 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1640    0.3848   -0.6168 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4233    0.3704   -0.8859 P   0  0  0  0  0  0  0  0  0  0  0  0
    2.0786   -0.9103   -0.1629 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4991   -1.6583   -0.2848 P   0  0  0  0  0  0  0  0  0  0  0  0
    3.3703   -3.1531    0.2992 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2834   -4.4754    0.1994 P   0  0  0  0  0  0  0  0  0  0  0  0
    4.1220   -5.1298   -1.2627 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7008   -4.1142    0.4245 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8158   -5.5361    1.3167 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9050   -1.7175   -1.7068 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6067   -0.8471    0.5562 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6762    0.2978   -2.3423 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0803    1.7156   -0.2935 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5720    1.2951    0.6609 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.0435    0.1729    1.9719 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5063   -0.4242    2.3251 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0016    6.3638    1.4990 P   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8716   -0.6404    2.9905 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0125    3.6073   -0.9757 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7763    2.8343   -2.5630 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8998    1.9222   -2.0303 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4318    1.7768   -2.5444 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0016    3.6386   -0.3586 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7433    0.0353   -0.9676 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9941    1.2530   -2.2978 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7494    2.3440   -0.9128 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2165   -5.3914   -1.4788 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3237   -6.3589    1.3148 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4053   -0.7688    1.4988 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9533    1.8292    0.6583 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3493    2.1968    0.9302 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1754   -0.3193    2.7973 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.8075    0.5309    1.4933 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.4494    5.0581    1.5799 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.0939    6.1681    0.6131 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.0630    7.0303    0.6676 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  2  0  0  0  0
  4  5  1  0  0  0  0
  5  6  2  0  0  0  0
  1  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  2  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
  5 10  1  0  0  0  0
  8 11  1  0  0  0  0
 11 12  1  0  0  0  0
 11 13  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 20 22  2  0  0  0  0
 20 23  1  0  0  0  0
 18 24  2  0  0  0  0
 18 25  1  0  0  0  0
 16 26  2  0  0  0  0
 16 27  1  0  0  0  0
 13 28  1  0  0  0  0
  3 29  1  0  0  0  0
  1 30  2  0  0  0  0
  2 32  1  0  0  0  0
  9 33  1  0  0  0  0
  9 34  1  0  0  0  0
 10 35  1  0  0  0  0
 11 36  1  0  0  0  0
 12 37  1  0  0  0  0
 13 38  1  0  0  0  0
 14 39  1  0  0  0  0
 14 40  1  0  0  0  0
 21 41  1  0  0  0  0
 23 42  1  0  0  0  0
 25 43  1  0  0  0  0
 27 44  1  0  0  0  0
 28 45  1  0  0  0  0
 29 46  1  0  0  0  0
 29 47  1  0  0  0  0
 31 48  1  0  0  0  0
 31 49  1  0  0  0  0
 31 50  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="119.31054248174" x2="108.11336241192" y1="284.49916312443" y2="282.95199721161" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="108.11336241192" x2="96.916182342105" y1="282.95199721161" y2="281.40483129879" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="96.916182342105" x2="87.508773753288" y1="281.40483129879" y2="285.93880056198" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="87.508773753288" x2="78.101365164472" y1="285.93880056198" y2="290.47276982517" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="77" x2="78.5" y1="291" y2="297" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="78.5" x2="80" y1="297" y2="303" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="80" x2="81.5" y1="291" y2="297" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="81.5" x2="83" y1="297" y2="303" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="80.923765474134" x2="91.703272954045" y1="302.40754191546" y2="304.22752800935" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="91.703272954045" x2="102.48278043396" y1="304.22752800935" y2="306.04751410323" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="103" x2="113.5" y1="308" y2="303.5" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="113.5" x2="124" y1="303.5" y2="299" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="103" x2="113" y1="305" y2="301" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="113" x2="123" y1="301" y2="297" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="119.31054248174" x2="120.95012956339" y1="284.49916312443" y2="290.89932906593" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="120.95012956339" x2="122.58971664504" y1="290.89932906593" y2="297.29949500742" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="122.58971664504" x2="133.64382163619" y1="297.29949500742" y2="299.33720404711" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="133.64382163619" x2="144.69792662734" y1="299.33720404711" y2="301.3749130868" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="144" x2="146" y1="302" y2="309.5" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="146" x2="148" y1="309.5" y2="317" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="146" x2="148" y1="302" y2="309.5" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="148" x2="150" y1="309.5" y2="317" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="148.27569225917" x2="138.27554405872" y1="316.5586447275" y2="323.89013167798" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="138.27554405872" x2="128.27539585827" y1="323.89013167798" y2="331.22161862846" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="128.27539585827" x2="117.02222988811" y1="331.22161862846" y2="324.7192562022" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="117.02222988811" x2="105.76906391794" y1="324.7192562022" y2="318.21689377594" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="102.48278043396" x2="104.12592217595" y1="306.04751410323" y2="312.13220393959" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="104.12592217595" x2="105.76906391794" y1="312.13220393959" y2="318.21689377594" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="148.27569225917" x2="160.65657422208" y1="316.5586447275" y2="318.15202122474" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="160.65657422208" x2="173.03745618499" y1="318.15202122474" y2="319.74539772198" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="173.03745618499" x2="176.74585558431" y1="319.74539772198" y2="331.76725899059" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="176.74585558431" x2="180.45425498362" y1="331.76725899059" y2="343.7891202592" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="173.03745618499" x2="181.56419767467" y1="319.74539772198" y2="311.39105725878" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="181.56419767467" x2="190.09093916434" y1="311.39105725878" y2="303.03671679557" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="190.09093916434" x2="202.82017784054" y1="303.03671679557" y2="305.4316691994" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="202.82017784054" x2="215.54941651673" y1="305.4316691994" y2="307.82662160322" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="215.54941651673" x2="223.38477657035" y1="307.82662160322" y2="299.3496453583" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="223.38477657035" x2="231.22013662397" y1="299.3496453583" y2="290.87266911338" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="231.22013662397" x2="245.32591751668" y1="290.87266911338" y2="290.74470134115" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="245.32591751668" x2="259.4316984094" y1="290.74470134115" y2="290.61673356892" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="259.4316984094" x2="265.25512071079" y1="290.61673356892" y2="279.23559982653" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="265.25512071079" x2="271.07854301218" y1="279.23559982653" y2="267.85446608414" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="271.07854301218" x2="283.70203054327" y1="267.85446608414" y2="261.20725124904" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="283.70203054327" x2="296.32551807436" y1="261.20725124904" y2="254.56003641394" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="296.32551807436" x2="295.180917445" y1="254.56003641394" y2="241.27627072477" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="295.180917445" x2="294.03631681564" y1="241.27627072477" y2="227.99250503559" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="294.03631681564" x2="302.15071770592" y1="227.99250503559" y2="216.24168661788" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="302.15071770592" x2="310.2651185962" y1="216.24168661788" y2="204.49086820016" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="310.2651185962" x2="308.83081314916" y1="204.49086820016" y2="198.67544388454" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="308.83081314916" x2="307.39650770212" y1="198.67544388454" y2="192.86001956891" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="310" x2="323" y1="206" y2="209.5" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="323" x2="336" y1="209.5" y2="213" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="311" x2="323.5" y1="204" y2="207" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="323.5" x2="336" y1="207" y2="210" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="310.2651185962" x2="306.10972065918" y1="204.49086820016" y2="195.06479764456" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="306.10972065918" x2="301.95432272216" y1="195.06479764456" y2="185.63872708896" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="297" x2="300.5" y1="256" y2="255.5" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="300.5" x2="304" y1="255.5" y2="255" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="297" x2="300.5" y1="254" y2="253.5" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="300.5" x2="304" y1="253.5" y2="253" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="296.32551807436" x2="306.16837255478" y1="254.56003641394" y2="261.7688875827" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="306.16837255478" x2="316.0112270352" y1="261.7688875827" y2="268.97773875146" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="260" x2="262.5" y1="292" y2="291.5" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="262.5" x2="265" y1="291.5" y2="291" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="260" x2="262" y1="290" y2="289.5" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="262" x2="264" y1="289.5" y2="289" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="259.4316984094" x2="265.27022801723" y1="290.61673356892" y2="302.57105629108" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="265.27022801723" x2="271.10875762507" y1="302.57105629108" y2="314.52537901324" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="190.09093916434" x2="189.25648264962" y1="303.03671679557" y2="305.04421122238" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="189.25648264962" x2="188.42202613489" y1="305.04421122238" y2="307.05170564918" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="78.101365164472" x2="66.865083830919" y1="290.47276982517" y2="288.78963815436" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="66.865083830919" x2="55.628802497366" y1="288.78963815436" y2="287.10650648355" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="120" x2="128.5" y1="286" y2="282" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="128.5" x2="137" y1="282" y2="278" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="119" x2="127.5" y1="284" y2="280" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #000000" />
<line x1="127.5" x2="136" y1="280" y2="276" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="96.916182342105" x2="95.573409398811" y1="281.40483129879" y2="277.02815575563" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="95.573409398811" x2="94.230636455518" y1="277.02815575563" y2="272.65148021246" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #a4a4a4" />
<line x1="105.76906391794" x2="99.749246632785" y1="318.21689377594" y2="318.20711846001" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="99.749246632785" x2="93.729429347631" y1="318.20711846001" y2="318.19734314407" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #a4a4a4" />
<line x1="180.45425498362" x2="180.6204353545" y1="343.7891202592" y2="346.24627921896" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="180.6204353545" x2="180.78661572538" y1="346.24627921896" y2="348.70343817873" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #a4a4a4" />
<line x1="307.39650770212" x2="299.3496453583" y1="192.86001956891" y2="190.5352717068" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="299.3496453583" x2="291.30278301447" y1="190.5352717068" y2="188.21052384468" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #a4a4a4" />
<line x1="301.95432272216" x2="306.4678526884" y1="185.63872708896" y2="178.32679077036" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="306.4678526884" x2="310.98138265463" y1="178.32679077036" y2="171.01485445175" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #a4a4a4" />
<line x1="316.0112270352" x2="314.2214555542" y1="268.97773875146" y2="269.67356351294" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="314.2214555542" x2="312.4316840732" y1="269.67356351294" y2="270.36938827442" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #a4a4a4" />
<line x1="271.10875762507" x2="269.98015296723" y1="314.52537901324" y2="315.53490254969" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="269.98015296723" x2="268.8515483094" y1="315.53490254969" y2="316.54442608615" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #a4a4a4" />
<line x1="188.42202613489" x2="190.40108327898" y1="307.05170564918" y2="315.06479871978" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #ff0000" />
<line x1="190.40108327898" x2="192.38014042306" y1="315.06479871978" y2="323.07789179038" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #a4a4a4" />
<line x1="55.628802497366" x2="54.456653250375" y1="287.10650648355" y2="282.73249693564" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="54.456653250375" x2="53.284504003383" y1="282.73249693564" y2="278.35848738773" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #a4a4a4" />
<line x1="55.628802497366" x2="48.839401248683" y1="287.10650648355" y2="290.28792748751" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #0000ff" />
<line x1="48.839401248683" x2="42.05" y1="290.28792748751" y2="293.46934849147" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #a4a4a4" />
<line x1="518.53622255514" x2="513.62901395629" y1="397.13923996645" y2="385.53593995283" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="513.62901395629" x2="508.72180535744" y1="385.53593995283" y2="373.93263993921" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #a4a4a4" />
<line x1="518.53622255514" x2="528.24311127757" y1="397.13923996645" y2="395.40012239529" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="528.24311127757" x2="537.95" y1="395.40012239529" y2="393.66100482413" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #a4a4a4" />
<line x1="518.53622255514" x2="510.19521206821" y1="397.13923996645" y2="403.06219275735" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #c8aa1a" />
<line x1="510.19521206821" x2="501.85420158128" y1="403.06219275735" y2="408.98514554825" style="stroke-opacity:1; stroke-width: 0.94516877564289; stroke: #a4a4a4" />
<ellipse cx="96.916182342105" cy="281.40483129879" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="96.916182342105" y="286.60325956482"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">N</text>
<ellipse cx="80.923765474134" cy="302.40754191546" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="80.923765474134" y="307.6059701815"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">N</text>
<ellipse cx="144.69792662734" cy="301.3749130868" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="144.69792662734" y="306.57334135283"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">N</text>
<ellipse cx="105.76906391794" cy="318.21689377594" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="105.76906391794" y="323.41532204198"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">N</text>
<ellipse cx="180.45425498362" cy="343.7891202592" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="180.45425498362" y="348.98754852523"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">O</text>
<ellipse cx="231.22013662397" cy="290.87266911338" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="231.22013662397" y="296.07109737941"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">O</text>
<ellipse cx="259.4316984094" cy="290.61673356892" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="259.4316984094" y="295.81516183496"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">P</text>
<ellipse cx="271.07854301218" cy="267.85446608414" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="271.07854301218" y="273.05289435018"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">O</text>
<ellipse cx="296.32551807436" cy="254.56003641394" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="296.32551807436" y="259.75846467998"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">P</text>
<ellipse cx="294.03631681564" cy="227.99250503559" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="294.03631681564" y="233.19093330163"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">O</text>
<ellipse cx="310.2651185962" cy="204.49086820016" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="310.2651185962" y="209.6892964662"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">P</text>
<ellipse cx="307.39650770212" cy="192.86001956891" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="307.39650770212" y="198.05844783495"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">O</text>
<ellipse cx="335.45699642312" cy="210.91058477352" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="335.45699642312" y="216.10901303956"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">O</text>
<ellipse cx="301.95432272216" cy="185.63872708896" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="301.95432272216" y="190.837155355"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">O</text>
<ellipse cx="303.53970123363" cy="253.50785695341" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="303.53970123363" y="258.70628521945"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">O</text>
<ellipse cx="316.0112270352" cy="268.97773875146" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="316.0112270352" y="274.1761670175"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">O</text>
<ellipse cx="263.92656640885" cy="289.32639186564" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="263.92656640885" y="294.52482013168"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">O</text>
<ellipse cx="271.10875762507" cy="314.52537901324" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="271.10875762507" y="319.72380727928"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">O</text>
<ellipse cx="188.42202613489" cy="307.05170564918" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="188.42202613489" y="312.25013391521"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">O</text>
<ellipse cx="55.628802497366" cy="287.10650648355" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="55.628802497366" y="292.30493474958"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">N</text>
<ellipse cx="136.26982696209" cy="276.4940680396" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="136.26982696209" y="281.69249630563"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">O</text>
<ellipse cx="518.53622255514" cy="397.13923996645" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="518.53622255514" y="402.33766823249"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">P</text>
<ellipse cx="94.230636455518" cy="272.65148021246" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="94.230636455518" y="277.8499084785"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">H</text>
<ellipse cx="93.729429347631" cy="318.19734314407" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="93.729429347631" y="323.39577141011"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">H</text>
<ellipse cx="180.78661572538" cy="348.70343817873" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="180.78661572538" y="353.90186644477"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">H</text>
<ellipse cx="291.30278301447" cy="188.21052384468" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="291.30278301447" y="193.40895211072"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">H</text>
<ellipse cx="310.98138265463" cy="171.01485445175" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="310.98138265463" y="176.21328271778"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">H</text>
<ellipse cx="312.4316840732" cy="270.36938827442" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="312.4316840732" y="275.56781654046"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">H</text>
<ellipse cx="268.8515483094" cy="316.54442608615" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="268.8515483094" y="321.74285435218"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">H</text>
<ellipse cx="192.38014042306" cy="323.07789179038" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="192.38014042306" y="328.27632005641"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">H</text>
<ellipse cx="53.284504003383" cy="278.35848738773" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="53.284504003383" y="283.55691565377"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">H</text>
<ellipse cx="42.05" cy="293.46934849147" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="298.66777675751"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">H</text>
<ellipse cx="508.72180535744" cy="373.93263993921" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="508.72180535744" y="379.13106820525"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">H</text>
<ellipse cx="537.95" cy="393.66100482413" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="398.85943309017"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">H</text>
<ellipse cx="501.85420158128" cy="408.98514554825" rx="6.1435970416788" ry="6.1435970416788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="501.85420158128" y="414.18357381429"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:11.814609695536px">H</text>
</g></svg>

✍: FYIcenter.com

2022-10-07, 119👍, 0💬