Molecule FYI-1001616

A

Molecule Summary:

ID: FYI-1001616
SMILES: N(C(=O)C=1C(C(F)F)=NN(C)C1)C2=C3C4C(C(C)C)C(C3=CC=C2)CC4

Received at FYIcenter.com on: 2022-10-04

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001616
FYIcenter.com

 26 29  0  0  0  0  0  0  0  0999 V2000
    6.0508    5.2504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2325    4.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4142    5.2504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2325    3.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3364    2.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6340    2.8232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9177    4.1580    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.6481    1.9103    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.9148    1.1040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5503    1.1040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7483    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1285    2.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8691    4.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6875    5.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4038    6.5850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0467    6.7277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2806    8.0522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0467    9.0909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    7.9093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4918    5.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5057    4.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5057    3.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6875    2.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8691    3.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9408    7.2530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1336    7.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  2  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  6  1  0  0  0  0
  9  5  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 10  1  0  0  0  0
 12  4  1  0  0  0  0
 13  1  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 17  1  0  0  0  0
 20 16  1  0  0  0  0
 21 20  1  0  0  0  0
 21 14  1  0  0  0  0
 22 21  2  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 24 13  1  0  0  0  0
 25 20  1  0  0  0  0
 26 25  1  0  0  0  0
 26 15  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="378.87973957795" x2="351.36285722335" y1="291.05484875236" y2="306.94278040214" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="351.36285722335" x2="323.84597486876" y1="306.94278040214" y2="322.83071205192" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #0000ff" />
<line x1="436" x2="408.5" y1="320" y2="304.5" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #ff0000" />
<line x1="408.5" x2="381" y1="304.5" y2="289" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="433" x2="405.5" y1="326" y2="310.5" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #ff0000" />
<line x1="405.5" x2="378" y1="310.5" y2="295" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="378.87973957795" x2="378.87973957795" y1="227.50777932213" y2="259.28131403725" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="378.87973957795" x2="378.87973957795" y1="259.28131403725" y2="291.05484875236" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="430.29022689494" x2="404.58498323645" y1="190.15728486772" y2="208.83253209493" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="404.58498323645" x2="378.87973957795" y1="208.83253209493" y2="227.50777932213" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="490.72165034138" x2="460.50593861816" y1="209.79190888515" y2="199.97459687644" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="460.50593861816" x2="430.29022689494" y1="199.97459687644" y2="190.15728486772" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="503.93403846696" x2="497.32784440417" y1="271.95579915666" y2="240.87385402091" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #00bc00" />
<line x1="497.32784440417" x2="490.72165034138" y1="240.87385402091" y2="209.79190888515" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="537.95" x2="514.33582517069" y1="167.27661413773" y2="188.53426151144" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #00bc00" />
<line x1="514.33582517069" x2="490.72165034138" y1="188.53426151144" y2="209.79190888515" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="408" x2="417.5" y1="131" y2="161.5" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #0000ff" />
<line x1="417.5" x2="427" y1="161.5" y2="192" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="414" x2="424" y1="129" y2="159.5" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #0000ff" />
<line x1="424" x2="434" y1="159.5" y2="190" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="347.10853344728" x2="378.8820681624" y1="129.72586142129" y2="129.72586142129" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #0000ff" />
<line x1="378.8820681624" x2="410.65560287751" y1="129.72586142129" y2="129.72586142129" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #0000ff" />
<line x1="309.75803899287" x2="328.43328622008" y1="78.310716935416" y2="104.01828917835" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="328.43328622008" x2="347.10853344728" y1="104.01828917835" y2="129.72586142129" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #0000ff" />
<line x1="327.46459509208" x2="337.28656426968" y1="190.15728486772" y2="159.9415731445" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="337.28656426968" x2="347.10853344728" y1="159.9415731445" y2="129.72586142129" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #0000ff" />
<line x1="327.46459509208" x2="353.17216733502" y1="190.15728486772" y2="208.83253209493" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="353.17216733502" x2="378.87973957795" y1="208.83253209493" y2="227.50777932213" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="268.81221015956" x2="296.32909251416" y1="291.05484875236" y2="306.94278040214" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="296.32909251416" x2="323.84597486876" y1="306.94278040214" y2="322.83071205192" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #0000ff" />
<line x1="216" x2="243.5" y1="326" y2="310.5" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="243.5" x2="271" y1="310.5" y2="295" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="213" x2="240.5" y1="320" y2="304.5" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="240.5" x2="268" y1="304.5" y2="289" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="200.57071449367" x2="207.17690855646" y1="384.98528798565" y2="353.90800001878" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="207.17690855646" x2="213.78310261925" y1="353.90800001878" y2="322.83071205192" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="137.3682755609" x2="168.96949502728" y1="391.63106798396" y2="388.3081779848" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="168.96949502728" x2="200.57071449367" y1="388.3081779848" y2="384.98528798565" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="101.68970473606" x2="119.52899014848" y1="453.31526986035" y2="422.47316892216" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="119.52899014848" x2="137.3682755609" y1="422.47316892216" y2="391.63106798396" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="137.3682755609" x2="119.52899014848" y1="501.68928306458" y2="477.50227646247" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="119.52899014848" x2="101.68970473606" y1="477.50227646247" y2="453.31526986035" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="42.05" x2="71.869852368028" y1="446.66017552427" y2="449.98772269231" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="71.869852368028" x2="101.68970473606" y1="449.98772269231" y2="453.31526986035" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="111.52564542031" x2="124.4469604906" y1="333.57480066866" y2="362.60293432631" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="124.4469604906" x2="137.3682755609" y1="362.60293432631" y2="391.63106798396" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="158.74468074117" x2="135.13516308074" y1="291.05484875236" y2="312.31482471051" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="135.13516308074" x2="111.52564542031" y1="312.31482471051" y2="333.57480066866" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="158.74468074117" x2="186.26389168021" y1="291.05484875236" y2="306.94278040214" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="186.26389168021" x2="213.78310261925" y1="306.94278040214" y2="322.83071205192" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="156" x2="156" y1="228" y2="260" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="156" x2="156" y1="260" y2="292" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="163" x2="163" y1="228" y2="260" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="163" x2="163" y1="260" y2="292" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="213.78310261925" x2="186.26389168021" y1="195.73657319146" y2="211.6221762568" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="186.26389168021" x2="158.74468074117" y1="211.6221762568" y2="227.50777932213" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="271" x2="243.5" y1="225" y2="209" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="243.5" x2="216" y1="209" y2="193" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="268" x2="240.5" y1="231" y2="215" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="240.5" x2="213" y1="215" y2="199" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="268.81221015956" x2="268.81221015956" y1="227.50777932213" y2="259.28131403725" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="268.81221015956" x2="268.81221015956" y1="259.28131403725" y2="291.05484875236" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="85.86464486622" x2="98.695145143265" y1="416.09517613471" y2="374.83498840169" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="98.695145143265" x2="111.52564542031" y1="374.83498840169" y2="333.57480066866" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="141.41535532161" x2="113.64000009391" y1="448.76987302899" y2="432.43252458185" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="113.64000009391" x2="85.86464486622" y1="432.43252458185" y2="416.09517613471" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="141.41535532161" x2="170.99303490764" y1="448.76987302899" y2="416.87758050732" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<line x1="170.99303490764" x2="200.57071449367" y1="416.87758050732" y2="384.98528798565" style="stroke-opacity:1; stroke-width: 2.7766083560441; stroke: #000000" />
<ellipse cx="323.84597486876" cy="322.83071205192" rx="18.047954314286" ry="18.047954314286" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="323.84597486876" y="338.10205801016"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.707604450551px">N</text>
<ellipse cx="433.91350428715" cy="322.83071205192" rx="18.047954314286" ry="18.047954314286" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="433.91350428715" y="338.10205801016"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:34.707604450551px">O</text>
<ellipse cx="503.93403846696" cy="271.95579915666" rx="18.047954314286" ry="18.047954314286" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="503.93403846696" y="287.2271451149"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:34.707604450551px">F</text>
<ellipse cx="537.95" cy="167.27661413773" rx="18.047954314286" ry="18.047954314286" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="182.54796009598"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:34.707604450551px">F</text>
<ellipse cx="410.65560287751" cy="129.72586142129" rx="18.047954314286" ry="18.047954314286" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="410.65560287751" y="144.99720737953"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.707604450551px">N</text>
<ellipse cx="347.10853344728" cy="129.72586142129" rx="18.047954314286" ry="18.047954314286" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="347.10853344728" y="144.99720737953"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.707604450551px">N</text>
</g></svg>

✍: FYIcenter.com

2022-10-07, 122👍, 0💬