Molecule FYI-1001613

A

Molecule Summary:

ID: FYI-1001613
SMILES: C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O

Received at FYIcenter.com on: 2022-10-01

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001613
FYIcenter.com

122132  0  0  0  0  0  0  0  0999 V2000
   25.4611   16.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4611   14.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6736   14.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8860   14.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8860   16.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6736   16.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6736   18.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0984   16.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0984   14.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2487   14.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2487   12.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0363   14.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8239   14.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6113   14.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3989   14.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3989   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6113   11.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8239   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0363   11.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6113   10.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1865   14.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1865   16.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9741   14.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616   14.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492   14.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368   14.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243   14.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368   11.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492   12.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368   10.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    9.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119   10.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9741    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1865    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1865    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9741    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3989    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3989    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9741    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119   11.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995   14.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   11.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621   11.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745    9.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745    8.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    8.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    9.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497   12.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119   14.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119   16.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243   16.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995   16.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995   18.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   18.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745   18.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745   16.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   16.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621   16.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497   16.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497   18.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   16.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248   16.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124   16.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124   14.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248   14.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   14.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248   12.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   14.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   16.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621   18.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   20.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368   16.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492   16.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616   16.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492   18.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616   18.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368   18.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243   21.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243   22.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368   23.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119   23.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119   24.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995   25.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   24.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   23.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995   22.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745   22.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745   25.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995   26.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492   22.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9741   21.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  6  1  1  0  0  0  0
  7  6  1  0  0  0  0
  8  5  1  0  0  0  0
  9  4  1  0  0  0  0
 10  2  1  0  0  0  0
 11 10  2  0  0  0  0
 12 10  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 16  1  0  0  0  0
 18 17  2  0  0  0  0
 18 13  1  0  0  0  0
 19 18  1  0  0  0  0
 20 17  1  0  0  0  0
 21 15  1  0  0  0  0
 22 21  2  0  0  0  0
 23 21  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  1  0  0  0  0
 30 25  1  0  0  0  0
 31 29  1  0  0  0  0
 32 31  1  0  0  0  0
 33 32  2  0  0  0  0
 34 32  1  0  0  0  0
 35 34  2  0  0  0  0
 36 35  1  0  0  0  0
 37 36  2  0  0  0  0
 38 37  1  0  0  0  0
 39 38  2  0  0  0  0
 39 34  1  0  0  0  0
 40 38  1  0  0  0  0
 41 40  1  0  0  0  0
 42 41  2  0  0  0  0
 43 41  1  0  0  0  0
 44 43  2  0  0  0  0
 45 44  1  0  0  0  0
 46 45  2  0  0  0  0
 47 46  1  0  0  0  0
 48 47  2  0  0  0  0
 48 43  1  0  0  0  0
 49 47  1  0  0  0  0
 50 46  1  0  0  0  0
 51 45  1  0  0  0  0
 52 37  1  0  0  0  0
 53 36  1  0  0  0  0
 54 28  1  0  0  0  0
 55 54  1  0  0  0  0
 56 55  2  0  0  0  0
 57 55  1  0  0  0  0
 58 57  2  0  0  0  0
 59 58  1  0  0  0  0
 60 59  2  0  0  0  0
 61 60  1  0  0  0  0
 62 61  2  0  0  0  0
 62 57  1  0  0  0  0
 63 61  1  0  0  0  0
 64 63  1  0  0  0  0
 65 64  2  0  0  0  0
 66 64  1  0  0  0  0
 67 66  2  0  0  0  0
 68 67  1  0  0  0  0
 69 68  2  0  0  0  0
 70 69  1  0  0  0  0
 71 70  2  0  0  0  0
 71 66  1  0  0  0  0
 72 70  1  0  0  0  0
 73 69  1  0  0  0  0
 74 68  1  0  0  0  0
 75 60  1  0  0  0  0
 76 59  1  0  0  0  0
 77 27  1  0  0  0  0
 78 77  1  0  0  0  0
 79 78  2  0  0  0  0
 80 78  1  0  0  0  0
 81 80  2  0  0  0  0
 82 81  1  0  0  0  0
 83 82  2  0  0  0  0
 84 83  1  0  0  0  0
 85 84  2  0  0  0  0
 85 80  1  0  0  0  0
 86 84  1  0  0  0  0
 87 86  1  0  0  0  0
 88 87  2  0  0  0  0
 89 87  1  0  0  0  0
 90 89  2  0  0  0  0
 91 90  1  0  0  0  0
 92 91  2  0  0  0  0
 93 92  1  0  0  0  0
 94 93  2  0  0  0  0
 94 89  1  0  0  0  0
 95 93  1  0  0  0  0
 96 92  1  0  0  0  0
 97 91  1  0  0  0  0
 98 83  1  0  0  0  0
 99 82  1  0  0  0  0
100 26  1  0  0  0  0
101100  1  0  0  0  0
102101  2  0  0  0  0
103101  1  0  0  0  0
104103  2  0  0  0  0
105104  1  0  0  0  0
106105  2  0  0  0  0
107106  1  0  0  0  0
108107  2  0  0  0  0
108103  1  0  0  0  0
109107  1  0  0  0  0
110109  1  0  0  0  0
111110  2  0  0  0  0
112110  1  0  0  0  0
113112  2  0  0  0  0
114113  1  0  0  0  0
115114  2  0  0  0  0
116115  1  0  0  0  0
117116  2  0  0  0  0
117112  1  0  0  0  0
118116  1  0  0  0  0
119115  1  0  0  0  0
120114  1  0  0  0  0
121106  1  0  0  0  0
122105  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="475" x2="475" y1="314" y2="326" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="475" x2="475" y1="326" y2="338" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="478" x2="478" y1="314" y2="326" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="478" x2="478" y1="326" y2="338" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="496.62613614494" x2="486.29431807247" y1="301.92952189811" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="486.29431807247" x2="475.9625" y1="307.89428284717" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="518" x2="508" y1="313" y2="307" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="508" x2="498" y1="307" y2="301" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="517" x2="506.5" y1="315" y2="309.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="506.5" x2="496" y1="309.5" y2="304" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="517.28806807247" x2="517.28806807247" y1="337.71808759244" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="517.28806807247" x2="517.28806807247" y1="325.78856569433" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="498" x2="508" y1="351" y2="345" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="508" x2="518" y1="345" y2="339" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="496" x2="506.5" y1="349" y2="343" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="506.5" x2="517" y1="343" y2="337" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="496.62613614494" x2="486.29431807247" y1="349.64760949056" y2="343.6828485415" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="486.29431807247" x2="475.9625" y1="343.6828485415" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="496.62613614494" x2="496.62613614494" y1="373.50665328678" y2="361.57713138867" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="496.62613614494" x2="496.62613614494" y1="361.57713138867" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="537.95" x2="527.61903403624" y1="349.64760949056" y2="343.6828485415" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="527.61903403624" x2="517.28806807247" y1="343.6828485415" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="537.95" x2="527.61903403624" y1="301.92952189811" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="527.61903403624" x2="517.28806807247" y1="307.89428284717" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="455.30056807247" x2="465.63153403624" y1="301.92952189811" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="465.63153403624" x2="475.9625" y1="307.89428284717" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="455" x2="455" y1="279" y2="290.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="455" x2="455" y1="290.5" y2="302" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="457" x2="457" y1="279" y2="290.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="457" x2="457" y1="290.5" y2="302" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="434.63863614494" x2="444.96960210871" y1="313.85904379622" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="444.96960210871" x2="455.30056807247" y1="307.89428284717" y2="301.92952189811" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="413.97670421741" x2="424.30767018118" y1="301.92952189811" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="424.30767018118" x2="434.63863614494" y1="307.89428284717" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="394" x2="404.5" y1="315" y2="309.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="404.5" x2="415" y1="309.5" y2="304" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="393" x2="403.5" y1="313" y2="307" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="403.5" x2="414" y1="307" y2="301" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="372.64943192753" x2="382.98039789129" y1="301.92952189811" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="382.98039789129" x2="393.31136385506" y1="307.89428284717" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="372" x2="372" y1="279" y2="290.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="372" x2="372" y1="290.5" y2="302" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="374" x2="374" y1="279" y2="290.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="374" x2="374" y1="290.5" y2="302" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="393.31136385506" x2="382.98039789129" y1="266.14095620378" y2="272.10571715283" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="382.98039789129" x2="372.64943192753" y1="272.10571715283" y2="278.07047810189" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="415" x2="404.5" y1="277" y2="271.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="404.5" x2="394" y1="271.5" y2="266" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="414" x2="403.5" y1="280" y2="274" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="403.5" x2="393" y1="274" y2="268" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="413.97670421741" x2="413.97670421741" y1="278.07047810189" y2="290" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="413.97670421741" x2="413.97670421741" y1="290" y2="301.92952189811" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="434.63863614494" x2="424.30767018118" y1="266.14095620378" y2="272.10571715283" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="424.30767018118" x2="413.97670421741" y1="272.10571715283" y2="278.07047810189" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="393.31136385506" x2="393.31136385506" y1="242.28191240756" y2="254.21143430567" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="393.31136385506" x2="393.31136385506" y1="254.21143430567" y2="266.14095620378" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="351.9875" x2="362.31846596376" y1="313.85904379622" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="362.31846596376" x2="372.64943192753" y1="307.89428284717" y2="301.92952189811" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="354" x2="354" y1="338" y2="326" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="354" x2="354" y1="326" y2="314" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="351" x2="351" y1="338" y2="326" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="351" x2="351" y1="326" y2="314" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="331.32556807247" x2="341.65653403624" y1="301.92952189811" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="341.65653403624" x2="351.9875" y1="307.89428284717" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="310.66193192753" x2="320.99375" y1="313.85904379622" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="320.99375" x2="331.32556807247" y1="307.89428284717" y2="301.92952189811" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="290" x2="300.33096596376" y1="301.92952189811" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="300.33096596376" x2="310.66193192753" y1="307.89428284717" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="269.33806807247" x2="279.66903403624" y1="313.85904379622" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="279.66903403624" x2="290" y1="307.89428284717" y2="301.92952189811" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="248.67443192753" x2="259.00625" y1="301.92952189811" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="259.00625" x2="269.33806807247" y1="307.89428284717" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="248.67443192753" x2="248.67443192753" y1="278.07047810189" y2="290" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="248.67443192753" x2="248.67443192753" y1="290" y2="301.92952189811" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="269.33806807247" x2="259.00625" y1="266.14095620378" y2="272.10571715283" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="259.00625" x2="248.67443192753" y1="272.10571715283" y2="278.07047810189" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="290" x2="279.66903403624" y1="278.07047810189" y2="272.10571715283" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="279.66903403624" x2="269.33806807247" y1="272.10571715283" y2="266.14095620378" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="290" x2="290" y1="278.07047810189" y2="290" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="290" x2="290" y1="290" y2="301.92952189811" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="269.33806807247" x2="269.33806807247" y1="242.28191240756" y2="254.21143430567" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="269.33806807247" x2="269.33806807247" y1="254.21143430567" y2="266.14095620378" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="248.67443192753" x2="259.00625" y1="230.35239050944" y2="236.3171514585" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="259.00625" x2="269.33806807247" y1="236.3171514585" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="229" x2="239.5" y1="244" y2="238" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="239.5" x2="250" y1="238" y2="232" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="228" x2="238.5" y1="242" y2="236" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="238.5" x2="249" y1="236" y2="230" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="248.67443192753" x2="248.67443192753" y1="206.49334671322" y2="218.42286861133" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="248.67443192753" x2="248.67443192753" y1="218.42286861133" y2="230.35239050944" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="228" x2="238.5" y1="196" y2="202" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="238.5" x2="249" y1="202" y2="208" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="229" x2="239.5" y1="194" y2="200" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="239.5" x2="250" y1="200" y2="206" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="228.0125" x2="228.0125" y1="170.70478101889" y2="182.634302917" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="228.0125" x2="228.0125" y1="182.634302917" y2="194.56382481511" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="249" x2="238.5" y1="158" y2="164" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="238.5" x2="228" y1="164" y2="170" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="250" x2="239.5" y1="160" y2="166" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="239.5" x2="229" y1="166" y2="172" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="269.33806807247" x2="259.00625" y1="170.70478101889" y2="164.74002006983" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="259.00625" x2="248.67443192753" y1="164.74002006983" y2="158.77525912078" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="271" x2="271" y1="195" y2="183" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="271" x2="271" y1="183" y2="171" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="269" x2="269" y1="195" y2="183" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="269" x2="269" y1="183" y2="171" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="269.33806807247" x2="259.00625" y1="194.56382481511" y2="200.52858576417" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="259.00625" x2="248.67443192753" y1="200.52858576417" y2="206.49334671322" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="290" x2="279.66903403624" y1="158.77525912078" y2="164.74002006983" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="279.66903403624" x2="269.33806807247" y1="164.74002006983" y2="170.70478101889" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="290" x2="290" y1="134.91621532455" y2="146.84573722267" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="290" x2="290" y1="146.84573722267" y2="158.77525912078" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="269" x2="279.5" y1="125" y2="131" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="279.5" x2="290" y1="131" y2="137" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="270" x2="280.5" y1="122" y2="128" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="280.5" x2="291" y1="128" y2="134" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="310.66193192753" x2="300.33096596376" y1="122.98669342644" y2="128.9514543755" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="300.33096596376" x2="290" y1="128.9514543755" y2="134.91621532455" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="310" x2="310" y1="100" y2="111.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="310" x2="310" y1="111.5" y2="123" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="312" x2="312" y1="100" y2="111.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="312" x2="312" y1="111.5" y2="123" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="331.32556807247" x2="320.99375" y1="87.198127732109" y2="93.162888681165" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="320.99375" x2="310.66193192753" y1="93.162888681165" y2="99.12764963022" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="353" x2="342.5" y1="99" y2="93" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="342.5" x2="332" y1="93" y2="87" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="352" x2="341.5" y1="101" y2="95" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="341.5" x2="331" y1="95" y2="89" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="351.9875" x2="351.9875" y1="122.98669342644" y2="111.05717152833" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="351.9875" x2="351.9875" y1="111.05717152833" y2="99.12764963022" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="332" x2="342.5" y1="137" y2="131" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="342.5" x2="353" y1="131" y2="125" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="331" x2="341.5" y1="134" y2="128" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="341.5" x2="352" y1="128" y2="122" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="331.32556807247" x2="320.99375" y1="134.91621532455" y2="128.9514543755" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="320.99375" x2="310.66193192753" y1="128.9514543755" y2="122.98669342644" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="372.64943192753" x2="362.31846596376" y1="134.91621532455" y2="128.9514543755" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="362.31846596376" x2="351.9875" y1="128.9514543755" y2="122.98669342644" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="372.64943192753" x2="362.31846596376" y1="87.198127732109" y2="93.162888681165" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="362.31846596376" x2="351.9875" y1="93.162888681165" y2="99.12764963022" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="331.32556807247" x2="331.32556807247" y1="63.339083935886" y2="75.268605833998" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="331.32556807247" x2="331.32556807247" y1="75.268605833998" y2="87.198127732109" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="248.67443192753" x2="248.67443192753" y1="134.91621532455" y2="146.84573722267" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="248.67443192753" x2="248.67443192753" y1="146.84573722267" y2="158.77525912078" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="207.35056807247" x2="217.68153403624" y1="158.77525912078" y2="164.74002006983" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="217.68153403624" x2="228.0125" y1="164.74002006983" y2="170.70478101889" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="228.0125" x2="238.34346596376" y1="266.14095620378" y2="272.10571715283" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="238.34346596376" x2="248.67443192753" y1="272.10571715283" y2="278.07047810189" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="207.35056807247" x2="217.68153403624" y1="278.07047810189" y2="272.10571715283" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="217.68153403624" x2="228.0125" y1="272.10571715283" y2="266.14095620378" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="209" x2="209" y1="302" y2="290.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="209" x2="209" y1="290.5" y2="279" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="207" x2="207" y1="302" y2="290.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="207" x2="207" y1="290.5" y2="279" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="186.68863614494" x2="197.01960210871" y1="266.14095620378" y2="272.10571715283" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="197.01960210871" x2="207.35056807247" y1="272.10571715283" y2="278.07047810189" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="167" x2="177.5" y1="280" y2="274" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="177.5" x2="188" y1="274" y2="268" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="166" x2="176.5" y1="277" y2="271.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="176.5" x2="187" y1="271.5" y2="266" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="145.36136385506" x2="155.69232981882" y1="266.14095620378" y2="272.10571715283" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="155.69232981882" x2="166.02329578259" y1="272.10571715283" y2="278.07047810189" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="145" x2="145" y1="243" y2="255" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="145" x2="145" y1="255" y2="267" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="147" x2="147" y1="243" y2="255" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="147" x2="147" y1="255" y2="267" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="166.02329578259" x2="155.69232981882" y1="230.35239050944" y2="236.3171514585" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="155.69232981882" x2="145.36136385506" y1="236.3171514585" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="188" x2="177.5" y1="242" y2="236" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="177.5" x2="167" y1="236" y2="230" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="187" x2="176.5" y1="244" y2="238" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="176.5" x2="166" y1="238" y2="232" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="186.68863614494" x2="186.68863614494" y1="242.28191240756" y2="254.21143430567" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="186.68863614494" x2="186.68863614494" y1="254.21143430567" y2="266.14095620378" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="166.02329578259" x2="166.02329578259" y1="206.49334671322" y2="218.42286861133" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="166.02329578259" x2="166.02329578259" y1="218.42286861133" y2="230.35239050944" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="145.36136385506" x2="155.69232981882" y1="194.56382481511" y2="200.52858576417" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="155.69232981882" x2="166.02329578259" y1="200.52858576417" y2="206.49334671322" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="126" x2="136" y1="208" y2="202" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="136" x2="146" y1="202" y2="196" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="125" x2="135" y1="206" y2="200" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="135" x2="145" y1="200" y2="194" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="145.36136385506" x2="145.36136385506" y1="170.70478101889" y2="182.634302917" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="145.36136385506" x2="145.36136385506" y1="182.634302917" y2="194.56382481511" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="125" x2="135" y1="160" y2="166" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="135" x2="145" y1="166" y2="172" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="126" x2="136" y1="158" y2="164" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="136" x2="146" y1="164" y2="170" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="124.69943192753" x2="124.69943192753" y1="134.91621532455" y2="146.84573722267" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="124.69943192753" x2="124.69943192753" y1="146.84573722267" y2="158.77525912078" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="145" x2="135" y1="122" y2="128" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="135" x2="125" y1="128" y2="134" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="146" x2="136" y1="125" y2="131" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="136" x2="126" y1="131" y2="137" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="166.02329578259" x2="155.69232981882" y1="134.91621532455" y2="128.9514543755" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="155.69232981882" x2="145.36136385506" y1="128.9514543755" y2="122.98669342644" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="168" x2="168" y1="159" y2="147" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="168" x2="168" y1="147" y2="135" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="165" x2="165" y1="159" y2="147" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="165" x2="165" y1="147" y2="135" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="166.02329578259" x2="155.69232981882" y1="158.77525912078" y2="164.74002006983" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="155.69232981882" x2="145.36136385506" y1="164.74002006983" y2="170.70478101889" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="186.68863614494" x2="176.35596596376" y1="122.98669342644" y2="128.9514543755" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="176.35596596376" x2="166.02329578259" y1="128.9514543755" y2="134.91621532455" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="145.36136385506" x2="145.36136385506" y1="99.12764963022" y2="111.05717152833" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="145.36136385506" x2="145.36136385506" y1="111.05717152833" y2="122.98669342644" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="104.0375" x2="114.36846596376" y1="122.98669342644" y2="128.9514543755" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="114.36846596376" x2="124.69943192753" y1="128.9514543755" y2="134.91621532455" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="124.69943192753" x2="135.03039789129" y1="230.35239050944" y2="236.3171514585" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="135.03039789129" x2="145.36136385506" y1="236.3171514585" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="124.69943192753" x2="135.03039789129" y1="278.07047810189" y2="272.10571715283" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="135.03039789129" x2="145.36136385506" y1="272.10571715283" y2="266.14095620378" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="228.0125" x2="238.34346596376" y1="313.85904379622" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="238.34346596376" x2="248.67443192753" y1="307.89428284717" y2="301.92952189811" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="228.0125" x2="228.0125" y1="337.71808759244" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="228.0125" x2="228.0125" y1="325.78856569433" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="250" x2="239.5" y1="349" y2="343" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="239.5" x2="229" y1="343" y2="337" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="249" x2="238.5" y1="351" y2="345" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="238.5" x2="228" y1="345" y2="339" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="207.35056807247" x2="217.68153403624" y1="349.64760949056" y2="343.6828485415" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="217.68153403624" x2="228.0125" y1="343.6828485415" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="209" x2="209" y1="374" y2="362" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="209" x2="209" y1="362" y2="350" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="207" x2="207" y1="374" y2="362" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="207" x2="207" y1="362" y2="350" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="186.68863614494" x2="197.01960210871" y1="385.43617518489" y2="379.47141423583" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="197.01960210871" x2="207.35056807247" y1="379.47141423583" y2="373.50665328678" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="166" x2="176.5" y1="375" y2="381" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="176.5" x2="187" y1="381" y2="387" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="167" x2="177.5" y1="373" y2="379" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="177.5" x2="188" y1="379" y2="385" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="166.02329578259" x2="166.02329578259" y1="349.64760949056" y2="361.57713138867" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="166.02329578259" x2="166.02329578259" y1="361.57713138867" y2="373.50665328678" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="187" x2="176.5" y1="337" y2="343" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="176.5" x2="166" y1="343" y2="349" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="188" x2="177.5" y1="339" y2="345" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="177.5" x2="167" y1="345" y2="351" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="186.68863614494" x2="197.01960210871" y1="337.71808759244" y2="343.6828485415" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="197.01960210871" x2="207.35056807247" y1="343.6828485415" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="145.36136385506" x2="155.69232981882" y1="337.71808759244" y2="343.6828485415" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="155.69232981882" x2="166.02329578259" y1="343.6828485415" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="124.69943192753" x2="135.03039789129" y1="349.64760949056" y2="343.6828485415" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="135.03039789129" x2="145.36136385506" y1="343.6828485415" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="126" x2="126" y1="374" y2="362" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="126" x2="126" y1="362" y2="350" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="124" x2="124" y1="374" y2="362" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="124" x2="124" y1="362" y2="350" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="104.0375" x2="114.36846596376" y1="337.71808759244" y2="343.6828485415" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="114.36846596376" x2="124.69943192753" y1="343.6828485415" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="85" x2="95" y1="351" y2="345" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="95" x2="105" y1="345" y2="339" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="83" x2="93.5" y1="349" y2="343" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="93.5" x2="104" y1="343" y2="337" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="62.711931927529" x2="73.042897891293" y1="337.71808759244" y2="343.6828485415" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="73.042897891293" x2="83.373863855057" y1="343.6828485415" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="62" x2="62" y1="314" y2="326" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="62" x2="62" y1="326" y2="338" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="64" x2="64" y1="314" y2="326" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="64" x2="64" y1="326" y2="338" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="83.373863855057" x2="73.042897891293" y1="301.92952189811" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="73.042897891293" x2="62.711931927529" y1="307.89428284717" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="105" x2="95" y1="313" y2="307" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="95" x2="85" y1="307" y2="301" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="104" x2="93.5" y1="315" y2="309.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="93.5" x2="83" y1="309.5" y2="304" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="104.0375" x2="104.0375" y1="313.85904379622" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="104.0375" x2="104.0375" y1="325.78856569433" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="83.373863855057" x2="83.373863855057" y1="278.07047810189" y2="290" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="83.373863855057" x2="83.373863855057" y1="290" y2="301.92952189811" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="42.05" x2="52.380965963764" y1="301.92952189811" y2="307.89428284717" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="52.380965963764" x2="62.711931927529" y1="307.89428284717" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="42.05" x2="52.380965963764" y1="349.64760949056" y2="343.6828485415" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="52.380965963764" x2="62.711931927529" y1="343.6828485415" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="145.36136385506" x2="155.69232981882" y1="385.43617518489" y2="379.47141423583" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="155.69232981882" x2="166.02329578259" y1="379.47141423583" y2="373.50665328678" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="186.68863614494" x2="186.68863614494" y1="409.29521898111" y2="397.365697083" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="186.68863614494" x2="186.68863614494" y1="397.365697083" y2="385.43617518489" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="269.33806807247" x2="269.33806807247" y1="337.71808759244" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="269.33806807247" x2="269.33806807247" y1="325.78856569433" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="290" x2="279.66903403624" y1="349.64760949056" y2="343.6828485415" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="279.66903403624" x2="269.33806807247" y1="343.6828485415" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="311" x2="300.5" y1="337" y2="343" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="300.5" x2="290" y1="343" y2="349" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="312" x2="301.5" y1="339" y2="345" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="301.5" x2="291" y1="345" y2="351" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="290" x2="290" y1="373.50665328678" y2="361.57713138867" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="290" x2="290" y1="361.57713138867" y2="349.64760949056" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="312" x2="301.5" y1="385" y2="379" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="301.5" x2="291" y1="379" y2="373" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="311" x2="300.5" y1="387" y2="381" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="300.5" x2="290" y1="381" y2="375" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="310.66193192753" x2="310.66193192753" y1="409.29521898111" y2="397.365697083" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="310.66193192753" x2="310.66193192753" y1="397.365697083" y2="385.43617518489" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="291" x2="301.5" y1="423" y2="417" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="301.5" x2="312" y1="417" y2="411" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="290" x2="300.5" y1="421" y2="415" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="300.5" x2="311" y1="415" y2="409" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="269.33806807247" x2="279.66903403624" y1="409.29521898111" y2="415.25997993017" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="279.66903403624" x2="290" y1="415.25997993017" y2="421.22474087922" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="269" x2="269" y1="386" y2="398" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="269" x2="269" y1="398" y2="410" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="271" x2="271" y1="386" y2="398" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="271" x2="271" y1="398" y2="410" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="269.33806807247" x2="279.66903403624" y1="385.43617518489" y2="379.47141423583" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="279.66903403624" x2="290" y1="379.47141423583" y2="373.50665328678" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="248.67443192753" x2="259.00625" y1="421.22474087922" y2="415.25997993017" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="259.00625" x2="269.33806807247" y1="415.25997993017" y2="409.29521898111" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="248.67443192753" x2="248.67443192753" y1="445.08378467545" y2="433.15426277733" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="248.67443192753" x2="248.67443192753" y1="433.15426277733" y2="421.22474087922" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="270" x2="260" y1="456" y2="450" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="260" x2="250" y1="450" y2="444" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="269" x2="259" y1="459" y2="453" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="259" x2="249" y1="453" y2="447" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="228.0125" x2="238.34346596376" y1="457.01330657356" y2="451.0485456245" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="238.34346596376" x2="248.67443192753" y1="451.0485456245" y2="445.08378467545" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="230" x2="230" y1="481" y2="469.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="230" x2="230" y1="469.5" y2="458" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="227" x2="227" y1="481" y2="469.5" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="227" x2="227" y1="469.5" y2="458" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="207.35056807247" x2="217.68153403624" y1="492.80187226789" y2="486.83711131884" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="217.68153403624" x2="228.0125" y1="486.83711131884" y2="480.87235036978" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="187" x2="197" y1="482" y2="488" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="197" x2="207" y1="488" y2="494" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="188" x2="198" y1="480" y2="486" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="198" x2="208" y1="486" y2="492" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="186.68863614494" x2="186.68863614494" y1="457.01330657356" y2="468.94282847167" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="186.68863614494" x2="186.68863614494" y1="468.94282847167" y2="480.87235036978" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="207" x2="197" y1="444" y2="450" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="197" x2="187" y1="450" y2="456" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="208" x2="198" y1="447" y2="453" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="198" x2="188" y1="453" y2="459" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="207.35056807247" x2="217.68153403624" y1="445.08378467545" y2="451.0485456245" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="217.68153403624" x2="228.0125" y1="451.0485456245" y2="457.01330657356" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="166.02329578259" x2="176.35596596376" y1="445.08378467545" y2="451.0485456245" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="176.35596596376" x2="186.68863614494" y1="451.0485456245" y2="457.01330657356" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="166.02329578259" x2="176.35596596376" y1="492.80187226789" y2="486.83711131884" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="176.35596596376" x2="186.68863614494" y1="486.83711131884" y2="480.87235036978" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="207.35056807247" x2="207.35056807247" y1="516.66091606411" y2="504.731394166" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="207.35056807247" x2="207.35056807247" y1="504.731394166" y2="492.80187226789" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="290" x2="290" y1="445.08378467545" y2="433.15426277733" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="290" x2="290" y1="433.15426277733" y2="421.22474087922" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<line x1="331.32556807247" x2="320.99375" y1="421.22474087922" y2="415.25997993017" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #ff0000" />
<line x1="320.99375" x2="310.66193192753" y1="415.25997993017" y2="409.29521898111" style="stroke-opacity:1; stroke-width: 1.004594517646; stroke: #000000" />
<ellipse cx="496.62613614494" cy="373.50665328678" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="496.62613614494" y="379.03192313383"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="537.95" cy="349.64760949056" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="355.17287933761"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="537.95" cy="301.92952189811" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="307.45479174516"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="455.30056807247" cy="278.07047810189" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="455.30056807247" y="283.59574794894"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="434.63863614494" cy="313.85904379622" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="434.63863614494" y="319.38431364328"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="434.63863614494" cy="266.14095620378" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="434.63863614494" y="271.66622605083"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="393.31136385506" cy="242.28191240756" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="393.31136385506" y="247.80718225461"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="351.9875" cy="337.71808759244" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="351.9875" y="343.2433574395"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="331.32556807247" cy="301.92952189811" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="331.32556807247" y="307.45479174516"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="290" cy="278.07047810189" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290" y="283.59574794894"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="269.33806807247" cy="242.28191240756" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="269.33806807247" y="247.80718225461"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="228.0125" cy="242.28191240756" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="228.0125" y="247.80718225461"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="290" cy="158.77525912078" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290" y="164.30052896783"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="269.33806807247" cy="122.98669342644" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="269.33806807247" y="128.5119632735"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="372.64943192753" cy="134.91621532455" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.64943192753" y="140.44148517161"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="372.64943192753" cy="87.198127732109" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.64943192753" y="92.723397579162"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="331.32556807247" cy="63.339083935886" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="331.32556807247" y="68.864353782939"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="248.67443192753" cy="134.91621532455" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="248.67443192753" y="140.44148517161"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="207.35056807247" cy="158.77525912078" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="207.35056807247" y="164.30052896783"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="228.0125" cy="266.14095620378" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="228.0125" y="271.66622605083"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="207.35056807247" cy="301.92952189811" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="207.35056807247" y="307.45479174516"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="166.02329578259" cy="206.49334671322" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="166.02329578259" y="212.01861656027"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="124.69943192753" cy="206.49334671322" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="124.69943192753" y="212.01861656027"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="186.68863614494" cy="122.98669342644" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="186.68863614494" y="128.5119632735"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="145.36136385506" cy="99.12764963022" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="145.36136385506" y="104.65291947727"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="104.0375" cy="122.98669342644" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="104.0375" y="128.5119632735"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="124.69943192753" cy="230.35239050944" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="124.69943192753" y="235.8776603565"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="124.69943192753" cy="278.07047810189" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="124.69943192753" y="283.59574794894"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="228.0125" cy="313.85904379622" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="228.0125" y="319.38431364328"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="248.67443192753" cy="349.64760949056" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="248.67443192753" y="355.17287933761"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="145.36136385506" cy="337.71808759244" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="145.36136385506" y="343.2433574395"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="124.69943192753" cy="373.50665328678" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="124.69943192753" y="379.03192313383"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="83.373863855057" cy="278.07047810189" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="83.373863855057" y="283.59574794894"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="42.05" cy="301.92952189811" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="307.45479174516"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="42.05" cy="349.64760949056" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="355.17287933761"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="145.36136385506" cy="385.43617518489" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="145.36136385506" y="390.96144503194"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="186.68863614494" cy="409.29521898111" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="186.68863614494" y="414.82048882817"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="269.33806807247" cy="337.71808759244" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="269.33806807247" y="343.2433574395"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="310.66193192753" cy="337.71808759244" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="310.66193192753" y="343.2433574395"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="248.67443192753" cy="421.22474087922" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="248.67443192753" y="426.75001072628"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="269.33806807247" cy="457.01330657356" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="269.33806807247" y="462.53857642061"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="166.02329578259" cy="445.08378467545" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="166.02329578259" y="450.6090545225"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="166.02329578259" cy="492.80187226789" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="166.02329578259" y="498.32714211494"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="207.35056807247" cy="516.66091606411" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="207.35056807247" y="522.18618591117"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="290" cy="445.08378467545" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290" y="450.6090545225"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
<ellipse cx="331.32556807247" cy="421.22474087922" rx="6.5298643646989" ry="6.5298643646989" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="331.32556807247" y="426.75001072628"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:12.557431470575px">O</text>
</g></svg>

✍: FYIcenter.com

2022-10-07, 117👍, 0💬