Molecule FYI-1001195

A

Molecule Summary:

ID: FYI-1001195
SMILES: CCCCCC=CCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC

Received at FYIcenter.com on: 2022-03-03

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001195
FYIcenter.com

 63 62  0  0  0  0  0  0  0  0999 V2000
   48.4974   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.2850   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.0726   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.8601   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6477   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4353   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2229   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0104   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7980   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5856   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3732   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1606   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9482   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7358   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5234   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3109   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0985   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8861   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8861   22.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6737   20.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4611   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2487   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0363   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8239   20.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6114   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6114   22.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3990   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1866   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9742   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124   21.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   20.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2487   18.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0363   18.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8239   18.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0363   16.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8239   16.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8239   14.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6114   14.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6114   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3990   11.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3990   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1866    9.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1866    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9742    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9742    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 18  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 27 25  1  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  1  0  0  0  0
 31 30  1  0  0  0  0
 32 31  1  0  0  0  0
 33 32  1  0  0  0  0
 34 33  1  0  0  0  0
 35 34  2  0  0  0  0
 36 35  1  0  0  0  0
 37 36  1  0  0  0  0
 38 37  2  0  0  0  0
 39 38  1  0  0  0  0
 40 39  1  0  0  0  0
 41 40  1  0  0  0  0
 42 41  1  0  0  0  0
 43 42  1  0  0  0  0
 44 22  1  0  0  0  0
 45 44  1  0  0  0  0
 46 45  2  0  0  0  0
 47 45  1  0  0  0  0
 48 47  1  0  0  0  0
 49 48  1  0  0  0  0
 50 49  1  0  0  0  0
 51 50  1  0  0  0  0
 52 51  1  0  0  0  0
 53 52  1  0  0  0  0
 54 53  1  0  0  0  0
 55 54  2  0  0  0  0
 56 55  1  0  0  0  0
 57 56  1  0  0  0  0
 58 57  2  0  0  0  0
 59 58  1  0  0  0  0
 60 59  1  0  0  0  0
 61 60  1  0  0  0  0
 62 61  1  0  0  0  0
 63 62  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="525.55285788516" x2="531.75142894258" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="531.75142894258" x2="537.95" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="513.15571577033" x2="519.35428682775" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="519.35428682775" x2="525.55285788516" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="500.75755112645" x2="506.95663344839" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="506.95663344839" x2="513.15571577033" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="488.36040901162" x2="494.55898006903" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="494.55898006903" x2="500.75755112645" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="475.96326689678" x2="482.1618379542" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="482.1618379542" x2="488.36040901162" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="464" x2="470" y1="384" y2="387.5" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="470" x2="476" y1="387.5" y2="391" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="464" x2="470.5" y1="383" y2="386.5" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="470.5" x2="477" y1="386.5" y2="390" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="451.16796013807" x2="457.36704246001" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="457.36704246001" x2="463.56612478195" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="438.77081802323" x2="444.96938908065" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="444.96938908065" x2="451.16796013807" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="427" x2="433.5" y1="391" y2="387.5" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="433.5" x2="440" y1="387.5" y2="384" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="426" x2="432.5" y1="390" y2="386.5" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="432.5" x2="439" y1="386.5" y2="383" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="413.97653379356" x2="420.17510485098" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="420.17510485098" x2="426.3736759084" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="401.57734662064" x2="407.7769402071" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="407.7769402071" x2="413.97653379356" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="389.18020450581" x2="395.37877556323" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="395.37877556323" x2="401.57734662064" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="376.78306239097" x2="382.98163344839" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="382.98163344839" x2="389.18020450581" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="364.38592027614" x2="370.58449133356" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="370.58449133356" x2="376.78306239097" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="351.98775563226" x2="358.1868379542" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="358.1868379542" x2="364.38592027614" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="339.59061351743" x2="345.78918457484" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="345.78918457484" x2="351.98775563226" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="327.19347140259" x2="333.39204246001" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="333.39204246001" x2="339.59061351743" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="328" x2="328" y1="405" y2="398" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #ff0000" />
<line x1="328" x2="328" y1="398" y2="391" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="327" x2="327" y1="405" y2="398" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #ff0000" />
<line x1="327" x2="327" y1="398" y2="391" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="314.79632928776" x2="320.99490034517" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #ff0000" />
<line x1="320.99490034517" x2="327.19347140259" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="302.39714211483" x2="308.5967357013" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="308.5967357013" x2="314.79632928776" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #ff0000" />
<line x1="290" x2="296.19857105742" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="296.19857105742" x2="302.39714211483" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="277.60285788517" x2="283.80142894258" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="283.80142894258" x2="290" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="265.20571577033" x2="271.40428682775" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #ff0000" />
<line x1="271.40428682775" x2="277.60285788517" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="252.80755112645" x2="259.00663344839" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="259.00663344839" x2="265.20571577033" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #ff0000" />
<line x1="254" x2="254" y1="405" y2="398" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #ff0000" />
<line x1="254" x2="254" y1="398" y2="391" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="253" x2="253" y1="405" y2="398" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #ff0000" />
<line x1="253" x2="253" y1="398" y2="391" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="240.41040901162" x2="246.60898006903" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="246.60898006903" x2="252.80755112645" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="228.01326689678" x2="234.2118379542" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="234.2118379542" x2="240.41040901162" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="215.61612478195" x2="221.81469583936" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="221.81469583936" x2="228.01326689678" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="203.21693760903" x2="209.41653119549" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="209.41653119549" x2="215.61612478195" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="190.81979549419" x2="197.01836655161" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="197.01836655161" x2="203.21693760903" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="178.42265337936" x2="184.62122443677" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="184.62122443677" x2="190.81979549419" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="166.02551126452" x2="172.22408232194" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="172.22408232194" x2="178.42265337936" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="153.62734662064" x2="159.82642894258" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="159.82642894258" x2="166.02551126452" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="141" x2="147.5" y1="384" y2="387.5" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="147.5" x2="154" y1="387.5" y2="391" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="142" x2="148.5" y1="383" y2="386.5" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="148.5" x2="155" y1="386.5" y2="390" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="128.83306239097" x2="135.03163344839" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="135.03163344839" x2="141.23020450581" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="116.43592027614" x2="122.63449133356" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="122.63449133356" x2="128.83306239097" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="105" x2="111" y1="391" y2="387.5" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="111" x2="117" y1="387.5" y2="384" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="104" x2="110.5" y1="390" y2="386.5" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="110.5" x2="117" y1="386.5" y2="383" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="91.639590988383" x2="97.8381620458" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="97.8381620458" x2="104.03673310322" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="79.242448873548" x2="85.441019930965" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="85.441019930965" x2="91.639590988383" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="66.845306758713" x2="73.04387781613" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="73.04387781613" x2="79.242448873548" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="54.447142114835" x2="60.646224436774" y1="390.20784619382" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="60.646224436774" x2="66.845306758713" y1="386.62899454404" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="42.05" x2="48.248571057417" y1="383.05014289426" y2="386.62899454404" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="48.248571057417" x2="54.447142114835" y1="386.62899454404" y2="390.20784619382" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="290" x2="290" y1="368.73473629514" y2="375.8924395947" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #ff0000" />
<line x1="290" x2="290" y1="375.8924395947" y2="383.05014289426" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="277.60285788517" x2="283.80142894258" y1="361.57703299558" y2="365.15588464536" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="283.80142894258" x2="290" y1="365.15588464536" y2="368.73473629514" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #ff0000" />
<line x1="266" x2="272" y1="370" y2="366.5" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #ff0000" />
<line x1="272" x2="278" y1="366.5" y2="363" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="265" x2="271.5" y1="369" y2="365" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #ff0000" />
<line x1="271.5" x2="278" y1="365" y2="361" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="277.60285788517" x2="277.60285788517" y1="347.26162639647" y2="354.41932969602" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="277.60285788517" x2="277.60285788517" y1="354.41932969602" y2="361.57703299558" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="265.20571577033" x2="271.40428682775" y1="340.10392309691" y2="343.68277474669" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="271.40428682775" x2="277.60285788517" y1="343.68277474669" y2="347.26162639647" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="265.20571577033" x2="265.20571577033" y1="325.78851649779" y2="332.94621979735" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="265.20571577033" x2="265.20571577033" y1="332.94621979735" y2="340.10392309691" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="252.80755112645" x2="259.00663344839" y1="318.63081319823" y2="322.20966484801" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="259.00663344839" x2="265.20571577033" y1="322.20966484801" y2="325.78851649779" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="252.80755112645" x2="252.80755112645" y1="304.31540659912" y2="311.47310989867" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="252.80755112645" x2="252.80755112645" y1="311.47310989867" y2="318.63081319823" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="240.41040901162" x2="246.60898006903" y1="297.15770329956" y2="300.73655494934" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="246.60898006903" x2="252.80755112645" y1="300.73655494934" y2="304.31540659912" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="240.41040901162" x2="240.41040901162" y1="282.84229670044" y2="290" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="240.41040901162" x2="240.41040901162" y1="290" y2="297.15770329956" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="228.01326689678" x2="234.2118379542" y1="275.68459340088" y2="279.26344505066" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="234.2118379542" x2="240.41040901162" y1="279.26344505066" y2="282.84229670044" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="228" x2="228" y1="262" y2="269" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="228" x2="228" y1="269" y2="276" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="229" x2="229" y1="262" y2="269" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="229" x2="229" y1="269" y2="276" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="215.61612478195" x2="221.81469583936" y1="254.21148350221" y2="257.79033515199" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="221.81469583936" x2="228.01326689678" y1="257.79033515199" y2="261.36918680177" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="215.61612478195" x2="215.61612478195" y1="239.89607690309" y2="247.05378020265" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="215.61612478195" x2="215.61612478195" y1="247.05378020265" y2="254.21148350221" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="203" x2="209.5" y1="234" y2="237.5" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="209.5" x2="216" y1="237.5" y2="241" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="204" x2="210" y1="233" y2="236.5" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="210" x2="216" y1="236.5" y2="240" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="203.21693760903" x2="203.21693760903" y1="218.42296700442" y2="225.58067030398" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="203.21693760903" x2="203.21693760903" y1="225.58067030398" y2="232.73837360353" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="190.81979549419" x2="197.01836655161" y1="211.26526370486" y2="214.84411535464" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="197.01836655161" x2="203.21693760903" y1="214.84411535464" y2="218.42296700442" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="190.81979549419" x2="190.81979549419" y1="196.94985710574" y2="204.1075604053" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="190.81979549419" x2="190.81979549419" y1="204.1075604053" y2="211.26526370486" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="178.42265337936" x2="184.62122443677" y1="189.79215380618" y2="193.37100545596" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="184.62122443677" x2="190.81979549419" y1="193.37100545596" y2="196.94985710574" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="178.42265337936" x2="178.42265337936" y1="175.47674720707" y2="182.63445050663" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<line x1="178.42265337936" x2="178.42265337936" y1="182.63445050663" y2="189.79215380618" style="stroke-opacity:1; stroke-width: 0.60275280230615; stroke: #000000" />
<ellipse cx="327.19347140259" cy="404.52325279293" rx="3.91789321499" ry="3.91789321499" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="327.19347140259" y="407.83839320562"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:7.5344100288269px">O</text>
<ellipse cx="314.79632928776" cy="383.05014289426" rx="3.91789321499" ry="3.91789321499" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="314.79632928776" y="386.36528330694"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:7.5344100288269px">O</text>
<ellipse cx="265.20571577033" cy="383.05014289426" rx="3.91789321499" ry="3.91789321499" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="265.20571577033" y="386.36528330694"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:7.5344100288269px">O</text>
<ellipse cx="252.80755112645" cy="404.52325279293" rx="3.91789321499" ry="3.91789321499" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="252.80755112645" y="407.83839320562"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:7.5344100288269px">O</text>
<ellipse cx="290" cy="368.73473629514" rx="3.91789321499" ry="3.91789321499" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290" y="372.04987670783"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:7.5344100288269px">O</text>
<ellipse cx="265.20571577033" cy="368.73473629514" rx="3.91789321499" ry="3.91789321499" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="265.20571577033" y="372.04987670783"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:7.5344100288269px">O</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 116👍, 0💬