Molecule FYI-1001472

A

Molecule Summary:

ID: FYI-1001472
SMILES: OC(COC1=CC=CC2=C1C(C=C(C(O)=O)O2)=O)COC(COC3=CC=CC4=C3C(C=C(C(O)=O)O4)=O)COC5=CC=CC6=C5C(C=C(C(O)=O)O6)=O

Received at FYIcenter.com on: 2022-08-05

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001472
FYIcenter.com

 53 58  0  0  0  0  0  0  0  0999 V2000
    9.6996    4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6996    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5493    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7617    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7617    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5493    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368   11.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5493   13.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244   13.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5493   10.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    8.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    9.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   11.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747   13.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623   11.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8499   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   11.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249   13.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249   14.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125   12.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8499   13.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8499    9.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8499    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    7.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    2.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8499    4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 10  5  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 14  2  0  0  0  0
 17 13  1  0  0  0  0
 17  9  1  0  0  0  0
 18 11  2  0  0  0  0
 19  2  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  2  0  0  0  0
 26 25  1  0  0  0  0
 27 26  2  0  0  0  0
 28 27  1  0  0  0  0
 29 28  2  0  0  0  0
 29 24  1  0  0  0  0
 30 29  1  0  0  0  0
 31 30  1  0  0  0  0
 32 31  2  0  0  0  0
 33 32  1  0  0  0  0
 34 33  1  0  0  0  0
 35 33  2  0  0  0  0
 36 32  1  0  0  0  0
 36 28  1  0  0  0  0
 37 30  2  0  0  0  0
 38 21  1  0  0  0  0
 39 38  1  0  0  0  0
 40 39  1  0  0  0  0
 41 40  2  0  0  0  0
 42 41  1  0  0  0  0
 43 42  2  0  0  0  0
 44 43  1  0  0  0  0
 45 44  2  0  0  0  0
 45 40  1  0  0  0  0
 46 45  1  0  0  0  0
 47 46  1  0  0  0  0
 48 47  2  0  0  0  0
 49 48  1  0  0  0  0
 50 49  1  0  0  0  0
 51 49  2  0  0  0  0
 52 48  1  0  0  0  0
 52 44  1  0  0  0  0
 53 46  2  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="347.22213498544" x2="347.22213498544" y1="256.96454062696" y2="234.94090104494" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="347.22213498544" x2="347.22213498544" y1="234.94090104494" y2="212.91726146291" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="385.36707874151" x2="366.29460686347" y1="278.98818020899" y2="267.97636041798" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="366.29460686347" x2="347.22213498544" y1="267.97636041798" y2="256.96454062696" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="423.51202249757" x2="404.43955061954" y1="256.96454062696" y2="267.97636041798" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="404.43955061954" x2="385.36707874151" y1="267.97636041798" y2="278.98818020899" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="461.65696625364" x2="442.58449437561" y1="278.98818020899" y2="267.97636041798" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="442.58449437561" x2="423.51202249757" y1="267.97636041798" y2="256.96454062696" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="499" x2="480" y1="255" y2="266" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="480" x2="461" y1="266" y2="277" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="501" x2="482" y1="259" y2="270" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="482" x2="463" y1="270" y2="281" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="537.95" x2="518.87752812197" y1="278.98818020899" y2="267.97636041798" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="518.87752812197" x2="499.80505624393" y1="267.97636041798" y2="256.96454062696" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="541" x2="541" y1="324" y2="301.5" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="541" x2="541" y1="301.5" y2="279" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="536" x2="536" y1="324" y2="301.5" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="536" x2="536" y1="301.5" y2="279" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="499.80505624393" x2="518.87752812197" y1="345.05909895506" y2="334.04727916405" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="518.87752812197" x2="537.95" y1="334.04727916405" y2="323.03545937304" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="461" x2="480" y1="326" y2="337" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="480" x2="499" y1="337" y2="348" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="463" x2="482" y1="322" y2="333" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="482" x2="501" y1="333" y2="344" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="461.65696625364" x2="461.65696625364" y1="323.03545937304" y2="301.01181979101" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="461.65696625364" x2="461.65696625364" y1="301.01181979101" y2="278.98818020899" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="423.51202249757" x2="442.58449437561" y1="345.05909895506" y2="334.04727916405" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="442.58449437561" x2="461.65696625364" y1="334.04727916405" y2="323.03545937304" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="423.51202249757" x2="423.51202249757" y1="389.10637811911" y2="367.08273853709" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="423.51202249757" x2="423.51202249757" y1="367.08273853709" y2="345.05909895506" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="463" x2="444" y1="410" y2="399" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="444" x2="425" y1="399" y2="388" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="461" x2="442" y1="414" y2="403" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="442" x2="423" y1="403" y2="392" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="461.65696625364" x2="461.65696625364" y1="455.17729686519" y2="433.15365728316" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="461.65696625364" x2="461.65696625364" y1="433.15365728316" y2="411.13001770114" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="499.80505624393" x2="480.73101124879" y1="477.20093644721" y2="466.1891166562" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="480.73101124879" x2="461.65696625364" y1="466.1891166562" y2="455.17729686519" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="425" x2="444" y1="480" y2="469" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="444" x2="463" y1="469" y2="458" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="423" x2="442" y1="476" y2="465" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="442" x2="461" y1="465" y2="454" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="499.80505624393" x2="480.73101124879" y1="389.10637811911" y2="400.11819791012" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="480.73101124879" x2="461.65696625364" y1="400.11819791012" y2="411.13001770114" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="499.80505624393" x2="499.80505624393" y1="389.10637811911" y2="367.08273853709" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="499.80505624393" x2="499.80505624393" y1="367.08273853709" y2="345.05909895506" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="385" x2="404" y1="326" y2="337" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="404" x2="423" y1="337" y2="348" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="387" x2="406" y1="322" y2="333" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="406" x2="425" y1="333" y2="344" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="309.07404499515" x2="328.14808999029" y1="278.98818020899" y2="267.97636041798" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="328.14808999029" x2="347.22213498544" y1="267.97636041798" y2="256.96454062696" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="270.92910123908" x2="290.00157311711" y1="256.96454062696" y2="267.97636041798" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="290.00157311711" x2="309.07404499515" y1="267.97636041798" y2="278.98818020899" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="232.78415748301" x2="251.85662936105" y1="278.98818020899" y2="267.97636041798" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="251.85662936105" x2="270.92910123908" y1="267.97636041798" y2="256.96454062696" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="232.78415748301" x2="232.78415748301" y1="323.03545937304" y2="301.01181979101" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="232.78415748301" x2="232.78415748301" y1="301.01181979101" y2="278.98818020899" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="270.92910123908" x2="251.85662936105" y1="345.05909895506" y2="334.04727916405" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="251.85662936105" x2="232.78415748301" y1="334.04727916405" y2="323.03545937304" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="270.92910123908" x2="270.92910123908" y1="389.10637811911" y2="367.08273853709" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="270.92910123908" x2="270.92910123908" y1="367.08273853709" y2="345.05909895506" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="311" x2="292" y1="410" y2="399" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="292" x2="273" y1="399" y2="388" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="308" x2="289" y1="414" y2="403" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="289" x2="270" y1="403" y2="392" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="309.07404499515" x2="309.07404499515" y1="455.17729686519" y2="433.15365728316" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="309.07404499515" x2="309.07404499515" y1="433.15365728316" y2="411.13001770114" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="273" x2="292" y1="480" y2="469" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="292" x2="311" y1="469" y2="458" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="270" x2="289" y1="476" y2="465" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="289" x2="308" y1="465" y2="454" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="232.78415748301" x2="251.85662936105" y1="455.17729686519" y2="466.1891166562" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="251.85662936105" x2="270.92910123908" y1="466.1891166562" y2="477.20093644721" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="231" x2="231" y1="412" y2="434" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="231" x2="231" y1="434" y2="456" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="236" x2="236" y1="412" y2="434" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="236" x2="236" y1="434" y2="456" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="232.78415748301" x2="251.85662936105" y1="411.13001770114" y2="400.11819791012" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="251.85662936105" x2="270.92910123908" y1="400.11819791012" y2="389.10637811911" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="194.63921372695" x2="213.71168560498" y1="389.10637811911" y2="400.11819791012" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="213.71168560498" x2="232.78415748301" y1="400.11819791012" y2="411.13001770114" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="156.48797750243" x2="175.56359561469" y1="411.13001770114" y2="400.11819791012" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="175.56359561469" x2="194.63921372695" y1="400.11819791012" y2="389.10637811911" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="159" x2="159" y1="456" y2="434" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="159" x2="159" y1="434" y2="412" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="155" x2="155" y1="456" y2="434" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="155" x2="155" y1="434" y2="412" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="118.34303374636" x2="137.41550562439" y1="477.20093644721" y2="466.1891166562" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="137.41550562439" x2="156.48797750243" y1="466.1891166562" y2="455.17729686519" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="118.34303374636" x2="118.34303374636" y1="521.24821561126" y2="499.22457602924" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="118.34303374636" x2="118.34303374636" y1="499.22457602924" y2="477.20093644721" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="80" x2="99" y1="458" y2="469" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="99" x2="118" y1="469" y2="480" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="82" x2="101" y1="454" y2="465" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="101" x2="120" y1="465" y2="476" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="194.63921372695" x2="175.56359561469" y1="477.20093644721" y2="466.1891166562" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="175.56359561469" x2="156.48797750243" y1="466.1891166562" y2="455.17729686519" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="194.63921372695" x2="213.71168560498" y1="477.20093644721" y2="466.1891166562" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="213.71168560498" x2="232.78415748301" y1="466.1891166562" y2="455.17729686519" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="193" x2="193" y1="346" y2="368" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="193" x2="193" y1="368" y2="390" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="197" x2="197" y1="346" y2="368" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="197" x2="197" y1="368" y2="390" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="194.63921372695" x2="213.71168560498" y1="256.96454062696" y2="267.97636041798" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="213.71168560498" x2="232.78415748301" y1="267.97636041798" y2="278.98818020899" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="156.48797750243" x2="175.56359561469" y1="278.98818020899" y2="267.97636041798" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="175.56359561469" x2="194.63921372695" y1="267.97636041798" y2="256.96454062696" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="118.34303374636" x2="137.41550562439" y1="256.96454062696" y2="267.97636041798" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="137.41550562439" x2="156.48797750243" y1="267.97636041798" y2="278.98818020899" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="82" x2="101" y1="281" y2="270" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="101" x2="120" y1="270" y2="259" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="80" x2="99" y1="277" y2="266" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="99" x2="118" y1="266" y2="255" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="42.05" x2="61.124044995146" y1="256.96454062696" y2="267.97636041798" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="61.124044995146" x2="80.198089990293" y1="267.97636041798" y2="278.98818020899" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="40" x2="40" y1="213" y2="235" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="40" x2="40" y1="235" y2="257" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="45" x2="45" y1="213" y2="235" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="45" x2="45" y1="235" y2="257" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="80.198089990293" x2="61.124044995146" y1="190.89362188089" y2="201.9054416719" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="61.124044995146" x2="42.05" y1="201.9054416719" y2="212.91726146291" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="120" x2="101" y1="211" y2="200" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="101" x2="82" y1="200" y2="189" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="118" x2="99" y1="215" y2="204" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="99" x2="80" y1="204" y2="193" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="118.34303374636" x2="118.34303374636" y1="212.91726146291" y2="234.94090104494" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="118.34303374636" x2="118.34303374636" y1="234.94090104494" y2="256.96454062696" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="156.48797750243" x2="137.41550562439" y1="190.89362188089" y2="201.9054416719" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="137.41550562439" x2="118.34303374636" y1="201.9054416719" y2="212.91726146291" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="156.48797750243" x2="156.48797750243" y1="146.84634271684" y2="168.86998229886" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="156.48797750243" x2="156.48797750243" y1="168.86998229886" y2="190.89362188089" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="118" x2="137" y1="127" y2="138" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="137" x2="156" y1="138" y2="149" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="120" x2="139" y1="123" y2="134" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="139" x2="158" y1="134" y2="145" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="118.34303374636" x2="118.34303374636" y1="80.775423970765" y2="102.79906355279" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="118.34303374636" x2="118.34303374636" y1="102.79906355279" y2="124.82270313481" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="80.198089990293" x2="99.270561868326" y1="58.75178438874" y2="69.763604179752" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="99.270561868326" x2="118.34303374636" y1="69.763604179752" y2="80.775423970765" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="156" x2="137" y1="57" y2="68" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="137" x2="118" y1="68" y2="79" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="158" x2="139" y1="61" y2="72" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="139" x2="120" y1="72" y2="83" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="80.198089990293" x2="99.270561868326" y1="146.84634271684" y2="135.83452292583" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="99.270561868326" x2="118.34303374636" y1="135.83452292583" y2="124.82270313481" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="80.198089990293" x2="80.198089990293" y1="146.84634271684" y2="168.86998229886" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="80.198089990293" x2="80.198089990293" y1="168.86998229886" y2="190.89362188089" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="196" x2="177" y1="211" y2="200" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="177" x2="158" y1="200" y2="189" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<line x1="194" x2="175" y1="215" y2="204" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #ff0000" />
<line x1="175" x2="156" y1="204" y2="193" style="stroke-opacity:1; stroke-width: 1.8546194992004; stroke: #000000" />
<ellipse cx="347.22213498544" cy="212.91726146291" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="347.22213498544" y="223.11766870852"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="423.51202249757" cy="256.96454062696" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="423.51202249757" y="267.16494787257"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="499.80505624393" cy="477.20093644721" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="499.80505624393" y="487.40134369281"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="423.51202249757" cy="477.20093644721" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="423.51202249757" y="487.40134369281"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="499.80505624393" cy="389.10637811911" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="499.80505624393" y="399.30678536471"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="385.36707874151" cy="323.03545937304" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="385.36707874151" y="333.23586661864"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="270.92910123908" cy="256.96454062696" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="270.92910123908" y="267.16494787257"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="270.92910123908" cy="345.05909895506" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="270.92910123908" y="355.25950620066"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="118.34303374636" cy="521.24821561126" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="118.34303374636" y="531.44862285686"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="80.198089990293" cy="455.17729686519" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="80.198089990293" y="465.37770411079"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="194.63921372695" cy="477.20093644721" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="194.63921372695" y="487.40134369281"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="194.63921372695" cy="345.05909895506" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="194.63921372695" y="355.25950620066"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="156.48797750243" cy="278.98818020899" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="156.48797750243" y="289.18858745459"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="80.198089990293" cy="58.75178438874" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="80.198089990293" y="68.952191634342"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="156.48797750243" cy="58.75178438874" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="156.48797750243" y="68.952191634342"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="80.198089990293" cy="146.84634271684" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="80.198089990293" y="157.04674996244"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
<ellipse cx="194.63921372695" cy="212.91726146291" rx="12.055026744803" ry="12.055026744803" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="194.63921372695" y="223.11766870852"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182743740006px">O</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 131👍, 0💬