Molecule FYI-1001468

A

Molecule Summary:

ID: FYI-1001468
SMILES: C1=C(C(=CC=C1C=CC(C(C(C=CC2=CC=C(C(=C2)OC)O)=O)CC3=CC=C(C(=C3)O)OC)=O)O)OC

Received at FYIcenter.com on: 2022-08-03

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001468
FYIcenter.com

 37 39  0  0  0  0  0  0  0  0999 V2000
   14.5492    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7617    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7617    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    7.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    7.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9741    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9741    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1865    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  6  1  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 19 14  1  0  0  0  0
 20 18  1  0  0  0  0
 21 20  1  0  0  0  0
 22 17  1  0  0  0  0
 23 11  2  0  0  0  0
 24 10  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 27 26  1  0  0  0  0
 28 27  2  0  0  0  0
 29 28  1  0  0  0  0
 30 29  2  0  0  0  0
 30 25  1  0  0  0  0
 31 29  1  0  0  0  0
 32 28  1  0  0  0  0
 33 32  1  0  0  0  0
 34  9  2  0  0  0  0
 35  3  1  0  0  0  0
 36  2  1  0  0  0  0
 37 36  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="471" x2="454.5" y1="336" y2="346" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="454.5" x2="438" y1="346" y2="356" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="473" x2="456.5" y1="340" y2="349.5" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="456.5" x2="440" y1="349.5" y2="359" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="471.83181783191" x2="471.83181783191" y1="299.54361751849" y2="318.63085255547" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="471.83181783191" x2="471.83181783191" y1="318.63085255547" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="438" x2="454.5" y1="283" y2="292.5" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="454.5" x2="471" y1="292.5" y2="302" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="440" x2="456.5" y1="279" y2="288.5" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="456.5" x2="473" y1="288.5" y2="298" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="405.71090891595" x2="422.24045445798" y1="299.54361751849" y2="290" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="422.24045445798" x2="438.77" y1="290" y2="280.45638248151" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="408" x2="408" y1="338" y2="319" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="408" x2="408" y1="319" y2="300" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="404" x2="404" y1="338" y2="319" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="404" x2="404" y1="319" y2="300" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="405.71090891595" x2="422.24045445798" y1="337.71808759244" y2="347.26170511093" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="422.24045445798" x2="438.77" y1="347.26170511093" y2="356.80532262942" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="372.65181783191" x2="389.18136337393" y1="356.80532262942" y2="347.26170511093" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="389.18136337393" x2="405.71090891595" y1="347.26170511093" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="339" x2="355.5" y1="340" y2="349.5" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="355.5" x2="372" y1="349.5" y2="359" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="341" x2="357.5" y1="336" y2="346" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="357.5" x2="374" y1="346" y2="356" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="306.53090891595" x2="323.06181783191" y1="356.80532262942" y2="347.26170511093" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="323.06181783191" x2="339.59272674786" y1="347.26170511093" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="273.47181783191" x2="290.00136337393" y1="337.71808759244" y2="347.26170511093" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="290.00136337393" x2="306.53090891595" y1="347.26170511093" y2="356.80532262942" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="240.41272674786" x2="256.94227228989" y1="356.80532262942" y2="347.26170511093" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="256.94227228989" x2="273.47181783191" y1="347.26170511093" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="207.35363566382" x2="223.88318120584" y1="337.71808759244" y2="347.26170511093" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="223.88318120584" x2="240.41272674786" y1="347.26170511093" y2="356.80532262942" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="176" x2="192.5" y1="359" y2="349.5" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="192.5" x2="209" y1="349.5" y2="340" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="174" x2="190.5" y1="356" y2="346" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="190.5" x2="207" y1="346" y2="336" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="141.23" x2="157.75954554202" y1="337.71808759244" y2="347.26170511093" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="157.75954554202" x2="174.28909108405" y1="347.26170511093" y2="356.80532262942" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="110" x2="126.5" y1="359" y2="349.5" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="126.5" x2="143" y1="349.5" y2="340" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="108" x2="124.5" y1="356" y2="346" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="124.5" x2="141" y1="346" y2="336" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="75.109091084046" x2="91.64" y1="337.71808759244" y2="347.26170511093" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="91.64" x2="108.17090891595" y1="347.26170511093" y2="356.80532262942" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="74" x2="74" y1="300" y2="319" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="74" x2="74" y1="319" y2="338" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="78" x2="78" y1="300" y2="319" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="78" x2="78" y1="319" y2="338" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="108.17090891595" x2="91.64" y1="280.45638248151" y2="290" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="91.64" x2="75.109091084046" y1="290" y2="299.54361751849" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="143" x2="126.5" y1="298" y2="288.5" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="126.5" x2="110" y1="288.5" y2="279" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="141" x2="124.5" y1="302" y2="292.5" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="124.5" x2="108" y1="292.5" y2="283" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="141.23" x2="141.23" y1="299.54361751849" y2="318.63085255547" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="141.23" x2="141.23" y1="318.63085255547" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="108.17090891595" x2="108.17090891595" y1="242.28191240756" y2="261.36914744453" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #ff0000" />
<line x1="108.17090891595" x2="108.17090891595" y1="261.36914744453" y2="280.45638248151" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="141.23" x2="124.70045445798" y1="223.19467737058" y2="232.73829488907" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="124.70045445798" x2="108.17090891595" y1="232.73829488907" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #ff0000" />
<line x1="42.05" x2="58.579545542023" y1="280.45638248151" y2="290" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #ff0000" />
<line x1="58.579545542023" x2="75.109091084046" y1="290" y2="299.54361751849" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="243" x2="243" y1="395" y2="376" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #ff0000" />
<line x1="243" x2="243" y1="376" y2="357" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="239" x2="239" y1="395" y2="376" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #ff0000" />
<line x1="239" x2="239" y1="376" y2="357" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="273.47181783191" x2="273.47181783191" y1="299.54361751849" y2="318.63085255547" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="273.47181783191" x2="273.47181783191" y1="318.63085255547" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="306.53090891595" x2="290.00136337393" y1="280.45638248151" y2="290" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="290.00136337393" x2="273.47181783191" y1="290" y2="299.54361751849" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="341" x2="324.5" y1="298" y2="288.5" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="324.5" x2="308" y1="288.5" y2="279" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="339" x2="322.5" y1="302" y2="292.5" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="322.5" x2="306" y1="292.5" y2="283" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="372.65181783191" x2="356.12227228989" y1="280.45638248151" y2="290" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="356.12227228989" x2="339.59272674786" y1="290" y2="299.54361751849" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="371" x2="371" y1="243" y2="262" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="371" x2="371" y1="262" y2="281" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="375" x2="375" y1="243" y2="262" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="375" x2="375" y1="262" y2="281" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="339.59272674786" x2="356.12227228989" y1="223.19467737058" y2="232.73829488907" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="356.12227228989" x2="372.65181783191" y1="232.73829488907" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="308" x2="324.5" y1="245" y2="235" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="324.5" x2="341" y1="235" y2="225" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="306" x2="322.5" y1="241" y2="231.5" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="322.5" x2="339" y1="231.5" y2="222" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="306.53090891595" x2="306.53090891595" y1="242.28191240756" y2="261.36914744453" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="306.53090891595" x2="306.53090891595" y1="261.36914744453" y2="280.45638248151" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="339.59272674786" x2="339.59272674786" y1="185.02020729662" y2="204.1074423336" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #ff0000" />
<line x1="339.59272674786" x2="339.59272674786" y1="204.1074423336" y2="223.19467737058" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="405.71090891595" x2="389.18136337393" y1="223.19467737058" y2="232.73829488907" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #ff0000" />
<line x1="389.18136337393" x2="372.65181783191" y1="232.73829488907" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="405.71090891595" x2="405.71090891595" y1="185.02020729662" y2="204.1074423336" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="405.71090891595" x2="405.71090891595" y1="204.1074423336" y2="223.19467737058" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #ff0000" />
<line x1="309" x2="309" y1="395" y2="376" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #ff0000" />
<line x1="309" x2="309" y1="376" y2="357" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="305" x2="305" y1="395" y2="376" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #ff0000" />
<line x1="305" x2="305" y1="376" y2="357" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="504.89090891595" x2="488.36136337393" y1="280.45638248151" y2="290" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #ff0000" />
<line x1="488.36136337393" x2="471.83181783191" y1="290" y2="299.54361751849" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="504.89090891595" x2="488.36136337393" y1="356.80532262942" y2="347.26170511093" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #ff0000" />
<line x1="488.36136337393" x2="471.83181783191" y1="347.26170511093" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="537.95" x2="521.42045445798" y1="337.71808759244" y2="347.26170511093" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #000000" />
<line x1="521.42045445798" x2="504.89090891595" y1="347.26170511093" y2="356.80532262942" style="stroke-opacity:1; stroke-width: 1.6073515462854; stroke: #ff0000" />
<ellipse cx="108.17090891595" cy="242.28191240756" rx="10.447785050855" ry="10.447785050855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="108.17090891595" y="251.12234591212"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.091894328568px">O</text>
<ellipse cx="42.05" cy="280.45638248151" rx="10.447785050855" ry="10.447785050855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="289.29681598608"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.091894328568px">O</text>
<ellipse cx="240.41272674786" cy="394.97979270338" rx="10.447785050855" ry="10.447785050855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.41272674786" y="403.82022620795"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.091894328568px">O</text>
<ellipse cx="339.59272674786" cy="185.02020729662" rx="10.447785050855" ry="10.447785050855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.59272674786" y="193.86064080119"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.091894328568px">O</text>
<ellipse cx="405.71090891595" cy="223.19467737058" rx="10.447785050855" ry="10.447785050855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="405.71090891595" y="232.03511087515"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.091894328568px">O</text>
<ellipse cx="306.53090891595" cy="394.97979270338" rx="10.447785050855" ry="10.447785050855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="306.53090891595" y="403.82022620795"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.091894328568px">O</text>
<ellipse cx="504.89090891595" cy="280.45638248151" rx="10.447785050855" ry="10.447785050855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="504.89090891595" y="289.29681598608"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.091894328568px">O</text>
<ellipse cx="504.89090891595" cy="356.80532262942" rx="10.447785050855" ry="10.447785050855" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="504.89090891595" y="365.64575613399"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.091894328568px">O</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 133👍, 0💬