Molecule FYI-1001466

A

Molecule Summary:

ID: FYI-1001466
SMILES: C12(Cl)C3(Cl)C(=O)C4(Cl)C1(Cl)C5(Cl)C(Cl)(Cl)C2(Cl)C3(Cl)C45Cl

Received at FYIcenter.com on: 2022-08-01

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001466
FYIcenter.com

 21 25  0  0  0  0  0  0  0  0999 V2000
    2.5874    2.3954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6734    1.7695    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.5227    3.1296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3961    4.0636    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.8464    2.3496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6778    2.8456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2597    1.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0081    0.3463    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.0720    1.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1653    0.0227    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.6543    1.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1143    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.0597    2.0896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0622    2.7372    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5496    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.8973    3.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0346    4.0615    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.8217    3.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5748    5.1549    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.8072    3.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8324    4.0608    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  1  1  0  0  0  0
  4  3  1  0  0  0  0
  5  3  1  0  0  0  0
  6  5  2  0  0  0  0
  7  5  1  0  0  0  0
  8  7  1  0  0  0  0
  9  7  1  0  0  0  0
  9  1  1  0  0  0  0
 10  9  1  0  0  0  0
 11  9  1  0  0  0  0
 12 11  1  0  0  0  0
 13 11  1  0  0  0  0
 14 13  1  0  0  0  0
 15 13  1  0  0  0  0
 16 13  1  0  0  0  0
 16  1  1  0  0  0  0
 17 16  1  0  0  0  0
 18 16  1  0  0  0  0
 18  3  1  0  0  0  0
 19 18  1  0  0  0  0
 20 18  1  0  0  0  0
 20  7  1  0  0  0  0
 20 11  1  0  0  0  0
 21 20  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="184.33088951375" x2="223.18732940128" y1="221.3040249297" y2="247.91260887456" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #00bc00" />
<line x1="223.18732940128" x2="262.0437692888" y1="247.91260887456" y2="274.52119281942" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="341.56768225773" x2="301.80572577327" y1="336.94657173719" y2="305.73388227831" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="301.80572577327" x2="262.0437692888" y1="305.73388227831" y2="274.52119281942" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="415.82854571017" x2="378.69811398395" y1="416.35995216377" y2="376.65326195048" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #00bc00" />
<line x1="378.69811398395" x2="341.56768225773" y1="376.65326195048" y2="336.94657173719" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="454.11531787943" x2="397.84150006858" y1="270.62704632741" y2="303.7868090323" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="397.84150006858" x2="341.56768225773" y1="303.7868090323" y2="336.94657173719" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="529" x2="493.5" y1="307" y2="286" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #ff0000" />
<line x1="493.5" x2="458" y1="286" y2="265" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="522" x2="486.5" y1="319" y2="298" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #ff0000" />
<line x1="486.5" x2="451" y1="298" y2="277" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="404.23113126672" x2="429.17322457307" y1="178.89353868047" y2="224.76029250394" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="429.17322457307" x2="454.11531787943" y1="224.76029250394" y2="270.62704632741" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="467.86386564707" x2="436.0474984569" y1="100.29639856663" y2="139.59496862355" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #00bc00" />
<line x1="436.0474984569" x2="404.23113126672" y1="139.59496862355" y2="178.89353868047" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="303.24690007544" x2="353.73901567108" y1="173.59647915095" y2="176.24500891571" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="353.73901567108" x2="404.23113126672" y1="176.24500891571" y2="178.89353868047" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="303.24690007544" x2="282.64533468212" y1="173.59647915095" y2="224.05883598519" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="282.64533468212" x2="262.0437692888" y1="224.05883598519" y2="274.52119281942" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="311.17973561484" x2="307.21331784514" y1="72.782298024827" y2="123.18938858789" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #00bc00" />
<line x1="307.21331784514" x2="303.24690007544" y1="123.18938858789" y2="173.59647915095" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="182.70691139154" x2="242.97690573349" y1="160.9532568068" y2="167.27486797888" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="242.97690573349" x2="303.24690007544" y1="167.27486797888" y2="173.59647915095" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="136.79339380015" x2="159.75015259584" y1="70.852229785337" y2="115.90274329607" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #00bc00" />
<line x1="159.75015259584" x2="182.70691139154" y1="115.90274329607" y2="160.9532568068" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="132.15102702147" x2="157.4289692065" y1="248.52053785749" y2="204.73689733214" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="157.4289692065" x2="182.70691139154" y1="204.73689733214" y2="160.9532568068" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="47.338557026267" x2="89.744792023867" y1="303.58274895412" y2="276.0516434058" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #00bc00" />
<line x1="89.744792023867" x2="132.15102702147" y1="276.0516434058" y2="248.52053785749" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="42.05" x2="87.100513510733" y1="202.6070202661" y2="225.56377906179" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #00bc00" />
<line x1="87.100513510733" x2="132.15102702147" y1="225.56377906179" y2="248.52053785749" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="203.36799430766" x2="167.75951066456" y1="346.57990792813" y2="297.55022289281" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="167.75951066456" x2="132.15102702147" y1="297.55022289281" y2="248.52053785749" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="203.36799430766" x2="232.70588179823" y1="346.57990792813" y2="310.55055037377" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="232.70588179823" x2="262.0437692888" y1="310.55055037377" y2="274.52119281942" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="130.01689870379" x2="166.69244650573" y1="416.18139959536" y2="381.38065376174" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #00bc00" />
<line x1="166.69244650573" x2="203.36799430766" y1="381.38065376174" y2="346.57990792813" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="281.96513442151" x2="242.66656436458" y1="410.229647315" y2="378.40477762156" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="242.66656436458" x2="203.36799430766" y1="378.40477762156" y2="346.57990792813" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="281.96513442151" x2="311.76640833962" y1="410.229647315" y2="373.5881095261" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="311.76640833962" x2="341.56768225773" y1="373.5881095261" y2="336.94657173719" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="260.97245387833" x2="271.46879414992" y1="509.14777021466" y2="459.68870876483" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #00bc00" />
<line x1="271.46879414992" x2="281.96513442151" y1="459.68870876483" y2="410.229647315" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="450.78233660243" x2="366.37373551197" y1="364.87729493862" y2="387.55347112681" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="366.37373551197" x2="281.96513442151" y1="387.55347112681" y2="410.229647315" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="450.78233660243" x2="427.50673393457" y1="364.87729493862" y2="271.88541680955" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="427.50673393457" x2="404.23113126672" y1="271.88541680955" y2="178.89353868047" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="450.78233660243" x2="316.74462399698" y1="364.87729493862" y2="262.91527587271" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="316.74462399698" x2="182.70691139154" y1="262.91527587271" y2="160.9532568068" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<line x1="537.95" x2="494.36616830121" y1="416.12188207256" y2="390.49958850559" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #00bc00" />
<line x1="494.36616830121" x2="450.78233660243" y1="390.49958850559" y2="364.87729493862" style="stroke-opacity:1; stroke-width: 5.6591434654639; stroke: #000000" />
<ellipse cx="184.33088951375" cy="221.3040249297" rx="36.784432525515" ry="36.784432525515" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="184.33088951375" y="252.42931398975"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:70.739293318299px">Cl</text>
<ellipse cx="415.82854571017" cy="416.35995216377" rx="36.784432525515" ry="36.784432525515" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="415.82854571017" y="447.48524122383"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:70.739293318299px">Cl</text>
<ellipse cx="524.80512996365" cy="312.79946248543" rx="36.784432525515" ry="36.784432525515" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="524.80512996365" y="343.92475154548"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:70.739293318299px">O</text>
<ellipse cx="467.86386564707" cy="100.29639856663" rx="36.784432525515" ry="36.784432525515" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="467.86386564707" y="131.42168762668"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:70.739293318299px">Cl</text>
<ellipse cx="311.17973561484" cy="72.782298024827" rx="36.784432525515" ry="36.784432525515" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="311.17973561484" y="103.90758708488"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:70.739293318299px">Cl</text>
<ellipse cx="136.79339380015" cy="70.852229785337" rx="36.784432525515" ry="36.784432525515" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="136.79339380015" y="101.97751884539"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:70.739293318299px">Cl</text>
<ellipse cx="47.338557026267" cy="303.58274895412" rx="36.784432525515" ry="36.784432525515" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="47.338557026267" y="334.70803801417"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:70.739293318299px">Cl</text>
<ellipse cx="42.05" cy="202.6070202661" rx="36.784432525515" ry="36.784432525515" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="233.73230932615"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:70.739293318299px">Cl</text>
<ellipse cx="130.01689870379" cy="416.18139959536" rx="36.784432525515" ry="36.784432525515" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="130.01689870379" y="447.30668865542"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:70.739293318299px">Cl</text>
<ellipse cx="260.97245387833" cy="509.14777021466" rx="36.784432525515" ry="36.784432525515" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="260.97245387833" y="540.27305927471"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:70.739293318299px">Cl</text>
<ellipse cx="537.95" cy="416.12188207256" rx="36.784432525515" ry="36.784432525515" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="447.24717113261"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:70.739293318299px">Cl</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 131👍, 0💬