Molecule FYI-1001467

A

Molecule Summary:

ID: FYI-1001467
SMILES: OCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)CO

Received at FYIcenter.com on: 2022-08-02

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001467
FYIcenter.com

 18 17  0  0  0  0  0  0  0  0999 V2000
    6.2498    6.1125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0374    5.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0374    4.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4374    4.0124    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.7373    2.8000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8249    3.3124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6125    4.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3125    5.2248    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.9125    5.2248    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.4000    3.3124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3124    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.7000    4.5248    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.4000    1.9124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6125    1.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3125    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.9125    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8249    1.9124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0374    1.2124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  3  1  0  0  0  0
  6  3  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  7  1  0  0  0  0
 10  7  1  0  0  0  0
 11 10  1  0  0  0  0
 12 10  1  0  0  0  0
 13 10  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 14  1  0  0  0  0
 17 14  1  0  0  0  0
 18 17  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="430.10211110075" x2="476.80024699413" y1="471.50414530711" y2="498.46996924224" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="476.80024699413" x2="523.4983828875" y1="498.46996924224" y2="525.43579317737" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #ff0000" />
<line x1="430.10211110075" x2="430.10211110075" y1="363.65625640787" y2="417.58020085749" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="430.10211110075" x2="430.10211110075" y1="417.58020085749" y2="471.50414530711" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="537.95" x2="484.02605555038" y1="363.65625640787" y2="363.65625640787" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #00bc00" />
<line x1="484.02605555038" x2="430.10211110075" y1="363.65625640787" y2="363.65625640787" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="484.01835212974" x2="457.06023161525" y1="270.25998462112" y2="316.95812051449" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #00bc00" />
<line x1="457.06023161525" x2="430.10211110075" y1="316.95812051449" y2="363.65625640787" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="336.69813589337" x2="383.40012349706" y1="309.73231195824" y2="336.69428418306" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #ff0000" />
<line x1="383.40012349706" x2="430.10211110075" y1="336.69428418306" y2="363.65625640787" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="243.30186410663" x2="290" y1="363.65625640787" y2="336.69428418306" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="290" x2="336.69813589337" y1="336.69428418306" y2="309.73231195824" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #ff0000" />
<line x1="297.22580855625" x2="270.26383633144" y1="457.05252819461" y2="410.35439230124" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #00bc00" />
<line x1="270.26383633144" x2="243.30186410663" y1="410.35439230124" y2="363.65625640787" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="189.377919657" x2="216.33989188182" y1="457.05252819461" y2="410.35439230124" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #00bc00" />
<line x1="216.33989188182" x2="243.30186410663" y1="410.35439230124" y2="363.65625640787" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="149.89788889925" x2="196.59987650294" y1="309.73231195824" y2="336.69428418306" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="196.59987650294" x2="243.30186410663" y1="336.69428418306" y2="363.65625640787" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="42.05" x2="95.973944449623" y1="309.73231195824" y2="309.73231195824" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #00bc00" />
<line x1="95.973944449623" x2="149.89788889925" y1="309.73231195824" y2="309.73231195824" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="95.973944449623" x2="122.93591667443" y1="403.12858374499" y2="356.43044785162" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #00bc00" />
<line x1="122.93591667443" x2="149.89788889925" y1="356.43044785162" y2="309.73231195824" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="149.89788889925" x2="149.89788889925" y1="201.884423059" y2="255.80836750862" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #ff0000" />
<line x1="149.89788889925" x2="149.89788889925" y1="255.80836750862" y2="309.73231195824" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="243.30186410663" x2="196.59987650294" y1="147.96047860938" y2="174.92245083419" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="196.59987650294" x2="149.89788889925" y1="174.92245083419" y2="201.884423059" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #ff0000" />
<line x1="297.22580855625" x2="270.26383633144" y1="54.56420682263" y2="101.262342716" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #00bc00" />
<line x1="270.26383633144" x2="243.30186410663" y1="101.262342716" y2="147.96047860938" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="189.377919657" x2="216.33989188182" y1="54.56420682263" y2="101.262342716" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #00bc00" />
<line x1="216.33989188182" x2="243.30186410663" y1="101.262342716" y2="147.96047860938" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="336.69813589337" x2="290" y1="201.884423059" y2="174.92245083419" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="290" x2="243.30186410663" y1="174.92245083419" y2="147.96047860938" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<line x1="430.10211110075" x2="383.40012349706" y1="147.96047860938" y2="174.92245083419" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #ff0000" />
<line x1="383.40012349706" x2="336.69813589337" y1="174.92245083419" y2="201.884423059" style="stroke-opacity:1; stroke-width: 4.5409907749649; stroke: #000000" />
<ellipse cx="523.4983828875" cy="525.43579317737" rx="29.516440037272" ry="29.516440037272" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="523.4983828875" y="550.41124243968"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:56.762384687061px">O</text>
<ellipse cx="537.95" cy="363.65625640787" rx="29.516440037272" ry="29.516440037272" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="388.63170567017"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:56.762384687061px">F</text>
<ellipse cx="484.01835212974" cy="270.25998462112" rx="29.516440037272" ry="29.516440037272" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="484.01835212974" y="295.23543388343"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:56.762384687061px">F</text>
<ellipse cx="336.69813589337" cy="309.73231195824" rx="29.516440037272" ry="29.516440037272" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="336.69813589337" y="334.70776122055"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:56.762384687061px">O</text>
<ellipse cx="297.22580855625" cy="457.05252819461" rx="29.516440037272" ry="29.516440037272" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="297.22580855625" y="482.02797745692"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:56.762384687061px">F</text>
<ellipse cx="189.377919657" cy="457.05252819461" rx="29.516440037272" ry="29.516440037272" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="189.377919657" y="482.02797745692"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:56.762384687061px">F</text>
<ellipse cx="42.05" cy="309.73231195824" rx="29.516440037272" ry="29.516440037272" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="334.70776122055"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:56.762384687061px">F</text>
<ellipse cx="95.973944449623" cy="403.12858374499" rx="29.516440037272" ry="29.516440037272" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="95.973944449623" y="428.1040330073"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:56.762384687061px">F</text>
<ellipse cx="149.89788889925" cy="201.884423059" rx="29.516440037272" ry="29.516440037272" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="149.89788889925" y="226.85987232131"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:56.762384687061px">O</text>
<ellipse cx="297.22580855625" cy="54.56420682263" rx="29.516440037272" ry="29.516440037272" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="297.22580855625" y="79.539656084937"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:56.762384687061px">F</text>
<ellipse cx="189.377919657" cy="54.56420682263" rx="29.516440037272" ry="29.516440037272" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="189.377919657" y="79.539656084937"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:56.762384687061px">F</text>
<ellipse cx="430.10211110075" cy="147.96047860938" rx="29.516440037272" ry="29.516440037272" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="430.10211110075" y="172.93592787168"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:56.762384687061px">O</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 135👍, 0💬