Molecule FYI-1001471

A

Molecule Summary:

ID: FYI-1001471
SMILES: Cc1onc(c1C(=O)N[C@H](C=O)[C@@H]1N[C@@H](C(O)=O)C(C)(C)S1)-c1c(Cl)cccc1Cl

Received at FYIcenter.com on: 2022-08-05

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001471
FYIcenter.com

 30 32  0  0  1  0  0  0  0  0999 V2000
    8.1436    4.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8518    6.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7910    7.1554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0892    8.3710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7163    8.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5696    6.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3539    5.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3539    4.5778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1454    6.6425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9227    5.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7072    6.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4916    5.9815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9227    4.5778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7872    3.7528    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2210    2.4178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3959    1.2822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.4289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9668    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6246    2.4178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7712    1.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9068    1.8469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0583    3.7528    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.6731    9.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9650   10.3914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2999   10.8251    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.9219   11.3306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5869   10.8969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2951    9.5239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3382    8.5846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0322    7.2932    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  6  2  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  7  1  0  0  0  0
 10  9  1  1  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 10  1  0  0  0  0
 13 14  1  1  0  0  0
 15 14  1  0  0  0  0
 15 16  1  6  0  0  0
 17 16  1  0  0  0  0
 18 16  2  0  0  0  0
 19 15  1  0  0  0  0
 20 19  1  0  0  0  0
 21 19  1  0  0  0  0
 22 19  1  0  0  0  0
 22 13  1  0  0  0  0
 23  5  1  0  0  0  0
 24 23  2  0  0  0  0
 25 24  1  0  0  0  0
 26 24  1  0  0  0  0
 27 26  2  0  0  0  0
 28 27  1  0  0  0  0
 29 28  2  0  0  0  0
 29 23  1  0  0  0  0
 30 29  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="441.26993892645" x2="447.65546219971" y1="309.56359769121" y2="279.52012647168" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="447.65546219971" x2="454.04098547297" y1="279.52012647168" y2="249.47665525215" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="482.37537729688" x2="461.82265811166" y1="355.21636894781" y2="332.38998331951" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #ff0000" />
<line x1="461.82265811166" x2="441.26993892645" y1="332.38998331951" y2="309.56359769121" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="451.6600912573" x2="467.01773427709" y1="408.41885072282" y2="381.81760983531" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #0000ff" />
<line x1="467.01773427709" x2="482.37537729688" y1="381.81760983531" y2="355.21636894781" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #ff0000" />
<line x1="391" x2="421" y1="399" y2="405.5" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="421" x2="451" y1="405.5" y2="412" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #0000ff" />
<line x1="393" x2="423" y1="393" y2="399.5" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="423" x2="453" y1="399.5" y2="406" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #0000ff" />
<line x1="385.15261239475" x2="388.3628806065" y1="334.54985702434" y2="365.09883060032" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="388.3628806065" x2="391.57314881824" y1="365.09883060032" y2="395.6478041763" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="387" x2="415" y1="338" y2="325.5" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="415" x2="443" y1="325.5" y2="313" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="384" x2="412" y1="332" y2="319.5" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="412" x2="440" y1="319.5" y2="307" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="331.94575397596" x2="358.54918318536" y1="303.83894762855" y2="319.19440232644" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="358.54918318536" x2="385.15261239475" y1="319.19440232644" y2="334.54985702434" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="329" x2="329" y1="243" y2="273.5" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #ff0000" />
<line x1="329" x2="329" y1="273.5" y2="304" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="336" x2="336" y1="243" y2="273.5" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #ff0000" />
<line x1="336" x2="336" y1="273.5" y2="304" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="279.05401390924" x2="305.4998839426" y1="332.76856300637" y2="318.30375531746" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #0000ff" />
<line x1="305.4998839426" x2="331.94575397596" y1="318.30375531746" y2="303.83894762855" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<polygon points=" 226,304 275,341 284,325" fill-opacity="1"  style="fill:#000000" />
<line x1="172.34268529469" x2="198.94173786031" y1="334.54985702434" y2="319.19440232644" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="198.94173786031" x2="225.54079042593" y1="319.19440232644" y2="303.83894762855" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="118" x2="144.5" y1="307" y2="322.5" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #ff0000" />
<line x1="144.5" x2="171" y1="322.5" y2="338" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="121" x2="147.5" y1="302" y2="317" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #ff0000" />
<line x1="147.5" x2="174" y1="317" y2="332" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="225.54079042593" x2="225.54079042593" y1="242.40399890562" y2="273.12147326708" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="225.54079042593" x2="225.54079042593" y1="273.12147326708" y2="303.83894762855" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<polygon points=" 226,243 182,199 171,214" fill-opacity="1"  style="fill:#000000" />
<line x1="194.82988103013" x2="185.33694067393" y1="147.86849328367" y2="177.08259050712" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="185.33694067393" x2="175.84400031772" y1="177.08259050712" y2="206.29668773057" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #0000ff" />
<polygon points=" 195,148 167,93 152,104" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="97.624622703123" x2="128.17140795721" y1="104.58786295518" y2="101.37759474344" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #ff0000" />
<line x1="128.17140795721" x2="158.7181932113" y1="101.37759474344" y2="98.167326531693" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="181" x2="168.5" y1="41" y2="69" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #ff0000" />
<line x1="168.5" x2="156" y1="69" y2="97" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="187" x2="174.5" y1="44" y2="72" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #ff0000" />
<line x1="174.5" x2="162" y1="72" y2="100" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="256.26045310928" x2="225.54516706971" y1="147.86849328367" y2="147.86849328367" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="225.54516706971" x2="194.82988103013" y1="147.86849328367" y2="147.86849328367" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="262.67661288899" x2="259.46853299914" y1="86.774922775493" y2="117.32170802958" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="259.46853299914" x2="256.26045310928" y1="117.32170802958" y2="147.86849328367" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="312.37777964097" x2="284.31911637513" y1="122.88223395054" y2="135.37536361711" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="284.31911637513" x2="256.26045310928" y1="135.37536361711" y2="147.86849328367" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="275.24195717791" x2="265.75120514359" y1="206.29668773057" y2="177.08259050712" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #c8aa1a" />
<line x1="265.75120514359" x2="256.26045310928" y1="177.08259050712" y2="147.86849328367" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="275.24195717791" x2="250.39137380192" y1="206.29668773057" y2="224.35034331809" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #c8aa1a" />
<line x1="250.39137380192" x2="225.54079042593" y1="224.35034331809" y2="242.40399890562" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="345.91600091787" x2="368.74457486806" y1="436.75761919051" y2="416.20271168341" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="368.74457486806" x2="391.57314881824" y1="416.20271168341" y2="395.6478041763" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="362" x2="356" y1="497" y2="467" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="356" x2="350" y1="467" y2="437" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="356" x2="349.5" y1="498" y2="468" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="349.5" x2="343" y1="468" y2="438" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="417.11524191128" x2="387.90333300973" y1="515.8260656982" y2="506.33531366388" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #00bc00" />
<line x1="387.90333300973" x2="358.69142410817" y1="506.33531366388" y2="496.84456162957" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="313.03865285157" x2="335.86503847987" y1="537.95" y2="517.39728081478" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="335.86503847987" x2="358.69142410817" y1="517.39728081478" y2="496.84456162957" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="254" x2="283.5" y1="523" y2="532.5" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="283.5" x2="313" y1="532.5" y2="542" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="256" x2="285.5" y1="516" y2="525.5" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="285.5" x2="315" y1="525.5" y2="535" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="241.83941185815" x2="248.22493513141" y1="458.87717684853" y2="488.92283638995" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="248.22493513141" x2="254.61045840467" y1="488.92283638995" y2="518.96849593137" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="286" x2="263" y1="416" y2="436.5" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="263" x2="240" y1="436.5" y2="457" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="290" x2="267.5" y1="421" y2="441.5" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="267.5" x2="245" y1="441.5" y2="462" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="287.49218311475" x2="316.70409201631" y1="417.76736183432" y2="427.26249051242" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="316.70409201631" x2="345.91600091787" y1="427.26249051242" y2="436.75761919051" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<line x1="274.09965315164" x2="280.7959181332" y1="361.24738407498" y2="389.50737295465" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #00bc00" />
<line x1="280.7959181332" x2="287.49218311475" y1="389.50737295465" y2="417.76736183432" style="stroke-opacity:1; stroke-width: 2.5866130206535; stroke: #000000" />
<ellipse cx="482.37537729688" cy="355.21636894781" rx="16.812984634248" ry="16.812984634248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="482.37537729688" y="369.4427405614"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:32.332662758169px">O</text>
<ellipse cx="451.6600912573" cy="408.41885072282" rx="16.812984634248" ry="16.812984634248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="451.6600912573" y="422.64522233642"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.332662758169px">N</text>
<ellipse cx="331.94575397596" cy="242.40399890562" rx="16.812984634248" ry="16.812984634248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="331.94575397596" y="256.63037051921"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:32.332662758169px">O</text>
<ellipse cx="279.05401390924" cy="332.76856300637" rx="16.812984634248" ry="16.812984634248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="279.05401390924" y="346.99493461997"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.332662758169px">N</text>
<ellipse cx="119.14020351967" cy="303.83894762855" rx="16.812984634248" ry="16.812984634248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="119.14020351967" y="318.06531924214"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:32.332662758169px">O</text>
<ellipse cx="175.84400031772" cy="206.29668773057" rx="16.812984634248" ry="16.812984634248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="175.84400031772" y="220.52305934416"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.332662758169px">N</text>
<ellipse cx="97.624622703123" cy="104.58786295518" rx="16.812984634248" ry="16.812984634248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="97.624622703123" y="118.81423456878"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:32.332662758169px">O</text>
<ellipse cx="183.70445254444" cy="42.05" rx="16.812984634248" ry="16.812984634248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="183.70445254444" y="56.276371613594"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:32.332662758169px">O</text>
<ellipse cx="275.24195717791" cy="206.29668773057" rx="16.812984634248" ry="16.812984634248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="275.24195717791" y="220.52305934416"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:32.332662758169px">S</text>
<ellipse cx="417.11524191128" cy="515.8260656982" rx="16.812984634248" ry="16.812984634248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="417.11524191128" y="530.05243731179"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:32.332662758169px">Cl</text>
<ellipse cx="274.09965315164" cy="361.24738407498" rx="16.812984634248" ry="16.812984634248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="274.09965315164" y="375.47375568858"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:32.332662758169px">Cl</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 133👍, 0💬