Molecule FYI-1001470

A

Molecule Summary:

ID: FYI-1001470
SMILES: CN1C=NC2=C1C(=O)N(C(=O)N2C)C

Received at FYIcenter.com on: 2022-08-04

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001470
FYIcenter.com

 14 15  0  0  0  0  0  0  0  0999 V2000
    4.5302    6.0868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3177    5.3868    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0388    5.9562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1019    4.9159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8020    3.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1714    3.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1082    2.9540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4775    3.2451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6756    1.6226    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3061    1.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8735    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3694    2.3719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.0808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6123    0.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  6  2  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  7  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 10  1  0  0  0  0
 12  5  1  0  0  0  0
 13 12  1  0  0  0  0
 14  9  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="337.16785585201" x2="386.55988039692" y1="480.92003351515" y2="509.43501675757" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #0000ff" />
<line x1="386.55988039692" x2="435.95190494184" y1="509.43501675757" y2="537.95" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="232.97410708418" x2="285.07098146809" y1="527.30983768154" y2="504.11493559834" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="285.07098146809" x2="337.16785585201" y1="504.11493559834" y2="480.92003351515" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #0000ff" />
<line x1="153" x2="191" y1="447" y2="489.5" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #0000ff" />
<line x1="191" x2="229" y1="489.5" y2="532" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="162" x2="200" y1="439" y2="481.5" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #0000ff" />
<line x1="200" x2="238" y1="481.5" y2="524" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="213.68168413616" x2="185.1626273247" y1="343.77111125715" y2="393.16313580206" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="185.1626273247" x2="156.64357051324" y1="393.16313580206" y2="442.55516034698" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #0000ff" />
<line x1="327" x2="271" y1="362" y2="350" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="271" x2="215" y1="350" y2="338" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="325" x2="269" y1="374" y2="362" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="269" x2="213" y1="362" y2="350" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="325.24859285667" x2="331.20822435434" y1="367.48743017678" y2="424.20373184596" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="331.20822435434" x2="337.16785585201" y1="424.20373184596" y2="480.92003351515" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #0000ff" />
<line x1="401.57098228954" x2="363.40978757311" y1="282.71645856608" y2="325.10194437143" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="363.40978757311" x2="325.24859285667" y1="325.10194437143" y2="367.48743017678" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="515" x2="459" y1="301" y2="289" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #ff0000" />
<line x1="459" x2="403" y1="289" y2="277" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="512" x2="456.5" y1="313" y2="301" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #ff0000" />
<line x1="456.5" x2="401" y1="301" y2="289" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="366.32646300191" x2="383.94872264573" y1="174.24546231189" y2="228.48096043898" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #0000ff" />
<line x1="383.94872264573" x2="401.57098228954" y1="228.48096043898" y2="282.71645856608" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="254.75140714333" x2="310.53893507262" y1="150.52914339226" y2="162.38730285207" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="310.53893507262" x2="366.32646300191" y1="162.38730285207" y2="174.24546231189" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #0000ff" />
<line x1="214" x2="232" y1="44" y2="98.5" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #ff0000" />
<line x1="232" x2="250" y1="98.5" y2="153" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="226" x2="243.5" y1="41" y2="95" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #ff0000" />
<line x1="243.5" x2="261" y1="95" y2="149" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="178.43716484852" x2="216.59428599593" y1="235.29196786489" y2="192.91055562857" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #0000ff" />
<line x1="216.59428599593" x2="254.75140714333" y1="192.91055562857" y2="150.52914339226" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="178.43716484852" x2="196.05942449234" y1="235.29196786489" y2="289.53153956102" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #0000ff" />
<line x1="196.05942449234" x2="213.68168413616" y1="289.53153956102" y2="343.77111125715" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="66.870256128015" x2="122.65371048827" y1="211.57564894526" y2="223.43380840507" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="122.65371048827" x2="178.43716484852" y1="223.43380840507" y2="235.29196786489" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #0000ff" />
<line x1="442.64070529671" x2="404.48358414931" y1="89.474490701189" y2="131.85997650654" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #000000" />
<line x1="404.48358414931" x2="366.32646300191" y1="131.85997650654" y2="174.24546231189" style="stroke-opacity:1; stroke-width: 4.8026644162754; stroke: #0000ff" />
<ellipse cx="337.16785585201" cy="480.92003351515" rx="31.21731870579" ry="31.21731870579" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="337.16785585201" y="507.33468780466"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:60.033305203442px">N</text>
<ellipse cx="156.64357051324" cy="442.55516034698" rx="31.21731870579" ry="31.21731870579" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="156.64357051324" y="468.96981463649"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:60.033305203442px">N</text>
<ellipse cx="513.12974387199" cy="306.43277748571" rx="31.21731870579" ry="31.21731870579" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="513.12974387199" y="332.84743177522"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:60.033305203442px">O</text>
<ellipse cx="366.32646300191" cy="174.24546231189" rx="31.21731870579" ry="31.21731870579" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="366.32646300191" y="200.6601166014"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:60.033305203442px">N</text>
<ellipse cx="219.50688785569" cy="42.05" rx="31.21731870579" ry="31.21731870579" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="219.50688785569" y="68.464654289515"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:60.033305203442px">O</text>
<ellipse cx="178.43716484852" cy="235.29196786489" rx="31.21731870579" ry="31.21731870579" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="178.43716484852" y="261.7066221544"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:60.033305203442px">N</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 131👍, 0💬