Molecule FYI-1001463

A

Molecule Summary:

ID: FYI-1001463
SMILES: C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1

Received at FYIcenter.com on: 2022-07-31

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001463
FYIcenter.com

 29 31  0  0  0  0  0  0  0  0999 V2000
    7.2746    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    7.7000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    9.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    9.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  3  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 15  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 21  2  0  0  0  0
 28 27  1  0  0  0  0
 28  9  1  0  0  0  0
 28 13  2  0  0  0  0
 29  7  2  0  0  0  0
 29  3  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="393" x2="368" y1="214" y2="199.5" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="368" x2="343" y1="199.5" y2="185" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="387" x2="362" y1="224" y2="210" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="362" x2="337" y1="210" y2="196" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="389.18081801986" x2="364.38459099007" y1="218.42326218205" y2="204.10791461846" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="364.38459099007" x2="339.58836396028" y1="204.10791461846" y2="189.79256705486" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="438.76918198014" x2="413.975" y1="247.05395730923" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="413.975" x2="389.18081801986" y1="232.73860974564" y2="218.42326218205" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="487" x2="462.5" y1="216" y2="230.5" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="462.5" x2="438" y1="230.5" y2="245" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="490" x2="465.5" y1="222" y2="236" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="465.5" x2="441" y1="236" y2="250" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="537.95" x2="513.15377297021" y1="247.05395730923" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="513.15377297021" x2="488.35754594042" y1="232.73860974564" y2="218.42326218205" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="541" x2="541" y1="305" y2="276.5" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="541" x2="541" y1="276.5" y2="248" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="535" x2="535" y1="305" y2="276.5" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="535" x2="535" y1="276.5" y2="248" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="488.35754594042" x2="513.15377297021" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="513.15377297021" x2="537.95" y1="318.63069512718" y2="304.31534756359" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="488.35754594042" x2="488.35754594042" y1="390.20743294514" y2="361.57673781795" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #0000ff" />
<line x1="488.35754594042" x2="488.35754594042" y1="361.57673781795" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="438.76918198014" x2="463.56336396028" y1="418.83812807232" y2="404.52278050873" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="463.56336396028" x2="488.35754594042" y1="404.52278050873" y2="390.20743294514" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #0000ff" />
<line x1="442" x2="442" y1="477" y2="448" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #0000ff" />
<line x1="442" x2="442" y1="448" y2="419" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="436" x2="436" y1="477" y2="448" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #0000ff" />
<line x1="436" x2="436" y1="448" y2="419" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="389.18081801986" x2="413.975" y1="504.73021345386" y2="490.41486589027" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="413.975" x2="438.76918198014" y1="490.41486589027" y2="476.09951832668" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #0000ff" />
<line x1="339" x2="363.5" y1="479" y2="493.5" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #0000ff" />
<line x1="363.5" x2="388" y1="493.5" y2="508" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="342" x2="366.5" y1="474" y2="488.5" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #0000ff" />
<line x1="366.5" x2="391" y1="488.5" y2="503" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="339.58836396028" x2="339.58836396028" y1="418.83812807232" y2="447.4688231995" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="339.58836396028" x2="339.58836396028" y1="447.4688231995" y2="476.09951832668" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #0000ff" />
<line x1="290" x2="314.79418198014" y1="390.20743294514" y2="404.52278050873" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="314.79418198014" x2="339.58836396028" y1="404.52278050873" y2="418.83812807232" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="287" x2="287" y1="333" y2="362" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="287" x2="287" y1="362" y2="391" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="294" x2="294" y1="333" y2="362" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="294" x2="294" y1="362" y2="391" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="240.41163603972" x2="265.20581801986" y1="304.31534756359" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #ff0000" />
<line x1="265.20581801986" x2="290" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="190.81918198014" x2="215.61540900993" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="215.61540900993" x2="240.41163603972" y1="318.63069512718" y2="304.31534756359" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #ff0000" />
<line x1="141.23081801986" x2="166.025" y1="304.31534756359" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="166.025" x2="190.81918198014" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="91.638363960278" x2="116.43459099007" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #ff0000" />
<line x1="116.43459099007" x2="141.23081801986" y1="318.63069512718" y2="304.31534756359" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="42.05" x2="66.844181980139" y1="304.31534756359" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="66.844181980139" x2="91.638363960278" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #ff0000" />
<line x1="339.58836396028" x2="314.79418198014" y1="304.31534756359" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="314.79418198014" x2="290" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="339.58836396028" x2="339.58836396028" y1="247.05395730923" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #ff0000" />
<line x1="339.58836396028" x2="339.58836396028" y1="275.68465243641" y2="304.31534756359" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="290" x2="314.79418198014" y1="218.42326218205" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="314.79418198014" x2="339.58836396028" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #ff0000" />
<line x1="290" x2="290" y1="161.16187192768" y2="189.79256705486" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="290" x2="290" y1="189.79256705486" y2="218.42326218205" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="240.41163603972" x2="265.20581801986" y1="132.5311768005" y2="146.84652436409" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #ff0000" />
<line x1="265.20581801986" x2="290" y1="146.84652436409" y2="161.16187192768" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="240.41163603972" x2="240.41163603972" y1="75.269786546138" y2="103.90048167332" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="240.41163603972" x2="240.41163603972" y1="103.90048167332" y2="132.5311768005" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #ff0000" />
<line x1="391" x2="366.5" y1="331" y2="316.5" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="366.5" x2="342" y1="316.5" y2="302" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="388" x2="363.5" y1="336" y2="321.5" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="363.5" x2="339" y1="321.5" y2="307" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="389.18081801986" x2="389.18081801986" y1="390.20743294514" y2="361.57673781795" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="389.18081801986" x2="389.18081801986" y1="361.57673781795" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="389.18081801986" x2="413.975" y1="390.20743294514" y2="404.52278050873" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="413.975" x2="438.76918198014" y1="404.52278050873" y2="418.83812807232" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="388" x2="363.5" y1="388" y2="402.5" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="363.5" x2="339" y1="402.5" y2="417" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="391" x2="366.5" y1="393" y2="407.5" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="366.5" x2="342" y1="407.5" y2="422" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="438" x2="462.5" y1="307" y2="321.5" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="462.5" x2="487" y1="321.5" y2="336" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="441" x2="465.5" y1="302" y2="316.5" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="465.5" x2="490" y1="316.5" y2="331" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="438.76918198014" x2="438.76918198014" y1="304.31534756359" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<line x1="438.76918198014" x2="438.76918198014" y1="275.68465243641" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110123290479; stroke: #000000" />
<ellipse cx="488.35754594042" cy="390.20743294514" rx="15.671580138811" ry="15.671580138811" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="488.35754594042" y="403.4680007549"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137654113098px">N</text>
<ellipse cx="438.76918198014" cy="476.09951832668" rx="15.671580138811" ry="15.671580138811" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="438.76918198014" y="489.36008613644"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137654113098px">N</text>
<ellipse cx="339.58836396028" cy="476.09951832668" rx="15.671580138811" ry="15.671580138811" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.58836396028" y="489.36008613644"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137654113098px">N</text>
<ellipse cx="240.41163603972" cy="304.31534756359" rx="15.671580138811" ry="15.671580138811" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.41163603972" y="317.57591537335"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137654113098px">O</text>
<ellipse cx="91.638363960278" cy="332.94604269077" rx="15.671580138811" ry="15.671580138811" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="91.638363960278" y="346.20661050054"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137654113098px">O</text>
<ellipse cx="339.58836396028" cy="247.05395730923" rx="15.671580138811" ry="15.671580138811" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.58836396028" y="260.31452511899"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137654113098px">O</text>
<ellipse cx="240.41163603972" cy="132.5311768005" rx="15.671580138811" ry="15.671580138811" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.41163603972" y="145.79174461026"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137654113098px">O</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 134👍, 0💬