Molecule FYI-1001458

A

Molecule Summary:

ID: FYI-1001458
SMILES: C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O

Received at FYIcenter.com on: 2022-07-30

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001458
FYIcenter.com

 45 44  0  0  0  0  0  0  0  0999 V2000
    8.4873    0.3695   -0.1564 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5066    1.3305    0.8602 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.6203   -0.4444   -0.0502 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.2281   -0.4892   -0.0227 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2089   -1.4501   -1.0393 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.2289   -1.1274    1.2223 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.9891    0.4009   -0.1388 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0083    1.3618    0.8778 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.9884    1.0390   -1.3837 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.7299   -0.4579   -0.0051 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7107   -1.4188   -1.0217 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.7307   -1.0960    1.2399 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.4909    0.4322   -0.1212 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5101    1.3932    0.8954 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.4902    1.0704   -1.3662 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.2317   -0.4265    0.0125 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2125   -1.3874   -1.0041 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.2324   -1.0647    1.2574 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.9927    0.4636   -0.1036 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0119    1.4245    0.9130 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.9919    1.1017   -1.3486 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2665   -0.3952    0.0300 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2857   -1.3561   -0.9865 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2658   -1.0333    1.2750 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5055    0.4949   -0.0860 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4863    1.4559    0.9305 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5063    1.1331   -1.3310 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7647   -0.3638    0.0476 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7840   -1.3247   -0.9690 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7640   -1.0020    1.2926 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0038    0.5263   -0.0685 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9845    1.4872    0.9481 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0045    1.1644   -1.3134 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2630   -0.3325    0.0652 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2822   -1.2934   -0.9514 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2622   -0.9706    1.3102 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5020    0.5576   -0.0509 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4828    1.5186    0.9657 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5027    1.1958   -1.2959 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9949   -0.4605    0.1076 S   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1376   -1.3150   -1.0188 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1160   -0.9655    1.4303 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1446    0.5282   -0.0234 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4868    0.8667   -1.1263 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.0205    0.1239    0.0421 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1  3  1  0  0  0  0
  1  4  1  0  0  0  0
  4  5  1  0  0  0  0
  4  6  1  0  0  0  0
  4  7  1  0  0  0  0
  7  8  1  0  0  0  0
  7  9  1  0  0  0  0
  7 10  1  0  0  0  0
 10 11  1  0  0  0  0
 10 12  1  0  0  0  0
 10 13  1  0  0  0  0
 13 14  1  0  0  0  0
 13 15  1  0  0  0  0
 13 16  1  0  0  0  0
 16 17  1  0  0  0  0
 16 18  1  0  0  0  0
 16 19  1  0  0  0  0
 19 20  1  0  0  0  0
 19 21  1  0  0  0  0
 19 22  1  0  0  0  0
 22 23  1  0  0  0  0
 22 24  1  0  0  0  0
 22 25  1  0  0  0  0
 25 26  1  0  0  0  0
 25 27  1  0  0  0  0
 25 28  1  0  0  0  0
 28 29  1  0  0  0  0
 28 30  1  0  0  0  0
 28 31  1  0  0  0  0
 31 32  1  0  0  0  0
 31 33  1  0  0  0  0
 31 34  1  0  0  0  0
 34 35  1  0  0  0  0
 34 36  1  0  0  0  0
 34 37  1  0  0  0  0
 37 38  1  0  0  0  0
 37 39  1  0  0  0  0
 37 40  1  0  0  0  0
 40 41  2  0  0  0  0
 40 42  2  0  0  0  0
 40 43  1  0  0  0  0
  1 44  1  0  0  0  0
 43 45  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="509.34349211845" x2="509.58713978046" y1="298.46454701438" y2="310.59643319009" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="509.58713978046" x2="509.83078744247" y1="310.59643319009" y2="322.72831936581" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="509.34349211845" x2="523.64674605922" y1="298.46454701438" y2="288.18968524704" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="523.64674605922" x2="537.95" y1="288.18968524704" y2="277.9148234797" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="509.34349211845" x2="493.44706020121" y1="298.46454701438" y2="287.62411968963" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="493.44706020121" x2="477.55062828398" y1="287.62411968963" y2="276.78369236487" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="477.55062828398" x2="477.30824304509" y1="276.78369236487" y2="264.65306861228" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="477.30824304509" x2="477.0658578062" y1="264.65306861228" y2="252.52244485968" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="477.55062828398" x2="477.56072766893" y1="276.78369236487" y2="268.726908018" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="477.56072766893" x2="477.57082705389" y1="268.726908018" y2="260.67012367113" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="477.55062828398" x2="461.90920583683" y1="276.78369236487" y2="288.02052054906" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="461.90920583683" x2="446.26778338968" y1="288.02052054906" y2="299.25734873325" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="446.26778338968" x2="446.51016862857" y1="299.25734873325" y2="311.38797248585" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="446.51016862857" x2="446.75255386746" y1="311.38797248585" y2="323.51859623844" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="446.26778338968" x2="446.25894642784" y1="299.25734873325" y2="307.312870657" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="446.25894642784" x2="446.25010946601" y1="307.312870657" y2="315.36839258075" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="446.26778338968" x2="430.37135147245" y1="299.25734873325" y2="288.41565898538" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="430.37135147245" x2="414.47491955521" y1="288.41565898538" y2="277.57396923751" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="414.47491955521" x2="414.23253431632" y1="277.57396923751" y2="265.44334548491" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="414.23253431632" x2="413.99014907743" y1="265.44334548491" y2="253.31272173231" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="414.47491955521" x2="414.48501894017" y1="277.57396923751" y2="269.51844731376" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="414.48501894017" x2="414.49511832512" y1="269.51844731376" y2="261.46292539" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="414.47491955521" x2="398.83349710806" y1="277.57396923751" y2="288.81079742169" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="398.83349710806" x2="383.19207466091" y1="288.81079742169" y2="300.04762560588" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="383.19207466091" x2="383.4344598998" y1="300.04762560588" y2="312.1795117816" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="383.4344598998" x2="383.67684513869" y1="312.1795117816" y2="324.31139795731" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="383.19207466091" x2="383.18323769908" y1="300.04762560588" y2="308.10440995275" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="383.18323769908" x2="383.17440073724" y1="308.10440995275" y2="316.16119429962" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="383.19207466091" x2="367.29564274368" y1="300.04762560588" y2="289.20719828113" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="367.29564274368" x2="351.39921082644" y1="289.20719828113" y2="278.36677095638" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="351.39921082644" x2="351.15682558755" y1="278.36677095638" y2="266.23614720378" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="351.15682558755" x2="350.91444034866" y1="266.23614720378" y2="254.10552345118" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="351.39921082644" x2="351.40804778828" y1="278.36677095638" y2="270.30998660951" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="351.40804778828" x2="351.41688475011" y1="270.30998660951" y2="262.25320226264" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="351.39921082644" x2="335.75778837929" y1="278.36677095638" y2="289.60359914056" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="335.75778837929" x2="320.11636593214" y1="289.60359914056" y2="300.84042732475" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="320.11636593214" x2="320.35875117103" y1="300.84042732475" y2="312.97105107735" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="320.35875117103" x2="320.60113640992" y1="312.97105107735" y2="325.10167482995" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="320.11636593214" x2="320.10626654719" y1="300.84042732475" y2="308.8959492485" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="320.10626654719" x2="320.09616716223" y1="308.8959492485" y2="316.95147117225" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="320.11636593214" x2="304.21993401491" y1="300.84042732475" y2="289.99873757688" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="304.21993401491" x2="288.32350209767" y1="289.99873757688" y2="279.15704782901" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="288.32350209767" x2="288.08111685878" y1="279.15704782901" y2="267.02642407641" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="288.08111685878" x2="287.83873161989" y1="267.02642407641" y2="254.89580032382" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="288.32350209767" x2="288.33233905951" y1="279.15704782901" y2="271.10152590526" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="288.33233905951" x2="288.34117602134" y1="271.10152590526" y2="263.04600398151" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="288.32350209767" x2="272.68207965052" y1="279.15704782901" y2="290.3938760132" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="272.68207965052" x2="257.04065720337" y1="290.3938760132" y2="301.63070419739" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="257.04065720337" x2="257.28304244226" y1="301.63070419739" y2="313.7625903731" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="257.28304244226" x2="257.52542768115" y1="313.7625903731" y2="325.89447654882" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="257.04065720337" x2="257.03055781842" y1="301.63070419739" y2="309.68748854425" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="257.03055781842" x2="257.02045843347" y1="309.68748854425" y2="317.74427289112" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="257.04065720337" x2="241.14422528614" y1="301.63070419739" y2="290.79027687263" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="241.14422528614" x2="225.24779336891" y1="290.79027687263" y2="279.94984954788" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="225.24779336891" x2="225.0041457069" y1="279.94984954788" y2="267.81922579528" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="225.0041457069" x2="224.76049804489" y1="267.81922579528" y2="255.68860204269" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="225.24779336891" x2="225.25663033074" y1="279.94984954788" y2="271.89306520101" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="225.25663033074" x2="225.26546729257" y1="271.89306520101" y2="263.83628085414" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="225.24779336891" x2="209.60510849864" y1="279.94984954788" y2="291.18667773207" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="209.60510849864" x2="193.96242362837" y1="291.18667773207" y2="302.42350591626" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="193.96242362837" x2="194.20607129038" y1="302.42350591626" y2="314.55412966885" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="194.20607129038" x2="194.44971895238" y1="314.55412966885" y2="326.68475342145" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="193.96242362837" x2="193.95358666653" y1="302.42350591626" y2="310.47902784001" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="193.95358666653" x2="193.9447497047" y1="310.47902784001" y2="318.53454976376" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="193.96242362837" x2="178.06599171113" y1="302.42350591626" y2="291.58181616838" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="178.06599171113" x2="162.1695597939" y1="291.58181616838" y2="280.74012642051" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="162.1695597939" x2="161.92717455501" y1="280.74012642051" y2="268.60950266792" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="161.92717455501" x2="161.68478931612" y1="268.60950266792" y2="256.47887891532" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="162.1695597939" x2="162.17965917885" y1="280.74012642051" y2="272.68460449676" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="162.17965917885" x2="162.18975856381" y1="272.68460449676" y2="264.62908257301" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="162.1695597939" x2="146.52813734675" y1="280.74012642051" y2="291.9769546047" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="146.52813734675" x2="130.8867148996" y1="291.9769546047" y2="303.21378278889" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="130.8867148996" x2="131.12910013849" y1="303.21378278889" y2="315.3456689646" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="131.12910013849" x2="131.37148537738" y1="315.3456689646" y2="327.47755514032" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="130.8867148996" x2="130.87787793776" y1="303.21378278889" y2="311.27056713576" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="130.87787793776" x2="130.86904097593" y1="311.27056713576" y2="319.32735148263" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #00bc00" />
<line x1="130.8867148996" x2="112.04000015274" y1="303.21378278889" y2="290.3610530121" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #000000" />
<line x1="112.04000015274" x2="93.19328540589" y1="290.3610530121" y2="277.50832323531" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #c8aa1a" />
<line x1="96" x2="94" y1="278" y2="267" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #c8aa1a" />
<line x1="94" x2="92" y1="267" y2="256" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #ff0000" />
<line x1="92" x2="90" y1="278" y2="267.5" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #c8aa1a" />
<line x1="90" x2="88" y1="267.5" y2="257" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #ff0000" />
<line x1="96" x2="94.5" y1="278" y2="271.5" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #c8aa1a" />
<line x1="94.5" x2="93" y1="271.5" y2="265" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #ff0000" />
<line x1="92" x2="90.5" y1="278" y2="272" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #c8aa1a" />
<line x1="90.5" x2="89" y1="272" y2="266" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #ff0000" />
<line x1="93.19328540589" x2="78.679206804203" y1="277.50832323531" y2="289.98990061505" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #c8aa1a" />
<line x1="78.679206804203" x2="64.165128202517" y1="289.98990061505" y2="302.47147799479" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #ff0000" />
<line x1="64.165128202517" x2="53.107564101259" y1="302.47147799479" y2="297.36750132378" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #ff0000" />
<line x1="53.107564101259" x2="42.05" y1="297.36750132378" y2="292.26352465276" style="stroke-opacity:1; stroke-width: 1.621082069939; stroke: #a4a4a4" />
<ellipse cx="509.83078744247" cy="322.72831936581" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="509.83078744247" y="331.64427075047"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="537.95" cy="277.9148234797" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="286.83077486436"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="477.0658578062" cy="252.52244485968" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="477.0658578062" y="261.43839624434"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="477.57082705389" cy="260.67012367113" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="477.57082705389" y="269.5860750558"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="446.75255386746" cy="323.51859623844" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="446.75255386746" y="332.43454762311"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="446.25010946601" cy="315.36839258075" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="446.25010946601" y="324.28434396541"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="413.99014907743" cy="253.31272173231" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="413.99014907743" y="262.22867311698"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="414.49511832512" cy="261.46292539" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="414.49511832512" y="270.37887677467"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="383.67684513869" cy="324.31139795731" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="383.67684513869" y="333.22734934198"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="383.17440073724" cy="316.16119429962" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="383.17440073724" y="325.07714568429"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="350.91444034866" cy="254.10552345118" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="350.91444034866" y="263.02147483585"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="351.41688475011" cy="262.25320226264" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="351.41688475011" y="271.1691536473"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="320.60113640992" cy="325.10167482995" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.60113640992" y="334.01762621461"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="320.09616716223" cy="316.95147117225" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.09616716223" y="325.86742255692"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="287.83873161989" cy="254.89580032382" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="287.83873161989" y="263.81175170848"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="288.34117602134" cy="263.04600398151" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="288.34117602134" y="271.96195536617"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="257.52542768115" cy="325.89447654882" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="257.52542768115" y="334.81042793348"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="257.02045843347" cy="317.74427289112" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="257.02045843347" y="326.66022427579"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="224.76049804489" cy="255.68860204269" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="224.76049804489" y="264.60455342735"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="225.26546729257" cy="263.83628085414" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="225.26546729257" y="272.7522322388"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="194.44971895238" cy="326.68475342145" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="194.44971895238" y="335.60070480611"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="193.9447497047" cy="318.53454976376" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="193.9447497047" y="327.45050114842"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="161.68478931612" cy="256.47887891532" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="161.68478931612" y="265.39483029998"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="162.18975856381" cy="264.62908257301" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="162.18975856381" y="273.54503395768"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="131.37148537738" cy="327.47755514032" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="131.37148537738" y="336.39350652498"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="130.86904097593" cy="319.32735148263" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="130.86904097593" y="328.24330286729"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">F</text>
<ellipse cx="93.19328540589" cy="277.50832323531" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="93.19328540589" y="286.42427461997"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">S</text>
<ellipse cx="89.590329823632" cy="255.93351212782" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="89.590329823632" y="264.84946351248"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">O</text>
<ellipse cx="90.135696611136" cy="264.75784973117" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="90.135696611136" y="273.67380111584"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">O</text>
<ellipse cx="64.165128202517" cy="302.47147799479" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="64.165128202517" y="311.38742937945"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">O</text>
<ellipse cx="42.05" cy="292.26352465276" rx="10.537033454604" ry="10.537033454604" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="301.17947603743"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:20.263525874238px">H</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 134👍, 0💬