Molecule FYI-1001459

A

Molecule Summary:

ID: FYI-1001459
SMILES: C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)

Received at FYIcenter.com on: 2022-07-30

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001459
FYIcenter.com

 44 43  0  0  0  0  0  0  0  0999 V2000
   -8.1192    0.4577   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2630   -0.3477   -0.0593 F   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1176    1.2654    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8717   -0.4281   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8733   -1.2358    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8733   -1.2358   -1.2015 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6207    0.4528   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6191    1.2605   -1.2015 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6191    1.2605    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3732   -0.4330   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3748   -1.2407    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3748   -1.2407   -1.2015 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1222    0.4478   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1206    1.2556   -1.2015 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1206    1.2556    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8747   -0.4380   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8763   -1.2457    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8763   -1.2457   -1.2015 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6237    0.4429   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6221    1.2506   -1.2015 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6221    1.2506    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.6237   -0.4429   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6221   -1.2506    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.6221   -1.2506   -1.2015 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.8747    0.4380   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8763    1.2457   -1.2015 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.8763    1.2457    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.1222   -0.4478   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1206   -1.2556    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.1206   -1.2556   -1.2015 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.3732    0.4330   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3748    1.2407   -1.2015 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.3748    1.2407    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.6207   -0.4528   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6191   -1.2605    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.6191   -1.2605   -1.2015 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.8717    0.4281   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8733    1.2358   -1.2015 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.8733    1.2358    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.1192   -0.4577   -0.0593 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2630    0.3477   -0.0593 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.1176   -1.2654    1.0830 F   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1179    1.0870   -0.9492 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1179   -1.0870   -0.9492 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1  3  1  0  0  0  0
  1  4  1  0  0  0  0
  4  5  1  0  0  0  0
  4  6  1  0  0  0  0
  4  7  1  0  0  0  0
  7  8  1  0  0  0  0
  7  9  1  0  0  0  0
  7 10  1  0  0  0  0
 10 11  1  0  0  0  0
 10 12  1  0  0  0  0
 10 13  1  0  0  0  0
 13 14  1  0  0  0  0
 13 15  1  0  0  0  0
 13 16  1  0  0  0  0
 16 17  1  0  0  0  0
 16 18  1  0  0  0  0
 16 19  1  0  0  0  0
 19 20  1  0  0  0  0
 19 21  1  0  0  0  0
 19 22  1  0  0  0  0
 22 23  1  0  0  0  0
 22 24  1  0  0  0  0
 22 25  1  0  0  0  0
 25 26  1  0  0  0  0
 25 27  1  0  0  0  0
 25 28  1  0  0  0  0
 28 29  1  0  0  0  0
 28 30  1  0  0  0  0
 28 31  1  0  0  0  0
 31 32  1  0  0  0  0
 31 33  1  0  0  0  0
 31 34  1  0  0  0  0
 34 35  1  0  0  0  0
 34 36  1  0  0  0  0
 34 37  1  0  0  0  0
 37 38  1  0  0  0  0
 37 39  1  0  0  0  0
 37 40  1  0  0  0  0
 40 41  1  0  0  0  0
 40 42  1  0  0  0  0
  1 43  1  0  0  0  0
 40 44  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="72.666993414661" x2="57.35849670733" y1="302.25161556731" y2="291.4722282198" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="57.35849670733" x2="42.05" y1="291.4722282198" y2="280.69284087229" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="72.666993414661" x2="72.688407643312" y1="302.25161556731" y2="313.06178586851" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="72.688407643312" x2="72.709821871964" y1="313.06178586851" y2="323.87195616971" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="72.666993414661" x2="89.363399816474" y1="302.25161556731" y2="290.39616323006" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="89.363399816474" x2="106.05980621829" y1="290.39616323006" y2="278.5407108928" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="106.05980621829" x2="106.03839198964" y1="278.5407108928" y2="267.7305405916" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="106.03839198964" x2="106.01697776098" y1="267.7305405916" y2="256.9203702904" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="106.05980621829" x2="106.03839198964" y1="278.5407108928" y2="267.7305405916" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="106.03839198964" x2="106.01697776098" y1="267.7305405916" y2="256.9203702904" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="106.05980621829" x2="122.80305624528" y1="278.5407108928" y2="290.33058215481" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="122.80305624528" x2="139.54630627227" y1="290.33058215481" y2="302.12045341682" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="139.54630627227" x2="139.56772050092" y1="302.12045341682" y2="312.93062371802" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="139.56772050092" x2="139.58913472957" y1="312.93062371802" y2="323.74079401922" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="139.54630627227" x2="139.56772050092" y1="302.12045341682" y2="312.93062371802" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="139.56772050092" x2="139.58913472957" y1="312.93062371802" y2="323.74079401922" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="139.54630627227" x2="156.24271267408" y1="302.12045341682" y2="290.26500107956" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="156.24271267408" x2="172.93911907589" y1="290.26500107956" y2="278.40954874231" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="172.93911907589" x2="172.91770484724" y1="278.40954874231" y2="267.59937844111" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="172.91770484724" x2="172.89629061859" y1="267.59937844111" y2="256.78920813991" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="172.93911907589" x2="172.91770484724" y1="278.40954874231" y2="267.59937844111" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="172.91770484724" x2="172.89629061859" y1="267.59937844111" y2="256.78920813991" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="172.93911907589" x2="189.68236910288" y1="278.40954874231" y2="290.19808161503" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="189.68236910288" x2="206.42561912987" y1="290.19808161503" y2="301.98661448775" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="206.42561912987" x2="206.44703335852" y1="301.98661448775" y2="312.79812317824" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="206.44703335852" x2="206.46844758717" y1="312.79812317824" y2="323.60963186873" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="206.42561912987" x2="206.44703335852" y1="301.98661448775" y2="312.79812317824" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="206.44703335852" x2="206.46844758717" y1="312.79812317824" y2="323.60963186873" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="206.42561912987" x2="223.12202553169" y1="301.98661448775" y2="290.13116215049" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="223.12202553169" x2="239.8184319335" y1="290.13116215049" y2="278.27570981324" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="239.8184319335" x2="239.79701770485" y1="278.27570981324" y2="267.46553951204" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="239.79701770485" x2="239.7756034762" y1="267.46553951204" y2="256.65536921084" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="239.8184319335" x2="239.79701770485" y1="278.27570981324" y2="267.46553951204" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="239.79701770485" x2="239.7756034762" y1="267.46553951204" y2="256.65536921084" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="239.8184319335" x2="256.56168196049" y1="278.27570981324" y2="290.06558107525" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="256.56168196049" x2="273.30493198748" y1="290.06558107525" y2="301.85545233726" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="273.30493198748" x2="273.32634621613" y1="301.85545233726" y2="312.66562263845" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="273.32634621613" x2="273.34776044478" y1="312.66562263845" y2="323.47579293965" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="273.30493198748" x2="273.32634621613" y1="301.85545233726" y2="312.66562263845" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="273.32634621613" x2="273.34776044478" y1="312.66562263845" y2="323.47579293965" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="273.30493198748" x2="290" y1="301.85545233726" y2="290" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="290" x2="306.69506801252" y1="290" y2="278.14454766274" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="306.69506801252" x2="306.67365378387" y1="278.14454766274" y2="267.33437736155" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="306.67365378387" x2="306.65223955522" y1="267.33437736155" y2="256.52420706035" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="306.69506801252" x2="306.67365378387" y1="278.14454766274" y2="267.33437736155" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="306.67365378387" x2="306.65223955522" y1="267.33437736155" y2="256.52420706035" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="306.69506801252" x2="323.43831803951" y1="278.14454766274" y2="289.93441892475" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="323.43831803951" x2="340.1815680665" y1="289.93441892475" y2="301.72429018676" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="340.1815680665" x2="340.20298229515" y1="301.72429018676" y2="312.53446048796" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="340.20298229515" x2="340.2243965238" y1="312.53446048796" y2="323.34463078916" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="340.1815680665" x2="340.20298229515" y1="301.72429018676" y2="312.53446048796" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="340.20298229515" x2="340.2243965238" y1="312.53446048796" y2="323.34463078916" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="340.1815680665" x2="356.87797446831" y1="301.72429018676" y2="289.86883784951" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="356.87797446831" x2="373.57438087013" y1="289.86883784951" y2="278.01338551225" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="373.57438087013" x2="373.55296664148" y1="278.01338551225" y2="267.20187682176" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="373.55296664148" x2="373.53155241283" y1="267.20187682176" y2="256.39036813127" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="373.57438087013" x2="373.55296664148" y1="278.01338551225" y2="267.20187682176" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="373.55296664148" x2="373.53155241283" y1="267.20187682176" y2="256.39036813127" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="373.57438087013" x2="390.31763089712" y1="278.01338551225" y2="289.80191838497" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="390.31763089712" x2="407.06088092411" y1="289.80191838497" y2="301.59045125769" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="407.06088092411" x2="407.08229515276" y1="301.59045125769" y2="312.40062155889" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="407.08229515276" x2="407.10370938141" y1="312.40062155889" y2="323.21079186009" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="407.06088092411" x2="407.08229515276" y1="301.59045125769" y2="312.40062155889" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="407.08229515276" x2="407.10370938141" y1="312.40062155889" y2="323.21079186009" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="407.06088092411" x2="423.75728732592" y1="301.59045125769" y2="289.73499892044" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="423.75728732592" x2="440.45369372773" y1="289.73499892044" y2="277.87954658318" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="440.45369372773" x2="440.43227949908" y1="277.87954658318" y2="267.06937628198" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="440.43227949908" x2="440.41086527043" y1="267.06937628198" y2="256.25920598078" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="440.45369372773" x2="440.43227949908" y1="277.87954658318" y2="267.06937628198" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="440.43227949908" x2="440.41086527043" y1="267.06937628198" y2="256.25920598078" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="440.45369372773" x2="457.19694375472" y1="277.87954658318" y2="289.66941784519" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="457.19694375472" x2="473.94019378171" y1="289.66941784519" y2="301.4592891072" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="473.94019378171" x2="473.96160801036" y1="301.4592891072" y2="312.2694594084" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="473.96160801036" x2="473.98302223902" y1="312.2694594084" y2="323.0796297096" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="473.94019378171" x2="473.96160801036" y1="301.4592891072" y2="312.2694594084" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="473.96160801036" x2="473.98302223902" y1="312.2694594084" y2="323.0796297096" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="473.94019378171" x2="490.63660018353" y1="301.4592891072" y2="289.60383676994" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="490.63660018353" x2="507.33300658534" y1="289.60383676994" y2="277.74838443269" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="507.33300658534" x2="522.64150329267" y1="277.74838443269" y2="288.5277717802" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="522.64150329267" x2="537.95" y1="288.5277717802" y2="299.30715912771" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<line x1="507.33300658534" x2="507.31159235669" y1="277.74838443269" y2="266.93821413149" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #000000" />
<line x1="507.31159235669" x2="507.29017812804" y1="266.93821413149" y2="256.12804383029" style="stroke-opacity:1; stroke-width: 1.7244060559156; stroke: #00bc00" />
<ellipse cx="42.05" cy="280.69284087229" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="290.17707417982"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="72.709821871964" cy="323.87195616971" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="72.709821871964" y="333.35618947724"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="106.01697776098" cy="256.9203702904" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="106.01697776098" y="266.40460359794"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="106.01697776098" cy="256.9203702904" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="106.01697776098" y="266.40460359794"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="139.58913472957" cy="323.74079401922" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="139.58913472957" y="333.22502732675"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="139.58913472957" cy="323.74079401922" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="139.58913472957" y="333.22502732675"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="172.89629061859" cy="256.78920813991" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="172.89629061859" y="266.27344144745"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="172.89629061859" cy="256.78920813991" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="172.89629061859" y="266.27344144745"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="206.46844758717" cy="323.60963186873" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="206.46844758717" y="333.09386517626"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="206.46844758717" cy="323.60963186873" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="206.46844758717" y="333.09386517626"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="239.7756034762" cy="256.65536921084" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="239.7756034762" y="266.13960251837"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="239.7756034762" cy="256.65536921084" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="239.7756034762" y="266.13960251837"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="273.34776044478" cy="323.47579293965" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="273.34776044478" y="332.96002624719"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="273.34776044478" cy="323.47579293965" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="273.34776044478" y="332.96002624719"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="306.65223955522" cy="256.52420706035" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="306.65223955522" y="266.00844036788"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="306.65223955522" cy="256.52420706035" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="306.65223955522" y="266.00844036788"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="340.2243965238" cy="323.34463078916" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="340.2243965238" y="332.8288640967"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="340.2243965238" cy="323.34463078916" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="340.2243965238" y="332.8288640967"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="373.53155241283" cy="256.39036813127" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="373.53155241283" y="265.87460143881"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="373.53155241283" cy="256.39036813127" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="373.53155241283" y="265.87460143881"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="407.10370938141" cy="323.21079186009" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="407.10370938141" y="332.69502516762"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="407.10370938141" cy="323.21079186009" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="407.10370938141" y="332.69502516762"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="440.41086527043" cy="256.25920598078" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="440.41086527043" y="265.74343928832"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="440.41086527043" cy="256.25920598078" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="440.41086527043" y="265.74343928832"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="473.98302223902" cy="323.0796297096" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="473.98302223902" y="332.56386301713"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="473.98302223902" cy="323.0796297096" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="473.98302223902" y="332.56386301713"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="537.95" cy="299.30715912771" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="308.79139243525"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
<ellipse cx="507.29017812804" cy="256.12804383029" rx="11.208639363451" ry="11.208639363451" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="507.29017812804" y="265.61227713783"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.555075698945px">F</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 134👍, 0💬