Molecule FYI-1001460

A

Molecule Summary:

ID: FYI-1001460
SMILES: CN(C1=C2C=CC=C1)C=C2C3=CC4=CC=C(N(C)C)C=C4N=C3N

Received at FYIcenter.com on: 2022-07-30

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001460
FYIcenter.com

 24 27  0  0  0  0  0  0  0  0999 V2000
    9.3599    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7903    1.2790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4903    2.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5536    3.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9862    4.8633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3557    5.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2924    4.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8598    2.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4210    1.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    3.6624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    5.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    7.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    7.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    7.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    7.8624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    9.2624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    7.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    5.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    3.6624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    2.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    1.5624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  8  3  1  0  0  0  0
  9  2  1  0  0  0  0
 10  9  2  0  0  0  0
 10  4  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 17  1  0  0  0  0
 20 16  1  0  0  0  0
 21 20  2  0  0  0  0
 21 13  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  2  0  0  0  0
 23 11  1  0  0  0  0
 24 23  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="428.07155166307" x2="440.57839874606" y1="142.78984272608" y2="114.70652562786" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #0000ff" />
<line x1="440.57839874606" x2="453.08524582905" y1="114.70652562786" y2="86.623208529631" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="458.8116954766" x2="443.44162356983" y1="196.03177181113" y2="169.41080726861" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="443.44162356983" x2="428.07155166307" y1="169.41080726861" y2="142.78984272608" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #0000ff" />
<line x1="421" x2="441.5" y1="244" y2="221.5" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="441.5" x2="462" y1="221.5" y2="199" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="416" x2="436.5" y1="240" y2="217" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="436.5" x2="457" y1="217" y2="194" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="436.67440048174" x2="427.17569604336" y1="300.19255339875" y2="270.95648090751" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="427.17569604336" x2="417.67699160497" y1="270.95648090751" y2="241.72040841628" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="498" x2="468" y1="310" y2="304" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="468" x2="438" y1="304" y2="298" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="497" x2="467" y1="317" y2="310.5" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="467" x2="437" y1="310.5" y2="304" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="537.95" x2="517.38264806418" y1="267.28742517091" y2="290.13174347349" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="517.38264806418" x2="496.81529612837" y1="290.13174347349" y2="312.97606177606" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="516" x2="525.5" y1="210" y2="239.5" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="525.5" x2="535" y1="239.5" y2="269" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="523" x2="532.5" y1="208" y2="237.5" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="532.5" x2="542" y1="237.5" y2="267" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="518.95259112323" x2="488.88214329992" y1="208.81528018845" y2="202.42352599979" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="488.88214329992" x2="458.8116954766" y1="202.42352599979" y2="196.03177181113" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="367.93943891467" x2="398.00549528887" y1="155.5733511034" y2="149.18159691474" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="398.00549528887" x2="428.07155166307" y1="149.18159691474" y2="142.78984272608" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #0000ff" />
<line x1="365" x2="368.5" y1="218" y2="187" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="368.5" x2="372" y1="187" y2="156" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="359" x2="362" y1="217" y2="186.5" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="362" x2="365" y1="186.5" y2="156" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="361.51474885764" x2="389.59587023131" y1="216.71549714852" y2="229.2179527824" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="389.59587023131" x2="417.67699160497" y1="229.2179527824" y2="241.72040841628" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="308.26842832347" x2="334.89158859056" y1="247.45564096206" y2="232.08556905529" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="334.89158859056" x2="361.51474885764" y1="232.08556905529" y2="216.71549714852" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="312" x2="312" y1="309" y2="278.5" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="312" x2="312" y1="278.5" y2="248" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="306" x2="306" y1="309" y2="278.5" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="306" x2="306" y1="278.5" y2="248" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="255.02649923843" x2="281.64746378095" y1="339.67607240268" y2="324.30600049591" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="281.64746378095" x2="308.26842832347" y1="324.30600049591" y2="308.93592858914" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="259" x2="259" y1="402" y2="371" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="259" x2="259" y1="371" y2="340" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="252" x2="252" y1="402" y2="371" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="252" x2="252" y1="371" y2="340" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="201.78017870426" x2="228.40333897134" y1="431.89650384329" y2="416.52643193652" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="228.40333897134" x2="255.02649923843" y1="416.52643193652" y2="401.15636002975" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="147" x2="174" y1="404" y2="419.5" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="174" x2="201" y1="419.5" y2="435" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="151" x2="177.5" y1="399" y2="414.5" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="177.5" x2="204" y1="414.5" y2="430" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="95.291929085048" x2="121.91508935213" y1="431.89650384329" y2="416.52643193652" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #0000ff" />
<line x1="121.91508935213" x2="148.53824961921" y1="416.52643193652" y2="401.15636002975" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="95.291929085048" x2="95.291929085048" y1="493.37679147037" y2="462.63664765683" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="95.291929085048" x2="95.291929085048" y1="462.63664765683" y2="431.89650384329" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #0000ff" />
<line x1="42.05" x2="68.670964542524" y1="401.15636002975" y2="416.52643193652" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="68.670964542524" x2="95.291929085048" y1="416.52643193652" y2="431.89650384329" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #0000ff" />
<line x1="148.53824961921" x2="148.53824961921" y1="339.67607240268" y2="370.41621621622" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="148.53824961921" x2="148.53824961921" y1="370.41621621622" y2="401.15636002975" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="201" x2="174" y1="307" y2="322" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="174" x2="147" y1="322" y2="337" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="204" x2="177.5" y1="312" y2="327.5" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="177.5" x2="151" y1="327.5" y2="343" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="201.78017870426" x2="228.40333897134" y1="308.93592858914" y2="324.30600049591" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="228.40333897134" x2="255.02649923843" y1="324.30600049591" y2="339.67607240268" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="201.78017870426" x2="201.78017870426" y1="247.45564096206" y2="278.1957847756" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #0000ff" />
<line x1="201.78017870426" x2="201.78017870426" y1="278.1957847756" y2="308.93592858914" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="254" x2="227.5" y1="214" y2="229.5" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="227.5" x2="201" y1="229.5" y2="245" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #0000ff" />
<line x1="257" x2="230.5" y1="220" y2="235.5" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="230.5" x2="204" y1="235.5" y2="251" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #0000ff" />
<line x1="255.02649923843" x2="281.64746378095" y1="216.71549714852" y2="232.08556905529" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="281.64746378095" x2="308.26842832347" y1="232.08556905529" y2="247.45564096206" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<line x1="255.02649923843" x2="255.02649923843" y1="155.23520952145" y2="185.97535333499" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #0000ff" />
<line x1="255.02649923843" x2="255.02649923843" y1="185.97535333499" y2="216.71549714852" style="stroke-opacity:1; stroke-width: 2.5886479208782; stroke: #000000" />
<ellipse cx="428.07155166307" cy="142.78984272608" rx="16.826211485708" ry="16.826211485708" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="428.07155166307" y="157.02740629091"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.358099010977px">N</text>
<ellipse cx="95.291929085048" cy="431.89650384329" rx="16.826211485708" ry="16.826211485708" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="95.291929085048" y="446.13406740812"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.358099010977px">N</text>
<ellipse cx="201.78017870426" cy="247.45564096206" rx="16.826211485708" ry="16.826211485708" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="201.78017870426" y="261.69320452689"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.358099010977px">N</text>
<ellipse cx="255.02649923843" cy="155.23520952145" rx="16.826211485708" ry="16.826211485708" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="255.02649923843" y="169.47277308628"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.358099010977px">N</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 133👍, 0💬