Molecule FYI-1001461

A

Molecule Summary:

ID: FYI-1001461
SMILES: CN1CCN(CC1)C1=CC(Cl)=C(C=C1[N+]([O-])=O)C(=O)NC1=CC(=CC=C1C)C1=NC2=CC=CC=C2S1

Received at FYIcenter.com on: 2022-07-30

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001461
FYIcenter.com

 36 40  0  0  0  0  0  0  0  0999 V2000
   18.8650    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6526    6.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4402    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2278    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2278    4.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4402    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6526    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0153    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8029    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5905    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3781    4.9000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.5905    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8029    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0153    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2278    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2278    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4402    2.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3781    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3781    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1655    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9531    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7407    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5282    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5282    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7407    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9531    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1655    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3158    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1695    4.1923    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8000    4.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1000    5.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7000    5.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7000    3.2710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1000    3.2710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0369    2.2306    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  7  2  1  0  0  0  0
  8  5  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 10  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 14  8  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 15  2  0  0  0  0
 18 12  1  0  0  0  0
 19 18  2  0  0  0  0
 20 18  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  2  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 26 21  1  0  0  0  0
 27 26  1  0  0  0  0
 28 23  1  0  0  0  0
 29 28  2  0  0  0  0
 30 29  1  0  0  0  0
 31 30  2  0  0  0  0
 32 31  1  0  0  0  0
 33 32  2  0  0  0  0
 34 33  1  0  0  0  0
 35 34  2  0  0  0  0
 35 30  1  0  0  0  0
 36 35  1  0  0  0  0
 36 28  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="506.07991465677" x2="522.01495732839" y1="363.60296846011" y2="372.80333951763" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="522.01495732839" x2="537.95" y1="372.80333951763" y2="382.00371057514" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="474.20982931354" x2="490.14487198516" y1="382.00371057514" y2="372.80333951763" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="490.14487198516" x2="506.07991465677" y1="372.80333951763" y2="363.60296846011" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="442.33974397032" x2="458.27478664193" y1="363.60296846011" y2="372.80333951763" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="458.27478664193" x2="474.20982931354" y1="372.80333951763" y2="382.00371057514" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="442.33974397032" x2="442.33974397032" y1="326.80148423006" y2="345.20222634508" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="442.33974397032" x2="442.33974397032" y1="345.20222634508" y2="363.60296846011" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="474.20982931354" x2="458.27478664193" y1="308.40074211503" y2="317.60111317254" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="458.27478664193" x2="442.33974397032" y1="317.60111317254" y2="326.80148423006" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="506.07991465677" x2="490.14487198516" y1="326.80148423006" y2="317.60111317254" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="490.14487198516" x2="474.20982931354" y1="317.60111317254" y2="308.40074211503" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="506.07991465677" x2="506.07991465677" y1="326.80148423006" y2="345.20222634508" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="506.07991465677" x2="506.07991465677" y1="345.20222634508" y2="363.60296846011" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="410.46702994964" x2="426.40338695998" y1="308.40074211503" y2="317.60111317254" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="426.40338695998" x2="442.33974397032" y1="317.60111317254" y2="326.80148423006" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="380" x2="396" y1="329" y2="320" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="396" x2="412" y1="320" y2="311" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="378" x2="394" y1="326" y2="316.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="394" x2="410" y1="316.5" y2="307" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="346.72685926319" x2="362.6619019348" y1="308.40074211503" y2="317.60111317254" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="362.6619019348" x2="378.59694460641" y1="317.60111317254" y2="326.80148423006" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="314.85677391996" x2="330.79181659157" y1="326.80148423006" y2="317.60111317254" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #00bc00" />
<line x1="330.79181659157" x2="346.72685926319" y1="317.60111317254" y2="308.40074211503" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="345" x2="345" y1="272" y2="290.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="345" x2="345" y1="290.5" y2="309" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="349" x2="349" y1="272" y2="290.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="349" x2="349" y1="290.5" y2="309" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="378.59694460641" x2="362.6619019348" y1="253.19851576994" y2="262.39888682746" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="362.6619019348" x2="346.72685926319" y1="262.39888682746" y2="271.59925788497" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="412" x2="396" y1="270" y2="261" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="396" x2="380" y1="261" y2="252" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="410" x2="394" y1="274" y2="264.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="394" x2="378" y1="264.5" y2="255" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="410.46702994964" x2="410.46702994964" y1="271.59925788497" y2="290" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="410.46702994964" x2="410.46702994964" y1="290" y2="308.40074211503" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="442.33974397032" x2="426.40338695998" y1="253.19851576994" y2="262.39888682746" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="426.40338695998" x2="410.46702994964" y1="262.39888682746" y2="271.59925788497" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="441" x2="441" y1="217" y2="235.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #ff0000" />
<line x1="441" x2="441" y1="235.5" y2="254" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="445" x2="445" y1="217" y2="235.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #ff0000" />
<line x1="445" x2="445" y1="235.5" y2="254" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="476" x2="460" y1="270" y2="261" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #ff0000" />
<line x1="460" x2="444" y1="261" y2="252" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="474" x2="458" y1="274" y2="264.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #ff0000" />
<line x1="458" x2="442" y1="264.5" y2="255" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="314.85677391996" x2="330.79181659157" y1="253.19851576994" y2="262.39888682746" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="330.79181659157" x2="346.72685926319" y1="262.39888682746" y2="271.59925788497" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="313" x2="313" y1="217" y2="235.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #ff0000" />
<line x1="313" x2="313" y1="235.5" y2="254" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="317" x2="317" y1="217" y2="235.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #ff0000" />
<line x1="317" x2="317" y1="235.5" y2="254" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="282.98143122184" x2="298.9191025709" y1="271.59925788497" y2="262.39888682746" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="298.9191025709" x2="314.85677391996" y1="262.39888682746" y2="253.19851576994" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="251.11134587861" x2="267.04638855023" y1="253.19851576994" y2="262.39888682746" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="267.04638855023" x2="282.98143122184" y1="262.39888682746" y2="271.59925788497" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="221" x2="237" y1="274" y2="264.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="237" x2="253" y1="264.5" y2="255" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="219" x2="235" y1="270" y2="261" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="235" x2="251" y1="261" y2="252" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="187.36854651471" x2="203.30490352505" y1="253.19851576994" y2="262.39888682746" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="203.30490352505" x2="219.24126053538" y1="262.39888682746" y2="271.59925788497" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="186" x2="186" y1="217" y2="235.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="186" x2="186" y1="235.5" y2="254" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="190" x2="190" y1="217" y2="235.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="190" x2="190" y1="235.5" y2="254" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="219.24126053538" x2="203.30490352505" y1="197.99628942486" y2="207.19666048237" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="203.30490352505" x2="187.36854651471" y1="207.19666048237" y2="216.39703153989" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="253" x2="237" y1="215" y2="206" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="237" x2="221" y1="206" y2="197" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="251" x2="235" y1="219" y2="209.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="235" x2="219" y1="209.5" y2="200" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="251.11134587861" x2="251.11134587861" y1="216.39703153989" y2="234.79777365492" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="251.11134587861" x2="251.11134587861" y1="234.79777365492" y2="253.19851576994" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="282.98143122184" x2="267.04638855023" y1="197.99628942486" y2="207.19666048237" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="267.04638855023" x2="251.11134587861" y1="207.19666048237" y2="216.39703153989" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="155.49846117148" x2="171.4335038431" y1="271.59925788497" y2="262.39888682746" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="171.4335038431" x2="187.36854651471" y1="262.39888682746" y2="253.19851576994" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="154" x2="156" y1="309" y2="290.5" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="156" x2="158" y1="290.5" y2="272" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="150" x2="152" y1="308" y2="290" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="152" x2="154" y1="290" y2="272" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="115.65296846011" x2="133.65283726478" y1="315.85041399417" y2="312.02437397297" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="133.65283726478" x2="151.65270606944" y1="312.02437397297" y2="308.19833395176" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #0000ff" />
<line x1="99" x2="108.5" y1="349" y2="333" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="108.5" x2="118" y1="333" y2="317" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="96" x2="105" y1="347" y2="331" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="105" x2="114" y1="331" y2="315" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="60.450742115028" x2="78.851484230056" y1="347.72312801484" y2="347.72312801484" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="78.851484230056" x2="97.252226345083" y1="347.72312801484" y2="347.72312801484" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="41" x2="50" y1="317" y2="333" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="50" x2="59" y1="333" y2="349" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="44" x2="53.5" y1="315" y2="331" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="53.5" x2="63" y1="331" y2="347" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="60.450742115028" x2="51.250371057514" y1="283.98032865094" y2="299.91537132255" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="51.250371057514" x2="42.05" y1="299.91537132255" y2="315.85041399417" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="98" x2="79.5" y1="283" y2="283" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="79.5" x2="61" y1="283" y2="283" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="98" x2="79.5" y1="286" y2="286" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="79.5" x2="61" y1="286" y2="286" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="97.252226345083" x2="106.4525974026" y1="283.98032865094" y2="299.91537132255" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="106.4525974026" x2="115.65296846011" y1="299.91537132255" y2="315.85041399417" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="121.88030532733" x2="109.5662658362" y1="256.63156851312" y2="270.30594858203" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #c8aa1a" />
<line x1="109.5662658362" x2="97.252226345083" y1="270.30594858203" y2="283.98032865094" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<line x1="121.88030532733" x2="138.6893832494" y1="256.63156851312" y2="264.11541319905" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #c8aa1a" />
<line x1="138.6893832494" x2="155.49846117148" y1="264.11541319905" y2="271.59925788497" style="stroke-opacity:1; stroke-width: 1.5495276511078; stroke: #000000" />
<ellipse cx="506.07991465677" cy="363.60296846011" rx="10.071929732201" ry="10.071929732201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="506.07991465677" y="372.1253705412"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:19.369095638848px">N</text>
<ellipse cx="442.33974397032" cy="326.80148423006" rx="10.071929732201" ry="10.071929732201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="442.33974397032" y="335.32388631115"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:19.369095638848px">N</text>
<ellipse cx="314.85677391996" cy="326.80148423006" rx="10.071929732201" ry="10.071929732201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="314.85677391996" y="335.32388631115"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:19.369095638848px">Cl</text>
<ellipse cx="442.33974397032" cy="253.19851576994" rx="10.071929732201" ry="10.071929732201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="442.33974397032" y="261.72091785104"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:19.369095638848px">N</text>
<ellipse cx="442.33974397032" cy="216.39703153989" rx="10.071929732201" ry="10.071929732201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="442.33974397032" y="224.91943362098"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:19.369095638848px">O</text>
<ellipse cx="474.20982931354" cy="271.59925788497" rx="10.071929732201" ry="10.071929732201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="474.20982931354" y="280.12165996607"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:19.369095638848px">O</text>
<ellipse cx="314.85677391996" cy="216.39703153989" rx="10.071929732201" ry="10.071929732201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="314.85677391996" y="224.91943362098"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:19.369095638848px">O</text>
<ellipse cx="282.98143122184" cy="271.59925788497" rx="10.071929732201" ry="10.071929732201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="282.98143122184" y="280.12165996607"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:19.369095638848px">N</text>
<ellipse cx="151.65270606944" cy="308.19833395176" rx="10.071929732201" ry="10.071929732201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="151.65270606944" y="316.72073603286"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:19.369095638848px">N</text>
<ellipse cx="121.88030532733" cy="256.63156851312" rx="10.071929732201" ry="10.071929732201" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="121.88030532733" y="265.15397059421"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:19.369095638848px">S</text>
</g></svg>

✍: FYIcenter.com

2022-08-27, 134👍, 0💬